From 13af49488ed551a8a1a5c2fcb93df76ee1da11bd Mon Sep 17 00:00:00 2001 From: Liam Brydon <62733830+MyCreativityOutlet@users.noreply.github.com> Date: Tue, 4 Nov 2025 16:33:56 +1300 Subject: [PATCH] starting on app domain with new dataset #120 --- epdb/models.py | 63 ++++++++++++++++++++++----------------------- tests/test_model.py | 31 ++++++++++++++++++++++ utilities/ml.py | 62 +++++++++++++++++++++++++------------------- 3 files changed, 98 insertions(+), 58 deletions(-) diff --git a/epdb/models.py b/epdb/models.py index fec94028..c5d68b02 100644 --- a/epdb/models.py +++ b/epdb/models.py @@ -28,7 +28,8 @@ from sklearn.metrics import precision_score, recall_score, jaccard_score from sklearn.model_selection import ShuffleSplit from utilities.chem import FormatConverter, ProductSet, PredictionResult, IndigoUtils -from utilities.ml import RuleBasedDataset, ApplicabilityDomainPCA, EnsembleClassifierChain, RelativeReasoning, EnviFormerDataset +from utilities.ml import RuleBasedDataset, ApplicabilityDomainPCA, EnsembleClassifierChain, RelativeReasoning, \ + EnviFormerDataset, Dataset logger = logging.getLogger(__name__) @@ -2184,9 +2185,9 @@ class PackageBasedModel(EPModel): ds.save(f) return ds - def load_dataset(self) -> "RuleBasedDataset": + def load_dataset(self) -> "Dataset | RuleBasedDataset | EnviFormerDataset": ds_path = os.path.join(s.MODEL_DIR, f"{self.uuid}_ds.pkl") - return RuleBasedDataset.load(ds_path) + return Dataset.load(ds_path) def retrain(self): self.build_dataset() @@ -2196,7 +2197,7 @@ class PackageBasedModel(EPModel): self.build_model() @abstractmethod - def _fit_model(self, ds: RuleBasedDataset): + def _fit_model(self, ds: Dataset): pass @abstractmethod @@ -2337,22 +2338,22 @@ class PackageBasedModel(EPModel): ) ds = RuleBasedDataset.generate_dataset(eval_reactions, self.applicable_rules, educts_only=True) if isinstance(self, RuleBasedRelativeReasoning): - X = np.array(ds.X(exclude_id_col=False, na_replacement=None)) - y = np.array(ds.y(na_replacement=np.nan)) + X = ds.X(exclude_id_col=False, na_replacement=None).to_numpy() + y = ds.y(na_replacement=np.nan).to_numpy() else: - X = np.array(ds.X(na_replacement=np.nan)) - y = np.array(ds.y(na_replacement=np.nan)) + X = ds.X(na_replacement=np.nan).to_numpy() + y = ds.y(na_replacement=np.nan).to_numpy() single_gen_result = evaluate_sg(self.model, X, y, np.arange(len(X)), self.threshold) self.eval_results = self.compute_averages([single_gen_result]) else: ds = self.load_dataset() if isinstance(self, RuleBasedRelativeReasoning): - X = np.array(ds.X(exclude_id_col=False, na_replacement=None)) - y = np.array(ds.y(na_replacement=np.nan)) + X = ds.X(exclude_id_col=False, na_replacement=None).to_numpy() + y = ds.y(na_replacement=np.nan).to_numpy() else: - X = np.array(ds.X(na_replacement=np.nan)) - y = np.array(ds.y(na_replacement=np.nan)) + X = ds.X(na_replacement=np.nan).to_numpy() + y = ds.y(na_replacement=np.nan).to_numpy() n_splits = kwargs.get("n_splits", 20) @@ -2586,7 +2587,7 @@ class RuleBasedRelativeReasoning(PackageBasedModel): X, y = ds.X(exclude_id_col=False, na_replacement=None), ds.y(na_replacement=None) model = RelativeReasoning( start_index=ds.triggered()[0], - end_index=ds.triggered()[1], + end_index=ds.triggered()[-1], ) model.fit(X, y) return model @@ -2596,7 +2597,7 @@ class RuleBasedRelativeReasoning(PackageBasedModel): return { "clz": "RuleBaseRelativeReasoning", "start_index": ds.triggered()[0], - "end_index": ds.triggered()[1], + "end_index": ds.triggered()[-1], } def _save_model(self, model): @@ -2716,7 +2717,7 @@ class MLRelativeReasoning(PackageBasedModel): start = datetime.now() ds = self.load_dataset() classify_ds, classify_prods = ds.classification_dataset([smiles], self.applicable_rules) - pred = self.model.predict_proba(np.array(classify_ds.X())) + pred = self.model.predict_proba(classify_ds.X().to_numpy()) res = MLRelativeReasoning.combine_products_and_probs( self.applicable_rules, pred[0], classify_prods[0] @@ -2761,7 +2762,9 @@ class ApplicabilityDomain(EnviPathModel): @cached_property def training_set_probs(self): - return joblib.load(os.path.join(s.MODEL_DIR, f"{self.model.uuid}_train_probs.pkl")) + ds = self.model.load_dataset() + col_ids = ds.block_indices("prob") + return ds[ds.columns[col_ids[0]: col_ids[1]]] def build(self): ds = self.model.load_dataset() @@ -2769,9 +2772,9 @@ class ApplicabilityDomain(EnviPathModel): start = datetime.now() # Get Trainingset probs and dump them as they're required when using the app domain - probs = self.model.model.predict_proba(ds.X()) - f = os.path.join(s.MODEL_DIR, f"{self.model.uuid}_train_probs.pkl") - joblib.dump(probs, f) + probs = self.model.model.predict_proba(ds.X().to_numpy()) + ds.add_probs(probs) + ds.save(os.path.join(s.MODEL_DIR, f"{self.model.uuid}_ds.pkl")) ad = ApplicabilityDomainPCA(num_neighbours=self.num_neighbours) ad.build(ds) @@ -2816,25 +2819,21 @@ class ApplicabilityDomain(EnviPathModel): # it identifies all training structures that have the same trigger reaction activated (i.e., value 1). # This is used to find "qualified neighbours" — training examples that share the same triggered feature # with a given assessment structure under a particular rule. - qualified_neighbours_per_rule: Dict[int, Dict[int, List[int]]] = defaultdict( - lambda: defaultdict(list) - ) - for rule_idx, feature_index in enumerate(range(*assessment_ds.triggered())): - feature = ds.columns[feature_index] - if feature.startswith("trig_"): - # TODO unroll loop - for i, cx in enumerate(assessment_ds.X(exclude_id_col=False)): - if int(cx[feature_index]) == 1: - for j, tx in enumerate(ds.X(exclude_id_col=False)): - if int(tx[feature_index]) == 1: - qualified_neighbours_per_rule[i][rule_idx].append(j) + import polars as pl + qualified_neighbours_per_rule: Dict = {} + # Select only the triggered columns + for i, row in enumerate(assessment_ds[:, assessment_ds.triggered()].iter_rows(named=True)): + # Find the rules the structure triggers. For each rule, filter the training dataset to rows that also + # trigger that rule. Select the structure_id of the compounds in those filtered rows + train_trig = {col_name: ds.df.filter(pl.col(col_name).eq(1)).select("structure_id") for col_name, value in row.items() if value == 1} + qualified_neighbours_per_rule[i] = train_trig probs = self.training_set_probs # preds = self.model.model.predict_proba(assessment_ds.X()) preds = self.model.combine_products_and_probs( self.model.applicable_rules, - self.model.model.predict_proba(assessment_ds.X())[0], + self.model.model.predict_proba(assessment_ds.X().to_numpy())[0], assessment_prods[0], ) diff --git a/tests/test_model.py b/tests/test_model.py index f3a5f3c7..b6c2cce5 100644 --- a/tests/test_model.py +++ b/tests/test_model.py @@ -62,6 +62,37 @@ class ModelTest(TestCase): # from pprint import pprint # pprint(mod.eval_results) + def test_applicability(self): + with TemporaryDirectory() as tmpdir: + with self.settings(MODEL_DIR=tmpdir): + threshold = float(0.5) + + rule_package_objs = [self.BBD_SUBSET] + data_package_objs = [self.BBD_SUBSET] + eval_packages_objs = [self.BBD_SUBSET] + + mod = MLRelativeReasoning.create( + self.package, + rule_package_objs, + data_package_objs, + eval_packages_objs, + threshold=threshold, + name="ECC - BBD - 0.5", + description="Created MLRelativeReasoning in Testcase", + build_app_domain=True, # To test the applicability domain this must be True + app_domain_num_neighbours=5, + app_domain_local_compatibility_threshold=0.5, + app_domain_reliability_threshold=0.5, + ) + + mod.build_dataset() + mod.build_model() + mod.multigen_eval = True + mod.save() + mod.evaluate_model(n_splits=2) + + results = mod.predict("CCN(CC)C(=O)C1=CC(=CC=C1)C") + def test_rbrr(self): with TemporaryDirectory() as tmpdir: with self.settings(MODEL_DIR=tmpdir): diff --git a/utilities/ml.py b/utilities/ml.py index e680046b..28ef4968 100644 --- a/utilities/ml.py +++ b/utilities/ml.py @@ -51,14 +51,13 @@ class Dataset(ABC): """See add_rows""" self.add_rows([row]) - def _block_indices(self, prefix) -> Tuple[int, int]: + def block_indices(self, prefix) -> List[int]: """Find the start and end indexes in column labels that has the prefix""" indices: List[int] = [] for i, feature in enumerate(self.columns): if feature.startswith(prefix): indices.append(i) - - return min(indices, default=None), max(indices, default=None) + return indices @property def columns(self) -> List[str]: @@ -99,11 +98,11 @@ class Dataset(ABC): See https://docs.pola.rs/api/python/stable/reference/dataframe/api/polars.DataFrame.__getitem__.html#polars.DataFrame.__getitem__""" res = self.df[item] if isinstance(res, pl.DataFrame): # If we get a dataframe back from indexing make new self with res dataframe - return self.__class__(data=self.df[item]) + return self.__class__(data=res) else: # If we don't get a dataframe back (likely base type, int, str, float etc.) return the item return res - def save(self, path: "Path"): + def save(self, path: "Path | str"): import pickle with open(path, "wb") as fh: @@ -115,6 +114,9 @@ class Dataset(ABC): return pickle.load(open(path, "rb")) + def to_numpy(self): + return self.df.to_numpy() + def __repr__(self): return ( f"<{self.__class__.__name__} #rows={len(self.df)} #cols={len(self.columns)}>" @@ -123,28 +125,34 @@ class Dataset(ABC): def __len__(self): return len(self.df) + def iter_rows(self, named=False): + return self.df.iter_rows(named=named) + class RuleBasedDataset(Dataset): def __init__(self, num_labels=None, columns=None, data=None): super().__init__(columns, data) # Calculating num_labels allows functions like getitem to be in the base Dataset as it unifies the init. self.num_labels: int = num_labels if num_labels else sum([1 for c in self.columns if "obs_" in c]) - self.num_features: int = len(self.columns) - self.num_labels - self._struct_features: Tuple[int, int] = self._block_indices("feature_") - self._triggered: Tuple[int, int] = self._block_indices("trig_") - self._observed: Tuple[int, int] = self._block_indices("obs_") + # Pre-calculate the ids of columns for features/labels, useful later in X and y + self._struct_features: List[int] = self.block_indices("feature_") + self._triggered: List[int] = self.block_indices("trig_") + self._observed: List[int] = self.block_indices("obs_") + self.feature_cols: List[int] = self._struct_features + self._triggered + self.num_features: int = len(self.feature_cols) + self.has_probs = False def times_triggered(self, rule_uuid) -> int: """Count how many times a rule is triggered by the number of rows with one in the rules trig column""" return self.df.filter(pl.col(f"trig_{rule_uuid}") == 1).height - def struct_features(self) -> Tuple[int, int]: + def struct_features(self) -> List[int]: return self._struct_features - def triggered(self) -> Tuple[int, int]: + def triggered(self) -> List[int]: return self._triggered - def observed(self) -> Tuple[int, int]: + def observed(self) -> List[int]: return self._observed def structure_id(self, index: int): @@ -153,21 +161,24 @@ class RuleBasedDataset(Dataset): def X(self, exclude_id_col=True, na_replacement=0): """Get all the feature and trig columns""" - res = self[:, 1 if exclude_id_col else 0: len(self.columns) - self.num_labels] + _col_ids = self.feature_cols + if not exclude_id_col: + _col_ids = [0] + _col_ids + res = self[:, _col_ids] if na_replacement is not None: res.df = res.df.fill_null(na_replacement) return res def trig(self, na_replacement=0): """Get all the trig columns""" - res = self[:, self._triggered[0]: self._triggered[1]] + res = self[:, self._triggered] if na_replacement is not None: res.df = res.df.fill_null(na_replacement) return res def y(self, na_replacement=0): """Get all the obs columns""" - res = self[:, len(self.columns) - self.num_labels:] + res = self[:, self._observed] if na_replacement is not None: res.df = res.df.fill_null(na_replacement) return res @@ -264,14 +275,6 @@ class RuleBasedDataset(Dataset): ) -> Tuple[RuleBasedDataset, List[List[PredictionResult]]]: classify_data = [] classify_products = [] - if isinstance(structures[0], str): - struct_smiles = structures[0] - else: - struct_smiles = structures[0].smiles - ds_columns = (["structure_id"] + - [f"feature_{i}" for i, _ in enumerate(FormatConverter.maccs(struct_smiles))] + - [f"trig_{r.uuid}" for r in applicable_rules] + - [f"obs_{r.uuid}" for r in applicable_rules]) for struct in structures: if isinstance(struct, str): struct_id = None @@ -293,12 +296,19 @@ class RuleBasedDataset(Dataset): else: trig.append(0) prods.append([]) - - classify_data.append([struct_id] + features + trig + ([-1] * len(trig))) + new_row = [struct_id] + features + trig + ([-1] * len(trig)) + if self.has_probs: + new_row += [-1] * len(trig) + classify_data.append(new_row) classify_products.append(prods) - ds = RuleBasedDataset(len(applicable_rules), ds_columns, data=classify_data) + ds = RuleBasedDataset(len(applicable_rules), self.columns, data=classify_data) return ds, classify_products + def add_probs(self, probs): + col_names = [f"prob_{self.columns[r_id].split('_')[-1]}" for r_id in self._observed] + self.df = self.df.with_columns(*[pl.Series(name, probs[:, j]) for j, name in enumerate(col_names)]) + self.has_probs = True + def to_arff(self, path: "Path"): arff = f"@relation 'enviPy-dataset: -C {self.num_labels}'\n" arff += "\n"