[Feature] Modern UI roll out (#236)

This PR moves all the collection pages into the new UI in a rough push.
I did not put the same amount of care into these as into search, index, and predict.

## Major changes

- All modals are now migrated to a state based alpine.js implementation.
- jQuery is no longer present in the base layout; ajax is replace by native fetch api
- most of the pps.js is now obsolte (as I understand it; the code is not referenced any more @jebus  please double check)
- in-memory pagination for large result lists (set to 50; we can make that configurable later; performance degrades at around 1k) stukk a bit rough tracked in #235

## Minor things

- Sarch and index also use alpine now
- The loading spinner is now CSS animated (not sure if it currently gets correctly called)

## Not done

- Ihave not even cheked the admin pages. Not sure If these need migrations
- The temporary migration pages still use the old template. Not sure what is supposed to happen with those? @jebus

## What I did to test

- opend all pages in browse, and user ; plus all pages reachable from there.
- Interacted and tested the functionality of each modal superfically with exception of the API key modal (no functional test).

---
This PR is massive sorry for that; just did not want to push half-brokenn state.
@jebus @liambrydon I would be glad if you could click around and try to break it :)

Finally closes #133

Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#236
Co-authored-by: Tobias O <tobias.olenyi@envipath.com>
Co-committed-by: Tobias O <tobias.olenyi@envipath.com>

.gitea/workflows/ci.yaml

@@ -103,6 +103,16 @@ jobs:
           source .venv/bin/activate
           playwright install --with-deps
 
+      - name: Run PNPM Commands
+        run: |
+          uv run python scripts/pnpm_wrapper.py install
+          cat << 'EOF' > pnpm-workspace.yaml
+          onlyBuiltDependencies:
+            - '@parcel/watcher'
+            - '@tailwindcss/oxide'
+          EOF
+          uv run python scripts/pnpm_wrapper.py run build
+
       - name: Wait for services
         run: |
           until pg_isready -h postgres -U postgres; do sleep 2; done

envipath/urls.py

@@ -34,3 +34,9 @@ if "migration" in s.INSTALLED_APPS:
 
 if s.MS_ENTRA_ENABLED:
     urlpatterns.append(path("", include("epauth.urls")))
+
+# Custom error handlers
+handler400 = "epdb.views.handler400"
+handler403 = "epdb.views.handler403"
+handler404 = "epdb.views.handler404"
+handler500 = "epdb.views.handler500"

epdb/views.py

@@ -62,6 +62,26 @@ def log_post_params(request):
             logger.debug(f"{k}\t{v}")
 
 
+def get_error_handler_context(request, for_user=None) -> Dict[str, Any]:
+    current_user = _anonymous_or_real(request)
+
+    if for_user:
+        current_user = for_user
+
+    ctx = {
+        "title": "enviPath",
+        "meta": {
+            "site_id": s.MATOMO_SITE_ID,
+            "version": "0.0.1",
+            "server_url": s.SERVER_URL,
+            "user": current_user,
+            "enabled_features": s.FLAGS,
+            "debug": s.DEBUG,
+        },
+    }
+    return ctx
+
+
 def error(request, message: str, detail: str, code: int = 400):
     context = get_base_context(request)
     error_context = {
@@ -76,6 +96,48 @@ def error(request, message: str, detail: str, code: int = 400):
     return render(request, "errors/error.html", context, status=code)
 
 
+def handler400(request, exception):
+    """Custom 400 Bad Request error handler"""
+    context = get_error_handler_context(request)
+    context["public_mode"] = True
+    return render(request, "errors/400_bad_request.html", context, status=400)
+
+
+def handler403(request, exception):
+    """Custom 403 Forbidden error handler"""
+    context = get_error_handler_context(request)
+    context["public_mode"] = True
+    return render(request, "errors/403_access_denied.html", context, status=403)
+
+
+def handler404(request, exception):
+    """Custom 404 Not Found error handler"""
+    context = get_error_handler_context(request)
+    context["public_mode"] = True
+    return render(request, "errors/404_not_found.html", context, status=404)
+
+
+def handler500(request):
+    """Custom 500 Internal Server Error handler"""
+    context = get_error_handler_context(request)
+
+    error_context = {}
+    error_context["error_message"] = "Internal Server Error"
+    error_context["error_detail"] = "An unexpected error occurred. Please try again later."
+
+    if request.headers.get("Accept") == "application/json":
+        return JsonResponse(error_context, status=500)
+
+    context["public_mode"] = True
+    context["error_code"] = 500
+    context["error_description"] = (
+        "We encountered an unexpected error while processing your request. Our team has been notified and is working to resolve the issue."
+    )
+    context.update(**error_context)
+
+    return render(request, "errors/error.html", context, status=500)
+
+
 def login(request):
     context = get_base_context(request)
 
@@ -192,8 +254,8 @@ def register(request):
 
 
 def editable(request, user):
-    if user.is_superuser:
+    # if user.is_superuser:
-        return True
+    #     return True
 
     url = request.build_absolute_uri(request.path)
     if PackageManager.is_package_url(url):

pyproject.toml

@@ -34,7 +34,7 @@ dependencies = [
 [tool.uv.sources]
 enviformer = { git = "ssh://git@git.envipath.com/enviPath/enviformer.git", rev = "v0.1.4" }
 envipy-plugins = { git = "ssh://git@git.envipath.com/enviPath/enviPy-plugins.git", rev = "v0.1.0" }
-envipy-additional-information = { git = "ssh://git@git.envipath.com/enviPath/enviPy-additional-information.git", rev = "v0.1.7"}
+envipy-additional-information = { git = "ssh://git@git.envipath.com/enviPath/enviPy-additional-information.git", rev = "v0.1.7" }
 envipy-ambit = { git = "ssh://git@git.envipath.com/enviPath/enviPy-ambit.git" }
 
 [project.optional-dependencies]
@@ -46,7 +46,7 @@ dev = [
     "pre-commit>=4.3.0",
     "ruff>=0.13.3",
     "pytest-playwright>=0.7.1",
-    "pytest-django>=4.11.1"
+    "pytest-django>=4.11.1",
 ]
 
 [tool.ruff]
@@ -68,47 +68,31 @@ docstring-code-format = true
 
 [tool.poe.tasks]
 # Main tasks
-setup = { sequence = ["db-up", "migrate", "bootstrap"], help = "Complete setup: start database, run migrations, and bootstrap data" }
+setup = { sequence = [
-dev = { shell = """
+    "db-up",
-# Start pnpm CSS watcher in background
+    "migrate",
-pnpm run dev &
+    "bootstrap",
-PNPM_PID=$!
+], help = "Complete setup: start database, run migrations, and bootstrap data" }
-echo "Started CSS watcher (PID: $PNPM_PID)"
+dev = { cmd = "uv run python scripts/dev_server.py", help = "Start the development server with CSS watcher", deps = [
-
+    "db-up",
-# Cleanup function
+    "js-deps",
-cleanup() {
+] }
-    echo "\nShutting down..."
+build = { sequence = [
-    if kill -0 $PNPM_PID 2>/dev/null; then
+    "build-frontend",
-        kill $PNPM_PID
+    "collectstatic",
-        echo "✓ CSS watcher stopped"
+], help = "Build frontend assets and collect static files" }
-    fi
-    if [ ! -z "${DJ_PID:-}" ] && kill -0 $DJ_PID 2>/dev/null; then
-        kill $DJ_PID
-        echo "✓ Django server stopped"
-    fi
-}
-
-# Set trap for cleanup
-trap cleanup EXIT INT TERM
-
-# Start Django dev server in background
-uv run python manage.py runserver &
-DJ_PID=$!
-
-# Wait for Django to finish
-wait $DJ_PID
-""", help = "Start the development server with CSS watcher", deps = ["db-up", "js-deps"] }
-build = { sequence = ["build-frontend", "collectstatic", "frontend-test-setup"], help = "Build frontend assets and collect static files" }
 
 # Database tasks
 db-up = { cmd = "docker compose -f docker-compose.dev.yml up -d", help = "Start PostgreSQL database using Docker Compose" }
 db-down = { cmd = "docker compose -f docker-compose.dev.yml down", help = "Stop PostgreSQL database" }
 
 # Frontend tasks
-js-deps = { cmd = "pnpm install", help = "Install frontend dependencies" }
+js-deps = { cmd = "uv run python scripts/pnpm_wrapper.py install", help = "Install frontend dependencies" }
 
 # Full cleanup tasks
-clean = { sequence = ["clean-db"], help = "Remove model files and database volumes (WARNING: destroys all data!)" }
+clean = { sequence = [
+    "clean-db",
+], help = "Remove model files and database volumes (WARNING: destroys all data!)" }
 clean-db = { cmd = "docker compose -f docker-compose.dev.yml down -v", help = "Removes the database container and volume." }
 
 # Django tasks
@@ -123,10 +107,17 @@ echo "Default admin credentials:"
 echo "  Username: admin"
 echo "  Email: admin@envipath.com"
 echo "  Password: SuperSafe"
-""", help = "Bootstrap initial data (anonymous user, packages, models)"  }
+""", help = "Bootstrap initial data (anonymous user, packages, models)" }
 shell = { cmd = "uv run python manage.py shell", help = "Open Django shell" }
 
-# Build tasks
+
-build-frontend = { cmd = "pnpm run build", help = "Build frontend assets using pnpm", deps = ["js-deps"] }
+build-frontend = { cmd = "uv run python scripts/pnpm_wrapper.py run build", help = "Build frontend assets using pnpm", deps = [
-collectstatic = { cmd = "uv run python manage.py collectstatic --noinput", help = "Collect static files for production", deps = ["build-frontend"] }
+    "js-deps",
-frontend-test-setup = {cmd = "playwright install", help = "Install the browsers required for frontend testing"}
+] } # Build tasks
+
+
+collectstatic = { cmd = "uv run python manage.py collectstatic --noinput", help = "Collect static files for production", deps = [
+    "build-frontend",
+] }
+
+frontend-test-setup = { cmd = "playwright install", help = "Install the browsers required for frontend testing" }

scripts/dev_server.py

@@ -0,0 +1,201 @@
+#!/usr/bin/env python3
+"""
+Cross-platform development server script.
+Starts pnpm CSS watcher and Django dev server, handling cleanup on exit.
+Works on both Windows and Unix systems.
+"""
+
+import atexit
+import shutil
+import signal
+import subprocess
+import sys
+import time
+
+
+def find_pnpm():
+    """
+    Find pnpm executable on the system.
+    Returns the path to pnpm or None if not found.
+    """
+    # Try to find pnpm using shutil.which
+    # On Windows, this will find pnpm.cmd if it's in PATH
+    pnpm_path = shutil.which("pnpm")
+
+    if pnpm_path:
+        return pnpm_path
+
+    # On Windows, also try pnpm.cmd explicitly
+    if sys.platform == "win32":
+        pnpm_cmd = shutil.which("pnpm.cmd")
+        if pnpm_cmd:
+            return pnpm_cmd
+
+    return None
+
+
+class DevServerManager:
+    """Manages background processes for development server."""
+
+    def __init__(self):
+        self.processes = []
+        self._cleanup_registered = False
+
+    def start_process(self, command, description, shell=False):
+        """Start a background process and return the process object."""
+        print(f"Starting {description}...")
+        try:
+            if shell:
+                # Use shell=True for commands that need shell interpretation
+                process = subprocess.Popen(
+                    command,
+                    shell=True,
+                    stdout=subprocess.PIPE,
+                    stderr=subprocess.STDOUT,
+                    text=True,
+                    bufsize=1,
+                )
+            else:
+                # Split command into list for subprocess
+                process = subprocess.Popen(
+                    command,
+                    stdout=subprocess.PIPE,
+                    stderr=subprocess.STDOUT,
+                    text=True,
+                    bufsize=1,
+                )
+            self.processes.append((process, description))
+            print(f"✓ Started {description} (PID: {process.pid})")
+            return process
+        except Exception as e:
+            print(f"✗ Failed to start {description}: {e}", file=sys.stderr)
+            self.cleanup()
+            sys.exit(1)
+
+    def cleanup(self):
+        """Terminate all running processes."""
+        if not self.processes:
+            return
+
+        print("\nShutting down...")
+        for process, description in self.processes:
+            if process.poll() is None:  # Process is still running
+                try:
+                    # Try graceful termination first
+                    if sys.platform == "win32":
+                        process.terminate()
+                    else:
+                        process.send_signal(signal.SIGTERM)
+
+                    # Wait up to 5 seconds for graceful shutdown
+                    try:
+                        process.wait(timeout=5)
+                    except subprocess.TimeoutExpired:
+                        # Force kill if graceful shutdown failed
+                        if sys.platform == "win32":
+                            process.kill()
+                        else:
+                            process.send_signal(signal.SIGKILL)
+                        process.wait()
+
+                    print(f"✓ {description} stopped")
+                except Exception as e:
+                    print(f"✗ Error stopping {description}: {e}", file=sys.stderr)
+
+        self.processes.clear()
+
+    def register_cleanup(self):
+        """Register cleanup handlers for various exit scenarios."""
+        if self._cleanup_registered:
+            return
+
+        self._cleanup_registered = True
+
+        # Register atexit handler (works on all platforms)
+        atexit.register(self.cleanup)
+
+        # Register signal handlers (Unix only)
+        if sys.platform != "win32":
+            signal.signal(signal.SIGINT, self._signal_handler)
+            signal.signal(signal.SIGTERM, self._signal_handler)
+
+    def _signal_handler(self, signum, frame):
+        """Handle Unix signals."""
+        self.cleanup()
+        sys.exit(0)
+
+    def wait_for_process(self, process, description):
+        """Wait for a process to finish and handle its output."""
+        try:
+            # Stream output from the process
+            for line in iter(process.stdout.readline, ""):
+                if line:
+                    print(f"[{description}] {line.rstrip()}")
+
+            process.wait()
+            return process.returncode
+        except KeyboardInterrupt:
+            # Handle Ctrl+C
+            self.cleanup()
+            sys.exit(0)
+        except Exception as e:
+            print(f"Error waiting for {description}: {e}", file=sys.stderr)
+            self.cleanup()
+            sys.exit(1)
+
+
+def main():
+    """Main entry point."""
+    manager = DevServerManager()
+    manager.register_cleanup()
+
+    # Find pnpm executable
+    pnpm_path = find_pnpm()
+    if not pnpm_path:
+        print("Error: pnpm not found in PATH.", file=sys.stderr)
+        print("\nPlease install pnpm:", file=sys.stderr)
+        print("  Windows: https://pnpm.io/installation#on-windows", file=sys.stderr)
+        print("  Unix: https://pnpm.io/installation#on-posix-systems", file=sys.stderr)
+        sys.exit(1)
+
+    # Determine shell usage based on platform
+    use_shell = sys.platform == "win32"
+
+    # Start pnpm CSS watcher
+    # Use the found pnpm path to ensure it works on Windows
+    pnpm_command = f'"{pnpm_path}" run dev' if use_shell else [pnpm_path, "run", "dev"]
+    manager.start_process(
+        pnpm_command,
+        "CSS watcher",
+        shell=use_shell,
+    )
+
+    # Give pnpm a moment to start
+    time.sleep(1)
+
+    # Start Django dev server
+    django_process = manager.start_process(
+        ["uv", "run", "python", "manage.py", "runserver"],
+        "Django server",
+        shell=False,
+    )
+
+    print("\nDevelopment servers are running. Press Ctrl+C to stop.\n")
+
+    try:
+        # Wait for Django server (main process)
+        # If Django exits, we should clean up everything
+        return_code = manager.wait_for_process(django_process, "Django")
+
+        # If Django exited unexpectedly, clean up and exit
+        if return_code != 0:
+            manager.cleanup()
+            sys.exit(return_code)
+    except KeyboardInterrupt:
+        # Ctrl+C was pressed
+        manager.cleanup()
+        sys.exit(0)
+
+
+if __name__ == "__main__":
+    main()

scripts/pnpm_wrapper.py

@@ -0,0 +1,59 @@
+#!/usr/bin/env python3
+"""
+Cross-platform pnpm command wrapper.
+Finds pnpm correctly on Windows (handles pnpm.cmd) and Unix systems.
+"""
+
+import shutil
+import subprocess
+import sys
+
+
+def find_pnpm():
+    """
+    Find pnpm executable on the system.
+    Returns the path to pnpm or None if not found.
+    """
+    # Try to find pnpm using shutil.which
+    # On Windows, this will find pnpm.cmd if it's in PATH
+    pnpm_path = shutil.which("pnpm")
+
+    if pnpm_path:
+        return pnpm_path
+
+    # On Windows, also try pnpm.cmd explicitly
+    if sys.platform == "win32":
+        pnpm_cmd = shutil.which("pnpm.cmd")
+        if pnpm_cmd:
+            return pnpm_cmd
+
+    return None
+
+
+def main():
+    """Main entry point - execute pnpm with provided arguments."""
+    pnpm_path = find_pnpm()
+
+    if not pnpm_path:
+        print("Error: pnpm not found in PATH.", file=sys.stderr)
+        print("\nPlease install pnpm:", file=sys.stderr)
+        print("  Windows: https://pnpm.io/installation#on-windows", file=sys.stderr)
+        print("  Unix: https://pnpm.io/installation#on-posix-systems", file=sys.stderr)
+        sys.exit(1)
+
+    # Get all arguments passed to this script
+    args = sys.argv[1:]
+
+    # Execute pnpm with the provided arguments
+    try:
+        sys.exit(subprocess.call([pnpm_path] + args))
+    except KeyboardInterrupt:
+        # Handle Ctrl+C gracefully
+        sys.exit(130)
+    except Exception as e:
+        print(f"Error executing pnpm: {e}", file=sys.stderr)
+        sys.exit(1)
+
+
+if __name__ == "__main__":
+    main()

static/css/input.css

@@ -34,3 +34,30 @@
 }
 
 @import "./daisyui-theme.css";
+
+/* Loading Spinner - Benzene Ring */
+.loading-spinner {
+  display: flex;
+  justify-content: center;
+  align-items: center;
+  padding: 2rem;
+}
+
+.loading-spinner svg {
+  width: 48px;
+  height: 48px;
+  animation: spin 2s linear infinite;
+}
+
+.loading-spinner .hexagon,
+.loading-spinner .double-bonds {
+  fill: none;
+  stroke: currentColor;
+  stroke-width: 2;
+}
+
+@keyframes spin {
+  100% {
+    transform: rotate(360deg);
+  }
+}

static/js/alpine/index.js

@@ -0,0 +1,265 @@
+/**
+ * Alpine.js Components for enviPath
+ *
+ * This module provides reusable Alpine.js data components for modals,
+ * form validation, and form submission.
+ */
+
+document.addEventListener('alpine:init', () => {
+  /**
+   * Modal Form Component
+   *
+   * Provides form validation using HTML5 Constraint Validation API,
+   * loading states for submission, and error message management.
+   *
+   * Basic Usage:
+   * <dialog x-data="modalForm()" @close="reset()">
+   *   <form id="my-form">
+   *     <input name="field" required>
+   *   </form>
+   *   <button @click="submit('my-form')" :disabled="isSubmitting">Submit</button>
+   * </dialog>
+   *
+   * With Custom State:
+   * <dialog x-data="modalForm({ state: { selectedItem: '', imageUrl: '' } })" @close="reset()">
+   *   <select x-model="selectedItem" @change="updateImagePreview(selectedItem + '?image=svg')">
+   *   <img :src="imageUrl" x-show="imageUrl">
+   * </dialog>
+   *
+   * With AJAX:
+   * <button @click="submitAsync('my-form', { onSuccess: (data) => console.log(data) })">
+   */
+  Alpine.data('modalForm', (options = {}) => ({
+    isSubmitting: false,
+    errors: {},
+    // Spread custom initial state from options
+    ...(options.state || {}),
+
+    /**
+     * Validate a single field using HTML5 Constraint Validation API
+     * @param {HTMLElement} field - The input/select/textarea element
+     */
+    validateField(field) {
+      const name = field.name || field.id;
+      if (!name) return;
+
+      if (!field.validity.valid) {
+        this.errors[name] = field.validationMessage;
+      } else {
+        delete this.errors[name];
+      }
+    },
+
+    /**
+     * Clear error for a field (call on input)
+     * @param {HTMLElement} field - The input element
+     */
+    clearError(field) {
+      const name = field.name || field.id;
+      if (name && this.errors[name]) {
+        delete this.errors[name];
+      }
+    },
+
+    /**
+     * Get error message for a field
+     * @param {string} name - Field name
+     * @returns {string|undefined} Error message or undefined
+     */
+    getError(name) {
+      return this.errors[name];
+    },
+
+    /**
+     * Check if form has any errors
+     * @returns {boolean} True if there are errors
+     */
+    hasErrors() {
+      return Object.keys(this.errors).length > 0;
+    },
+
+    /**
+     * Validate all fields in a form
+     * @param {string} formId - The form element ID
+     * @returns {boolean} True if form is valid
+     */
+    validateAll(formId) {
+      const form = document.getElementById(formId);
+      if (!form) return false;
+
+      this.errors = {};
+      const fields = form.querySelectorAll('input, select, textarea');
+
+      fields.forEach(field => {
+        if (field.name && !field.validity.valid) {
+          this.errors[field.name] = field.validationMessage;
+        }
+      });
+
+      return !this.hasErrors();
+    },
+
+    /**
+     * Validate that two password fields match
+     * @param {string} password1Id - ID of first password field
+     * @param {string} password2Id - ID of second password field
+     * @returns {boolean} True if passwords match
+     */
+    validatePasswordMatch(password1Id, password2Id) {
+      const pw1 = document.getElementById(password1Id);
+      const pw2 = document.getElementById(password2Id);
+
+      if (!pw1 || !pw2) return false;
+
+      if (pw1.value !== pw2.value) {
+        this.errors[pw2.name || password2Id] = 'Passwords do not match';
+        pw2.setCustomValidity('Passwords do not match');
+        return false;
+      }
+
+      delete this.errors[pw2.name || password2Id];
+      pw2.setCustomValidity('');
+      return true;
+    },
+
+    /**
+     * Submit a form with loading state
+     * @param {string} formId - The form element ID
+     */
+    submit(formId) {
+      const form = document.getElementById(formId);
+      if (!form) return;
+
+      // Validate before submit
+      if (!form.checkValidity()) {
+        form.reportValidity();
+        return;
+      }
+
+      // Set action to current URL if empty
+      if (!form.action || form.action === window.location.href + '#') {
+        form.action = window.location.href;
+      }
+
+      // Set loading state and submit
+      this.isSubmitting = true;
+      form.submit();
+    },
+
+    /**
+     * Submit form via AJAX (fetch)
+     * @param {string} formId - The form element ID
+     * @param {Object} options - Options { onSuccess, onError, closeOnSuccess }
+     */
+    async submitAsync(formId, options = {}) {
+      const form = document.getElementById(formId);
+      if (!form) return;
+
+      // Validate before submit
+      if (!form.checkValidity()) {
+        form.reportValidity();
+        return;
+      }
+
+      this.isSubmitting = true;
+
+      try {
+        const formData = new FormData(form);
+        const response = await fetch(form.action || window.location.href, {
+          method: form.method || 'POST',
+          body: formData,
+          headers: {
+            'X-Requested-With': 'XMLHttpRequest',
+          },
+        });
+
+        const data = await response.json().catch(() => ({}));
+
+        if (response.ok) {
+          if (options.onSuccess) {
+            options.onSuccess(data);
+          }
+
+          if (data.redirect || data.success) {
+            window.location.href = data.redirect || data.success;
+          } else if (options.closeOnSuccess) {
+            this.$el.closest('dialog')?.close();
+          }
+        } else {
+          const errorMsg = data.error || data.message || `Error: ${response.status}`;
+          this.errors['_form'] = errorMsg;
+
+          if (options.onError) {
+            options.onError(errorMsg, data);
+          }
+        }
+      } catch (error) {
+        this.errors['_form'] = error.message;
+
+        if (options.onError) {
+          options.onError(error.message);
+        }
+      } finally {
+        this.isSubmitting = false;
+      }
+    },
+
+    /**
+     * Set form action URL dynamically
+     * @param {string} formId - The form element ID
+     * @param {string} url - The URL to set as action
+     */
+    setFormAction(formId, url) {
+      const form = document.getElementById(formId);
+      if (form) {
+        form.action = url;
+      }
+    },
+
+    /**
+     * Update image preview
+     * @param {string} url - Image URL (with query params)
+     * @param {string} targetId - Target element ID for the image
+     */
+    updateImagePreview(url) {
+      // Store URL for reactive binding with :src
+      this.imageUrl = url;
+    },
+
+    /**
+     * Reset form state (call on modal close)
+     * Resets to initial state from options
+     */
+    reset() {
+      this.isSubmitting = false;
+      this.errors = {};
+      this.imageUrl = '';
+
+      // Reset custom state to initial values
+      if (options.state) {
+        Object.keys(options.state).forEach(key => {
+          this[key] = options.state[key];
+        });
+      }
+
+      // Call custom reset handler if provided
+      if (options.onReset) {
+        options.onReset.call(this);
+      }
+    }
+  }));
+
+  /**
+   * Simple Modal Component (no form)
+   *
+   * For modals that don't need form validation.
+   *
+   * Usage:
+   * <dialog x-data="modal()">
+   *   <button @click="$el.closest('dialog').close()">Close</button>
+   * </dialog>
+   */
+  Alpine.data('modal', () => ({
+    // Placeholder for simple modals that may need state later
+  }));
+});

static/js/alpine/pagination.js

@@ -0,0 +1,133 @@
+/**
+ * Alpine.js Pagination Component
+ *
+ * Provides client-side pagination for large lists.
+ */
+
+document.addEventListener('alpine:init', () => {
+  Alpine.data('paginatedList', (initialItems = [], options = {}) => ({
+    allItems: initialItems,
+    filteredItems: [],
+    currentPage: 1,
+    perPage: options.perPage || 50,
+    searchQuery: '',
+    isReviewed: options.isReviewed || false,
+    instanceId: options.instanceId || Math.random().toString(36).substring(2, 9),
+
+    init() {
+      this.filteredItems = this.allItems;
+    },
+
+    get totalPages() {
+      return Math.ceil(this.filteredItems.length / this.perPage);
+    },
+
+    get paginatedItems() {
+      const start = (this.currentPage - 1) * this.perPage;
+      const end = start + this.perPage;
+      return this.filteredItems.slice(start, end);
+    },
+
+    get totalItems() {
+      return this.filteredItems.length;
+    },
+
+    get showingStart() {
+      if (this.totalItems === 0) return 0;
+      return (this.currentPage - 1) * this.perPage + 1;
+    },
+
+    get showingEnd() {
+      return Math.min(this.currentPage * this.perPage, this.totalItems);
+    },
+
+    search(query) {
+      this.searchQuery = query.toLowerCase();
+      if (this.searchQuery === '') {
+        this.filteredItems = this.allItems;
+      } else {
+        this.filteredItems = this.allItems.filter(item =>
+          item.name.toLowerCase().includes(this.searchQuery)
+        );
+      }
+      this.currentPage = 1;
+    },
+
+    nextPage() {
+      if (this.currentPage < this.totalPages) {
+        this.currentPage++;
+      }
+    },
+
+    prevPage() {
+      if (this.currentPage > 1) {
+        this.currentPage--;
+      }
+    },
+
+    goToPage(page) {
+      if (page >= 1 && page <= this.totalPages) {
+        this.currentPage = page;
+      }
+    },
+
+    get pageNumbers() {
+      const pages = [];
+      const total = this.totalPages;
+      const current = this.currentPage;
+
+      // Handle empty case
+      if (total === 0) {
+        return pages;
+      }
+
+      if (total <= 7) {
+        // Show all pages if 7 or fewer
+        for (let i = 1; i <= total; i++) {
+          pages.push({ page: i, isEllipsis: false, key: `${this.instanceId}-page-${i}` });
+        }
+      } else {
+        // More than 7 pages - show first, last, and sliding window around current
+        // Always show first page
+        pages.push({ page: 1, isEllipsis: false, key: `${this.instanceId}-page-1` });
+
+        // Determine the start and end of the middle range
+        let rangeStart, rangeEnd;
+
+        if (current <= 4) {
+          // Near the beginning: show pages 2-5
+          rangeStart = 2;
+          rangeEnd = 5;
+        } else if (current >= total - 3) {
+          // Near the end: show last 4 pages before the last page
+          rangeStart = total - 4;
+          rangeEnd = total - 1;
+        } else {
+          // In the middle: show current page and one on each side
+          rangeStart = current - 1;
+          rangeEnd = current + 1;
+        }
+
+        // Add ellipsis before range if there's a gap
+        if (rangeStart > 2) {
+          pages.push({ page: '...', isEllipsis: true, key: `${this.instanceId}-ellipsis-start` });
+        }
+
+        // Add pages in the range
+        for (let i = rangeStart; i <= rangeEnd; i++) {
+          pages.push({ page: i, isEllipsis: false, key: `${this.instanceId}-page-${i}` });
+        }
+
+        // Add ellipsis after range if there's a gap
+        if (rangeEnd < total - 1) {
+          pages.push({ page: '...', isEllipsis: true, key: `${this.instanceId}-ellipsis-end` });
+        }
+
+        // Always show last page
+        pages.push({ page: total, isEllipsis: false, key: `${this.instanceId}-page-${total}` });
+      }
+
+      return pages;
+    }
+  }));
+});

static/js/alpine/search.js

@@ -0,0 +1,145 @@
+/**
+ * Search Modal Alpine.js Component
+ *
+ * Provides package selection, search mode switching, and results display
+ * for the search modal.
+ */
+
+document.addEventListener('alpine:init', () => {
+  /**
+   * Search Modal Component
+   *
+   * Usage:
+   * <dialog x-data="searchModal()" @close="reset()">
+   *   ...
+   * </dialog>
+   */
+  Alpine.data('searchModal', () => ({
+    // Package selector state
+    selectedPackages: [],
+
+    // Search state
+    searchMode: 'text',
+    searchModeLabel: 'Text',
+    query: '',
+
+    // Results state
+    results: null,
+    isSearching: false,
+    error: null,
+
+    // Initialize on modal open
+    init() {
+      // Load reviewed packages by default
+      this.loadInitialSelection();
+
+      // Watch for modal open to focus searchbar
+      this.$watch('$el.open', (open) => {
+        if (open) {
+          setTimeout(() => {
+            this.$refs.searchbar.focus();
+          }, 320);
+        }
+      });
+    },
+
+    loadInitialSelection() {
+      // Select all reviewed packages by default
+      const menuItems = this.$refs.packageDropdown.querySelectorAll('li');
+
+      for (const item of menuItems) {
+        // Stop at 'Unreviewed Packages' section
+        if (item.classList.contains('menu-title') &&
+            item.textContent.trim() === 'Unreviewed Packages') {
+          break;
+        }
+
+        const packageOption = item.querySelector('.package-option');
+        if (packageOption) {
+          this.selectedPackages.push({
+            url: packageOption.dataset.packageUrl,
+            name: packageOption.dataset.packageName
+          });
+        }
+      }
+    },
+
+    togglePackage(url, name) {
+      const index = this.selectedPackages.findIndex(pkg => pkg.url === url);
+
+      if (index !== -1) {
+        this.selectedPackages.splice(index, 1);
+      } else {
+        this.selectedPackages.push({ url, name });
+      }
+    },
+
+    removePackage(url) {
+      const index = this.selectedPackages.findIndex(pkg => pkg.url === url);
+      if (index !== -1) {
+        this.selectedPackages.splice(index, 1);
+      }
+    },
+
+    isPackageSelected(url) {
+      return this.selectedPackages.some(pkg => pkg.url === url);
+    },
+
+    setSearchMode(mode, label) {
+      this.searchMode = mode;
+      this.searchModeLabel = label;
+      this.$refs.modeDropdown.hidePopover();
+    },
+
+    async performSearch(serverBase) {
+      if (!this.query.trim()) {
+        return;
+      }
+
+      if (this.selectedPackages.length < 1) {
+        this.results = { error: 'no_packages' };
+        return;
+      }
+
+      const params = new URLSearchParams();
+      this.selectedPackages.forEach(pkg => params.append('packages', pkg.url));
+      params.append('search', this.query.trim());
+      params.append('mode', this.searchModeLabel.toLowerCase());
+
+      this.isSearching = true;
+      this.results = null;
+      this.error = null;
+
+      try {
+        const response = await fetch(`${serverBase}/search?${params.toString()}`, {
+          method: 'GET',
+          headers: { 'Accept': 'application/json' }
+        });
+
+        if (!response.ok) {
+          throw new Error('Search request failed');
+        }
+
+        this.results = await response.json();
+      } catch (err) {
+        console.error('Search error:', err);
+        this.error = 'Search failed. Please try again.';
+      } finally {
+        this.isSearching = false;
+      }
+    },
+
+    hasResults() {
+      if (!this.results || this.results.error) return false;
+      const categories = ['Compounds', 'Compound Structures', 'Rules', 'Reactions', 'Pathways'];
+      return categories.some(cat => this.results[cat] && this.results[cat].length > 0);
+    },
+
+    reset() {
+      this.query = '';
+      this.results = null;
+      this.error = null;
+      this.isSearching = false;
+    }
+  }));
+});

static/js/pw.js

@@ -1,15 +1,22 @@
 console.log("loaded pw.js")
 
 function predictFromNode(url) {
-    $.post("", {node: url})
+    fetch("", {
-        .done(function (data) {
+        method: "POST",
-            console.log("Success:", data);
+        headers: {
-            window.location.href = data.success;
+            "Content-Type": "application/x-www-form-urlencoded",
-        })
+            "X-CSRFToken": document.querySelector('[name=csrfmiddlewaretoken]')?.value || ''
-        .fail(function (xhr, status, error) {
+        },
-            console.error("Error:", xhr.status, xhr.responseText);
+        body: new URLSearchParams({node: url})
-            // show user-friendly message or log error
+    })
-        });
+    .then(response => response.json())
+    .then(data => {
+        console.log("Success:", data);
+        window.location.href = data.success;
+    })
+    .catch(error => {
+        console.error("Error:", error);
+    });
 }
 
 // data = {{ pathway.d3_json | safe }};
@@ -103,6 +110,9 @@ function draw(pathway, elem) {
     }
 
     function dragstarted(event, d) {
+        // Prevent zoom pan when dragging nodes
+        event.sourceEvent.stopPropagation();
+
         if (!event.active) simulation.alphaTarget(0.3).restart();
         d.fx = d.x;
         d.fy = d.y;
@@ -117,6 +127,9 @@ function draw(pathway, elem) {
     }
 
     function dragged(event, d) {
+        // Prevent zoom pan when dragging nodes
+        event.sourceEvent.stopPropagation();
+
         d.fx = event.x;
         d.fy = event.y;
 
@@ -127,6 +140,9 @@ function draw(pathway, elem) {
     }
 
     function dragended(event, d) {
+        // Prevent zoom pan when dragging nodes
+        event.sourceEvent.stopPropagation();
+
         if (!event.active) simulation.alphaTarget(0);
 
         // Mark that dragging has ended
@@ -192,52 +208,153 @@ function draw(pathway, elem) {
         d3.select(t).select("circle").classed("highlighted", !d3.select(t).select("circle").classed("highlighted"));
     }
 
-    // Wait one second before showing popup
+    // Wait before showing popup (ms)
     var popupWaitBeforeShow = 1000;
-    // Keep Popup at least for one second
-    var popushowAtLeast = 1000;
 
-    function pop_show_e(element) {
+    // Custom popover element
-        var e = element;
+    let popoverTimeout = null;
-        setTimeout(function () {
-            if ($(e).is(':hover')) { // if element is still hovered
-                $(e).popover("show");
 
-                // workaround to set fixed positions
+    function createPopover() {
-                pop = $(e).attr("aria-describedby")
+        const popover = document.createElement('div');
-                h = $('#' + pop).height();
+        popover.id = 'custom-popover';
-                $('#' + pop).attr("style", `position: fixed; top: ${clientY - (h / 2.0)}px; left: ${clientX + 10}px; margin: 0px; max-width: 1000px; display: block;`)
+        popover.className = 'fixed z-50';
-                setTimeout(function () {
+        popover.style.cssText = `
-                    var close = setInterval(function () {
+            background: #ffffff;
-                        if (!$(".popover:hover").length // mouse outside popover
+            border: 1px solid #d1d5db;
-                            && !$(e).is(':hover')) { // mouse outside element
+            box-shadow: 0 10px 15px -3px rgb(0 0 0 / 0.1), 0 4px 6px -4px rgb(0 0 0 / 0.1);
-                            $(e).popover('hide');
+            max-width: 320px;
-                            clearInterval(close);
+            padding: 0.75rem;
-                        }
+            border-radius: 0.5rem;
-                    }, 100);
+            opacity: 0;
-                }, popushowAtLeast);
+            visibility: hidden;
+            transition: opacity 150ms ease-in-out, visibility 150ms ease-in-out;
+            pointer-events: auto;
+        `;
+        popover.setAttribute('role', 'tooltip');
+        popover.innerHTML = `
+            <div class="font-semibold mb-2 popover-title" style="font-weight: 600; margin-bottom: 0.5rem;"></div>
+            <div class="text-sm popover-content" style="font-size: 0.875rem;"></div>
+        `;
+
+        // Add styles for content images
+        const style = document.createElement('style');
+        style.textContent = `
+            #custom-popover img {
+                max-width: 100%;
+                height: auto;
+                display: block;
+                margin: 0.5rem 0;
             }
-        }, popupWaitBeforeShow);
+            #custom-popover a {
+                color: #2563eb;
+                text-decoration: none;
+            }
+            #custom-popover a:hover {
+                text-decoration: underline;
+            }
+        `;
+        if (!document.getElementById('popover-styles')) {
+            style.id = 'popover-styles';
+            document.head.appendChild(style);
+        }
+
+        // Keep popover open when hovering over it
+        popover.addEventListener('mouseenter', () => {
+            if (popoverTimeout) {
+                clearTimeout(popoverTimeout);
+                popoverTimeout = null;
+            }
+        });
+
+        popover.addEventListener('mouseleave', () => {
+            hidePopover();
+        });
+
+        document.body.appendChild(popover);
+        return popover;
+    }
+
+    function getPopover() {
+        return document.getElementById('custom-popover') || createPopover();
+    }
+
+    function showPopover(element, title, content) {
+        const popover = getPopover();
+        popover.querySelector('.popover-title').textContent = title;
+        popover.querySelector('.popover-content').innerHTML = content;
+
+        // Make visible to measure
+        popover.style.visibility = 'hidden';
+        popover.style.opacity = '0';
+        popover.style.display = 'block';
+
+        // Smart positioning - avoid viewport overflow
+        const padding = 10;
+        const popoverRect = popover.getBoundingClientRect();
+        const viewportWidth = window.innerWidth;
+        const viewportHeight = window.innerHeight;
+
+        let left = clientX + 15;
+        let top = clientY - (popoverRect.height / 2);
+
+        // Prevent right overflow
+        if (left + popoverRect.width > viewportWidth - padding) {
+            left = clientX - popoverRect.width - 15;
+        }
+
+        // Prevent bottom overflow
+        if (top + popoverRect.height > viewportHeight - padding) {
+            top = viewportHeight - popoverRect.height - padding;
+        }
+
+        // Prevent top overflow
+        if (top < padding) {
+            top = padding;
+        }
+
+        popover.style.top = `${top}px`;
+        popover.style.left = `${left}px`;
+        popover.style.visibility = 'visible';
+        popover.style.opacity = '1';
+
+        currentElement = element;
+    }
+
+    function hidePopover() {
+        const popover = getPopover();
+        popover.style.opacity = '0';
+        popover.style.visibility = 'hidden';
+        currentElement = null;
     }
 
     function pop_add(objects, title, contentFunction) {
-        objects.attr("id", "pop")
+        objects.each(function (d) {
-            .attr("data-container", "body")
+            const element = this;
-            .attr("data-toggle", "popover")
-            .attr("data-placement", "right")
-            .attr("title", title);
 
-        objects.each(function (d, i) {
+            element.addEventListener('mouseenter', () => {
-            options = {trigger: "manual", html: true, animation: false};
+                if (popoverTimeout) clearTimeout(popoverTimeout);
-            this_ = this;
+
-            var p = $(this).popover(options).on("mouseenter", function () {
+                popoverTimeout = setTimeout(() => {
-                pop_show_e(this);
+                    if (element.matches(':hover')) {
+                        const content = contentFunction(d);
+                        showPopover(element, title, content);
+                    }
+                }, popupWaitBeforeShow);
             });
-            p.on("show.bs.popover", function (e) {
+
-                // this is to dynamically ajdust the content and bounds of the popup
+            element.addEventListener('mouseleave', () => {
-                p.attr('data-content', contentFunction(d));
+                if (popoverTimeout) {
-                p.data("bs.popover").setContent();
+                    clearTimeout(popoverTimeout);
-                p.data("bs.popover").tip().css({"max-width": "1000px"});
+                    popoverTimeout = null;
+                }
+
+                // Delay hide to allow moving to popover
+                setTimeout(() => {
+                    const popover = getPopover();
+                    if (!popover.matches(':hover') && !element.matches(':hover')) {
+                        hidePopover();
+                    }
+                }, 100);
             });
         });
     }
@@ -255,7 +372,7 @@ function draw(pathway, elem) {
             }
         }
 
-        popupContent += "<img src='" + n.image + "' width='" + 20 * nodeRadius + "'><br>"
+        popupContent += "<img src='" + n.image + "'><br>"
         if (n.scenarios.length > 0) {
             popupContent += '<b>Half-lives and related scenarios:</b><br>'
             for (var s of n.scenarios) {
@@ -265,7 +382,7 @@ function draw(pathway, elem) {
 
         var isLeaf = pathway.links.filter(obj => obj.source.id === n.id).length === 0;
         if (pathway.isIncremental && isLeaf) {
-            popupContent += '<br><a class="btn btn-primary" onclick="predictFromNode(\'' + n.url + '\')" href="#">Predict from here</a><br>';
+            popupContent += '<br><a class="btn btn-primary btn-sm mt-2" onclick="predictFromNode(\'' + n.url + '\')" href="#">Predict from here</a><br>';
         }
 
         return popupContent;
@@ -285,7 +402,7 @@ function draw(pathway, elem) {
             popupContent += adcontent;
         }
 
-        popupContent += "<img src='" + e.image + "' width='" + 20 * nodeRadius + "'><br>"
+        popupContent += "<img src='" + e.image + "'><br>"
         if (e.reaction_probability) {
             popupContent += '<b>Probability:</b><br>' + e.reaction_probability.toFixed(3) + '<br>';
         }
@@ -308,6 +425,23 @@ function draw(pathway, elem) {
     });
 
     const zoomable = d3.select("#zoomable");
+    const svg = d3.select("#pwsvg");
+    const container = d3.select("#vizdiv");
+
+    // Set explicit SVG dimensions for proper zoom behavior
+    svg.attr("width", width)
+       .attr("height", height);
+
+    // Add background rectangle FIRST to enable pan/zoom on empty space
+    // This must be inserted before zoomable group so it's behind everything
+    svg.insert("rect", "#zoomable")
+        .attr("x", 0)
+        .attr("y", 0)
+        .attr("width", width)
+        .attr("height", height)
+        .attr("fill", "transparent")
+        .attr("pointer-events", "all")
+        .style("cursor", "grab");
 
     // Zoom Funktion aktivieren
     const zoom = d3.zoom()
@@ -316,7 +450,12 @@ function draw(pathway, elem) {
             zoomable.attr("transform", event.transform);
         });
 
-    d3.select("svg").call(zoom);
+    // Apply zoom to the SVG element - this enables wheel zoom
+    svg.call(zoom);
+
+    // Also apply zoom to container to catch events that might not reach SVG
+    // This ensures drag-to-pan works even when clicking on empty space
+    container.call(zoom);
 
     nodes = pathway['nodes'];
     links = pathway['links'];

templates/actions/collections/compound.html

@@ -1,6 +1,9 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#new_compound_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('new_compound_modal').showModal(); return false;"
+    >
       <span class="glyphicon glyphicon-plus"></span> New Compound</a
     >
   </li>

templates/actions/collections/compound_structure.html

@@ -2,8 +2,7 @@
   <li>
     <a
       role="button"
-      data-toggle="modal"
+      onclick="document.getElementById('new_compound_structure_modal').showModal(); return false;"
-      data-target="#new_compound_structure_modal"
     >
       <span class="glyphicon glyphicon-plus"></span> New Compound Structure</a
     >

templates/actions/collections/edge.html

@@ -1,6 +1,9 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#new_edge_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('new_edge_modal').showModal(); return false;"
+    >
       <span class="glyphicon glyphicon-plus"></span> New Edge</a
     >
   </li>

templates/actions/collections/group.html

@@ -1,5 +1,8 @@
 <li>
-  <a role="button" data-toggle="modal" data-target="#new_group_modal">
+  <a
+    role="button"
+    onclick="document.getElementById('new_group_modal').showModal(); return false;"
+  >
     <span class="glyphicon glyphicon-plus"></span> New Group</a
   >
 </li>

templates/actions/collections/model.html

@@ -1,6 +1,9 @@
 {% if meta.can_edit and meta.enabled_features.MODEL_BUILDING %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#new_model_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('new_model_modal').showModal(); return false;"
+    >
       <span class="glyphicon glyphicon-plus"></span> New Model</a
     >
   </li>

templates/actions/collections/node.html

@@ -1,6 +1,9 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#new_node_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('new_node_modal').showModal(); return false;"
+    >
       <span class="glyphicon glyphicon-plus"></span> New Node</a
     >
   </li>

templates/actions/collections/package.html

@@ -1,18 +1,23 @@
 <li>
-  <a role="button" data-toggle="modal" data-target="#new_package_modal">
+  <a
+    role="button"
+    onclick="document.getElementById('new_package_modal').showModal(); return false;"
+  >
     <span class="glyphicon glyphicon-plus"></span> New Package</a
   >
 </li>
 <li>
-  <a role="button" data-toggle="modal" data-target="#import_package_modal">
+  <a
+    role="button"
+    onclick="document.getElementById('import_package_modal').showModal(); return false;"
+  >
     <span class="glyphicon glyphicon-import"></span> Import Package from JSON</a
   >
 </li>
 <li>
   <a
     role="button"
-    data-toggle="modal"
+    onclick="document.getElementById('import_legacy_package_modal').showModal(); return false;"
-    data-target="#import_legacy_package_modal"
   >
     <span class="glyphicon glyphicon-import"></span> Import Package from legacy
     JSON</a

templates/actions/collections/reaction.html

@@ -1,6 +1,9 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#new_reaction_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('new_reaction_modal').showModal(); return false;"
+    >
       <span class="glyphicon glyphicon-plus"></span> New Reaction</a
     >
   </li>

templates/actions/collections/rule.html

@@ -1,6 +1,9 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#new_rule_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('new_rule_modal').showModal(); return false;"
+    >
       <span class="glyphicon glyphicon-plus"></span> New Rule</a
     >
   </li>

templates/actions/collections/scenario.html

@@ -1,6 +1,9 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#new_scenario_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('new_scenario_modal').showModal(); return false;"
+    >
       <span class="glyphicon glyphicon-plus"></span> New Scenario</a
     >
   </li>

templates/actions/collections/setting.html

@@ -1,6 +1,9 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#new_setting_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('new_setting_modal').showModal(); return false;"
+    >
       <span class="glyphicon glyphicon-plus"></span>New Setting</a
     >
   </li>

templates/actions/objects/compound.html

@@ -1,42 +1,59 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_compound_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('edit_compound_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-edit"></i> Edit Compound</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#add_structure_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('add_structure_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Add Structure</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
     >
   </li>
   <li>
     <a
       role="button"
-      data-toggle="modal"
+      onclick="document.getElementById('generic_set_external_reference_modal').showModal(); return false;"
-      data-target="#generic_set_external_reference_modal"
     >
       <i class="glyphicon glyphicon-plus"></i> Set External Reference</a
     >
   </li>
 {% endif %}
 <li>
-  <a role="button" data-toggle="modal" data-target="#generic_copy_object_modal">
+  <a
+    role="button"
+    onclick="document.getElementById('generic_copy_object_modal').showModal(); return false;"
+  >
     <i class="glyphicon glyphicon-duplicate"></i> Copy</a
   >
 </li>
 {% if meta.can_edit %}
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Compound</a
     >
   </li>

templates/actions/objects/compound_structure.html

@@ -2,33 +2,40 @@
   <li>
     <a
       role="button"
-      data-toggle="modal"
+      onclick="document.getElementById('edit_compound_structure_modal').showModal(); return false;"
-      data-target="#edit_compound_structure_modal"
     >
       <i class="glyphicon glyphicon-edit"></i> Edit Compound Structure</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
     >
   </li>
   <li>
     <a
       role="button"
-      data-toggle="modal"
+      onclick="document.getElementById('generic_set_external_reference_modal').showModal(); return false;"
-      data-target="#generic_set_external_reference_modal"
     >
       <i class="glyphicon glyphicon-plus"></i> Set External Reference</a
     >
   </li>
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Compound Structure</a
     >
   </li>

templates/actions/objects/edge.html

@@ -1,16 +1,25 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
     >
   </li>
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Edge</a
     >
   </li>

templates/actions/objects/group.html

@@ -1,11 +1,17 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_group_member_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('edit_group_member_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Add/Remove Member</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Group</a
     >
   </li>

templates/actions/objects/model.html

@@ -1,21 +1,33 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_model_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('edit_model_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-edit"></i> Edit Model</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#evaluate_model_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('evaluate_model_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-ok"></i> Evaluate Model</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#retrain_model_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('retrain_model_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-repeat"></i> Retrain Model</a
     >
   </li>
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Model</a
     >
   </li>

templates/actions/objects/node.html

@@ -1,21 +1,33 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_node_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('edit_node_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-edit"></i> Edit Node</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
     >
   </li>
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Node</a
     >
   </li>

templates/actions/objects/package.html

@@ -1,35 +1,49 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_package_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('edit_package_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-edit"></i> Edit Package</a
     >
   </li>
   <li>
     <a
       role="button"
-      data-toggle="modal"
+      onclick="document.getElementById('edit_package_permissions_modal').showModal(); return false;"
-      data-target="#edit_package_permissions_modal"
     >
       <i class="glyphicon glyphicon-user"></i> Edit Permissions</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#publish_package_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('publish_package_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-bullhorn"></i> Publish Package</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#export_package_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('export_package_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-bullhorn"></i> Export Package as JSON</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_license_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_license_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-duplicate"></i> License</a
     >
   </li>
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Package</a
     >
   </li>

templates/actions/objects/pathway.html

@@ -1,26 +1,34 @@
 {% if meta.can_edit %}
   <li>
-    <a class="button" data-toggle="modal" data-target="#add_pathway_node_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('add_pathway_node_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Add Compound</a
     >
   </li>
   <li>
-    <a class="button" data-toggle="modal" data-target="#add_pathway_edge_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('add_pathway_edge_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Add Reaction</a
     >
   </li>
   <li role="separator" class="divider"></li>
 {% endif %}
 <li>
-  <a role="button" data-toggle="modal" data-target="#generic_copy_object_modal">
+  <a
+    role="button"
+    onclick="document.getElementById('generic_copy_object_modal').showModal(); return false;"
+  >
     <i class="glyphicon glyphicon-duplicate"></i> Copy</a
   >
 </li>
 <li>
   <a
     class="button"
-    data-toggle="modal"
+    onclick="document.getElementById('download_pathway_csv_modal').showModal(); return false;"
-    data-target="#download_pathway_csv_modal"
   >
     <i class="glyphicon glyphicon-floppy-save"></i> Download Pathway as CSV</a
   >
@@ -28,8 +36,7 @@
 <li>
   <a
     class="button"
-    data-toggle="modal"
+    onclick="document.getElementById('download_pathway_image_modal').showModal(); return false;"
-    data-target="#download_pathway_image_modal"
   >
     <i class="glyphicon glyphicon-floppy-save"></i> Download Pathway as Image</a
   >
@@ -38,8 +45,7 @@
   <li>
     <a
       class="button"
-      data-toggle="modal"
+      onclick="document.getElementById('identify_missing_rules_modal').showModal(); return false;"
-      data-target="#identify_missing_rules_modal"
     >
       <i class="glyphicon glyphicon-question-sign"></i> Identify Missing
       Rules</a
@@ -47,30 +53,34 @@
   </li>
   <li role="separator" class="divider"></li>
   <li>
-    <a class="button" data-toggle="modal" data-target="#edit_pathway_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('edit_pathway_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-edit"></i> Edit Pathway</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
     >
   </li>
-  {#    <li>#}
-  {#        <a class="button" data-toggle="modal" data-target="#add_pathway_edge_modal">#}
-  {#            <i class="glyphicon glyphicon-plus"></i> Calculate Compound Properties</a>#}
-  {#    </li>#}
   <li role="separator" class="divider"></li>
   <li>
     <a
       class="button"
-      data-toggle="modal"
+      onclick="document.getElementById('delete_pathway_node_modal').showModal(); return false;"
-      data-target="#delete_pathway_node_modal"
     >
       <i class="glyphicon glyphicon-trash"></i> Delete Compound</a
     >
@@ -78,14 +88,16 @@
   <li>
     <a
       class="button"
-      data-toggle="modal"
+      onclick="document.getElementById('delete_pathway_edge_modal').showModal(); return false;"
-      data-target="#delete_pathway_edge_modal"
     >
       <i class="glyphicon glyphicon-trash"></i> Delete Reaction</a
     >
   </li>
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Pathway</a
     >
   </li>

templates/actions/objects/reaction.html

@@ -1,37 +1,51 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_reaction_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('edit_reaction_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-edit"></i> Edit Reaction</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
     >
   </li>
   <li>
     <a
       role="button"
-      data-toggle="modal"
+      onclick="document.getElementById('generic_set_external_reference_modal').showModal(); return false;"
-      data-target="#generic_set_external_reference_modal"
     >
       <i class="glyphicon glyphicon-plus"></i> Set External Reference</a
     >
   </li>
 {% endif %}
 <li>
-  <a role="button" data-toggle="modal" data-target="#generic_copy_object_modal">
+  <a
+    role="button"
+    onclick="document.getElementById('generic_copy_object_modal').showModal(); return false;"
+  >
     <i class="glyphicon glyphicon-duplicate"></i> Copy</a
   >
 </li>
 {% if meta.can_edit %}
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Reaction</a
     >
   </li>

templates/actions/objects/rule.html

@@ -1,28 +1,43 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_rule_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('edit_rule_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-edit"></i> Edit Rule</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
     >
   </li>
 {% endif %}
 <li>
-  <a role="button" data-toggle="modal" data-target="#generic_copy_object_modal">
+  <a
+    role="button"
+    onclick="document.getElementById('generic_copy_object_modal').showModal(); return false;"
+  >
     <i class="glyphicon glyphicon-duplicate"></i> Copy</a
   >
 </li>
 {% if meta.can_edit %}
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Rule</a
     >
   </li>

templates/actions/objects/scenario.html

@@ -2,8 +2,7 @@
   <li>
     <a
       class="button"
-      data-toggle="modal"
+      onclick="document.getElementById('add_additional_information_modal').showModal(); return false;"
-      data-target="#add_additional_information_modal"
     >
       <i class="glyphicon glyphicon-trash"></i> Add Additional Information</a
     >
@@ -11,14 +10,16 @@
   <li>
     <a
       class="button"
-      data-toggle="modal"
+      onclick="document.getElementById('update_scenario_additional_information_modal').showModal(); return false;"
-      data-target="#update_scenario_additional_information_modal"
     >
       <i class="glyphicon glyphicon-trash"></i> Set Additional Information</a
     >
   </li>
   <li>
-    <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Scenario</a
     >
   </li>

templates/actions/objects/user.html

@@ -1,19 +1,24 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_user_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('edit_user_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-edit"></i> Update</a
     >
   </li>
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_password_modal">
+    <a
+      role="button"
+      onclick="document.getElementById('edit_password_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-lock"></i> Update Password</a
     >
   </li>
   <li>
     <a
       role="button"
-      data-toggle="modal"
+      onclick="document.getElementById('new_prediction_setting_modal').showModal(); return false;"
-      data-target="#new_prediction_setting_modal"
     >
       <i class="glyphicon glyphicon-plus"></i> New Prediction Setting</a
     >
@@ -23,7 +28,10 @@
   {#            <i class="glyphicon glyphicon-console"></i> Manage API Token</a>#}
   {#    </li>#}
   <li>
-    <a role="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
       <i class="glyphicon glyphicon-trash"></i> Delete Account</a
     >
   </li>

templates/collections/joblog.html

@@ -1,49 +1,33 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 {% load static %}
 {% load envipytags %}
 {% block content %}
-  <div class="panel-group" id="reviewListAccordion">
+  <div class="space-y-2 p-4">
-    <div class="panel panel-default">
+    <!-- Header Section -->
-      <div
+    <div class="card bg-base-100">
-        class="panel-heading"
+      <div class="card-body">
-        id="headingPanel"
+        <h2 class="card-title text-2xl">User Prediction Jobs</h2>
-        style="font-size:2rem;height: 46px"
+        <p class="mt-2">Job Logs Desc</p>
-      >
-        Jobs
-      </div>
-      <div class="panel-body">
-        <p>Job Logs Desc</p>
       </div>
+    </div>
 
-      <div
+    <!-- Jobs -->
-        class="panel panel-default panel-heading list-group-item"
+    <div class="collapse-arrow bg-base-200 collapse">
-        style="background-color:silver"
+      <input type="checkbox" checked />
-      >
+      <div class="collapse-title text-xl font-medium">Recent Jobs</div>
-        <h4 class="panel-title">
+      <div class="collapse-content" id="job-content">
-          <a
+        <div class="overflow-x-auto">
-            id="job-accordion-link"
+          <table class="table-zebra table">
-            data-toggle="collapse"
+            <thead>
-            data-parent="#job-accordion"
+              <tr>
-            href="#jobs"
+                <th>ID</th>
-          >
+                <th>Name</th>
-            Jobs
+                <th>Status</th>
-          </a>
+                <th>Queued</th>
-        </h4>
+                <th>Done</th>
-      </div>
+                <th>Result</th>
-      <div id="jobs" class="panel-collapse in collapse">
+              </tr>
-        <div class="panel-body list-group-item" id="job-content">
+            </thead>
-          <table class="table-bordered table-hover table">
-            <tr style="background-color: rgba(0, 0, 0, 0.08);">
-              {% if meta.user.is_superuser %}
-                <th scope="col">User</th>
-              {% endif %}
-              <th scope="col">ID</th>
-              <th scope="col">Name</th>
-              <th scope="col">Status</th>
-              <th scope="col">Queued</th>
-              <th scope="col">Done</th>
-              <th scope="col">Result</th>
-            </tr>
             <tbody>
               {% for job in jobs %}
                 <tr>
@@ -58,7 +42,11 @@
                   <td>{{ job.created }}</td>
                   <td>{{ job.done_at }}</td>
                   {% if job.task_result and job.task_result|is_url == True %}
-                    <td><a href="{{ job.task_result }}">Result</a></td>
+                    <td>
+                      <a href="{{ job.task_result }}" class="link link-primary"
+                        >Result</a
+                      >
+                    </td>
                   {% elif job.task_result %}
                     <td>{{ job.task_result|slice:"40" }}...</td>
                   {% else %}
@@ -70,19 +58,31 @@
           </table>
         </div>
       </div>
-
-      <!-- Unreviewable objects such as User / Group / Setting -->
-      <ul class="list-group">
-        {% for obj in objects %}
-          {% if object_type == 'user' %}
-            <a class="list-group-item" href="{{ obj.url }}"
-              >{{ obj.username }}</a
-            >
-          {% else %}
-            <a class="list-group-item" href="{{ obj.url }}">{{ obj.name }}</a>
-          {% endif %}
-        {% endfor %}
-      </ul>
     </div>
+
+    {% if objects %}
+      <!-- Unreviewable objects such as User / Group / Setting -->
+      <div class="card bg-base-100 shadow-xl">
+        <div class="card-body">
+          <ul class="menu bg-base-200 rounded-box">
+            {% for obj in objects %}
+              {% if object_type == 'user' %}
+                <li>
+                  <a href="{{ obj.url }}" class="hover:bg-base-300"
+                    >{{ obj.username }}</a
+                  >
+                </li>
+              {% else %}
+                <li>
+                  <a href="{{ obj.url }}" class="hover:bg-base-300"
+                    >{{ obj.name }}</a
+                  >
+                </li>
+              {% endif %}
+            {% endfor %}
+          </ul>
+        </div>
+      </div>
+    {% endif %}
   </div>
 {% endblock content %}

templates/collections/objects_list.html

@@ -1,28 +1,32 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 {% load static %}
 {% block content %}
 
-  {% if object_type != 'package' %}
+  {# Serialize objects data for Alpine pagination #}
-    <div>
+  {# prettier-ignore-start #}
-      <div id="load-all-error" style="display: none;">
+  {# FIXME: This is a hack to get the objects data into the JavaScript code. #}
-        <div class="alert alert-danger" role="alert">
+  <script>
-          <span
+    window.reviewedObjects = [
-            class="glyphicon glyphicon-exclamation-sign"
+      {% for obj in reviewed_objects %}
-            aria-hidden="true"
+        { "name": "{{ obj.name|escapejs }}", "url": "{{ obj.url }}" }{% if not forloop.last %},{% endif %}
-          ></span>
+      {% endfor %}
-          <span class="sr-only">Error:</span>
+    ];
-          Getting objects failed!
+    window.unreviewedObjects = [
-        </div>
+      {% for obj in unreviewed_objects %}
-      </div>
+        { "name": "{{ obj.name|escapejs }}", "url": "{{ obj.url }}" }{% if not forloop.last %},{% endif %}
+      {% endfor %}
+    ];
+  </script>
+  {# prettier-ignore-end #}
 
+  {% if object_type != 'package' %}
+    <div class="px-8 py-4">
       <input
         type="text"
         id="object-search"
-        class="form-control"
+        class="input input-bordered hidden w-full max-w-xs"
         placeholder="Search by name"
-        style="display: none;"
       />
-      <p></p>
     </div>
   {% endif %}
 
@@ -56,423 +60,474 @@
     {% endif %}
   {% endblock action_modals %}
 
-  <div class="panel-group" id="reviewListAccordion">
+  <div class="px-8 py-4">
-    <div class="panel panel-default">
+    <!-- Header Section -->
-      <div
+    <div class="card bg-base-100">
-        class="panel-heading"
+      <div class="card-body px-0 py-4">
-        id="headingPanel"
+        <div class="flex items-center justify-between">
-        style="font-size:2rem;height: 46px"
+          <h2 class="card-title text-2xl">
-      >
+            {% if object_type == 'package' %}
-        {% if object_type == 'package' %}
+              Packages
-          Packages
+            {% elif object_type == 'compound' %}
-        {% elif object_type == 'compound' %}
+              Compounds
-          Compounds
+            {% elif object_type == 'structure' %}
-        {% elif object_type == 'structure' %}
+              Compound structures
-          Compound structures
+            {% elif object_type == 'rule' %}
-        {% elif object_type == 'rule' %}
+              Rules
-          Rules
+            {% elif object_type == 'reaction' %}
-        {% elif object_type == 'reaction' %}
+              Reactions
-          Reactions
+            {% elif object_type == 'pathway' %}
-        {% elif object_type == 'pathway' %}
+              Pathways
-          Pathways
+            {% elif object_type == 'node' %}
-        {% elif object_type == 'node' %}
+              Nodes
-          Nodes
+            {% elif object_type == 'edge' %}
-        {% elif object_type == 'edge' %}
+              Edges
-          Edges
+            {% elif object_type == 'scenario' %}
-        {% elif object_type == 'scenario' %}
+              Scenarios
-          Scenarios
+            {% elif object_type == 'model' %}
-        {% elif object_type == 'model' %}
+              Model
-          Model
+            {% elif object_type == 'setting' %}
-        {% elif object_type == 'setting' %}
+              Settings
-          Settings
+            {% elif object_type == 'user' %}
-        {% elif object_type == 'user' %}
+              Users
-          Users
+            {% elif object_type == 'group' %}
-        {% elif object_type == 'group' %}
+              Groups
-          Groups
+            {% endif %}
-        {% endif %}
+          </h2>
-        <div
+          <div id="actionsButton" class="dropdown dropdown-end hidden">
-          id="actionsButton"
+            <div tabindex="0" role="button" class="btn btn-ghost btn-sm">
-          style="float: right;font-weight: normal;font-size: medium;position: relative; top: 50%; transform: translateY(-50%);z-index:100;display: none;"
+              <svg
-          class="dropdown"
+                xmlns="http://www.w3.org/2000/svg"
-        >
+                width="16"
-          <a
+                height="16"
-            href="#"
+                viewBox="0 0 24 24"
-            class="dropdown-toggle"
+                fill="none"
-            data-toggle="dropdown"
+                stroke="currentColor"
-            role="button"
+                stroke-width="2"
-            aria-haspopup="true"
+                stroke-linecap="round"
-            aria-expanded="false"
+                stroke-linejoin="round"
-            ><span class="glyphicon glyphicon-wrench"></span> Actions
+                class="lucide lucide-wrench"
-            <span class="caret"></span><span style="padding-right:1em"></span
+              >
-          ></a>
+                <path
-          <ul id="actionsList" class="dropdown-menu">
+                  d="M14.7 6.3a1 1 0 0 0 0 1.4l1.6 1.6a1 1 0 0 0 1.4 0l3.77-3.77a6 6 0 0 1-7.94 7.94l-6.91 6.91a2.12 2.12 0 0 1-3-3l6.91-6.91a6 6 0 0 1 7.94-7.94l-3.76 3.76z"
-            {% block actions %}
+                />
-              {% if object_type == 'package' %}
+              </svg>
-                {% include "actions/collections/package.html" %}
+              Actions
-              {% elif object_type == 'compound' %}
+            </div>
-                {% include "actions/collections/compound.html" %}
+            <ul
-              {% elif object_type == 'structure' %}
+              tabindex="-1"
-                {% include "actions/collections/compound_structure.html" %}
+              class="dropdown-content menu bg-base-100 rounded-box z-50 w-52 p-2"
-              {% elif object_type == 'rule' %}
+            >
-                {% include "actions/collections/rule.html" %}
+              {% block actions %}
-              {% elif object_type == 'reaction' %}
+                {% if object_type == 'package' %}
-                {% include "actions/collections/reaction.html" %}
+                  {% include "actions/collections/package.html" %}
-              {% elif object_type == 'setting' %}
+                {% elif object_type == 'compound' %}
-                {% include "actions/collections/setting.html" %}
+                  {% include "actions/collections/compound.html" %}
-              {% elif object_type == 'scenario' %}
+                {% elif object_type == 'structure' %}
-                {% include "actions/collections/scenario.html" %}
+                  {% include "actions/collections/compound_structure.html" %}
-              {% elif object_type == 'model' %}
+                {% elif object_type == 'rule' %}
-                {% include "actions/collections/model.html" %}
+                  {% include "actions/collections/rule.html" %}
-              {% elif object_type == 'pathway' %}
+                {% elif object_type == 'reaction' %}
-                {% include "actions/collections/pathway.html" %}
+                  {% include "actions/collections/reaction.html" %}
-              {% elif object_type == 'node' %}
+                {% elif object_type == 'setting' %}
-                {% include "actions/collections/node.html" %}
+                  {% include "actions/collections/setting.html" %}
-              {% elif object_type == 'edge' %}
+                {% elif object_type == 'scenario' %}
-                {% include "actions/collections/edge.html" %}
+                  {% include "actions/collections/scenario.html" %}
-              {% elif object_type == 'group' %}
+                {% elif object_type == 'model' %}
-                {% include "actions/collections/group.html" %}
+                  {% include "actions/collections/model.html" %}
-              {% endif %}
+                {% elif object_type == 'pathway' %}
-            {% endblock %}
+                  {% include "actions/collections/pathway.html" %}
-          </ul>
+                {% elif object_type == 'node' %}
+                  {% include "actions/collections/node.html" %}
+                {% elif object_type == 'edge' %}
+                  {% include "actions/collections/edge.html" %}
+                {% elif object_type == 'group' %}
+                  {% include "actions/collections/group.html" %}
+                {% endif %}
+              {% endblock %}
+            </ul>
+          </div>
         </div>
-      </div>
+        <div class="mt-2">
-      <div class="panel-body">
+          <!-- Set Text above links -->
-        <!-- Set Text above links -->
+          {% if object_type == 'package' %}
-        {% if object_type == 'package' %}
-          <p>
-            A package contains pathways, rules, etc. and can reflect specific
-            experimental conditions.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/packages"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'compound' %}
-          <p>
-            A compound stores the structure of a molecule and can include
-            meta-information.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/compounds"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'structure' %}
-          <p>
-            The structures stored in this compound
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/compounds"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'rule' %}
-          <p>
-            A rule describes a biotransformation reaction template that is
-            defined as SMIRKS.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/Rules"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'reaction' %}
-          <p>
-            A reaction is a specific biotransformation from educt compounds to
-            product compounds.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/reactions"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'pathway' %}
-          <p>
-            A pathway displays the (predicted) biodegradation of a compound as
-            graph.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/pathways"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'node' %}
-          <p>
-            Nodes represent the (predicted) compounds in a graph.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/nodes"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'edge' %}
-          <p>
-            Edges represent the links between Nodes in a graph
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/edges"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'scenario' %}
-          <p>
-            A scenario contains meta-information that can be attached to other
-            data (compounds, rules, ..).
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/scenarios"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'model' %}
-          <p>
-            A model applies machine learning to limit the combinatorial
-            explosion.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/relative_reasoning"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'setting' %}
-          <p>
-            A setting includes configuration parameters for pathway predictions.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/settings"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'user' %}
-          <p>
-            Register now to create own packages and to submit and manage your
-            data.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/users"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% elif object_type == 'group' %}
-          <p>
-            Users can team up in groups to share packages.
-            <a
-              target="_blank"
-              href="https://wiki.envipath.org/index.php/groups"
-              role="button"
-              >Learn more &gt;&gt;</a
-            >
-          </p>
-        {% endif %}
-
-        <!-- If theres nothing to show extend the text above -->
-        {% if reviewed_objects and unreviewed_objects %}
-          {% if reviewed_objects|length == 0 and unreviewed_objects|length == 0 %}
             <p>
-              Nothing found. There are two possible reasons: <br /><br />1.
+              A package contains pathways, rules, etc. and can reflect specific
-              There is no content yet.<br />2. You have no reading
+              experimental conditions.
-              permissions.<br /><br />Please be sure you have at least reading
+              <a
-              permissions.
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/packages"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'compound' %}
+            <p>
+              A compound stores the structure of a molecule and can include
+              meta-information.
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/compounds"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'structure' %}
+            <p>
+              The structures stored in this compound
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/compounds"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'rule' %}
+            <p>
+              A rule describes a biotransformation reaction template that is
+              defined as SMIRKS.
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/Rules"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'reaction' %}
+            <p>
+              A reaction is a specific biotransformation from educt compounds to
+              product compounds.
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/reactions"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'pathway' %}
+            <p>
+              A pathway displays the (predicted) biodegradation of a compound as
+              graph.
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/pathways"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'node' %}
+            <p>
+              Nodes represent the (predicted) compounds in a graph.
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/nodes"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'edge' %}
+            <p>
+              Edges represent the links between Nodes in a graph
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/edges"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'scenario' %}
+            <p>
+              A scenario contains meta-information that can be attached to other
+              data (compounds, rules, ..).
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/scenarios"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'model' %}
+            <p>
+              A model applies machine learning to limit the combinatorial
+              explosion.
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/relative_reasoning"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'setting' %}
+            <p>
+              A setting includes configuration parameters for pathway
+              predictions.
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/settings"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'user' %}
+            <p>
+              Register now to create own packages and to submit and manage your
+              data.
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/users"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
+            </p>
+          {% elif object_type == 'group' %}
+            <p>
+              Users can team up in groups to share packages.
+              <a
+                target="_blank"
+                href="https://wiki.envipath.org/index.php/groups"
+                class="link link-primary"
+                >Learn more &gt;&gt;</a
+              >
             </p>
           {% endif %}
-        {% endif %}
+
+          <!-- If theres nothing to show extend the text above -->
+          {% if reviewed_objects and unreviewed_objects %}
+            {% if reviewed_objects|length == 0 and unreviewed_objects|length == 0 %}
+              <p class="mt-4">
+                Nothing found. There are two possible reasons: <br /><br />1.
+                There is no content yet.<br />2. You have no reading
+                permissions.<br /><br />Please be sure you have at least reading
+                permissions.
+              </p>
+            {% endif %}
+          {% endif %}
+        </div>
       </div>
+    </div>
+
+    <!-- Lists Container - Full Width with Reviewed on Right -->
+    <div class="w-full">
       {% if reviewed_objects %}
         {% if reviewed_objects|length > 0 %}
+          <!-- Reviewed -->
           <div
-            class="panel panel-default panel-heading list-group-item"
+            class="collapse-arrow bg-base-200 collapse order-2 w-full"
-            style="background-color:silver"
+            x-data="paginatedList(window.reviewedObjects || [], { isReviewed: true, instanceId: 'reviewed' })"
           >
-            <h4 class="panel-title">
+            <input type="checkbox" checked />
-              <a
+            <div class="collapse-title text-xl font-medium">
-                id="ReviewedLink"
+              Reviewed
-                data-toggle="collapse"
+              <span
-                data-parent="#reviewListAccordion"
+                class="badge badge-sm badge-neutral ml-2"
-                href="#Reviewed"
+                x-text="totalItems"
-                >Reviewed</a
+              ></span>
+            </div>
+            <div class="collapse-content w-full">
+              <ul class="menu bg-base-100 rounded-box w-full">
+                <template x-for="obj in paginatedItems" :key="obj.url">
+                  <li>
+                    <a :href="obj.url" class="hover:bg-base-200">
+                      <span x-text="obj.name"></span>
+                      <span
+                        class="tooltip tooltip-left ml-auto"
+                        data-tip="Reviewed"
+                      >
+                        <svg
+                          xmlns="http://www.w3.org/2000/svg"
+                          width="16"
+                          height="16"
+                          viewBox="0 0 24 24"
+                          fill="none"
+                          stroke="currentColor"
+                          stroke-width="2"
+                          stroke-linecap="round"
+                          stroke-linejoin="round"
+                          class="lucide lucide-star"
+                        >
+                          <polygon
+                            points="12 2 15.09 8.26 22 9.27 17 14.14 18.18 21.02 12 17.77 5.82 21.02 7 14.14 2 9.27 8.91 8.26 12 2"
+                          />
+                        </svg>
+                      </span>
+                    </a>
+                  </li>
+                </template>
+              </ul>
+              <!-- Pagination Controls -->
+              <div
+                x-show="totalPages > 1"
+                class="mt-4 flex items-center justify-between px-2"
               >
-            </h4>
+                <span class="text-base-content/70 text-sm">
-          </div>
+                  Showing <span x-text="showingStart"></span>-<span
-          <div id="Reviewed" class="panel-collapse in collapse">
+                    x-text="showingEnd"
-            <div class="panel-body list-group-item" id="ReviewedContent">
+                  ></span>
-              {% if object_type == 'package' %}
+                  of <span x-text="totalItems"></span>
-                {% for obj in reviewed_objects %}
+                </span>
-                  <a class="list-group-item" href="{{ obj.url }}"
+                <div class="join">
-                    >{{ obj.name|safe }}
+                  <button
-                    <span
+                    class="join-item btn btn-sm"
-                      class="glyphicon glyphicon-star"
+                    :disabled="currentPage === 1"
-                      aria-hidden="true"
+                    @click="prevPage()"
-                      style="float:right"
+                  >
-                      data-toggle="tooltip"
+                    «
-                      data-placement="top"
+                  </button>
-                      title=""
+                  <template x-for="item in pageNumbers" :key="item.key">
-                      data-original-title="Reviewed"
+                    <button
-                    >
+                      class="join-item btn btn-sm"
-                    </span>
+                      :class="{ 'btn-active': item.page === currentPage }"
-                  </a>
+                      :disabled="item.isEllipsis"
-                {% endfor %}
+                      @click="!item.isEllipsis && goToPage(item.page)"
-              {% else %}
+                      x-text="item.page"
-                {% for obj in reviewed_objects|slice:":50" %}
+                    ></button>
-                  <a class="list-group-item" href="{{ obj.url }}"
+                  </template>
-                    >{{ obj.name|safe }}{# <i>({{ obj.package.name }})</i> #}
+                  <button
-                    <span
+                    class="join-item btn btn-sm"
-                      class="glyphicon glyphicon-star"
+                    :disabled="currentPage === totalPages"
-                      aria-hidden="true"
+                    @click="nextPage()"
-                      style="float:right"
+                  >
-                      data-toggle="tooltip"
+                    »
-                      data-placement="top"
+                  </button>
-                      title=""
+                </div>
-                      data-original-title="Reviewed"
+              </div>
-                    >
-                    </span>
-                  </a>
-                {% endfor %}
-              {% endif %}
             </div>
           </div>
         {% endif %}
       {% endif %}
+
       {% if unreviewed_objects %}
+        <!-- Unreviewed -->
         <div
-          class="panel panel-default panel-heading list-group-item"
+          class="collapse-arrow bg-base-200 collapse order-1 w-full"
-          style="background-color:silver"
+          x-data="paginatedList(window.unreviewedObjects || [], { isReviewed: false, instanceId: 'unreviewed' })"
         >
-          <h4 class="panel-title">
+          <input
-            <a
+            type="checkbox"
-              id="UnreviewedLink"
+            {% if reviewed_objects|length == 0 or object_type == 'package' %}checked{% endif %}
-              data-toggle="collapse"
+          />
-              data-parent="#unReviewListAccordion"
+          <div class="collapse-title text-xl font-medium">
-              href="#Unreviewed"
+            Unreviewed
-              >Unreviewed</a
+            <span
+              class="badge badge-sm badge-neutral ml-2"
+              x-text="totalItems"
+            ></span>
+          </div>
+          <div class="collapse-content w-full">
+            <ul class="menu bg-base-100 rounded-box w-full">
+              <template x-for="obj in paginatedItems" :key="obj.url">
+                <li>
+                  <a
+                    :href="obj.url"
+                    class="hover:bg-base-200"
+                    x-text="obj.name"
+                  ></a>
+                </li>
+              </template>
+            </ul>
+            <!-- Pagination Controls -->
+            <div
+              x-show="totalPages > 1"
+              class="mt-4 flex items-center justify-between px-2"
             >
-          </h4>
+              <span class="text-base-content/70 text-sm">
-        </div>
+                Showing <span x-text="showingStart"></span>-<span
-        <div
+                  x-text="showingEnd"
-          id="Unreviewed"
+                ></span>
-          class="panel-collapse {% if reviewed_objects|length == 0 or object_type == 'package' %}in{% endif %} collapse"
+                of <span x-text="totalItems"></span>
-        >
+              </span>
-          <div class="panel-body list-group-item" id="UnreviewedContent">
+              <div class="join">
-            {% if object_type == 'package' %}
+                <button
-              {% for obj in unreviewed_objects %}
+                  class="join-item btn btn-sm"
-                <a class="list-group-item" href="{{ obj.url }}"
+                  :disabled="currentPage === 1"
-                  >{{ obj.name|safe }}</a
+                  @click="prevPage()"
                 >
-              {% endfor %}
+                  «
-            {% else %}
+                </button>
-              {% for obj in unreviewed_objects|slice:":50" %}
+                <template x-for="item in pageNumbers" :key="item.key">
-                <a class="list-group-item" href="{{ obj.url }}"
+                  <button
-                  >{{ obj.name|safe }}</a
+                    class="join-item btn btn-sm"
+                    :class="{ 'btn-active': item.page === currentPage }"
+                    :disabled="item.isEllipsis"
+                    @click="!item.isEllipsis && goToPage(item.page)"
+                    x-text="item.page"
+                  ></button>
+                </template>
+                <button
+                  class="join-item btn btn-sm"
+                  :disabled="currentPage === totalPages"
+                  @click="nextPage()"
                 >
-              {% endfor %}
+                  »
-            {% endif %}
+                </button>
+              </div>
+            </div>
           </div>
         </div>
       {% endif %}
-      {% if objects %}
-        <!-- Unreviewable objects such as User / Group / Setting -->
-        <ul class="list-group">
-          {% for obj in objects %}
-            {% if object_type == 'user' %}
-              <a class="list-group-item" href="{{ obj.url }}"
-                >{{ obj.username|safe }}</a
-              >
-            {% else %}
-              <a class="list-group-item" href="{{ obj.url }}"
-                >{{ obj.name|safe }}</a
-              >
-            {% endif %}
-          {% endfor %}
-        </ul>
-      {% endif %}
     </div>
-    <style>
-      .spinner-widget {
-        position: fixed; /* stays in place on scroll */
-        bottom: 20px; /* distance from bottom */
-        right: 20px; /* distance from right */
-        z-index: 9999; /* above most elements */
-        width: 60px; /* adjust to gif size */
-        height: 60px;
-      }
 
-      .spinner-widget img {
+    {% if objects %}
-        width: 100%;
+      <!-- Unreviewable objects such as User / Group / Setting -->
-        height: auto;
+      <div class="card bg-base-100">
-      }
+        <div class="card-body">
-    </style>
+          <ul class="menu bg-base-200 rounded-box">
-
+            {% for obj in objects %}
-    <div id="load-all-loading" class="spinner-widget" style="display: none">
+              {% if object_type == 'user' %}
-      <img
+                <li>
-        id="loading-gif"
+                  <a href="{{ obj.url }}" class="hover:bg-base-300"
-        src="{% static '/images/wait.gif' %}"
+                    >{{ obj.username }}</a
-        alt="Loading..."
+                  >
-      />
+                </li>
-    </div>
+              {% else %}
+                <li>
+                  <a href="{{ obj.url }}" class="hover:bg-base-300"
+                    >{{ obj.name }}</a
+                  >
+                </li>
+              {% endif %}
+            {% endfor %}
+          </ul>
+        </div>
+      </div>
+    {% endif %}
   </div>
-  {# prettier-ignore-start #}
-    <script>
-        $(function () {
 
-            $('#object-search').show();
+  <script>
+    document.addEventListener("DOMContentLoaded", function () {
+      // Show actions button if there are actions
+      const actionsButton = document.getElementById("actionsButton");
+      const actionsList = actionsButton?.querySelector("ul");
+      if (actionsList && actionsList.children.length > 0) {
+        actionsButton?.classList.remove("hidden");
+      }
 
-            {% if object_type != 'package' and object_type != 'user' and object_type != 'group' %}
+      // Show search input and connect to Alpine pagination
-                {% if reviewed_objects|length > 50 or unreviewed_objects|length > 50 %}
+      const objectSearch = document.getElementById("object-search");
-                    $('#load-all-loading').show()
+      if (objectSearch) {
-
+        objectSearch.classList.remove("hidden");
-                    setTimeout(function () {
+        objectSearch.addEventListener("input", function () {
-                        $('#load-all-error').hide();
+          const query = this.value;
-
+          // Dispatch search to all paginatedList components
-                        $.getJSON('?all=true', function (resp) {
+          document
-                            $('#ReviewedContent').empty();
+            .querySelectorAll('[x-data*="paginatedList"]')
-                            $('#UnreviewedContent').empty();
+            .forEach((el) => {
-
+              if (el._x_dataStack && el._x_dataStack[0]) {
-                            for (o in resp.objects) {
+                el._x_dataStack[0].search(query);
-                                obj = resp.objects[o];
+              }
-                                if (obj.reviewed) {
-                                    $('#ReviewedContent').append('<a class="list-group-item" href="' + obj.url + '">' + obj.name + ' <span class="glyphicon glyphicon-star" aria-hidden="true" style="float:right" data-toggle="tooltip" data-placement="top" title="" data-original-title="Reviewed"></span></a>');
-                                } else {
-                                    $('#UnreviewedContent').append('<a class="list-group-item" href="' + obj.url + '">' + obj.name + '</a>');
-                                }
-                            }
-
-                            $('#load-all-loading').hide();
-                            $('#load-remaining').hide();
-                        }).fail(function (resp) {
-                            $('#load-all-loading').hide();
-                            $('#load-all-error').show();
-                        });
-
-                    }, 2500);
-                {% endif %}
-            {% endif %}
-
-            $('#modal-form-delete-submit').on('click', function (e) {
-                e.preventDefault();
-                $('#modal-form-delete').submit();
             });
-
-            $('#object-search').on('keyup', function () {
-                let query = $(this).val().toLowerCase();
-                $('a.list-group-item').each(function () {
-                    let text = $(this).text().toLowerCase();
-                    $(this).toggle(text.indexOf(query) !== -1);
-                });
-            });
-
         });
-    </script>
+      }
-    {# prettier-ignore-end #}
+
+      // Delete form submit handler
+      const deleteSubmit = document.getElementById("modal-form-delete-submit");
+      const deleteForm = document.getElementById("modal-form-delete");
+      if (deleteSubmit && deleteForm) {
+        deleteSubmit.addEventListener("click", function (e) {
+          e.preventDefault();
+          deleteForm.submit();
+        });
+      }
+    });
+  </script>
 {% endblock content %}

templates/errors/400_bad_request.html

@@ -1,18 +1,77 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 {% load static %}
 {% block content %}
-  <div class="alert alert-error" role="alert">
+  <div class="flex min-h-[60vh] flex-col items-center justify-center p-8">
-    <h4 class="alert-heading">Bad Request!</h4>
+    <div class="w-full max-w-2xl">
-    <p>Lorem</p>
+      <div class="alert alert-error mb-6 shadow-lg">
-    <hr />
+        <svg
-    <p class="mb-0">
+          xmlns="http://www.w3.org/2000/svg"
-      You can find out more about permissions in our
+          class="h-8 w-8 shrink-0 stroke-current"
-      <a
+          fill="none"
-        target="_blank"
+          viewBox="0 0 24 24"
-        href="https://wiki.envipath.org/index.php/packages"
+        >
-        role="button"
+          <path
-        >Wiki &gt;&gt;</a
+            stroke-linecap="round"
-      >
+            stroke-linejoin="round"
-    </p>
+            stroke-width="2"
+            d="M12 9v2m0 4h.01m-6.938 4h13.856c1.54 0 2.502-1.667 1.732-3L13.732 4c-.77-1.333-2.694-1.333-3.464 0L3.34 16c-.77 1.333.192 3 1.732 3z"
+          />
+        </svg>
+        <div class="flex flex-col">
+          <h3 class="text-lg font-bold">Bad Request</h3>
+          <p class="text-sm">The request you sent was invalid or malformed.</p>
+        </div>
+      </div>
+
+      <div class="card bg-base-100 shadow-xl">
+        <div class="card-body">
+          <h2 class="card-title mb-4 text-2xl">What happened?</h2>
+          <p class="text-base-content/70 mb-4">
+            The server couldn't process your request because it contains invalid
+            data or parameters.
+          </p>
+          <div class="card-actions mt-6 justify-end">
+            <a href="/" class="btn btn-primary">
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="mr-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M3 12l2-2m0 0l7-7 7 7M5 10v10a1 1 0 001 1h3m10-11l2 2m-2-2v10a1 1 0 01-1 1h-3m-6 0a1 1 0 001-1v-4a1 1 0 011-1h2a1 1 0 011 1v4a1 1 0 001 1m-6 0h6"
+                />
+              </svg>
+              Go Home
+            </a>
+            <a
+              href="https://wiki.envipath.org/index.php/packages"
+              target="_blank"
+              class="btn btn-outline"
+            >
+              Learn More
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="ml-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M10 6H6a2 2 0 00-2 2v10a2 2 0 002 2h10a2 2 0 002-2v-4M14 4h6m0 0v6m0-6L10 14"
+                />
+              </svg>
+            </a>
+          </div>
+        </div>
+      </div>
+    </div>
   </div>
 {% endblock content %}

templates/errors/403_access_denied.html

@@ -1,18 +1,80 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 {% load static %}
 {% block content %}
-  <div class="alert alert-error" role="alert">
+  <div class="flex min-h-[60vh] flex-col items-center justify-center p-8">
-    <h4 class="alert-heading">Access Denied!</h4>
+    <div class="w-full max-w-2xl">
-    <p>Access to X denied.</p>
+      <div class="alert alert-warning mb-6 shadow-lg">
-    <hr />
+        <svg
-    <p class="mb-0">
+          xmlns="http://www.w3.org/2000/svg"
-      You can find out more about permissions in our
+          class="h-8 w-8 shrink-0 stroke-current"
-      <a
+          fill="none"
-        target="_blank"
+          viewBox="0 0 24 24"
-        href="https://wiki.envipath.org/index.php/packages"
+        >
-        role="button"
+          <path
-        >Wiki &gt;&gt;</a
+            stroke-linecap="round"
-      >
+            stroke-linejoin="round"
-    </p>
+            stroke-width="2"
+            d="M12 9v2m0 4h.01m-6.938 4h13.856c1.54 0 2.502-1.667 1.732-3L13.732 4c-.77-1.333-2.694-1.333-3.464 0L3.34 16c-.77 1.333.192 3 1.732 3z"
+          />
+        </svg>
+        <div class="flex flex-col">
+          <h3 class="text-lg font-bold">Access Denied</h3>
+          <p class="text-sm">
+            You don't have permission to access this resource.
+          </p>
+        </div>
+      </div>
+
+      <div class="card bg-base-100 shadow-xl">
+        <div class="card-body">
+          <h2 class="card-title mb-4 text-2xl">Permission Required</h2>
+          <p class="text-base-content/70 mb-4">
+            You need the appropriate permissions to access this content. If you
+            believe this is an error, please contact the package owner or
+            administrator.
+          </p>
+          <div class="card-actions mt-6 justify-end">
+            <a href="/" class="btn btn-primary">
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="mr-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M3 12l2-2m0 0l7-7 7 7M5 10v10a1 1 0 001 1h3m10-11l2 2m-2-2v10a1 1 0 01-1 1h-3m-6 0a1 1 0 001-1v-4a1 1 0 011-1h2a1 1 0 011 1v4a1 1 0 001 1m-6 0h6"
+                />
+              </svg>
+              Go Home
+            </a>
+            <a
+              href="https://wiki.envipath.org/index.php/packages"
+              target="_blank"
+              class="btn btn-outline"
+            >
+              Learn More
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="ml-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M10 6H6a2 2 0 00-2 2v10a2 2 0 002 2h10a2 2 0 002-2v-4M14 4h6m0 0v6m0-6L10 14"
+                />
+              </svg>
+            </a>
+          </div>
+        </div>
+      </div>
+    </div>
   </div>
 {% endblock content %}

templates/errors/404_not_found.html

@@ -1,18 +1,77 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 {% load static %}
 {% block content %}
-  <div class="alert alert-error" role="alert">
+  <div class="flex min-h-[60vh] flex-col items-center justify-center p-8">
-    <h4 class="alert-heading">Not Found!</h4>
+    <div class="w-full max-w-2xl">
-    <p>Does not exist</p>
+      <div class="alert alert-info mb-6 shadow-lg">
-    <hr />
+        <svg
-    <p class="mb-0">
+          xmlns="http://www.w3.org/2000/svg"
-      You can find out more about permissions in our
+          class="h-8 w-8 shrink-0 stroke-current"
-      <a
+          fill="none"
-        target="_blank"
+          viewBox="0 0 24 24"
-        href="https://wiki.envipath.org/index.php/packages"
+        >
-        role="button"
+          <path
-        >Wiki &gt;&gt;</a
+            stroke-linecap="round"
-      >
+            stroke-linejoin="round"
-    </p>
+            stroke-width="2"
+            d="M13 16h-1v-4h-1m1-4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"
+          />
+        </svg>
+        <div class="flex flex-col">
+          <h3 class="text-lg font-bold">Page Not Found</h3>
+          <p class="text-sm">The page you're looking for doesn't exist.</p>
+        </div>
+      </div>
+
+      <div class="card bg-base-100 shadow-xl">
+        <div class="card-body">
+          <h2 class="card-title mb-4 text-2xl">404 Error</h2>
+          <p class="text-base-content/70 mb-4">
+            The page or resource you requested could not be found. It may have
+            been moved, deleted, or the URL might be incorrect.
+          </p>
+          <div class="card-actions mt-6 justify-end">
+            <a href="/" class="btn btn-primary">
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="mr-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M3 12l2-2m0 0l7-7 7 7M5 10v10a1 1 0 001 1h3m10-11l2 2m-2-2v10a1 1 0 01-1 1h-3m-6 0a1 1 0 001-1v-4a1 1 0 011-1h2a1 1 0 011 1v4a1 1 0 001 1m-6 0h6"
+                />
+              </svg>
+              Go Home
+            </a>
+            <a
+              href="https://wiki.envipath.org/index.php/packages"
+              target="_blank"
+              class="btn btn-outline"
+            >
+              Learn More
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="ml-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M10 6H6a2 2 0 00-2 2v10a2 2 0 002 2h10a2 2 0 002-2v-4M14 4h6m0 0v6m0-6L10 14"
+                />
+              </svg>
+            </a>
+          </div>
+        </div>
+      </div>
+    </div>
   </div>
 {% endblock content %}

templates/errors/error.html

@@ -1,9 +1,76 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 {% load static %}
 {% block content %}
-  <div class="alert alert-danger" role="alert">
+  <div class="flex min-h-[60vh] flex-col items-center justify-center p-8">
-    <h4 class="alert-heading">{{ error_message }}</h4>
+    <div class="w-full max-w-2xl">
-    <hr />
+      <div class="alert alert-error mb-6 shadow-lg">
-    <p class="mb-0">{{ error_detail }}</p>
+        <svg
+          xmlns="http://www.w3.org/2000/svg"
+          class="h-8 w-8 shrink-0 stroke-current"
+          fill="none"
+          viewBox="0 0 24 24"
+        >
+          <path
+            stroke-linecap="round"
+            stroke-linejoin="round"
+            stroke-width="2"
+            d="M10 14l2-2m0 0l2-2m-2 2l-2-2m2 2l2 2m7-2a9 9 0 11-18 0 9 9 0 0118 0z"
+          />
+        </svg>
+        <div class="flex flex-col">
+          <h3 class="text-lg font-bold">
+            {{ error_message|default:"An Error Occurred" }}
+          </h3>
+          <p class="text-sm">
+            {{ error_detail|default:"Something went wrong. Please try again later." }}
+          </p>
+        </div>
+      </div>
+
+      <div class="card bg-base-100 shadow-xl">
+        <div class="card-body">
+          <h2 class="card-title mb-4 text-2xl">Oops! Something went wrong</h2>
+          <p class="text-base-content/70 mb-4">
+            {{ error_description|default:"We encountered an unexpected error while processing your request. Our team has been notified and is working to resolve the issue." }}
+          </p>
+          <div class="card-actions mt-6 justify-end">
+            <a href="/" class="btn btn-primary">
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="mr-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M3 12l2-2m0 0l7-7 7 7M5 10v10a1 1 0 001 1h3m10-11l2 2m-2-2v10a1 1 0 01-1 1h-3m-6 0a1 1 0 001-1v-4a1 1 0 011-1h2a1 1 0 011 1v4a1 1 0 001 1m-6 0h6"
+                />
+              </svg>
+              Go Home
+            </a>
+            <button onclick="window.history.back()" class="btn btn-outline">
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="mr-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M10 19l-7-7m0 0l7-7m-7 7h18"
+                />
+              </svg>
+              Go Back
+            </button>
+          </div>
+        </div>
+      </div>
+    </div>
   </div>
 {% endblock content %}

templates/errors/user_account_inactive.html

@@ -1,11 +1,81 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 {% load static %}
 {% block content %}
-  <div class="alert alert-danger" role="alert">
+  <div class="flex min-h-[60vh] flex-col items-center justify-center p-8">
-    <h4 class="alert-heading">Your account has not been activated yet!</h4>
+    <div class="w-full max-w-2xl">
-    <p>
+      <div class="alert alert-warning mb-6 shadow-lg">
-      Your account has not been activated yet. If you have questions
+        <svg
-      <a href="mailto:admin@envipath.org">contact us.</a>
+          xmlns="http://www.w3.org/2000/svg"
-    </p>
+          class="h-8 w-8 shrink-0 stroke-current"
+          fill="none"
+          viewBox="0 0 24 24"
+        >
+          <path
+            stroke-linecap="round"
+            stroke-linejoin="round"
+            stroke-width="2"
+            d="M12 9v2m0 4h.01m-6.938 4h13.856c1.54 0 2.502-1.667 1.732-3L13.732 4c-.77-1.333-2.694-1.333-3.464 0L3.34 16c-.77 1.333.192 3 1.732 3z"
+          />
+        </svg>
+        <div class="flex flex-col">
+          <h3 class="text-lg font-bold">Account Not Activated</h3>
+          <p class="text-sm">Your account is pending activation.</p>
+        </div>
+      </div>
+
+      <div class="card bg-base-100 shadow-xl">
+        <div class="card-body">
+          <h2 class="card-title mb-4 text-2xl">Account Activation Required</h2>
+          <p class="text-base-content/70 mb-4">
+            Your account has not been activated yet. An administrator needs to
+            approve your account before you can access all features. This
+            process typically takes 24-48 hours.
+          </p>
+          <div class="divider"></div>
+          <p class="text-base-content/70 mb-4">
+            If you have questions or believe this is an error, please
+            <a href="mailto:admin@envipath.org" class="link link-primary"
+              >contact us</a
+            >.
+          </p>
+          <div class="card-actions mt-6 justify-end">
+            <a href="/" class="btn btn-primary">
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="mr-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M3 12l2-2m0 0l7-7 7 7M5 10v10a1 1 0 001 1h3m10-11l2 2m-2-2v10a1 1 0 01-1 1h-3m-6 0a1 1 0 001-1v-4a1 1 0 011-1h2a1 1 0 011 1v4a1 1 0 001 1m-6 0h6"
+                />
+              </svg>
+              Go Home
+            </a>
+            <a href="mailto:admin@envipath.org" class="btn btn-outline">
+              <svg
+                xmlns="http://www.w3.org/2000/svg"
+                class="mr-2 h-5 w-5"
+                fill="none"
+                viewBox="0 0 24 24"
+                stroke="currentColor"
+              >
+                <path
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  stroke-width="2"
+                  d="M3 8l7.89 5.26a2 2 0 002.22 0L21 8M5 19h14a2 2 0 002-2V7a2 2 0 00-2-2H5a2 2 0 00-2 2v10a2 2 0 002 2z"
+                />
+              </svg>
+              Contact Admin
+            </a>
+          </div>
+        </div>
+      </div>
+    </div>
   </div>
 {% endblock content %}

templates/framework.html

@@ -228,15 +228,7 @@
                       >Documentation Wiki</a
                     >
                   </li>
-                  <li>
+
-                    <a
-                      href="#"
-                      id="citeButton"
-                      data-toggle="modal"
-                      data-target="#citemodal"
-                      >How to cite enviPath</a
-                    >
-                  </li>
                   <li class="divider"></li>
                   <li><a>Version: {{ meta.version }}</a></li>
                 </ul>
@@ -408,10 +400,5 @@
         }
       });
     </script>
-    {% block modals %}
-      {% include "modals/cite_modal.html" %}
-      {% include "modals/predict_modal.html" %}
-      {% include "modals/batch_predict_modal.html" %}
-    {% endblock %}
   </body>
 </html>

templates/framework_modern.html

@@ -21,8 +21,14 @@
       type="text/css"
     />
 
-    {# jQuery - Keep for compatibility with existing JS #}
+    {# Alpine.js - For reactive components #}
-    <script src="https://ajax.googleapis.com/ajax/libs/jquery/3.1.1/jquery.min.js"></script>
+    <script
+      defer
+      src="https://cdn.jsdelivr.net/npm/alpinejs@3.x.x/dist/cdn.min.js"
+    ></script>
+    <script src="{% static 'js/alpine/index.js' %}"></script>
+    <script src="{% static 'js/alpine/search.js' %}"></script>
+    <script src="{% static 'js/alpine/pagination.js' %}"></script>
 
     {# Font Awesome #}
     <link
@@ -35,21 +41,10 @@
 
     <script>
       const csrftoken = document.querySelector("[name=csrf-token]").content;
-
-      // Setup CSRF header for all jQuery AJAX requests
-      $.ajaxSetup({
-        beforeSend: function (xhr, settings) {
-          if (!/^(GET|HEAD|OPTIONS|TRACE)$/i.test(settings.type)) {
-            xhr.setRequestHeader("X-CSRFToken", csrftoken);
-          }
-        },
-      });
     </script>
 
     {# General EP JS #}
     <script src="{% static 'js/pps.js' %}"></script>
-    {# Modal Steps for Stepwise Modal Wizards #}
-    <script src="{% static 'js/jquery-bootstrap-modal-steps.js' %}"></script>
 
     {% if not debug %}
       <!-- Matomo -->
@@ -171,10 +166,11 @@
     {% endblock %}
 
     <script>
-      $(function () {
+      document.addEventListener("DOMContentLoaded", function () {
-        // Hide actionsbutton if there's no action defined
+        // Show actions button if there are actions defined
-        if ($("#actionsButton ul").children().length > 0) {
+        const actionsButtonUl = document.querySelector("#actionsButton ul");
-          $("#actionsButton").show();
+        if (actionsButtonUl && actionsButtonUl.children.length > 0) {
+          document.getElementById("actionsButton").style.display = "";
         }
       });
 

templates/includes/navbar.html

@@ -1,140 +1,267 @@
 {% load static %}
-{# Modern DaisyUI Navbar #}
+{# Modern DaisyUI Navbar with Mobile Drawer Menu #}
-<div class="navbar x-50 bg-neutral-50 text-neutral-950 shadow-lg">
+<div class="drawer drawer-mobile">
-  <div class="navbar-start">
+  <input id="drawer-toggle" type="checkbox" class="drawer-toggle" />
-    <a href="{{ meta.server_url }}" class="btn btn-ghost text-xl normal-case">
+  <div class="drawer-content flex flex-col">
-      <svg class="fill-base-content h-8" viewBox="0 0 104 26" role="img">
+    {# Navbar #}
-        <use href="{% static "/images/logo-name.svg" %}#ep-logo-name" />
+    <div class="navbar x-50 bg-neutral-50 text-neutral-950 shadow-lg">
-      </svg>
+      <div class="navbar-start">
-    </a>
+        {# Hamburger menu button - visible on mobile, hidden on desktop #}
-  </div>
+        {% if not public_mode %}
-
+          <label
-  {% if not public_mode %}
+            for="drawer-toggle"
-    <div class="navbar-center hidden lg:flex">
+            class="btn btn-square btn-ghost drawer-button lg:hidden"
-      <a
+          >
-        href="{{ meta.server_url }}/predict"
+            <svg
-        role="button"
+              xmlns="http://www.w3.org/2000/svg"
-        class="btn btn-ghost"
+              fill="none"
-        id="predictLink"
+              viewBox="0 0 24 24"
-        >Predict</a
+              class="inline-block h-5 w-5 stroke-current"
-      >
+            >
-      <!-- <li><a href="{{ meta.server_url }}/package" id="packageLink">Package</a></li> -->
+              <path
-      <!--<li><a href="{{ meta.server_url }}/browse" id="browseLink">Browse</a></li>-->
+                stroke-linecap="round"
-      <div class="dropdown dropdown-center">
+                stroke-linejoin="round"
-        <div tabindex="0" role="button" class="btn btn-ghost">Browse</div>
+                stroke-width="2"
-        <ul
+                d="M4 6h16M4 12h16M4 18h16"
-          tabindex="-1"
+              ></path>
-          class="dropdown-content menu bg-base-100 rounded-box z-1 w-52 p-2 shadow-sm"
+            </svg>
+          </label>
+        {% endif %}
+        <a
+          href="{{ meta.server_url }}"
+          class="btn btn-ghost text-xl normal-case"
         >
-          <li>
+          <svg class="fill-base-content h-8" viewBox="0 0 104 26" role="img">
-            <a href="{{ meta.server_url }}/package" id="packageLink">Package</a>
+            <use href="{% static "/images/logo-name.svg" %}#ep-logo-name" />
-          </li>
+          </svg>
-          <li>
+        </a>
-            <a href="{{ meta.server_url }}/pathway" id="pathwayLink">Pathway</a>
+      </div>
-          </li>
+
-          <li><a href="{{ meta.server_url }}/rule" id="ruleLink">Rule</a></li>
+      {% if not public_mode %}
-          <li>
+        {# Desktop menu - hidden on mobile, visible on desktop #}
-            <a href="{{ meta.server_url }}/compound" id="compoundLink"
+        <div class="navbar-center hidden lg:flex">
-              >Compound</a
+          <a
+            href="{{ meta.server_url }}/predict"
+            role="button"
+            class="btn btn-ghost"
+            id="predictLink"
+            >Predict</a
+          >
+          <div class="dropdown dropdown-center">
+            <div tabindex="0" role="button" class="btn btn-ghost">Browse</div>
+            <ul
+              tabindex="-1"
+              class="dropdown-content menu bg-base-100 rounded-box z-1 w-52 p-2 shadow-sm"
             >
-          </li>
+              <li>
-          <li>
+                <a href="{{ meta.server_url }}/package" id="packageLink"
-            <a href="{{ meta.server_url }}/reaction" id="reactionLink"
+                  >Package</a
-              >Reaction</a
+                >
+              </li>
+              <li>
+                <a href="{{ meta.server_url }}/pathway" id="pathwayLink"
+                  >Pathway</a
+                >
+              </li>
+              <li>
+                <a href="{{ meta.server_url }}/rule" id="ruleLink">Rule</a>
+              </li>
+              <li>
+                <a href="{{ meta.server_url }}/compound" id="compoundLink"
+                  >Compound</a
+                >
+              </li>
+              <li>
+                <a href="{{ meta.server_url }}/reaction" id="reactionLink"
+                  >Reaction</a
+                >
+              </li>
+              <li>
+                <a
+                  href="{{ meta.server_url }}/model"
+                  id="relative-reasoningLink"
+                  >Model</a
+                >
+              </li>
+              <li>
+                <a href="{{ meta.server_url }}/scenario" id="scenarioLink"
+                  >Scenario</a
+                >
+              </li>
+            </ul>
+          </div>
+        </div>
+      {% endif %}
+
+      <div class="navbar-end">
+        {% if not public_mode %}
+          <a id="search-trigger" role="button" class="cursor-pointer">
+            <div
+              class="badge badge-dash bg-base-200 text-base-content/50 m-1 flex items-center space-x-1 p-2"
             >
-          </li>
+              <svg
-          <li>
+                xmlns="http://www.w3.org/2000/svg"
-            <a href="{{ meta.server_url }}/model" id="relative-reasoningLink"
+                width="16"
-              >Model</a
+                height="16"
+                viewBox="0 0 24 24"
+                fill="none"
+                stroke="currentColor"
+                stroke-width="2"
+                stroke-linecap="round"
+                stroke-linejoin="round"
+                class="lucide lucide-search-icon lucide-search"
+              >
+                <path d="m21 21-4.34-4.34" />
+                <circle cx="11" cy="11" r="8" />
+              </svg>
+              <span id="search-shortcut">⌘K</span>
+            </div>
+          </a>
+        {% endif %}
+        {% if meta.user.username == 'anonymous' or public_mode %}
+          <a href="{% url 'login' %}" id="loginButton" class="p-2">Login</a>
+        {% else %}
+          <div class="dropdown dropdown-end">
+            <div
+              tabindex="0"
+              role="button"
+              class="btn btn-ghost btn-circle m-1"
+              id="loggedInButton"
             >
-          </li>
+              <svg
-          <li>
+                xmlns="http://www.w3.org/2000/svg"
-            <a href="{{ meta.server_url }}/scenario" id="scenarioLink"
+                width="24"
-              >Scenario</a
+                height="24"
+                viewBox="0 0 24 24"
+                fill="none"
+                stroke="currentColor"
+                stroke-width="2"
+                stroke-linecap="round"
+                stroke-linejoin="round"
+                class="lucide lucide-circle-user-icon lucide-circle-user"
+              >
+                <circle cx="12" cy="12" r="10" />
+                <circle cx="12" cy="10" r="3" />
+                <path d="M7 20.662V19a2 2 0 0 1 2-2h6a2 2 0 0 1 2 2v1.662" />
+              </svg>
+            </div>
+            <ul
+              tabindex="-1"
+              class="dropdown-content menu bg-base-100 rounded-box z-50 w-52 p-2 shadow-sm"
             >
-          </li>
+              <li>
-        </ul>
+                <a href="{{ meta.user.url }}" id="accountbutton">Settings</a>
+              </li>
+              <li>
+                <form
+                  id="logoutForm"
+                  action="{% url 'logout' %}"
+                  method="post"
+                  style="display: none;"
+                >
+                  {% csrf_token %}
+                  <input type="hidden" name="logout" value="true" />
+                </form>
+                <a
+                  href="#"
+                  id="logoutButton"
+                  onclick="event.preventDefault(); document.getElementById('logoutForm').submit();"
+                  >Logout</a
+                >
+              </li>
+            </ul>
+          </div>
+        {% endif %}
       </div>
     </div>
-  {% endif %}
+  </div>
-
+  {# Mobile drawer menu - slides in from the left #}
-  <div class="navbar-end">
+  <div class="drawer-side">
-    {% if not public_mode %}
+    <label for="drawer-toggle" class="drawer-overlay"></label>
-      <a id="search-trigger" role="button" class="cursor-pointer">
+    <ul class="menu min-h-full w-80 bg-base-200 p-4 text-base-content">
-        <div
+      {# Drawer header with close button #}
-          class="badge badge-dash bg-base-200 text-base-content/50 m-1 flex items-center space-x-1 p-2"
+      <li class="mb-4">
-        >
+        <div class="flex items-center justify-between">
-          <svg
+          <span class="font-bold text-lg">Menu</span>
-            xmlns="http://www.w3.org/2000/svg"
+          <label
-            width="16"
+            for="drawer-toggle"
-            height="16"
+            class="btn btn-sm btn-circle btn-ghost"
-            viewBox="0 0 24 24"
+            aria-label="Close menu"
-            fill="none"
-            stroke="currentColor"
-            stroke-width="2"
-            stroke-linecap="round"
-            stroke-linejoin="round"
-            class="lucide lucide-search-icon lucide-search"
           >
-            <path d="m21 21-4.34-4.34" />
+            <svg
-            <circle cx="11" cy="11" r="8" />
+              xmlns="http://www.w3.org/2000/svg"
-          </svg>
+              class="h-6 w-6"
-          <span id="search-shortcut">⌘K</span>
+              fill="none"
+              viewBox="0 0 24 24"
+              stroke="currentColor"
+            >
+              <path
+                stroke-linecap="round"
+                stroke-linejoin="round"
+                stroke-width="2"
+                d="M6 18L18 6M6 6l12 12"
+              />
+            </svg>
+          </label>
         </div>
-      </a>
+      </li>
-    {% endif %}
+      {% if not public_mode %}
-    {% if meta.user.username == 'anonymous' or public_mode %}
+        {# Predict link #}
-      <a href="{% url 'login' %}" id="loginButton" class="p-2">Login</a>
+        <li>
-    {% else %}
+          <a
-      <div class="dropdown dropdown-end">
+            href="{{ meta.server_url }}/predict"
-        <div
+            class="text-lg"
-          tabindex="0"
+            id="predictLinkMobile"
-          role="button"
+            >Predict</a
-          class="btn btn-ghost btn-circle m-1"
-          id="loggedInButton"
-        >
-          <svg
-            xmlns="http://www.w3.org/2000/svg"
-            width="24"
-            height="24"
-            viewBox="0 0 24 24"
-            fill="none"
-            stroke="currentColor"
-            stroke-width="2"
-            stroke-linecap="round"
-            stroke-linejoin="round"
-            class="lucide lucide-circle-user-icon lucide-circle-user"
           >
-            <circle cx="12" cy="12" r="10" />
+        </li>
-            <circle cx="12" cy="10" r="3" />
+        {# Browse menu with submenu #}
-            <path d="M7 20.662V19a2 2 0 0 1 2-2h6a2 2 0 0 1 2 2v1.662" />
+        <li>
-          </svg>
+          <details>
-        </div>
+            <summary class="text-lg">Browse</summary>
-        <ul
+            <ul>
-          tabindex="-1"
+              <li>
-          class="dropdown-content menu bg-base-100 rounded-box z-50 w-52 p-2 shadow-sm"
+                <a href="{{ meta.server_url }}/package" id="packageLinkMobile"
-        >
+                  >Package</a
-          <li><a href="{{ meta.user.url }}" id="accountbutton">Settings</a></li>
+                >
-          <li>
+              </li>
-            <form
+              <li>
-              id="logoutForm"
+                <a href="{{ meta.server_url }}/pathway" id="pathwayLinkMobile"
-              action="{% url 'logout' %}"
+                  >Pathway</a
-              method="post"
+                >
-              style="display: none;"
+              </li>
-            >
+              <li>
-              {% csrf_token %}
+                <a href="{{ meta.server_url }}/rule" id="ruleLinkMobile"
-              <input type="hidden" name="logout" value="true" />
+                  >Rule</a
-            </form>
+                >
-            <a
+              </li>
-              href="#"
+              <li>
-              id="logoutButton"
+                <a href="{{ meta.server_url }}/compound" id="compoundLinkMobile"
-              onclick="event.preventDefault(); document.getElementById('logoutForm').submit();"
+                  >Compound</a
-              >Logout</a
+                >
-            >
+              </li>
-          </li>
+              <li>
-        </ul>
+                <a href="{{ meta.server_url }}/reaction" id="reactionLinkMobile"
-      </div>
+                  >Reaction</a
-    {% endif %}
+                >
+              </li>
+              <li>
+                <a
+                  href="{{ meta.server_url }}/model"
+                  id="relative-reasoningLinkMobile"
+                  >Model</a
+                >
+              </li>
+              <li>
+                <a href="{{ meta.server_url }}/scenario" id="scenarioLinkMobile"
+                  >Scenario</a
+                >
+              </li>
+            </ul>
+          </details>
+        </li>
+      {% endif %}
+    </ul>
   </div>
 </div>
 

templates/index/index.html

@@ -9,7 +9,7 @@
     >
       <div class="hero-overlay"></div>
       <!-- Predict Pathway text over the image -->
-      <div class="absolute bottom-40 left-1/8 z-10 -translate-x-8">
+      <div class="absolute bottom-40 left-1/8 -translate-x-8">
         <h2 class="text-base-100 text-left text-3xl text-shadow-lg">
           Predict Your Pathway
         </h2>
@@ -20,16 +20,68 @@
   <div class="bg-base-200 mx-auto max-w-5xl shadow-md">
     <!-- Predict Pathway Section -->
     <div
-      class="relative z-20 mx-auto -mt-32 mb-10 w-full flex-col lg:flex-row-reverse"
+      class="relative mx-auto -mt-32 mb-10 w-full flex-col lg:flex-row-reverse"
     >
       <div
         class="card bg-base-100 mx-auto w-3/4 shrink-0 shadow-xl transition-all duration-300 ease-in-out"
+        x-data="{
+          drawMode: false,
+          smiles: '',
+          loadExample(smilesStr, linkEl) {
+            if (this.drawMode && window.indexKetcher && window.indexKetcher.setMolecule) {
+              window.indexKetcher.setMolecule(smilesStr);
+            } else {
+              this.smiles = smilesStr;
+            }
+            const original = linkEl.textContent;
+            linkEl.textContent = 'loaded!';
+            setTimeout(() => linkEl.textContent = original, 1000);
+          },
+          syncFromKetcher() {
+            const ketcher = getKetcherInstance('index-ketcher');
+            if (ketcher && ketcher.getSmiles) {
+              try {
+                const s = ketcher.getSmiles();
+                if (s && s.trim()) this.smiles = s;
+              } catch (err) {
+                console.error('Failed to sync from Ketcher:', err);
+              }
+            }
+          },
+          submitForm() {
+            let finalSmiles = '';
+            if (this.drawMode) {
+              const ketcher = getKetcherInstance('index-ketcher');
+              if (ketcher && ketcher.getSmiles) {
+                try {
+                  finalSmiles = ketcher.getSmiles().trim();
+                } catch (err) {
+                  console.error('Failed to get SMILES from Ketcher:', err);
+                  alert('Unable to extract structure. Please try again or switch to SMILES input.');
+                  return;
+                }
+              } else {
+                alert('The drawing editor is still loading. Please wait and try again.');
+                return;
+              }
+            } else {
+              finalSmiles = this.smiles.trim();
+            }
+            if (!finalSmiles) {
+              alert('Please enter a SMILES string or draw a structure.');
+              return;
+            }
+            document.getElementById('index-form-smiles').value = finalSmiles;
+            document.getElementById('index-form').submit();
+          }
+        }"
+        x-init="$watch('drawMode', value => { if (!value) syncFromKetcher(); })"
       >
         <div class="card-body">
           <div class="my-4 ml-8 flex h-fit flex-row items-center justify-start">
             <div class="flex items-center gap-1">
               <label class="swap btn btn-ghost btn-sm p-1" title="Input Mode">
-                <input type="checkbox" />
+                <input type="checkbox" x-model="drawMode" />
                 <span class="swap-on flex items-center gap-1">
                   <div
                     class="bg-neutral/50 text-neutral-content flex items-center justify-center rounded-full p-1"
@@ -82,16 +134,24 @@
 
           <fieldset
             class="fieldset overflow-hidden transition-all duration-300 ease-in-out"
+            :class="drawMode ? 'p-4' : 'p-8'"
           >
             <form
               id="index-form"
               action="{{ meta.current_package.url }}/pathway"
               method="POST"
+              @submit.prevent="submitForm()"
             >
               {% csrf_token %}
               <div
                 id="text-input-container"
-                class="scale-100 transform opacity-100 transition-all duration-300 ease-in-out"
+                x-show="!drawMode"
+                x-transition:enter="transition ease-out duration-300"
+                x-transition:enter-start="opacity-0 scale-95"
+                x-transition:enter-end="opacity-100 scale-100"
+                x-transition:leave="transition ease-in duration-300"
+                x-transition:leave-start="opacity-100 scale-100"
+                x-transition:leave-end="opacity-0 scale-95"
               >
                 <div class="join mx-auto w-full">
                   <input
@@ -99,6 +159,7 @@
                     id="index-form-text-input"
                     placeholder="canonical SMILES string"
                     class="input input-md join-item grow"
+                    x-model="smiles"
                   />
                   <button class="btn btn-neutral join-item">Predict!</button>
                 </div>
@@ -107,15 +168,15 @@
                     <a
                       href="#"
                       class="example-link hover:text-primary cursor-pointer"
-                      data-smiles="CN1C=NC2=C1C(=O)N(C(=O)N2C)C"
                       title="load example"
+                      @click.prevent="loadExample('CN1C=NC2=C1C(=O)N(C(=O)N2C)C', $el)"
                       >Caffeine</a
                     >
                     <a
                       href="#"
                       class="example-link hover:text-primary cursor-pointer"
-                      data-smiles="CC(C)CC1=CC=C(C=C1)C(C)C(=O)O"
                       title="load example"
+                      @click.prevent="loadExample('CC(C)CC1=CC=C(C=C1)C(C)C(=O)O', $el)"
                       >Ibuprofen</a
                     >
                   </div>
@@ -128,7 +189,14 @@
               </div>
               <div
                 id="ketcher-container"
-                class="hidden w-full scale-95 transform opacity-0 transition-all duration-300 ease-in-out"
+                x-show="drawMode"
+                x-transition:enter="transition ease-out duration-300"
+                x-transition:enter-start="opacity-0 scale-95"
+                x-transition:enter-end="opacity-100 scale-100"
+                x-transition:leave="transition ease-in duration-300"
+                x-transition:leave-start="opacity-100 scale-100"
+                x-transition:leave-end="opacity-0 scale-95"
+                class="w-full"
               >
                 <iframe
                   id="index-ketcher"
@@ -337,166 +405,20 @@
     // Make render function globally available
     window.renderDiscourseTopics = renderDiscourseTopics;
 
-    // Toggle functionality with smooth animations
+    // Ketcher iframe load handler - set up change event to sync SMILES
-    function toggleInputMode() {
+    document.addEventListener("DOMContentLoaded", function () {
-      const toggle = $('input[type="checkbox"]');
+      const indexKetcher = document.getElementById("index-ketcher");
-      const textContainer = $("#text-input-container");
+      indexKetcher.addEventListener("load", function () {
-      const ketcherContainer = $("#ketcher-container");
-      const formCard = $(".card");
-      const fieldset = $(".fieldset");
-
-      if (toggle.is(":checked")) {
-        // Draw mode - show Ketcher, hide text input
-        textContainer.addClass("opacity-0 transform scale-95");
-        textContainer.removeClass("opacity-100 transform scale-100");
-
-        // Adjust fieldset padding for Ketcher mode - reduce padding and make more compact
-        fieldset.removeClass("p-8");
-        fieldset.addClass("p-4");
-
-        // Wait for fade out to complete, then hide and show new content
-        setTimeout(() => {
-          textContainer.addClass("hidden");
-          ketcherContainer.removeClass("hidden opacity-0 transform scale-95");
-          ketcherContainer.addClass("opacity-100 transform scale-100");
-
-          // Force re-evaluation of iframe size
-          const iframe = document.getElementById("index-ketcher");
-          if (iframe) {
-            iframe.style.height = "400px";
-          }
-        }, 300);
-      } else {
-        // SMILES mode - show text input, hide Ketcher
-        ketcherContainer.addClass("opacity-0 transform scale-95");
-        ketcherContainer.removeClass("opacity-100 transform scale-100");
-
-        // Restore fieldset padding for text input mode
-        fieldset.removeClass("p-4");
-        fieldset.addClass("p-8");
-
-        // Wait for fade out to complete, then hide and show new content
-        setTimeout(() => {
-          ketcherContainer.addClass("hidden");
-          textContainer.removeClass("hidden opacity-0 transform scale-95");
-          textContainer.addClass("opacity-100 transform scale-100");
-        }, 300);
-
-        // Transfer SMILES from Ketcher to text input if available
-        const ketcher = getKetcherInstance("index-ketcher");
-        if (ketcher && ketcher.getSmiles) {
-          try {
-            const smiles = ketcher.getSmiles();
-            if (smiles && smiles.trim() !== "") {
-              $("#index-form-text-input").val(smiles);
-            }
-          } catch (err) {
-            console.error("Failed to sync Ketcher to text input:", err);
-            // Non-critical error, just log it
-          }
-        }
-      }
-    }
-
-    // Ketcher integration
-    function indexKetcherToTextInput() {
-      $("#index-form-smiles").val(this.ketcher.getSmiles());
-    }
-
-    $(function () {
-      // Initialize fieldset with proper padding
-      $(".fieldset").addClass("p-8");
-
-      // Toggle event listener
-      $('input[type="checkbox"]').on("change", toggleInputMode);
-
-      // Ketcher iframe load handler
-      $("#index-ketcher").on("load", function () {
         const checkKetcherReady = () => {
           const win = this.contentWindow;
           if (win.ketcher && "editor" in win.ketcher) {
             window.indexKetcher = win.ketcher;
-            win.ketcher.editor.event.change.handlers.push({
-              once: false,
-              priority: 0,
-              f: indexKetcherToTextInput,
-              ketcher: win.ketcher,
-            });
           } else {
             setTimeout(checkKetcherReady, 100);
           }
         };
         checkKetcherReady();
       });
-
-      // Handle example link clicks
-      $(".example-link").on("click", function (e) {
-        e.preventDefault();
-        const smiles = $(this).data("smiles");
-        const title = $(this).attr("title");
-
-        // Check if we're in Ketcher mode or text input mode
-        if ($('input[type="checkbox"]').is(":checked")) {
-          // In Ketcher mode - set the SMILES in Ketcher
-          if (window.indexKetcher && window.indexKetcher.setMolecule) {
-            window.indexKetcher.setMolecule(smiles);
-          }
-        } else {
-          // In text input mode - set the SMILES in the text input
-          $("#index-form-text-input").val(smiles);
-        }
-
-        // Show a brief feedback
-        const originalText = $(this).text();
-        $(this).text(`loaded!`);
-        setTimeout(() => {
-          $(this).text(originalText);
-        }, 1000);
-      });
-
-      // Handle form submission on Enter
-      $("#index-form").on("submit", function (e) {
-        e.preventDefault();
-
-        var textSmiles = "";
-
-        // Check if we're in Ketcher mode and extract SMILES
-        if ($('input[type="checkbox"]').is(":checked")) {
-          // Use the robust getter function
-          const ketcher = getKetcherInstance("index-ketcher");
-          if (ketcher && ketcher.getSmiles) {
-            try {
-              textSmiles = ketcher.getSmiles().trim();
-            } catch (err) {
-              console.error("Failed to get SMILES from Ketcher:", err);
-              alert(
-                "Unable to extract structure from the drawing editor. Please try again or switch to SMILES input mode.",
-              );
-              return;
-            }
-          } else {
-            console.warn("Ketcher not available, possibly still loading");
-            alert(
-              "The drawing editor is still loading. Please wait a moment and try again.",
-            );
-            return;
-          }
-        } else {
-          textSmiles = $("#index-form-text-input").val().trim();
-        }
-
-        if (textSmiles === "") {
-          alert("Please enter a SMILES string or draw a structure.");
-          return;
-        }
-
-        $("#index-form-smiles").val(textSmiles);
-        $("#index-form").attr("action", currentPackage + "/pathway");
-        $("#index-form").attr("method", "POST");
-        this.submit();
-      });
-
-      // Discourse topics are now loaded automatically by discourse-api.js
     });
   </script>
 {% endblock main_content %}

templates/modals/cite_modal.html

@@ -1,48 +0,0 @@
-<div
-  class="modal fade bs-modal-lg"
-  id="citemodal"
-  tabindex="-1"
-  role="dialog"
-  aria-labelledby="myLargeModalLabel"
-  aria-hidden="true"
->
-  <div class="modal-dialog modal-lg">
-    <div class="modal-content">
-      <div class="modal-header">
-        <h3>How to cite enviPath</h3>
-      </div>
-      <div class="modal-body">
-        <ol class="list-group list-group-numbered">
-          <li class="list-group-item">
-            Hafner, J., Lorsbach, T., Schmidt, S. <em>et al.</em>
-            <cite
-              >Advancements in biotransformation pathway prediction:
-              enhancements, datasets, and novel functionalities in
-              enviPath.</cite
-            >
-            <a href="https://doi.org/10.1186/s13321-024-00881-6" target="_blank"
-              >J Cheminform 16, 93 (2024)</a
-            >
-          </li>
-          <li class="list-group-item">
-            Wicker, J., Lorsbach, T., Gütlein, M., Schmid, E., Latino, D.,
-            Kramer, S., Fenner, K.
-            <cite
-              >enviPath - The environmental contaminant biotransformation
-              pathway resource</cite
-            >
-            <a href="https://doi.org/10.1093/nar/gkv1229" target="_blank">
-              Nucleic Acids Research, Volume 44, Issue D1, 4 January 2016, Pages
-              D502-D508
-            </a>
-          </li>
-        </ol>
-      </div>
-      <div class="modal-footer">
-        <button type="button" class="btn btn-default" data-dismiss="modal">
-          Close
-        </button>
-      </div>
-    </div>
-  </div>
-</div>

templates/modals/collections/import_legacy_package_modal.html

@@ -1,70 +1,85 @@
-<div
+<dialog
-  class="modal fade"
-  tabindex="-1"
   id="import_legacy_package_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="import_legacy_package_modal"
+  x-data="modalForm()"
-  aria-hidden="true"
+  @close="reset()"
 >
-  <div class="modal-dialog">
+  <div class="modal-box">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Import Package from Legacy System</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h4 class="modal-title">Import Package from legacy System</h4>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-body">
+      >
-        <p>Create a Package based on the JSON Export of the legacy system.</p>
+        ✕
-        <form
+      </button>
-          id="import-legacy-package-modal-form"
+    </form>
-          accept-charset="UTF-8"
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-          enctype="multipart/form-data"
+      <p class="mb-4">
-        >
+        Create a Package based on the JSON Export of the legacy system.
-          {% csrf_token %}
+      </p>
-          <p>
+      <form
-            <label class="btn btn-primary" for="legacyJsonFile">
+        id="import-legacy-package-modal-form"
-              <input
+        accept-charset="UTF-8"
-                id="legacyJsonFile"
+        method="post"
-                name="file"
+        enctype="multipart/form-data"
-                type="file"
+      >
-                style="display:none;"
+        {% csrf_token %}
-                onchange="$('#upload-legacy-file-info').html(this.files[0].name)"
+        <div class="form-control">
-              />
+          <label class="label">
-              Choose JSON File
+            <span class="label-text">Legacy JSON File</span>
-            </label>
+          </label>
-            <span class="label label-info" id="upload-legacy-file-info"></span>
+          <input
-            <input
+            type="file"
-              type="hidden"
+            id="legacyJsonFile"
-              value="import-legacy-package-json"
+            name="file"
-              name="hidden"
+            class="file-input file-input-bordered w-full"
-              readonly=""
+            accept=".json"
-            />
+            required
-          </p>
+          />
-        </form>
+        </div>
-      </div>
+        <input
-      <div class="modal-footer">
+          type="hidden"
-        <a
+          value="import-legacy-package-json"
-          id="import-legacy-package-modal-form-submit"
+          name="hidden"
-          class="btn btn-primary"
+          readonly
-          href="#"
+        />
-          >Submit</a
+      </form>
-        >
+    </div>
-        <button type="button" class="btn btn-default" data-dismiss="modal">
+
-          Cancel
+    <!-- Footer -->
-        </button>
+    <div class="modal-action">
-      </div>
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('import-legacy-package-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Importing...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#import-legacy-package-modal-form-submit").on("click", function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#import-legacy-package-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/collections/import_package_modal.html

@@ -1,70 +1,83 @@
-<div
+<dialog
-  class="modal fade"
-  tabindex="-1"
   id="import_package_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="import_package_modal"
+  x-data="modalForm()"
-  aria-hidden="true"
+  @close="reset()"
 >
-  <div class="modal-dialog">
+  <div class="modal-box">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Import Package</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h4 class="modal-title">Import Package</h4>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-body">
+      >
-        <p>Create a Package based on a JSON Export.</p>
+        ✕
-        <form
+      </button>
-          id="import-package-modal-form"
+    </form>
-          accept-charset="UTF-8"
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-          enctype="multipart/form-data"
+      <p class="mb-4">Create a Package based on a JSON Export.</p>
-        >
+      <form
-          {% csrf_token %}
+        id="import-package-modal-form"
-          <p>
+        accept-charset="UTF-8"
-            <label class="btn btn-primary" for="jsonFile">
+        method="post"
-              <input
+        enctype="multipart/form-data"
-                id="jsonFile"
+      >
-                name="file"
+        {% csrf_token %}
-                type="file"
+        <div class="form-control">
-                style="display:none;"
+          <label class="label">
-                onchange="$('#upload-file-info').html(this.files[0].name)"
+            <span class="label-text">JSON File</span>
-              />
+          </label>
-              Choose JSON File
+          <input
-            </label>
+            type="file"
-            <span class="label label-info" id="upload-file-info"></span>
+            id="jsonFile"
-            <input
+            name="file"
-              type="hidden"
+            class="file-input file-input-bordered w-full"
-              value="import-package-json"
+            accept=".json"
-              name="hidden"
+            required
-              readonly=""
+          />
-            />
+        </div>
-          </p>
+        <input
-        </form>
+          type="hidden"
-      </div>
+          value="import-package-json"
-      <div class="modal-footer">
+          name="hidden"
-        <a
+          readonly
-          id="import-package-modal-form-submit"
+        />
-          class="btn btn-primary"
+      </form>
-          href="#"
+    </div>
-          >Submit</a
+
-        >
+    <!-- Footer -->
-        <button type="button" class="btn btn-default" data-dismiss="modal">
+    <div class="modal-action">
-          Cancel
+      <button
-        </button>
+        type="button"
-      </div>
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('import-package-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Importing...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#import-package-modal-form-submit").on("click", function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#import-package-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/collections/new_compound_modal.html

@@ -1,119 +1,137 @@
 {% load static %}
-<div
+
-  class="modal fade bs-modal-lg"
+<dialog
   id="new_compound_modal"
-  tabindex="-1"
+  class="modal"
-  aria-labelledby="new_compound_modal"
+  x-data="modalForm()"
-  aria-modal="true"
+  @close="reset()"
-  role="dialog"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-3xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Create a new Compound</h3>
-        <button
+
-          type="button"
+    <!-- Close button (X) -->
-          class="close"
+    <form method="dialog">
-          data-dismiss="modal"
+      <button
-          aria-label="Close"
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-        >
+        :disabled="isSubmitting"
-          <span aria-hidden="true">×</span>
+      >
-        </button>
+        ✕
-        <h4 class="modal-title">Create a new Compound</h4>
+      </button>
-      </div>
+    </form>
-      <div class="modal-body">
+
-        <form
+    <!-- Body -->
-          id="new_compound_modal_form"
+    <div class="py-4">
-          accept-charset="UTF-8"
+      <form
-          action="{% url 'package compound list' meta.current_package.uuid %}"
+        id="new-compound-modal-form"
-          data-remote="true"
+        accept-charset="UTF-8"
-          method="post"
+        action="{% url 'package compound list' meta.current_package.uuid %}"
-        >
+        method="post"
-          {% csrf_token %}
+      >
-          <label for="compound-name">Name</label>
+        {% csrf_token %}
+
+        <div class="form-control mb-3">
+          <label class="label" for="compound-name">
+            <span class="label-text">Name</span>
+          </label>
           <input
             id="compound-name"
-            class="form-control"
+            class="input input-bordered w-full"
             name="compound-name"
             placeholder="Name"
+            required
           />
-          <label for="compound-description">Description</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="compound-description">
+            <span class="label-text">Description</span>
+          </label>
           <input
             id="compound-description"
-            class="form-control"
+            class="input input-bordered w-full"
             name="compound-description"
             placeholder="Description"
           />
-          <label for="compound-smiles">SMILES</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="compound-smiles">
+            <span class="label-text">SMILES</span>
+          </label>
           <input
             type="text"
-            class="form-control"
+            class="input input-bordered w-full"
             name="compound-smiles"
             placeholder="SMILES"
             id="compound-smiles"
           />
-          <p></p>
+        </div>
-          <div>
+
-            <iframe
+        <div class="mb-3">
-              id="new_compound_ketcher"
+          <iframe
-              src="{% static '/js/ketcher2/ketcher.html' %}"
+            id="new_compound_ketcher"
-              width="100%"
+            src="{% static '/js/ketcher2/ketcher.html' %}"
-              height="510"
+            width="100%"
-            ></iframe>
+            height="510"
-          </div>
+          ></iframe>
-          <p></p>
+        </div>
-        </form>
+      </form>
-      </div>
+    </div>
-      <div class="modal-footer">
+
-        <button
+    <!-- Footer -->
-          type="button"
+    <div class="modal-action">
-          class="btn btn-secondary pull-left"
+      <button
-          data-dismiss="modal"
+        type="button"
-        >
+        class="btn"
-          Close
+        onclick="this.closest('dialog').close()"
-        </button>
+        :disabled="isSubmitting"
-        <button
+      >
-          type="button"
+        Close
-          class="btn btn-primary"
+      </button>
-          id="new_compound_modal_form_submit"
+      <button
-        >
+        type="button"
-          Submit
+        class="btn btn-primary"
-        </button>
+        @click="submit('new-compound-modal-form')"
-      </div>
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Creating...</span>
+      </button>
     </div>
   </div>
-</div>
-<script>
-  function newCompoundModalketcherToNewCompoundModalTextInput() {
-    $("#compound-smiles").val(this.ketcher.getSmiles());
-  }
 
-  $(function () {
+  <!-- Backdrop -->
-    $("#new_compound_ketcher").on("load", function () {
+  <form method="dialog" class="modal-backdrop">
+    <button :disabled="isSubmitting">close</button>
+  </form>
+</dialog>
+
+<script>
+  document
+    .getElementById("new_compound_ketcher")
+    .addEventListener("load", function () {
+      const iframe = this;
       const checkKetcherReady = () => {
-        win = this.contentWindow;
+        const win = iframe.contentWindow;
         if (win.ketcher && "editor" in win.ketcher) {
           win.ketcher.editor.event.change.handlers.push({
             once: false,
             priority: 0,
-            f: newCompoundModalketcherToNewCompoundModalTextInput,
+            f: function () {
+              document.getElementById("compound-smiles").value =
+                this.ketcher.getSmiles();
+            },
             ketcher: win.ketcher,
           });
         } else {
           setTimeout(checkKetcherReady, 100);
         }
       };
-
       checkKetcherReady();
     });
-
-    $(function () {
-      $("#new_compound_modal_form_submit").on("click", function (e) {
-        e.preventDefault();
-        $(this).prop("disabled", true);
-
-        // submit form
-        $("#new_compound_modal_form").submit();
-      });
-    });
-  });
 </script>

templates/modals/collections/new_group_modal.html

@@ -1,70 +1,96 @@
-<div
+{% load static %}
-  class="modal fade"
+
-  tabindex="-1"
+<dialog
   id="new_group_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="new_group_modal"
+  x-data="modalForm()"
-  aria-hidden="true"
+  @close="reset()"
 >
-  <div class="modal-dialog">
+  <div class="modal-box">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="font-bold text-lg">New Group</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h4 class="modal-title">New Group</h4>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-body">
+      >
-        <p>
+        ✕
-          Create new Group. You can assign users to the group once it is
+      </button>
-          created. Description can be changed after creation.
+    </form>
-        </p>
+
-        <form
+    <!-- Body -->
-          id="new_group_modal_form"
+    <div class="py-4">
-          accept-charset="UTF-8"
+      <p class="mb-4">
-          action="{{ SERVER_BASE }}/group"
+        Create new Group. You can assign users to the group once it is created.
-          data-remote="true"
+        Description can be changed after creation.
-          method="post"
+      </p>
-        >
+
-          {% csrf_token %}
+      <form
-          <p>
+        id="new-group-modal-form"
-            <label for="name">Name</label>
+        accept-charset="UTF-8"
-            <input
+        action="{{ SERVER_BASE }}/group"
-              id="name"
+        method="post"
-              type="text"
+      >
-              name="group-name"
+        {% csrf_token %}
-              class="form-control"
+
-              placeholder="Name"
+        <div class="form-control mb-3">
-            />
+          <label class="label" for="group-name">
-          </p>
+            <span class="label-text">Name</span>
-          <p>
+          </label>
-            <label for="description">Description</label>
+          <input
-            <input
+            id="group-name"
-              id="description"
+            class="input input-bordered w-full"
-              type="text"
+            name="group-name"
-              class="form-control"
+            placeholder="Name"
-              placeholder="Description..."
+            required
-              name="group-description"
+          />
-            />
+        </div>
-          </p>
+
-        </form>
+        <div class="form-control mb-3">
-      </div>
+          <label class="label" for="group-description">
-      <div class="modal-footer">
+            <span class="label-text">Description</span>
-        <a id="new_group_modal_form_submit" class="btn btn-primary" href="#"
+          </label>
-          >Submit</a
+          <input
-        >
+            id="group-description"
-        <button type="button" class="btn btn-default" data-dismiss="modal">
+            type="text"
-          Cancel
+            class="input input-bordered w-full"
-        </button>
+            placeholder="Description..."
-      </div>
+            name="group-description"
+          />
+        </div>
+      </form>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('new-group-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Creating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#new_group_modal_form_submit").on("click", function () {
+    <button :disabled="isSubmitting">close</button>
-      $("#new_group_modal_form").submit();
+  </form>
-    });
+</dialog>
-  });
-</script>

templates/modals/collections/new_model_modal.html

@@ -1,30 +1,66 @@
-<div
+<dialog
-  class="modal fade"
-  tabindex="-1"
   id="new_model_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="new_model_modal"
+  x-data="{
-  aria-hidden="true"
+    isSubmitting: false,
+    modelType: '',
+    buildAppDomain: false,
+
+    reset() {
+      this.isSubmitting = false;
+      this.modelType = '';
+      this.buildAppDomain = false;
+    },
+
+    get showMlrr() {
+      return this.modelType === 'mlrr';
+    },
+
+    get showRbrr() {
+      return this.modelType === 'rbrr';
+    },
+
+    get showEnviformer() {
+      return this.modelType === 'enviformer';
+    },
+
+    submit(formId) {
+      const form = document.getElementById(formId);
+      if (form && form.checkValidity()) {
+        this.isSubmitting = true;
+        form.submit();
+      } else if (form) {
+        form.reportValidity();
+      }
+    }
+  }"
+  @close="reset()"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-3xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">New Model</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h4 class="modal-title">New Model</h4>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-body">
+      >
-        <form
+        ✕
-          id="new_model_form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action="{{ meta.current_package.url }}/model"
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          {% csrf_token %}
+        id="new_model_form"
-          <div class="jumbotron">
+        accept-charset="UTF-8"
+        action="{{ meta.current_package.url }}/model"
+        method="post"
+      >
+        {% csrf_token %}
+        <div class="alert alert-info mb-4">
+          <span>
             Create a new Model to limit the number of degradation products in
             the prediction. You just need to set a name and the packages you
             want the object to be based on. There are multiple types of models
@@ -32,239 +68,270 @@
             <a
               target="_blank"
               href="https://wiki.envipath.org/index.php/relative-reasoning"
-              role="button"
+              class="link"
               >wiki &gt;&gt;</a
             >
-          </div>
+          </span>
-          <!-- Name -->
+        </div>
-          <label for="model-name">Name</label>
+
+        <!-- Name -->
+        <div class="form-control mb-3">
+          <label class="label" for="model-name">
+            <span class="label-text">Name</span>
+          </label>
           <input
             id="model-name"
             name="model-name"
-            class="form-control"
+            class="input input-bordered w-full"
             placeholder="Name"
+            required
           />
+        </div>
 
-          <!-- Description -->
+        <!-- Description -->
-          <label for="model-description">Description</label>
+        <div class="form-control mb-3">
+          <label class="label" for="model-description">
+            <span class="label-text">Description</span>
+          </label>
           <input
             id="model-description"
             name="model-description"
-            class="form-control"
+            class="input input-bordered w-full"
             placeholder="Description"
           />
+        </div>
 
-          <!-- Model Type -->
+        <!-- Model Type -->
-          <label for="model-type">Model Type</label>
+        <div class="form-control mb-3">
+          <label class="label" for="model-type">
+            <span class="label-text">Model Type</span>
+          </label>
           <select
             id="model-type"
             name="model-type"
-            class="form-control"
+            class="select select-bordered w-full"
-            data-width="100%"
+            x-model="modelType"
+            required
           >
-            <option disabled selected>Select Model Type</option>
+            <option value="" disabled selected>Select Model Type</option>
             {% for k, v in model_types.items %}
               <option value="{{ v }}">{{ k }}</option>
             {% endfor %}
           </select>
+        </div>
 
-          <!-- Rule Packages -->
+        <!-- Rule Packages (MLRR, RBRR) -->
-          <div id="rule-packages" class="ep-model-param mlrr rbrr">
+        <div class="form-control mb-3" x-show="showMlrr || showRbrr" x-cloak>
-            <label for="model-rule-packages">Rule Packages</label>
+          <label class="label" for="model-rule-packages">
-            <select
+            <span class="label-text">Rule Packages</span>
-              id="model-rule-packages"
+          </label>
-              name="model-rule-packages"
+          <select
-              data-actions-box="true"
+            id="model-rule-packages"
-              class="form-control"
+            name="model-rule-packages"
-              multiple
+            class="select select-bordered w-full h-32"
-              data-width="100%"
+            multiple
-            >
+          >
-              <option disabled>Reviewed Packages</option>
+            <optgroup label="Reviewed Packages">
               {% for obj in meta.readable_packages %}
                 {% if obj.reviewed %}
                   <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
                 {% endif %}
               {% endfor %}
-
+            </optgroup>
-              <option disabled>Unreviewed Packages</option>
+            <optgroup label="Unreviewed Packages">
               {% for obj in meta.readable_packages %}
                 {% if not obj.reviewed %}
                   <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
                 {% endif %}
               {% endfor %}
-            </select>
+            </optgroup>
-          </div>
+          </select>
+          <label class="label">
+            <span class="label-text-alt">Hold Ctrl/Cmd to select multiple</span>
+          </label>
+        </div>
 
-          <!-- Data Packages -->
+        <!-- Data Packages (MLRR, RBRR, Enviformer) -->
-          <div id="data-packages" class="ep-model-param mlrr rbrr enviformer">
+        <div
-            <label for="model-data-packages">Data Packages</label>
+          class="form-control mb-3"
-            <select
+          x-show="showMlrr || showRbrr || showEnviformer"
-              id="model-data-packages"
+          x-cloak
-              name="model-data-packages"
+        >
-              data-actions-box="true"
+          <label class="label" for="model-data-packages">
-              class="form-control"
+            <span class="label-text">Data Packages</span>
-              multiple
+          </label>
-              data-width="100%"
+          <select
-            >
+            id="model-data-packages"
-              <option disabled>Reviewed Packages</option>
+            name="model-data-packages"
+            class="select select-bordered w-full h-32"
+            multiple
+          >
+            <optgroup label="Reviewed Packages">
               {% for obj in meta.readable_packages %}
                 {% if obj.reviewed %}
                   <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
                 {% endif %}
               {% endfor %}
-
+            </optgroup>
-              <option disabled>Unreviewed Packages</option>
+            <optgroup label="Unreviewed Packages">
               {% for obj in meta.readable_packages %}
                 {% if not obj.reviewed %}
                   <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
                 {% endif %}
               {% endfor %}
-            </select>
+            </optgroup>
-          </div>
+          </select>
+          <label class="label">
+            <span class="label-text-alt">Hold Ctrl/Cmd to select multiple</span>
+          </label>
+        </div>
 
-          <!-- Fingerprinter -->
+        <!-- Fingerprinter (MLRR) -->
-          <div id="fingerprinter" class="ep-model-param mlrr">
+        <div class="form-control mb-3" x-show="showMlrr" x-cloak>
-            <label for="model-fingerprinter">Fingerprinter</label>
+          <label class="label" for="model-fingerprinter">
-            <select
+            <span class="label-text">Fingerprinter</span>
-              id="model-fingerprinter"
+          </label>
-              name="model-fingerprinter"
+          <select
-              data-actions-box="true"
+            id="model-fingerprinter"
-              class="form-control"
+            name="model-fingerprinter"
-              multiple
+            class="select select-bordered w-full h-32"
-              data-width="100%"
+            multiple
-            >
+          >
-              <option value="MACCS" selected>MACCS Fingerprinter</option>
+            <option value="MACCS" selected>MACCS Fingerprinter</option>
-              {% if meta.enabled_features.PLUGINS and additional_descriptors %}
+            {% if meta.enabled_features.PLUGINS and additional_descriptors %}
-                <option disabled selected>
+              <optgroup label="Additional Fingerprinter / Descriptor">
-                  Select Additional Fingerprinter / Descriptor
-                </option>
                 {% for k, v in additional_descriptors.items %}
                   <option value="{{ v }}">{{ k }}</option>
                 {% endfor %}
-              {% endif %}
+              </optgroup>
-            </select>
+            {% endif %}
-          </div>
+          </select>
+          <label class="label">
+            <span class="label-text-alt">Hold Ctrl/Cmd to select multiple</span>
+          </label>
+        </div>
 
-          <!-- Threshold -->
+        <!-- Threshold (MLRR, Enviformer) -->
-          <div id="threshold" class="ep-model-param mlrr enviformer">
+        <div
-            <label for="model-threshold">Threshold</label>
+          class="form-control mb-3"
-            <input
+          x-show="showMlrr || showEnviformer"
-              type="number"
+          x-cloak
-              min="0"
+        >
-              max="1"
+          <label class="label" for="model-threshold">
-              step="0.05"
+            <span class="label-text">Threshold</span>
-              value="0.5"
+          </label>
-              id="model-threshold"
+          <input
-              name="model-threshold"
+            type="number"
-              class="form-control"
+            min="0"
-            />
+            max="1"
-          </div>
+            step="0.05"
+            value="0.5"
+            id="model-threshold"
+            name="model-threshold"
+            class="input input-bordered w-full"
+          />
+        </div>
 
-          <div id="appdomain" class="ep-model-param mlrr">
+        <!-- Applicability Domain (MLRR) -->
-            {% if meta.enabled_features.APPLICABILITY_DOMAIN %}
+        {% if meta.enabled_features.APPLICABILITY_DOMAIN %}
-              <!-- Build AD? -->
+          <div x-show="showMlrr" x-cloak>
-              <div class="checkbox">
+            <div class="form-control mb-3">
-                <label>
+              <label class="label cursor-pointer justify-start gap-3">
-                  <input
+                <input
-                    type="checkbox"
+                  type="checkbox"
-                    id="build-app-domain"
+                  id="build-app-domain"
-                    name="build-app-domain"
+                  name="build-app-domain"
-                  />Also build an Applicability Domain?
+                  class="checkbox"
+                  x-model="buildAppDomain"
+                />
+                <span class="label-text"
+                  >Also build an Applicability Domain?</span
+                >
+              </label>
+            </div>
+
+            <div x-show="buildAppDomain" x-cloak class="ml-4 space-y-3">
+              <div class="form-control">
+                <label class="label" for="num-neighbors">
+                  <span class="label-text">Number of Neighbors</span>
                 </label>
-              </div>
-              <div id="ad-params" style="display:none">
-                <!-- Num Neighbors -->
-                <label for="num-neighbors">Number of Neighbors</label>
                 <input
                   id="num-neighbors"
                   name="num-neighbors"
                   type="number"
-                  class="form-control"
+                  class="input input-bordered w-full"
                   value="5"
                   step="1"
                   min="0"
                   max="10"
                 />
-                <!-- Local Compatibility -->
+              </div>
-                <label for="local-compatibility-threshold"
+
-                  >Local Compatibility Threshold</label
+              <div class="form-control">
-                >
+                <label class="label" for="local-compatibility-threshold">
+                  <span class="label-text">Local Compatibility Threshold</span>
+                </label>
                 <input
                   id="local-compatibility-threshold"
                   name="local-compatibility-threshold"
                   type="number"
-                  class="form-control"
+                  class="input input-bordered w-full"
-                  value="0.5"
-                  step="0.01"
-                  min="0"
-                  max="1"
-                />
-                <!-- Reliability -->
-                <label for="reliability-threshold">Reliability Threshold</label>
-                <input
-                  id="reliability-threshold"
-                  name="reliability-threshold"
-                  type="number"
-                  class="form-control"
                   value="0.5"
                   step="0.01"
                   min="0"
                   max="1"
                 />
               </div>
-            {% endif %}
+
+              <div class="form-control">
+                <label class="label" for="reliability-threshold">
+                  <span class="label-text">Reliability Threshold</span>
+                </label>
+                <input
+                  id="reliability-threshold"
+                  name="reliability-threshold"
+                  type="number"
+                  class="input input-bordered w-full"
+                  value="0.5"
+                  step="0.01"
+                  min="0"
+                  max="1"
+                />
+              </div>
+            </div>
           </div>
-        </form>
+        {% endif %}
-      </div>
+      </form>
-      <div class="modal-footer">
+    </div>
-        <a id="new_model_modal_form_submit" class="btn btn-primary" href="#"
+
-          >Submit</a
+    <!-- Footer -->
-        >
+    <div class="modal-action">
-        <button type="button" class="btn btn-default" data-dismiss="modal">
+      <button
-          Cancel
+        type="button"
-        </button>
+        class="btn"
-      </div>
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('new_model_form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Creating...</span>
+      </button>
     </div>
   </div>
-</div>
 
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    // Built in Model Types
+    <button :disabled="isSubmitting">close</button>
-    var nativeModelTypes = ["mlrr", "rbrr", "enviformer"];
+  </form>
-
+</dialog>
-    // Initially hide all "specific" forms
-    $(".ep-model-param").each(function () {
-      $(this).hide();
-    });
-
-    $("#model-type").selectpicker();
-    $("#model-fingerprinter").selectpicker();
-    $("#model-rule-packages").selectpicker();
-    $("#model-data-packages").selectpicker();
-
-    $("#build-app-domain").change(function () {
-      if ($(this).is(":checked")) {
-        $("#ad-params").show();
-      } else {
-        $("#ad-params").hide();
-      }
-    });
-
-    // On change hide all and show only selected
-    $("#model-type").change(function () {
-      $(".ep-model-param").hide();
-      var modelType = $("#model-type").val();
-      if (nativeModelTypes.indexOf(modelType) !== -1) {
-        $("." + modelType).show();
-      } else {
-        // do nothing
-      }
-    });
-
-    $("#new_model_modal_form_submit").on("click", function (e) {
-      e.preventDefault();
-      $("#new_model_form").submit();
-    });
-  });
-</script>

templates/modals/collections/new_package_modal.html

@@ -1,68 +1,93 @@
-<div
+{% load static %}
-  class="modal fade"
+
-  tabindex="-1"
+<dialog
   id="new_package_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="new_package_modal"
+  x-data="modalForm()"
-  aria-hidden="true"
+  @close="reset()"
 >
-  <div class="modal-dialog">
+  <div class="modal-box">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="font-bold text-lg">New Package</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h4 class="modal-title">New Package</h4>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-body">
+      >
-        <p>Create new package. Description can be changed later.</p>
+        ✕
-        <form
+      </button>
-          id="new_package_modal_form"
+    </form>
-          accept-charset="UTF-8"
+
-          action=""
+    <!-- Body -->
-          data-remote="true"
+    <div class="py-4">
-          method="post"
+      <p class="mb-4">Create new package. Description can be changed later.</p>
-        >
+
-          {% csrf_token %}
+      <form
-          <p>
+        id="new-package-modal-form"
-            <label for="name">Name</label>
+        accept-charset="UTF-8"
-            <input
+        action=""
-              id="name"
+        method="post"
-              class="form-control"
+      >
-              name="package-name"
+        {% csrf_token %}
-              placeholder="Name"
+
-            />
+        <div class="form-control mb-3">
-          </p>
+          <label class="label" for="package-name">
-          <p>
+            <span class="label-text">Name</span>
-            <label for="description">Description</label>
+          </label>
-            <input
+          <input
-              id="description"
+            id="package-name"
-              type="text"
+            class="input input-bordered w-full"
-              rows="3"
+            name="package-name"
-              class="form-control"
+            placeholder="Name"
-              placeholder="Description..."
+            required
-              name="package-description"
+          />
-            />
+        </div>
-          </p>
+
-        </form>
+        <div class="form-control mb-3">
-      </div>
+          <label class="label" for="package-description">
-      <div class="modal-footer">
+            <span class="label-text">Description</span>
-        <a id="new_package_modal_form_submit" class="btn btn-primary" href="#"
+          </label>
-          >Submit</a
+          <input
-        >
+            id="package-description"
-        <button type="button" class="btn btn-default" data-dismiss="modal">
+            type="text"
-          Cancel
+            class="input input-bordered w-full"
-        </button>
+            placeholder="Description..."
-      </div>
+            name="package-description"
+          />
+        </div>
+      </form>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('new-package-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Creating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#new_package_modal_form_submit").on("click", function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#new_package_modal_form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/collections/new_pathway_modal.html

@@ -1,376 +0,0 @@
-{% load static %}
-<div
-  class="modal fade"
-  tabindex="-1"
-  id="new_pathway_modal"
-  role="dialog"
-  aria-labelledby="new_pathway_modal"
-  aria-hidden="true"
-  style="overflow-y: auto;"
->
-  <!-- FIXME: make width dynamic-->
-  <div class="modal-dialog" id="new_pathway_modal_dialog" style="width:900px">
-    <div class="modal-content">
-      <div class="modal-header">
-        <button type="button" class="close" data-dismiss="modal">
-          <span aria-hidden="true">&times;</span>
-          <span class="sr-only">Close</span>
-        </button>
-        <h4 class="js-title-step"></h4>
-      </div>
-      <div class="modal-body hide" data-step="1" data-title="New Pathway">
-        <div class="jumbotron">
-          Create a new pathway by entering the root compound and a name. Then
-          select if you want to use the prediction engine to generate a
-          predicted pathway or create an empty pathway that you fill in by
-          yourself. If you choose to predict a pathway, you can modify the
-          settings for the prediction, or use the default settings and just
-          click Submit.
-        </div>
-        <div class="modal-body">
-          {% if current_user.name == 'anonymous' %}
-            <div class="alert alert-warning">
-              You are currently logged in as Anonymous. Please note: Pathways
-              entered or predicted as anonymous user will be deleted after 30
-              days. Please log in to save your results.
-            </div>
-          {% endif %}
-        </div>
-        <div class="row">
-          <div class="col-md-6">
-            <label for="name">Name</label>
-            <input
-              id="name"
-              class="form-control"
-              name="name"
-              placeholder="Name"
-            />
-            <label for="description">Description</label>
-            <input
-              id="description"
-              class="form-control"
-              name="description"
-              placeholder="no description"
-            />
-          </div>
-
-          <div class="col-md-6">
-            <label for="predict">Predict pathway or build yourself?</label>
-            <div class="radio" id="predict">
-              <p>
-                <label>
-                  <input
-                    type="radio"
-                    name="predict"
-                    id="radioPredict"
-                    value="predict"
-                    checked
-                  />Predict pathway
-                </label>
-              </p>
-              <p>
-                <label>
-                  <input
-                    type="radio"
-                    name="predict"
-                    id="radioIncremental"
-                    value="incremental"
-                  />Incremental prediction
-                </label>
-              </p>
-              <p>
-                <label>
-                  <input
-                    type="radio"
-                    name="predict"
-                    id="radioBuild"
-                    value="build"
-                  />Build pathway
-                </label>
-              </p>
-            </div>
-          </div>
-        </div>
-        <label for="smilesinput">SMILES</label>
-        <table style="width: 100%">
-          <colgroup>
-            <col span="1" style="width: 90%;" />
-            <col span="1" style="width: 10%;" />
-          </colgroup>
-          <tr>
-            <td>
-              <input
-                id="smilesinput"
-                class="form-control"
-                name="smilesinput"
-                placeholder="C1CCCCC1"
-                autocapitalize="none"
-              />
-            </td>
-            <td>
-              <button type="button" class="btn btn-default" id="render-button">
-                Render
-              </button>
-            </td>
-          </tr>
-        </table>
-        <p id="ketcher_container"></p>
-        <div>
-          <iframe
-            id="ifKetcher"
-            src="{% static '/js/ketcher/ketcher.html' %}"
-            width="850"
-            height="510"
-          ></iframe>
-        </div>
-      </div>
-      <div
-        class="modal-body hide"
-        data-step="2"
-        data-title="New Pathway - Advanced Settings"
-      >
-        <div class="jumbotron">
-          Choose if you want to use an existing setting, or create a new one for
-          this pathway prediction. Then click Submit to use the specified
-          setting, or click next to set the parameters.
-        </div>
-        <div id="settings">
-          <div class="radio" id="settingRadio">
-            <p>
-              <label>
-                <input
-                  type="radio"
-                  name="existing"
-                  id="radioDefault"
-                  value="exisiting"
-                  checked
-                />
-                Use Default
-              </label>
-            </p>
-            <p>
-              <label>
-                <input
-                  type="radio"
-                  name="existing"
-                  id="radioExists"
-                  value="exisiting"
-                />
-                Select Existing
-              </label>
-            </p>
-            <p>
-              <label>
-                <input
-                  type="radio"
-                  name="existing"
-                  id="radioNew"
-                  value="temporary"
-                />
-                Create New
-              </label>
-            </p>
-          </div>
-
-          <select id="settingSelect" name="settingSelect" class="form-control">
-            {% for setting in available_settings %}
-              <option value="{{ setting.id }}">{{ setting.name|safe }}</option>
-            {% endfor %}
-          </select>
-          <p></p>
-        </div>
-      </div>
-      {% with step_offset=1 %}
-        {% include "templates/modals/collections/new_setting_modal_body.html" %}
-      {% endwith %}
-      <div class="modal-footer">
-        <button
-          type="button"
-          class="btn btn-default js-btn-step pull-left"
-          data-orientation="cancel"
-          onclick="reset()"
-          data-dismiss="modal"
-        ></button>
-        <button
-          type="button"
-          class="btn btn-default js-btn-step"
-          data-orientation="previous"
-          id="backbutton"
-        ></button>
-        <button
-          type="button"
-          class="btn btn-default js-btn-step"
-          data-orientation="next"
-          id="nextbutton"
-        ></button>
-        <a id="modal-form-submit" class="btn btn-primary" href="#">Submit</a>
-      </div>
-    </div>
-  </div>
-</div>
-
-<script>
-  s = new Setting(
-    "settingName",
-    "package_multi_select",
-    "modelSelect",
-    "cutoff",
-    "evalType",
-    "availableTS",
-    "forms",
-    "truncatorTable",
-    "summaryTable",
-  );
-
-  $(function () {
-    // hide all forms
-    $("#forms").children().hide();
-
-    $("#render-button").on("click", function () {
-      syncKetcherAndTextInput("text", "ifKetcher", "smilesinput");
-    });
-
-    // If theres a change in the in '#smilesinput' sync the value to ketcher
-    $("#smilesinput").on("input", function () {
-      syncKetcherAndTextInput("text", "ifKetcher", "smilesinput");
-    });
-
-    // If theres an update in ketcher sync it to textinput
-    setInterval(function () {
-      syncKetcherAndTextInput("ketcher", "ifKetcher", "smilesinput");
-    }, 250);
-
-    $("#smilesinput").on("blur", function () {
-      syncKetcherAndTextInput("text", "ifKetcher", "smilesinput");
-    });
-
-    $("#smilesinput").on("keypress", function (event) {
-      if (event.keyCode == 13) {
-        syncKetcherAndTextInput("text", "ifKetcher", "smilesinput");
-      }
-    });
-
-    // Show forms depending on the selected TS
-    $("#availableTS").on("change", function (e) {
-      e.preventDefault();
-
-      var type = $(this).val();
-      // hide current content
-      $("#forms").children().hide();
-
-      if (type === "") {
-        return;
-      }
-
-      $("#" + type + "_form").show();
-    });
-
-    $("#modelSelect").on("change", function () {
-      setCutoff = function (thresh) {
-        $("#cutoff").val(thresh);
-      };
-
-      var modelUri = $("#modelSelect :selected").val();
-      fillPRCurve(modelUri, setCutoff);
-    });
-
-    // Add a TS to the setting
-    $("#add-ts-button").on("click", function (e) {
-      e.preventDefault();
-      s.addTruncator();
-    });
-
-    $("input[type=radio][name=predict]").change(function () {
-      if (this.id == "radioBuild") {
-        $("#nextbutton").prop("disabled", true);
-      } else {
-        $("#nextbutton").prop("disabled", false);
-      }
-    });
-
-    $("input[type=radio][name=existing]").change(function () {
-      if (this.id == "radioDefault" || this.id == "radioExists") {
-        if (this.id == "radioDefault") {
-          $("#settingSelect").prop("disabled", true);
-        } else {
-          $("#settingSelect").prop("disabled", false);
-        }
-        $("#nextbutton").prop("disabled", true);
-      } else {
-        // build...
-        $("#settingSelect").prop("disabled", true);
-        $("#nextbutton").prop("disabled", false);
-      }
-    });
-
-    var pwStep1 = function () {
-      console.log("pw step 1");
-      // Make "Next" to "Advanced"
-      $("#nextbutton").val("Advanced");
-    };
-
-    var pwStep2 = function () {
-      console.log("pw step 2");
-      // Make "Advanced" to "Next"
-      $("#nextbutton").val("Next");
-      // As "Use default is preselected" disable "Next" button
-      $("#nextbutton").prop("disabled", true);
-      // Disable setting dropdown as long as the correspndonding radio isnt checked
-      $("#settingSelect").prop("disabled", true);
-      // Show submit button
-      $("#modal-form-submit").show();
-    };
-
-    var settingStep1 = function () {
-      // First step sets name and packages
-      s.extractName();
-      s.extractSelectedPackages();
-    };
-
-    var settingStep2 = function () {
-      // Seconds step gathers relative reasoning params
-      s.extractRelativeReasoning();
-      s.extractCutoff();
-      s.extractEvaluationType();
-    };
-
-    var settingStep3 = function () {
-      s.updateTable();
-      s.updateSummaryTable();
-      // hide duplicate submit...
-      $("#nextbutton").hide();
-    };
-
-    var postPathway = function () {
-      console.log("Complete!");
-      console.log(s.tsParams);
-      console.log("Getting SMILES");
-    };
-
-    function dummy() {
-      console.log("dummy");
-    }
-
-    $("#new_pathway_modal").modalSteps({
-      btnCancelHtml: "Cancel",
-      btnPreviousHtml: "Back",
-      btnNextHtml: "Next",
-      btnLastStepHtml: "Submit",
-      disableNextButton: false,
-      completeCallback: postPathway,
-      callbacks: {
-        1: pwStep1,
-        2: pwStep2,
-        3: dummy,
-        4: settingStep1,
-        5: settingStep2,
-        6: settingStep3,
-      },
-    });
-
-    $("#modal-form-submit").on("click", function () {
-      e.preventDefault();
-      postPathway();
-    });
-  });
-</script>

templates/modals/collections/new_prediction_setting_modal.html

@@ -1,185 +1,260 @@
 {% load static %}
 
-<div id="new_prediction_setting_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="new_prediction_setting_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="{
-        <h5 class="modal-title">Create a Prediction Setting</h5>
+    isSubmitting: false,
-        <button
+    tpMethod: '',
-          type="button"
-          class="close"
-          data-dismiss="modal"
-          aria-label="Close"
-        >
-          <span aria-hidden="true">&times;</span>
-        </button>
-      </div>
-      <div class="modal-body">
-        <p>
-          To create a Prediction Setting fill the form below and click "Create"
-        </p>
-        <form
-          id="new-prediction-setting-modal-form"
-          accept-charset="UTF-8"
-          action=""
-          data-remote="true"
-          method="post"
-        >
-          {% csrf_token %}
 
-          <label for="prediction-setting-name">Name</label>
+    reset() {
+      this.isSubmitting = false;
+      this.tpMethod = '';
+    },
+
+    async submit() {
+      const form = document.getElementById('new-prediction-setting-modal-form');
+      if (!form.checkValidity()) {
+        form.reportValidity();
+        return;
+      }
+
+      this.isSubmitting = true;
+      const formData = new FormData(form);
+
+      try {
+        const response = await fetch('/setting', {
+          method: 'POST',
+          body: new URLSearchParams(formData)
+        });
+        if (response.ok) {
+          location.reload();
+        }
+      } catch (error) {
+        console.error('Error creating setting:', error);
+      } finally {
+        this.isSubmitting = false;
+      }
+    }
+  }"
+  @close="reset()"
+>
+  <div class="modal-box max-w-2xl">
+    <!-- Header -->
+    <h3 class="text-lg font-bold">Create a Prediction Setting</h3>
+
+    <!-- Close button (X) -->
+    <form method="dialog">
+      <button
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <p class="mb-4">
+        To create a Prediction Setting fill the form below and click "Create"
+      </p>
+      <form
+        id="new-prediction-setting-modal-form"
+        accept-charset="UTF-8"
+        action=""
+        method="post"
+      >
+        {% csrf_token %}
+
+        <div class="form-control mb-3">
+          <label class="label" for="prediction-setting-name">
+            <span class="label-text">Name</span>
+          </label>
           <input
             id="prediction-setting-name"
             name="prediction-setting-name"
-            class="form-control"
+            class="input input-bordered w-full"
             placeholder="Name"
+            required
           />
-          <label for="prediction-setting-description">Description</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="prediction-setting-description">
+            <span class="label-text">Description</span>
+          </label>
           <input
             id="prediction-setting-description"
             name="prediction-setting-description"
-            class="form-control"
+            class="input input-bordered w-full"
             placeholder="Description"
           />
+        </div>
 
-          <label for="prediction-setting-max-nodes">Max #Nodes</label>
+        <div class="form-control mb-3">
+          <label class="label" for="prediction-setting-max-nodes">
+            <span class="label-text">Max #Nodes</span>
+          </label>
           <input
             id="prediction-setting-max-nodes"
             type="number"
-            class="form-control"
+            class="input input-bordered w-full"
             name="prediction-setting-max-nodes"
             value="30"
             min="1"
             max="50"
             step="1"
           />
-          <label for="prediction-setting-max-depth">Max Depth</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="prediction-setting-max-depth">
+            <span class="label-text">Max Depth</span>
+          </label>
           <input
             id="prediction-setting-max-depth"
             type="number"
-            class="form-control"
+            class="input input-bordered w-full"
             name="prediction-setting-max-depth"
             value="5"
             min="1"
             max="8"
             step="1"
           />
+        </div>
 
-          <label for="tp-generation-method">TP Generation Method</label>
+        <div class="form-control mb-3">
+          <label class="label" for="tp-generation-method">
+            <span class="label-text">TP Generation Method</span>
+          </label>
           <select
             id="tp-generation-method"
             name="tp-generation-method"
-            class="form-control"
+            class="select select-bordered w-full"
-            data-width="100%"
+            x-model="tpMethod"
+            required
           >
-            <option disabled selected>Select how TPs are generated</option>
+            <option value="" disabled selected>
+              Select how TPs are generated
+            </option>
             <option value="rule-based-prediction-setting">Rule Based</option>
             <option value="model-based-prediction-setting">Model Based</option>
           </select>
-          <div id="rule-based-prediction-setting-specific-form">
+        </div>
-            <!-- Rule Packages -->
+
-            <label>Rule Packages</label><br />
+        <!-- Rule Based Settings -->
+        <div x-show="tpMethod === 'rule-based-prediction-setting'" x-cloak>
+          <div class="form-control mb-3">
+            <label class="label">
+              <span class="label-text">Rule Packages</span>
+            </label>
             <select
               id="rule-based-prediction-setting-packages"
               name="rule-based-prediction-setting-packages"
-              data-actions-box="true"
+              class="select select-bordered w-full h-32"
-              class="form-control"
               multiple
-              data-width="100%"
             >
-              <option disabled>Reviewed Packages</option>
+              <optgroup label="Reviewed Packages">
-              {% for obj in meta.readable_packages %}
+                {% for obj in meta.readable_packages %}
-                {% if obj.reviewed %}
+                  {% if obj.reviewed %}
-                  <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
+                    <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
-                {% endif %}
+                  {% endif %}
-              {% endfor %}
+                {% endfor %}
-
+              </optgroup>
-              <option disabled>Unreviewed Packages</option>
+              <optgroup label="Unreviewed Packages">
-              {% for obj in meta.readable_packages %}
+                {% for obj in meta.readable_packages %}
-                {% if not obj.reviewed %}
+                  {% if not obj.reviewed %}
-                  <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
+                    <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
-                {% endif %}
+                  {% endif %}
-              {% endfor %}
+                {% endfor %}
+              </optgroup>
             </select>
+            <label class="label">
+              <span class="label-text-alt"
+                >Hold Ctrl/Cmd to select multiple</span
+              >
+            </label>
           </div>
-          <div id="model-based-prediction-setting-specific-form">
+        </div>
-            <label>Select Model</label><br />
+
+        <!-- Model Based Settings -->
+        <div x-show="tpMethod === 'model-based-prediction-setting'" x-cloak>
+          <div class="form-control mb-3">
+            <label class="label" for="model-based-prediction-setting-model">
+              <span class="label-text">Select Model</span>
+            </label>
             <select
               id="model-based-prediction-setting-model"
               name="model-based-prediction-setting-model"
-              class="form-control"
+              class="select select-bordered w-full"
-              data-width="100%"
             >
-              <option disabled selected>Select the model</option>
+              <option value="" disabled selected>Select the model</option>
               {% for m in models %}
                 <option value="{{ m.url }}">{{ m.name|safe }}</option>
               {% endfor %}
             </select>
-            <label for="model-based-prediction-setting-threshold"
+          </div>
-              >Threshold</label
+
-            >
+          <div class="form-control mb-3">
+            <label class="label" for="model-based-prediction-setting-threshold">
+              <span class="label-text">Threshold</span>
+            </label>
             <input
               id="model-based-prediction-setting-threshold"
               name="model-based-prediction-setting-threshold"
-              class="form-control"
+              class="input input-bordered w-full"
               placeholder="0.25"
               type="number"
+              min="0"
+              max="1"
+              step="0.05"
             />
           </div>
+        </div>
 
-          <input
+        <div class="form-control">
-            class="form-check-input"
+          <label class="label cursor-pointer justify-start gap-3">
-            type="checkbox"
+            <input
-            value="on"
+              type="checkbox"
-            id="prediction-setting-new-default"
+              class="checkbox"
-            name="prediction-setting-new-default"
+              value="on"
-          />
+              id="prediction-setting-new-default"
-          <label class="form-check-label" for="prediction-setting-new-default"
+              name="prediction-setting-new-default"
-            >Set this setting as new default</label
+            />
-          >
+            <span class="label-text">Set this setting as new default</span>
-        </form>
+          </label>
-      </div>
+        </div>
-      <div class="modal-footer">
+      </form>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+    </div>
-          Close
+
-        </button>
+    <!-- Footer -->
-        <button
+    <div class="modal-action">
-          type="button"
+      <button
-          class="btn btn-primary"
+        type="button"
-          id="new-prediction-setting-modal-submit"
+        class="btn"
-        >
+        onclick="this.closest('dialog').close()"
-          Create
+        :disabled="isSubmitting"
-        </button>
+      >
-      </div>
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit()"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Create</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Creating...</span>
+      </button>
     </div>
   </div>
-</div>
-<script>
-  $(function () {
-    // Initially hide all "specific" forms
-    $("div[id$='-specific-form']").each(function () {
-      $(this).hide();
-    });
 
-    $("#rule-based-prediction-setting-packages").selectpicker();
+  <!-- Backdrop -->
-
+  <form method="dialog" class="modal-backdrop">
-    // On change hide all and show only selected
+    <button :disabled="isSubmitting">close</button>
-    $("#tp-generation-method").change(function () {
+  </form>
-      $("div[id$='-specific-form']").each(function () {
+</dialog>
-        $(this).hide();
-      });
-      val = $("option:selected", this).val();
-      $("#" + val + "-specific-form").show();
-    });
-
-    $("#new-prediction-setting-modal-submit").click(function (e) {
-      e.preventDefault();
-      // $('#new-prediction-setting-modal-form').submit();
-
-      const formData = $("#new-prediction-setting-modal-form").serialize();
-      $.post("/setting", formData, function (response) {
-        location.reload();
-      });
-    });
-  });
-</script>

templates/modals/collections/new_reaction_modal.html

@@ -1,91 +1,105 @@
 {% load static %}
-<div
+
-  class="modal fade bs-modal-lg"
+<dialog
   id="new_reaction_modal"
-  tabindex="-1"
+  class="modal"
-  aria-labelledby="new_reaction_modal"
+  x-data="modalForm()"
-  aria-modal="true"
+  @close="reset()"
-  role="dialog"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-3xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="font-bold text-lg">Create a new Reaction</h3>
-        <button
+
-          type="button"
+    <!-- Close button (X) -->
-          class="close"
+    <form method="dialog">
-          data-dismiss="modal"
+      <button
-          aria-label="Close"
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-        >
+        :disabled="isSubmitting"
-          <span aria-hidden="true">×</span>
+      >
-        </button>
+        ✕
-        <h4 class="modal-title">Create a new Reaction</h4>
+      </button>
-      </div>
+    </form>
-      <div class="modal-body">
+
-        <form
+    <!-- Body -->
-          id="new_reaction_modal_form"
+    <div class="py-4">
-          accept-charset="UTF-8"
+      <form
-          action="{% url 'package reaction list' meta.current_package.uuid %}"
+        id="new-reaction-modal-form"
-          data-remote="true"
+        accept-charset="UTF-8"
-          method="post"
+        action="{% url 'package reaction list' meta.current_package.uuid %}"
-        >
+        method="post"
-          {% csrf_token %}
+      >
-          <label for="reaction-name">Name</label>
+        {% csrf_token %}
+
+        <div class="form-control mb-3">
+          <label class="label" for="reaction-name">
+            <span class="label-text">Name</span>
+          </label>
           <input
             id="reaction-name"
-            class="form-control"
+            class="input input-bordered w-full"
             name="reaction-name"
             placeholder="Name"
+            required
           />
-          <label for="reaction-description">Description</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="reaction-description">
+            <span class="label-text">Description</span>
+          </label>
           <input
             id="reaction-description"
-            class="form-control"
+            class="input input-bordered w-full"
             name="reaction-description"
             placeholder="Description"
           />
-          <p></p>
+        </div>
-          <div>
+
-            <iframe
+        <div class="mb-3">
-              id="new_reaction_ketcher"
+          <iframe
-              src="{% static '/js/ketcher2/ketcher.html' %}"
+            id="new_reaction_ketcher"
-              width="100%"
+            src="{% static '/js/ketcher2/ketcher.html' %}"
-              height="510"
+            width="100%"
-            ></iframe>
+            height="510"
-          </div>
+          ></iframe>
-          <input type="hidden" name="reaction-smirks" id="reaction-smirks" />
+        </div>
-          <p></p>
+
-        </form>
+        <input type="hidden" name="reaction-smirks" id="reaction-smirks" />
-      </div>
+      </form>
-      <div class="modal-footer">
+    </div>
-        <button
+
-          type="button"
+    <!-- Footer -->
-          class="btn btn-secondary pull-left"
+    <div class="modal-action">
-          data-dismiss="modal"
+      <button
-        >
+        type="button"
-          Close
+        class="btn"
-        </button>
+        onclick="this.closest('dialog').close()"
-        <button
+        :disabled="isSubmitting"
-          type="button"
+      >
-          class="btn btn-primary"
+        Close
-          id="new_reaction_modal_form_submit"
+      </button>
-        >
+      <button
-          Submit
+        type="button"
-        </button>
+        class="btn btn-primary"
-      </div>
+        @click="
+          const k = getKetcher('new_reaction_ketcher');
+          document.getElementById('reaction-smirks').value = k.getSmiles();
+          submit('new-reaction-modal-form');
+        "
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Creating...</span>
+      </button>
     </div>
   </div>
-</div>
-<script>
-  $(function () {
-    $("#new_reaction_modal_form_submit").on("click", function (e) {
-      e.preventDefault();
-      $(this).prop("disabled", true);
 
-      k = getKetcher("new_reaction_ketcher");
+  <!-- Backdrop -->
-      $("#reaction-smirks").val(k.getSmiles());
+  <form method="dialog" class="modal-backdrop">
-
+    <button :disabled="isSubmitting">close</button>
-      // submit form
+  </form>
-      $("#new_reaction_modal_form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/collections/new_rule_modal.html

@@ -1,120 +1,140 @@
 {% load static %}
-<div
+
-  class="modal fade bs-modal-lg"
+<dialog
   id="new_rule_modal"
-  tabindex="-1"
+  class="modal"
-  aria-labelledby="new_rule_modal"
+  x-data="{
-  aria-modal="true"
+    ...modalForm(),
-  role="dialog"
+    smirksVizHtml: '',
+    updateSmirksViz() {
+      const smirks = document.getElementById('rule-smirks').value;
+      if (!smirks) {
+        this.smirksVizHtml = '';
+        return;
+      }
+
+      const img = new Image();
+      img.src = '{% url 'depict' %}?is_query_smirks=true&smirks=' + encodeURIComponent(smirks);
+      img.style.width = '100%';
+      img.style.height = '100%';
+      img.style.objectFit = 'cover';
+
+      img.onload = () => {
+        this.smirksVizHtml = img.outerHTML;
+      };
+
+      img.onerror = () => {
+        this.smirksVizHtml = `
+          <div class='alert alert-error' role='alert'>
+            <h4 class='alert-heading'>Could not render SMIRKS!</h4>
+            <p>Could not render SMIRKS - Have you entered a valid SMIRKS?</p>
+          </div>`;
+      };
+    }
+  }"
+  @close="reset(); smirksVizHtml = ''"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-3xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="font-bold text-lg">Create a new Rule</h3>
-        <button
+
-          type="button"
+    <!-- Close button (X) -->
-          class="close"
+    <form method="dialog">
-          data-dismiss="modal"
+      <button
-          aria-label="Close"
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-        >
+        :disabled="isSubmitting"
-          <span aria-hidden="true">×</span>
+      >
-        </button>
+        ✕
-        <h4 class="modal-title">Create a new Rule</h4>
+      </button>
-      </div>
+    </form>
-      <div class="modal-body">
+
-        <form
+    <!-- Body -->
-          id="new_rule_modal_form"
+    <div class="py-4">
-          accept-charset="UTF-8"
+      <form
-          action="{% url 'package rule list' meta.current_package.uuid %}"
+        id="new-rule-modal-form"
-          data-remote="true"
+        accept-charset="UTF-8"
-          method="post"
+        action="{% url 'package rule list' meta.current_package.uuid %}"
-        >
+        method="post"
-          {% csrf_token %}
+      >
-          <label for="rule-name">Name</label>
+        {% csrf_token %}
+
+        <div class="form-control mb-3">
+          <label class="label" for="rule-name">
+            <span class="label-text">Name</span>
+          </label>
           <input
             id="rule-name"
-            class="form-control"
+            class="input input-bordered w-full"
             name="rule-name"
             placeholder="Name"
+            required
           />
-          <label for="rule-description">Description</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="rule-description">
+            <span class="label-text">Description</span>
+          </label>
           <input
             id="rule-description"
-            class="form-control"
+            class="input input-bordered w-full"
             name="rule-description"
             placeholder="Description"
           />
-          <label for="rule-smirks">SMIRKS</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="rule-smirks">
+            <span class="label-text">SMIRKS</span>
+          </label>
           <input
             id="rule-smirks"
-            class="form-control"
+            class="input input-bordered w-full"
             name="rule-smirks"
             placeholder="SMIRKS"
+            @input="updateSmirksViz()"
           />
-          <p></p>
+        </div>
-          <div id="rule-smirks-viz"></div>
+
-          <input
+        <div id="rule-smirks-viz" class="mb-3" x-html="smirksVizHtml"></div>
-            type="hidden"
+
-            name="rule-type"
+        <input
-            id="rule-type"
+          type="hidden"
-            value="SimpleAmbitRule"
+          name="rule-type"
-          />
+          id="rule-type"
-          <p></p>
+          value="SimpleAmbitRule"
-        </form>
+        />
-      </div>
+      </form>
-      <div class="modal-footer">
+    </div>
-        <button
+
-          type="button"
+    <!-- Footer -->
-          class="btn btn-secondary pull-left"
+    <div class="modal-action">
-          data-dismiss="modal"
+      <button
-        >
+        type="button"
-          Close
+        class="btn"
-        </button>
+        onclick="this.closest('dialog').close()"
-        <button
+        :disabled="isSubmitting"
-          type="button"
+      >
-          class="btn btn-primary"
+        Close
-          id="new_rule_modal_form_submit"
+      </button>
-        >
+      <button
-          Submit
+        type="button"
-        </button>
+        class="btn btn-primary"
-      </div>
+        @click="submit('new-rule-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Creating...</span>
+      </button>
     </div>
   </div>
-</div>
-<script>
-  $(function () {
-    $("#rule-smirks").on("input", function (e) {
-      $("#rule-smirks-viz").empty();
 
-      smirks = $("#rule-smirks").val();
+  <!-- Backdrop -->
-
+  <form method="dialog" class="modal-backdrop">
-      const img = new Image();
+    <button :disabled="isSubmitting">close</button>
-      img.src =
+  </form>
-        "{% url 'depict' %}?is_query_smirks=true&smirks=" +
+</dialog>
-        encodeURIComponent(smirks);
-      img.style.width = "100%";
-      img.style.height = "100%";
-      img.style.objectFit = "cover";
-
-      img.onload = function () {
-        $("#rule-smirks-viz").append(img);
-      };
-
-      img.onerror = function () {
-        error_tpl = `
-                <div class="alert alert-error" role="alert">
-                    <h4 class="alert-heading">Could not render SMIRKS!</h4>
-                    <p>Could not render SMIRKS - Have you entered a valid SMIRKS?</a>
-                    </p>
-                </div>`;
-        $("#rule-smirks-viz").append(error_tpl);
-      };
-    });
-
-    $("#new_rule_modal_form_submit").on("click", function (e) {
-      e.preventDefault();
-      $(this).prop("disabled", true);
-      // submit form
-      $("#new_rule_modal_form").submit();
-    });
-  });
-</script>

templates/modals/collections/new_scenario_modal.html

@@ -1,30 +1,45 @@
-<div
+{% load static %}
-  class="modal fade"
+
-  tabindex="-1"
+<dialog
   id="new_scenario_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="new_scenario_modal"
+  x-data="{
-  aria-hidden="true"
+    ...modalForm(),
+    scenarioType: 'empty',
+    validateYear(el) {
+      if (el.value && el.value.length < 4) {
+        el.value = new Date().getFullYear();
+      }
+    }
+  }"
+  @close="reset()"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-3xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="font-bold text-lg">New Scenario</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h4 class="modal-title">New Scenario</h4>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-body">
+      >
-        <form
+        ✕
-          id="new_scenario_form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action="{{ meta.current_package.url }}/scenario"
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          {% csrf_token %}
+        id="new-scenario-modal-form"
-          <div class="jumbotron">
+        accept-charset="UTF-8"
+        action="{{ meta.current_package.url }}/scenario"
+        method="post"
+      >
+        {% csrf_token %}
+
+        <div class="alert alert-info mb-4">
+          <span>
             Please enter name, description, and date of scenario. Date should be
             associated to the data, not the current date. For example, this
             could reflect the publishing date of a study. You can leave all
@@ -32,122 +47,131 @@
             <a
               target="_blank"
               href="https://wiki.envipath.org/index.php/scenario"
-              role="button"
+              class="link"
               >wiki &gt;&gt;</a
             >
-          </div>
+          </span>
-          <label for="scenario-name">Name</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="scenario-name">
+            <span class="label-text">Name</span>
+          </label>
           <input
             id="scenario-name"
             name="scenario-name"
-            class="form-control"
+            class="input input-bordered w-full"
             placeholder="Name"
+            required
           />
-          <label for="scenario-description">Description</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="scenario-description">
+            <span class="label-text">Description</span>
+          </label>
           <input
             id="scenario-description"
             name="scenario-description"
-            class="form-control"
+            class="input input-bordered w-full"
             placeholder="Description"
           />
-          <label id="dateField" for="dateYear">Date</label>
+        </div>
-          <table>
+
-            <tr>
+        <div class="form-control mb-3">
-              <th>
+          <label class="label">
-                <input
+            <span class="label-text">Date</span>
-                  type="number"
+          </label>
-                  id="dateYear"
+          <div class="flex gap-2">
-                  name="scenario-date-year"
+            <input
-                  class="form-control"
+              type="number"
-                  placeholder="YYYY"
+              id="dateYear"
-                  max="{% now "Y" %}"
+              name="scenario-date-year"
-                />
+              class="input input-bordered w-24"
-              </th>
+              placeholder="YYYY"
-              <th>
+              max="{% now 'Y' %}"
-                <input
+              @blur="validateYear($el)"
-                  type="number"
+            />
-                  id="dateMonth"
+            <input
-                  name="scenario-date-month"
+              type="number"
-                  min="1"
+              id="dateMonth"
-                  max="12"
+              name="scenario-date-month"
-                  class="form-control"
+              min="1"
-                  placeholder="MM"
+              max="12"
-                />
+              class="input input-bordered w-20"
-              </th>
+              placeholder="MM"
-              <th>
+            />
-                <input
+            <input
-                  type="number"
+              type="number"
-                  id="dateDay"
+              id="dateDay"
-                  name="scenario-date-day"
+              name="scenario-date-day"
-                  min="1"
+              min="1"
-                  max="31"
+              max="31"
-                  class="form-control"
+              class="input input-bordered w-20"
-                  placeholder="DD"
+              placeholder="DD"
-                />
+            />
-              </th>
+          </div>
-            </tr>
+        </div>
-          </table>
+
-          <label for="scenario-type">Scenario Type</label>
+        <div class="form-control mb-3">
+          <label class="label" for="scenario-type">
+            <span class="label-text">Scenario Type</span>
+          </label>
           <select
             id="scenario-type"
             name="scenario-type"
-            class="form-control"
+            class="select select-bordered w-full"
-            data-width="100%"
+            x-model="scenarioType"
           >
             <option value="empty" selected>Empty Scenario</option>
             {% for k, v in scenario_types.items %}
               <option value="{{ v.name }}">{{ k }}</option>
             {% endfor %}
           </select>
+        </div>
 
-          {% for type in scenario_types.values %}
+        {% for type in scenario_types.values %}
-            <div id="{{ type.name }}-specific-inputs">
+          <div
-              {% for widget in type.widgets %}
+            id="{{ type.name }}-specific-inputs"
-                {{ widget|safe }}
+            x-show="scenarioType === '{{ type.name }}'"
-              {% endfor %}
+            x-cloak
-            </div>
+          >
-          {% endfor %}
+            {% for widget in type.widgets %}
-        </form>
+              {{ widget|safe }}
-      </div>
+            {% endfor %}
-      <div class="modal-footer">
+          </div>
-        <a id="new_scenario_modal_form_submit" class="btn btn-primary" href="#"
+        {% endfor %}
-          >Submit</a
+      </form>
-        >
+    </div>
-        <button type="button" class="btn btn-default" data-dismiss="modal">
+
-          Cancel
+    <!-- Footer -->
-        </button>
+    <div class="modal-action">
-      </div>
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('new-scenario-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Creating...</span>
+      </button>
     </div>
   </div>
-</div>
 
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    // Initially hide all "specific" forms
+    <button :disabled="isSubmitting">close</button>
-    $("div[id$='-specific-inputs']").each(function () {
+  </form>
-      $(this).hide();
+</dialog>
-    });
-
-    // On change hide all and show only selected
-    $("#scenario-type").change(function () {
-      $("div[id$='-specific-inputs']").each(function () {
-        $(this).hide();
-      });
-      val = $("option:selected", this).val();
-      $("#" + val + "-specific-inputs").show();
-    });
-
-    $("#new_scenario_modal_form_submit").on("click", function (e) {
-      e.preventDefault();
-      $("#new_scenario_form").submit();
-    });
-
-    var dateYear = document.getElementById("dateYear");
-    dateYear.addEventListener("change", () => {
-      console.log("Final value after editing:", dateYear.value);
-      if (dateYear.value.length < 4) {
-        dateYear.value = new Date().getFullYear();
-      }
-    });
-  });
-</script>

templates/modals/objects/add_additional_information_modal.html

@@ -1,92 +1,117 @@
 {% load static %}
-<!-- Add Additional Information-->
+<!-- Add Additional Information -->
-<div id="add_additional_information_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="add_additional_information_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="{
-        <button
+    isSubmitting: false,
-          type="button"
+    selectedType: '',
-          class="close"
+
-          data-dismiss="modal"
+    reset() {
-          aria-label="Close"
+      this.isSubmitting = false;
-        >
+      this.selectedType = '';
-          <span aria-hidden="true">&times;</span>
+    },
-        </button>
+
-        <h3 class="modal-title">Add Additional Information</h3>
+    submit() {
-      </div>
+      if (!this.selectedType) return;
-      <div class="modal-body">
+
+      const form = document.getElementById('add_' + this.selectedType + '_add-additional-information-modal-form');
+      if (form && form.checkValidity()) {
+        this.isSubmitting = true;
+        form.submit();
+      } else if (form) {
+        form.reportValidity();
+      }
+    }
+  }"
+  @close="reset()"
+>
+  <div class="modal-box">
+    <!-- Header -->
+    <h3 class="text-lg font-bold">Add Additional Information</h3>
+
+    <!-- Close button (X) -->
+    <form method="dialog">
+      <button
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <div class="form-control">
+        <label class="label" for="select-additional-information-type">
+          <span class="label-text">Select the type to add</span>
+        </label>
         <select
           id="select-additional-information-type"
-          data-actions-box="true"
+          class="select select-bordered w-full"
-          class="form-control"
+          x-model="selectedType"
-          data-width="100%"
         >
-          <option selected disabled>Select the type to add</option>
+          <option value="" selected disabled>Select the type to add</option>
           {% for add_inf in available_additional_information %}
             <option value="{{ add_inf.name }}">
               {{ add_inf.display_name }}
             </option>
           {% endfor %}
         </select>
-        {% for add_inf in available_additional_information %}
-          <div class="aiform {{ add_inf.name }}" style="display: none;">
-            <form
-              id="add_{{ add_inf.name }}_add-additional-information-modal-form"
-              accept-charset="UTF-8"
-              action=""
-              data-remote="true"
-              method="post"
-            >
-              {% csrf_token %}
-              {{ add_inf.widget|safe }}
-              <input
-                type="hidden"
-                name="hidden"
-                value="add-additional-information"
-              />
-            </form>
-          </div>
-        {% endfor %}
       </div>
-      <div class="modal-footer">
+
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+      {% for add_inf in available_additional_information %}
-          Close
+        <div
-        </button>
+          class="mt-4"
-        <button
+          x-show="selectedType === '{{ add_inf.name }}'"
-          type="button"
+          x-cloak
-          class="btn btn-primary"
-          id="add-additional-information-modal-submit"
         >
-          Add
+          <form
-        </button>
+            id="add_{{ add_inf.name }}_add-additional-information-modal-form"
-      </div>
+            accept-charset="UTF-8"
+            action=""
+            method="post"
+          >
+            {% csrf_token %}
+            {{ add_inf.widget|safe }}
+            <input
+              type="hidden"
+              name="hidden"
+              value="add-additional-information"
+            />
+          </form>
+        </div>
+      {% endfor %}
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit()"
+        :disabled="isSubmitting || !selectedType"
+      >
+        <span x-show="!isSubmitting">Add</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Adding...</span>
+      </button>
     </div>
   </div>
-</div>
-<script>
-  $(function () {
-    $("#select-additional-information-type").change(function (e) {
-      var selectedType = $(
-        "#select-additional-information-type :selected",
-      ).val();
-      $(".aiform").hide();
-      $("." + selectedType).show();
-    });
 
-    $("#add-additional-information-modal-submit").click(function (e) {
+  <!-- Backdrop -->
-      e.preventDefault();
+  <form method="dialog" class="modal-backdrop">
-
+    <button :disabled="isSubmitting">close</button>
-      var selectedType = $(
+  </form>
-        "#select-additional-information-type :selected",
+</dialog>
-      ).val();
-      console.log(selectedType);
-      if (
-        selectedType !== null &&
-        selectedType !== undefined &&
-        selectedType !== ""
-      ) {
-        $("." + selectedType + " >form").submit();
-      }
-    });
-  });
-</script>

templates/modals/objects/add_pathway_edge_modal.html

@@ -1,67 +1,107 @@
 {% load static %}
-<div
+<dialog
-  class="modal fade bs-modal-lg"
   id="add_pathway_edge_modal"
-  tabindex="-1"
+  class="modal"
-  aria-labelledby="add_pathway_edge_modal"
+  x-data="{
-  aria-modal="true"
+    isSubmitting: false,
-  role="dialog"
+    reactionImageUrl: '',
+
+    reset() {
+      this.isSubmitting = false;
+      this.reactionImageUrl = '';
+    },
+
+    updateReactionImage() {
+      const substratesSelect = document.getElementById('add_pathway_edge_substrates');
+      const productsSelect = document.getElementById('add_pathway_edge_products');
+
+      const substrates = [];
+      for (const option of substratesSelect.selectedOptions) {
+        substrates.push(option.dataset.smiles);
+      }
+
+      const products = [];
+      for (const option of productsSelect.selectedOptions) {
+        products.push(option.dataset.smiles);
+      }
+
+      if (substrates.length > 0 && products.length > 0) {
+        const reaction = substrates.join('.') + '>>' + products.join('.');
+        this.reactionImageUrl = '{% url "depict" %}?smirks=' + encodeURIComponent(reaction);
+      } else {
+        this.reactionImageUrl = '';
+      }
+    },
+
+    submit() {
+      this.isSubmitting = true;
+      document.getElementById('add_pathway_edge_modal_form').submit();
+    }
+  }"
+  @close="reset()"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-4xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Add a Reaction</h3>
-        <button
+
-          type="button"
+    <!-- Close button (X) -->
-          class="close"
+    <form method="dialog">
-          data-dismiss="modal"
+      <button
-          aria-label="Close"
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-        >
+        :disabled="isSubmitting"
-          <span aria-hidden="true">&times;</span>
+      >
-        </button>
+        ✕
-        <h4 class="modal-title">Add a Reaction</h4>
+      </button>
-      </div>
+    </form>
-      <div class="modal-body">
+
-        <form
+    <!-- Body -->
-          id="add_pathway_edge_modal_form"
+    <div class="py-4">
-          accept-charset="UTF-8"
+      <form
-          action="{% url 'package pathway edge list' meta.current_package.uuid pathway.uuid %}"
+        id="add_pathway_edge_modal_form"
-          data-remote="true"
+        accept-charset="UTF-8"
-          method="post"
+        action="{% url 'package pathway edge list' meta.current_package.uuid pathway.uuid %}"
-        >
+        data-remote="true"
-          {% csrf_token %}
+        method="post"
-          <label for="edge-name">Name</label>
+      >
+        {% csrf_token %}
+        <div class="form-control mb-3">
+          <label class="label" for="edge-name">
+            <span class="label-text">Name</span>
+          </label>
           <input
             id="edge-name"
-            class="form-control"
+            type="text"
+            class="input input-bordered w-full"
             name="edge-name"
             placeholder="Name"
           />
-          <label for="edge-description">Description</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="edge-description">
+            <span class="label-text">Description</span>
+          </label>
           <input
             id="edge-description"
-            class="form-control"
+            type="text"
+            class="input input-bordered w-full"
             name="edge-description"
             placeholder="Description"
           />
-          <p></p>
+        </div>
-          <div class="row">
+
-            <div class="col-xs-5">
+        <div class="mb-3 grid grid-cols-11 gap-2">
-              <legend>Substrate(s)</legend>
+          <div class="col-span-5">
-            </div>
+            <div class="form-control">
-            <div class="col-xs-2"></div>
+              <label class="label">
-            <div class="col-xs-5">
+                <span class="label-text font-semibold">Substrate(s)</span>
-              <legend>Product(s)</legend>
+              </label>
-            </div>
-          </div>
-          <div class="row">
-            <div class="col-xs-5">
               <select
                 id="add_pathway_edge_substrates"
                 name="edge-substrates"
-                data-actions-box="true"
+                class="select select-bordered h-32 w-full"
-                class="form-control"
                 multiple
-                data-width="100%"
+                @change="updateReactionImage()"
               >
                 {% for n in pathway.nodes %}
                   <option
@@ -73,20 +113,21 @@
                 {% endfor %}
               </select>
             </div>
-            <div
+          </div>
-              class="col-xs-2"
+          <div class="col-span-1 flex items-center justify-center">
-              style="display: flex; justify-content: center; align-items: center;"
+            <span class="text-2xl">→</span>
-            >
+          </div>
-              <i class="glyphicon glyphicon-arrow-right"></i>
+          <div class="col-span-5">
-            </div>
+            <div class="form-control">
-            <div class="col-xs-5">
+              <label class="label">
+                <span class="label-text font-semibold">Product(s)</span>
+              </label>
               <select
                 id="add_pathway_edge_products"
                 name="edge-products"
-                data-actions-box="true"
+                class="select select-bordered h-32 w-full"
-                class="form-control"
                 multiple
-                data-width="100%"
+                @change="updateReactionImage()"
               >
                 {% for n in pathway.nodes %}
                   <option
@@ -99,76 +140,42 @@
               </select>
             </div>
           </div>
-          <div class="row">
+        </div>
-            <p></p>
+
-            <div class="col-xs-12" id="reaction_image"></div>
+        <div class="mb-3" x-show="reactionImageUrl" x-cloak>
-          </div>
+          <img :src="reactionImageUrl" class="w-full" alt="Reaction preview" />
-        </form>
+        </div>
-      </div>
+      </form>
-      <div class="modal-footer">
+    </div>
-        <button
+
-          type="button"
+    <!-- Footer -->
-          class="btn btn-secondary pull-left"
+    <div class="modal-action">
-          data-dismiss="modal"
+      <button
-        >
+        type="button"
-          Close
+        class="btn"
-        </button>
+        onclick="this.closest('dialog').close()"
-        <button
+        :disabled="isSubmitting"
-          type="button"
+      >
-          class="btn btn-primary"
+        Close
-          id="add_pathway_edge_modal_form_submit"
+      </button>
-        >
+      <button
-          Submit
+        type="button"
-        </button>
+        class="btn btn-primary"
-      </div>
+        @click="submit()"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Submitting...</span>
+      </button>
     </div>
   </div>
-</div>
-<script>
-  function reactionImage() {
-    var substrates = [];
-    $("#add_pathway_edge_substrates option:selected").each(function () {
-      var smiles = $(this).data("smiles"); // read data-smiles attribute
-      substrates.push(smiles);
-    });
 
-    var products = [];
+  <!-- Backdrop -->
-    $("#add_pathway_edge_products option:selected").each(function () {
+  <form method="dialog" class="modal-backdrop">
-      var smiles = $(this).data("smiles"); // read data-smiles attribute
+    <button :disabled="isSubmitting">close</button>
-      products.push(smiles);
+  </form>
-    });
+</dialog>
-
-    if (substrates.length > 0 && products.length > 0) {
-      reaction = substrates.join(".") + ">>" + products.join(".");
-      $("#reaction_image").empty();
-      $("#reaction_image").append(
-        "<img width='100%' src='{% url 'depict' %}?smirks=" +
-          encodeURIComponent(reaction) +
-          "'>",
-      );
-    }
-  }
-
-  $(function () {
-    $("#add_pathway_edge_substrates").selectpicker();
-    $("#add_pathway_edge_products").selectpicker();
-
-    $("#add_pathway_edge_substrates").on("change", function (e) {
-      reactionImage();
-    });
-
-    $("#add_pathway_edge_products").on("change", function (e) {
-      reactionImage();
-    });
-
-    $(function () {
-      $("#add_pathway_edge_modal_form_submit").on("click", function (e) {
-        e.preventDefault();
-        $(this).prop("disabled", true);
-
-        // submit form
-        $("#add_pathway_edge_modal_form").submit();
-      });
-    });
-  });
-</script>

templates/modals/objects/add_pathway_node_modal.html

@@ -1,119 +1,137 @@
 {% load static %}
-<div
+<dialog
-  class="modal fade bs-modal-lg"
   id="add_pathway_node_modal"
-  tabindex="-1"
+  class="modal"
-  aria-labelledby="add_pathway_node_modal"
+  x-data="modalForm()"
-  aria-modal="true"
+  @close="reset()"
-  role="dialog"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-4xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Add a Node</h3>
-        <button
+
-          type="button"
+    <!-- Close button (X) -->
-          class="close"
+    <form method="dialog">
-          data-dismiss="modal"
+      <button
-          aria-label="Close"
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-        >
+        :disabled="isSubmitting"
-          <span aria-hidden="true">&times;</span>
+      >
-        </button>
+        ✕
-        <h4 class="modal-title">Add a Node</h4>
+      </button>
-      </div>
+    </form>
-      <div class="modal-body">
+
-        <form
+    <!-- Body -->
-          id="add_pathway_node_modal_form"
+    <div class="py-4">
-          accept-charset="UTF-8"
+      <form
-          action="{% url 'package pathway node list' meta.current_package.uuid pathway.uuid %}"
+        id="add_pathway_node_modal_form"
-          data-remote="true"
+        accept-charset="UTF-8"
-          method="post"
+        action="{% url 'package pathway node list' meta.current_package.uuid pathway.uuid %}"
-        >
+        data-remote="true"
-          {% csrf_token %}
+        method="post"
-          <label for="node-name">Name</label>
+      >
+        {% csrf_token %}
+        <div class="form-control mb-3">
+          <label class="label" for="node-name">
+            <span class="label-text">Name</span>
+          </label>
           <input
             id="node-name"
-            class="form-control"
+            type="text"
+            class="input input-bordered w-full"
             name="node-name"
             placeholder="Name"
           />
-          <label for="node-description">Description</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="node-description">
+            <span class="label-text">Description</span>
+          </label>
           <input
             id="node-description"
-            class="form-control"
+            type="text"
+            class="input input-bordered w-full"
             name="node-description"
             placeholder="Description"
           />
-          <label for="node-smiles">SMILES</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="node-smiles">
+            <span class="label-text">SMILES</span>
+          </label>
           <input
             type="text"
-            class="form-control"
+            class="input input-bordered w-full"
             name="node-smiles"
             placeholder="SMILES"
             id="node-smiles"
           />
-          <p></p>
+        </div>
-          <div>
+
-            <iframe
+        <div class="mb-3">
-              id="add_node_ketcher"
+          <iframe
-              src="{% static '/js/ketcher2/ketcher.html' %}"
+            id="add_node_ketcher"
-              width="100%"
+            src="{% static '/js/ketcher2/ketcher.html' %}"
-              height="510"
+            width="100%"
-            ></iframe>
+            height="510"
-          </div>
+          ></iframe>
-          <p></p>
+        </div>
-        </form>
+      </form>
-      </div>
+    </div>
-      <div class="modal-footer">
+
-        <button
+    <!-- Footer -->
-          type="button"
+    <div class="modal-action">
-          class="btn btn-secondary pull-left"
+      <button
-          data-dismiss="modal"
+        type="button"
-        >
+        class="btn"
-          Close
+        onclick="this.closest('dialog').close()"
-        </button>
+        :disabled="isSubmitting"
-        <button
+      >
-          type="button"
+        Close
-          class="btn btn-primary"
+      </button>
-          id="add_pathway_node_modal_form_submit"
+      <button
-        >
+        type="button"
-          Submit
+        class="btn btn-primary"
-        </button>
+        @click="submit('add_pathway_node_modal_form')"
-      </div>
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Submitting...</span>
+      </button>
     </div>
   </div>
-</div>
-<script>
-  function newStructureModalketcherToNewStructureModalTextInput() {
-    $("#node-smiles").val(this.ketcher.getSmiles());
-  }
 
-  $(function () {
+  <!-- Backdrop -->
-    $("#add_node_ketcher").on("load", function () {
+  <form method="dialog" class="modal-backdrop">
+    <button :disabled="isSubmitting">close</button>
+  </form>
+</dialog>
+
+<script>
+  document
+    .getElementById("add_node_ketcher")
+    .addEventListener("load", function () {
+      const iframe = this;
       const checkKetcherReady = () => {
-        win = this.contentWindow;
+        const win = iframe.contentWindow;
         if (win.ketcher && "editor" in win.ketcher) {
           win.ketcher.editor.event.change.handlers.push({
             once: false,
             priority: 0,
-            f: newStructureModalketcherToNewStructureModalTextInput,
+            f: function () {
+              document.getElementById("node-smiles").value =
+                this.ketcher.getSmiles();
+            },
             ketcher: win.ketcher,
           });
         } else {
           setTimeout(checkKetcherReady, 100);
         }
       };
-
       checkKetcherReady();
     });
-
-    $(function () {
-      $("#add_pathway_node_modal_form_submit").on("click", function (e) {
-        e.preventDefault();
-        $(this).prop("disabled", true);
-
-        // submit form
-        $("#add_pathway_node_modal_form").submit();
-      });
-    });
-  });
 </script>

templates/modals/objects/add_structure_modal.html

@@ -1,119 +1,137 @@
 {% load static %}
-<div
+<dialog
-  class="modal fade bs-modal-lg"
   id="add_structure_modal"
-  tabindex="-1"
+  class="modal"
-  aria-labelledby="add_structure_modal"
+  x-data="modalForm()"
-  aria-modal="true"
+  @close="reset()"
-  role="dialog"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-4xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Create a new Structure</h3>
-        <button
+
-          type="button"
+    <!-- Close button (X) -->
-          class="close"
+    <form method="dialog">
-          data-dismiss="modal"
+      <button
-          aria-label="Close"
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-        >
+        :disabled="isSubmitting"
-          <span aria-hidden="true">×</span>
+      >
-        </button>
+        ✕
-        <h4 class="modal-title">Create a new Structure</h4>
+      </button>
-      </div>
+    </form>
-      <div class="modal-body">
+
-        <form
+    <!-- Body -->
-          id="add_structure_modal_form"
+    <div class="py-4">
-          accept-charset="UTF-8"
+      <form
-          action="{% url 'package compound structure list' meta.current_package.uuid compound.uuid %}"
+        id="add_structure_modal_form"
-          data-remote="true"
+        accept-charset="UTF-8"
-          method="post"
+        action="{% url 'package compound structure list' meta.current_package.uuid compound.uuid %}"
-        >
+        data-remote="true"
-          {% csrf_token %}
+        method="post"
-          <label for="structure-name">Name</label>
+      >
+        {% csrf_token %}
+        <div class="form-control mb-3">
+          <label class="label" for="structure-name">
+            <span class="label-text">Name</span>
+          </label>
           <input
             id="structure-name"
-            class="form-control"
+            type="text"
+            class="input input-bordered w-full"
             name="structure-name"
             placeholder="Name"
           />
-          <label for="structure-description">Description</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="structure-description">
+            <span class="label-text">Description</span>
+          </label>
           <input
             id="structure-description"
-            class="form-control"
+            type="text"
+            class="input input-bordered w-full"
             name="structure-description"
             placeholder="Description"
           />
-          <label for="structure-smiles">SMILES</label>
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="structure-smiles">
+            <span class="label-text">SMILES</span>
+          </label>
           <input
             type="text"
-            class="form-control"
+            class="input input-bordered w-full"
             name="structure-smiles"
             placeholder="SMILES"
             id="structure-smiles"
           />
-          <p></p>
+        </div>
-          <div>
+
-            <iframe
+        <div class="mb-3">
-              id="add_structure_ketcher"
+          <iframe
-              src="{% static '/js/ketcher2/ketcher.html' %}"
+            id="add_structure_ketcher"
-              width="100%"
+            src="{% static '/js/ketcher2/ketcher.html' %}"
-              height="510"
+            width="100%"
-            ></iframe>
+            height="510"
-          </div>
+          ></iframe>
-          <p></p>
+        </div>
-        </form>
+      </form>
-      </div>
+    </div>
-      <div class="modal-footer">
+
-        <button
+    <!-- Footer -->
-          type="button"
+    <div class="modal-action">
-          class="btn btn-secondary pull-left"
+      <button
-          data-dismiss="modal"
+        type="button"
-        >
+        class="btn"
-          Close
+        onclick="this.closest('dialog').close()"
-        </button>
+        :disabled="isSubmitting"
-        <button
+      >
-          type="button"
+        Close
-          class="btn btn-primary"
+      </button>
-          id="add_structure_modal_form_submit"
+      <button
-        >
+        type="button"
-          Submit
+        class="btn btn-primary"
-        </button>
+        @click="submit('add_structure_modal_form')"
-      </div>
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Submitting...</span>
+      </button>
     </div>
   </div>
-</div>
-<script>
-  function newStructureModalketcherToNewStructureModalTextInput() {
-    $("#structure-smiles").val(this.ketcher.getSmiles());
-  }
 
-  $(function () {
+  <!-- Backdrop -->
-    $("#add_structure_ketcher").on("load", function () {
+  <form method="dialog" class="modal-backdrop">
+    <button :disabled="isSubmitting">close</button>
+  </form>
+</dialog>
+
+<script>
+  document
+    .getElementById("add_structure_ketcher")
+    .addEventListener("load", function () {
+      const iframe = this;
       const checkKetcherReady = () => {
-        win = this.contentWindow;
+        const win = iframe.contentWindow;
         if (win.ketcher && "editor" in win.ketcher) {
           win.ketcher.editor.event.change.handlers.push({
             once: false,
             priority: 0,
-            f: newStructureModalketcherToNewStructureModalTextInput,
+            f: function () {
+              document.getElementById("structure-smiles").value =
+                this.ketcher.getSmiles();
+            },
             ketcher: win.ketcher,
           });
         } else {
           setTimeout(checkKetcherReady, 100);
         }
       };
-
       checkKetcherReady();
     });
-
-    $(function () {
-      $("#add_structure_modal_form_submit").on("click", function (e) {
-        e.preventDefault();
-        $(this).prop("disabled", true);
-
-        // submit form
-        $("#add_structure_modal_form").submit();
-      });
-    });
-  });
 </script>

templates/modals/objects/delete_pathway_edge_modal.html

@@ -1,36 +1,48 @@
 {% load static %}
 <!-- Delete Edge -->
-<div id="delete_pathway_edge_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="delete_pathway_edge_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm({ state: { selectedEdge: '', imageUrl: '' } })"
-        <h3 class="modal-title">Delete Edge</h3>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="text-lg font-bold">Delete Edge</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <p class="mb-4">
         Deletes the Edge. Nodes referenced by this edge will remain.
-        <p></p>
+      </p>
-        <form
+      <form
-          id="delete-pathway-edge-modal-form"
+        id="delete-pathway-edge-modal-form"
-          accept-charset="UTF-8"
+        accept-charset="UTF-8"
-          action=""
+        action=""
-          data-remote="true"
+        method="post"
-          method="post"
+      >
-        >
+        {% csrf_token %}
-          {% csrf_token %}
+        <div class="form-control">
+          <label class="label" for="delete_pathway_edge_edges">
+            <span class="label-text">Select Reaction to delete</span>
+          </label>
           <select
             id="delete_pathway_edge_edges"
             name="edge-url"
-            data-actions-box="true"
+            class="select select-bordered w-full"
-            class="form-control"
+            x-model="selectedEdge"
-            data-width="100%"
+            @change="imageUrl = selectedEdge ? selectedEdge + '?image=svg' : ''"
+            required
           >
             <option value="" disabled selected>
               Select Reaction to delete
@@ -39,51 +51,44 @@
               <option value="{{ e.url }}">{{ e.edge_label.name|safe }}</option>
             {% endfor %}
           </select>
-          <input type="hidden" id="hidden" name="hidden" value="delete" />
+        </div>
-        </form>
+        <input type="hidden" id="hidden" name="hidden" value="delete" />
-        <p></p>
+      </form>
-        <div id="delete_pathway_edge_image"></div>
+
-      </div>
+      <!-- Image Preview -->
-      <div class="modal-footer">
+      <div class="mt-4" x-show="imageUrl" x-cloak>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+        <img :src="imageUrl" class="w-full" alt="Edge preview" />
-          Close
-        </button>
-        <button
-          type="button"
-          class="btn btn-primary"
-          id="delete-pathway-edge-modal-submit"
-        >
-          Delete
-        </button>
       </div>
     </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-error"
+        @click="setFormAction('delete-pathway-edge-modal-form', selectedEdge); submit('delete-pathway-edge-modal-form')"
+        :disabled="isSubmitting || !selectedEdge"
+      >
+        <span x-show="!isSubmitting">Delete</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Deleting...</span>
+      </button>
+    </div>
   </div>
-</div>
-<script>
-  $(function () {
-    $("#delete_pathway_edge_edges").selectpicker();
 
-    $("#delete_pathway_edge_edges").on("change", function (e) {
+  <!-- Backdrop -->
-      edge_url = $("#delete_pathway_edge_edges option:selected").val();
+  <form method="dialog" class="modal-backdrop">
-
+    <button :disabled="isSubmitting">close</button>
-      if (edge_url !== "") {
+  </form>
-        $("#delete_pathway_edge_image").empty();
+</dialog>
-        $("#delete_pathway_edge_image").append(
-          "<img width='100%' src='" + edge_url + "?image=svg'>",
-        );
-      }
-    });
-
-    $("#delete-pathway-edge-modal-submit").click(function (e) {
-      e.preventDefault();
-      edge_url = $("#delete_pathway_edge_edges option:selected").val();
-
-      if (edge_url === "") {
-        return;
-      }
-
-      $("#delete-pathway-edge-modal-form").attr("action", edge_url);
-      $("#delete-pathway-edge-modal-form").submit();
-    });
-  });
-</script>

templates/modals/objects/delete_pathway_node_modal.html

@@ -1,38 +1,49 @@
 {% load static %}
-
 <!-- Delete Node -->
-<div id="delete_pathway_node_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="delete_pathway_node_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm({ state: { selectedNode: '', imageUrl: '' } })"
-        <h3 class="modal-title">Delete Node</h3>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="text-lg font-bold">Delete Node</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <p class="mb-4">
         Deletes the Node. Edges having this Node as Substrate or Product will be
         removed as well.
-        <p></p>
+      </p>
-        <form
+      <form
-          id="delete-pathway-node-modal-form"
+        id="delete-pathway-node-modal-form"
-          accept-charset="UTF-8"
+        accept-charset="UTF-8"
-          action=""
+        action=""
-          data-remote="true"
+        method="post"
-          method="post"
+      >
-        >
+        {% csrf_token %}
-          {% csrf_token %}
+        <div class="form-control">
+          <label class="label" for="delete_pathway_node_nodes">
+            <span class="label-text">Select Compound to delete</span>
+          </label>
           <select
             id="delete_pathway_node_nodes"
             name="node-url"
-            data-actions-box="true"
+            class="select select-bordered w-full"
-            class="form-control"
+            x-model="selectedNode"
-            data-width="100%"
+            @change="imageUrl = selectedNode ? selectedNode + '?image=svg' : ''"
+            required
           >
             <option value="" disabled selected>
               Select Compound to delete
@@ -43,51 +54,44 @@
               </option>
             {% endfor %}
           </select>
-          <input type="hidden" id="hidden" name="hidden" value="delete" />
+        </div>
-        </form>
+        <input type="hidden" id="hidden" name="hidden" value="delete" />
-        <p></p>
+      </form>
-        <div id="delete_pathway_node_image"></div>
+
-      </div>
+      <!-- Image Preview -->
-      <div class="modal-footer">
+      <div class="mt-4" x-show="imageUrl" x-cloak>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+        <img :src="imageUrl" class="w-full" alt="Node preview" />
-          Close
-        </button>
-        <button
-          type="button"
-          class="btn btn-primary"
-          id="delete-pathway-node-modal-submit"
-        >
-          Delete
-        </button>
       </div>
     </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-error"
+        @click="setFormAction('delete-pathway-node-modal-form', selectedNode); submit('delete-pathway-node-modal-form')"
+        :disabled="isSubmitting || !selectedNode"
+      >
+        <span x-show="!isSubmitting">Delete</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Deleting...</span>
+      </button>
+    </div>
   </div>
-</div>
-<script>
-  $(function () {
-    $("#delete_pathway_node_nodes").selectpicker();
 
-    $("#delete_pathway_node_nodes").on("change", function (e) {
+  <!-- Backdrop -->
-      node_url = $("#delete_pathway_node_nodes option:selected").val();
+  <form method="dialog" class="modal-backdrop">
-
+    <button :disabled="isSubmitting">close</button>
-      if (node_url !== "") {
+  </form>
-        $("#delete_pathway_node_image").empty();
+</dialog>
-        $("#delete_pathway_node_image").append(
-          "<img width='100%' src='" + node_url + "?image=svg'>",
-        );
-      }
-    });
-
-    $("#delete-pathway-node-modal-submit").click(function (e) {
-      e.preventDefault();
-      node_url = $("#delete_pathway_node_nodes option:selected").val();
-
-      if (node_url === "") {
-        return;
-      }
-
-      $("#delete-pathway-node-modal-form").attr("action", node_url);
-      $("#delete-pathway-node-modal-form").submit();
-    });
-  });
-</script>

templates/modals/objects/download_pathway_csv_modal.html

@@ -1,53 +1,69 @@
 {% load static %}
-<!-- Download Pathway -->
+
-<div id="download_pathway_csv_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="download_pathway_csv_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h3 class="modal-title">Download Pathway as CSV</h3>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Download Pathway as CSV</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <p>
         By clicking on Download the Pathway will be converted into a CSV and
         directly downloaded.
-        <form
+      </p>
-          id="download-pathway-csv-modal-form"
+
-          accept-charset="UTF-8"
+      <form
-          action="{{ pathway.url }}"
+        id="download-pathway-csv-modal-form"
-          data-remote="true"
+        accept-charset="UTF-8"
-          method="GET"
+        action="{{ pathway.url }}"
-        >
+        method="GET"
-          <input type="hidden" name="download" value="true" />
+      >
-        </form>
+        <input type="hidden" name="download" value="true" />
-      </div>
+      </form>
-      <div class="modal-footer">
+    </div>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+
-          Close
+    <!-- Footer -->
-        </button>
+    <div class="modal-action">
-        <button
+      <button
-          type="button"
+        type="button"
-          class="btn btn-primary"
+        class="btn"
-          id="download-pathway-csv-modal-submit"
+        onclick="this.closest('dialog').close()"
-        >
+        :disabled="isSubmitting"
-          Download
+      >
-        </button>
+        Close
-      </div>
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('download-pathway-csv-modal-form'); $el.closest('dialog').close();"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Download</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#download-pathway-csv-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#download-pathway-csv-modal-form").submit();
+</dialog>
-      $("#download_pathway_csv_modal").modal("hide");
-    });
-  });
-</script>

templates/modals/objects/download_pathway_image_modal.html

@@ -1,43 +1,57 @@
 {% load static %}
-<!-- Download Pathway -->
+
-<div id="download_pathway_image_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="download_pathway_image_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h3 class="modal-title">Download Pathway as Image</h3>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Download Pathway as Image</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        By clicking on Download the Pathway will be saved as SVG.
+      >
-      </div>
+        ✕
-      <div class="modal-footer">
+      </button>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+    </form>
-          Close
+
-        </button>
+    <!-- Body -->
-        <button
+    <div class="py-4">
-          type="button"
+      <p>By clicking on Download the Pathway will be saved as SVG.</p>
-          class="btn btn-primary"
+    </div>
-          id="download-pathway-image-modal-submit"
+
-        >
+    <!-- Footer -->
-          Download
+    <div class="modal-action">
-        </button>
+      <button
-      </div>
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="isSubmitting = true; downloadSVG(document.getElementById('pwsvg'), '{{ pathway.name.split|join:'_' }}.svg'); $el.closest('dialog').close();"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Download</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#download-pathway-image-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      downloadSVG($("#pwsvg")[0], '{{ pathway.name.split|join:"_" }}.svg');
+</dialog>
-      $("#download_pathway_image_modal").modal("hide");
-    });
-  });
-</script>

templates/modals/objects/edit_compound_modal.html

@@ -1,70 +1,91 @@
 {% load static %}
-<!-- Edit Compound -->
+
-<div id="edit_compound_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_compound_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h5 class="modal-title">Edit Compound</h5>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Edit Compound</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <p>Edit Compound.</p>
+      >
-        <form
+        ✕
-          id="edit-compound-modal-form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action=""
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          {% csrf_token %}
+        id="edit-compound-modal-form"
-          <p>
+        accept-charset="UTF-8"
-            <label for="compound-name">Name</label>
+        action=""
-            <input
+        method="post"
-              id="compound-name"
+      >
-              class="form-control"
+        {% csrf_token %}
-              name="compound-name"
+
-              value="{{ compound.name|safe }}"
+        <div class="form-control mb-3">
-            />
+          <label class="label" for="compound-name">
-          </p>
+            <span class="label-text">Name</span>
-          <p>
+          </label>
-            <label for="compound-description">Description</label>
+          <input
-            <input
+            id="compound-name"
-              id="compound-description"
+            class="input input-bordered w-full"
-              type="text"
+            name="compound-name"
-              class="form-control"
+            value="{{ compound.name|safe }}"
-              value="{{ compound.description|safe }}"
+            required
-              name="compound-description"
+          />
-            />
+        </div>
-          </p>
+
-        </form>
+        <div class="form-control mb-3">
-      </div>
+          <label class="label" for="compound-description">
-      <div class="modal-footer">
+            <span class="label-text">Description</span>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+          </label>
-          Close
+          <input
-        </button>
+            id="compound-description"
-        <button
+            type="text"
-          type="button"
+            class="input input-bordered w-full"
-          class="btn btn-primary"
+            value="{{ compound.description|safe }}"
-          id="edit-compound-modal-submit"
+            name="compound-description"
-        >
+          />
-          Update
+        </div>
-        </button>
+      </form>
-      </div>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('edit-compound-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-compound-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-compound-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_compound_structure_modal.html

@@ -1,70 +1,91 @@
 {% load static %}
-<!-- Edit Compound -->
+
-<div id="edit_compound_structure_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_compound_structure_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h5 class="modal-title">Create a Compound</h5>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Edit Compound Structure</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <p>Edit a Compound Structure.</p>
+      >
-        <form
+        ✕
-          id="edit-compound-structure-modal-form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action=""
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          {% csrf_token %}
+        id="edit-compound-structure-modal-form"
-          <p>
+        accept-charset="UTF-8"
-            <label for="compound-structure-name">Name</label>
+        action=""
-            <input
+        method="post"
-              id="compound-structure-name"
+      >
-              class="form-control"
+        {% csrf_token %}
-              name="compound-structure-name"
+
-              value="{{ compound_structure.name|safe }}"
+        <div class="form-control mb-3">
-            />
+          <label class="label" for="compound-structure-name">
-          </p>
+            <span class="label-text">Name</span>
-          <p>
+          </label>
-            <label for="compound-structure-description">Description</label>
+          <input
-            <input
+            id="compound-structure-name"
-              id="compound-structure-description"
+            class="input input-bordered w-full"
-              type="text"
+            name="compound-structure-name"
-              class="form-control"
+            value="{{ compound_structure.name|safe }}"
-              value="{{ compound_structure.description|safe }}"
+            required
-              name="compound-structure-description"
+          />
-            />
+        </div>
-          </p>
+
-        </form>
+        <div class="form-control mb-3">
-      </div>
+          <label class="label" for="compound-structure-description">
-      <div class="modal-footer">
+            <span class="label-text">Description</span>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+          </label>
-          Close
+          <input
-        </button>
+            id="compound-structure-description"
-        <button
+            type="text"
-          type="button"
+            class="input input-bordered w-full"
-          class="btn btn-primary"
+            value="{{ compound_structure.description|safe }}"
-          id="edit-compound-structure-modal-submit"
+            name="compound-structure-description"
-        >
+          />
-          Create
+        </div>
-        </button>
+      </form>
-      </div>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('edit-compound-structure-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-compound-structure-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-compound-structure-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_group_member_modal.html

@@ -1,151 +1,150 @@
 {% load static %}
-<!-- Edit Package Permission -->
+<!-- Edit Group Member -->
-<div id="edit_group_member_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_group_member_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="{
-        <h5 class="modal-title">Add or Remove Group Member</h5>
+    isSubmitting: false,
-        <button
-          type="button"
-          class="close"
-          data-dismiss="modal"
-          aria-label="Close"
-        >
-          <span aria-hidden="true">&times;</span>
-        </button>
-      </div>
-      <div class="modal-body">
-        <p>
-          To add member (either User or entire Groups) to this group select the
-          entity you want to add below and click the check mark.
-          <br />
-          To remove member simply click the <code>X</code> next to the member.
-        </p>
 
-        <div class="row">
+    reset() {
-          <div class="col-xs-8">
+      this.isSubmitting = false;
-            <legend>User or Group</legend>
+    },
-          </div>
-          <div class="col-xs-4">
-            <legend>Add/Remove</legend>
-          </div>
-        </div>
 
-        <div class="row">
+    submitForm(form) {
-          <form
+      if (form && form.checkValidity()) {
-            id="modal-form-group-member"
+        form.submit();
-            class="form-inline"
+      } else if (form) {
-            role="form"
+        form.reportValidity();
-            accept-charset="UTF-8"
+      }
-            action=""
+    }
-            data-remote="true"
+  }"
-            method="post"
+  @close="reset()"
-          >
+>
-            {% csrf_token %}
+  <div class="modal-box">
-            <div class="col-xs-8">
+    <!-- Header -->
-              <select
+    <h3 class="text-lg font-bold">Add or Remove Group Member</h3>
-                id="select_member"
+
-                name="member"
+    <!-- Close button (X) -->
-                data-actions-box="true"
+    <form method="dialog">
-                class="selPackages"
+      <button
-                data-width="100%"
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-              >
+        :disabled="isSubmitting"
-                <option disabled selected>User</option>
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <p class="mb-4">
+        To add member (either User or entire Groups) to this group select the
+        entity you want to add below and click the check mark.
+        <br />
+        To remove member simply click the X button next to the member.
+      </p>
+
+      <!-- Add Member Form -->
+      <form
+        id="modal-form-group-member"
+        accept-charset="UTF-8"
+        action=""
+        method="post"
+        class="mb-4"
+      >
+        {% csrf_token %}
+        <div class="flex gap-2 items-end">
+          <div class="form-control flex-1">
+            <label class="label">
+              <span class="label-text">User or Group</span>
+            </label>
+            <select
+              id="select_member"
+              name="member"
+              class="select select-bordered w-full"
+              required
+            >
+              <optgroup label="Users">
                 {% for u in users %}
                   <option value="{{ u.url }}">{{ u.username }}</option>
                 {% endfor %}
-                <option disabled>Groups</option>
+              </optgroup>
+              <optgroup label="Groups">
                 {% for g in groups %}
                   <option value="{{ g.url }}">{{ g.name|safe }}</option>
                 {% endfor %}
-              </select>
+              </optgroup>
-              <input type="hidden" name="action" value="add" />
+            </select>
-            </div>
+            <input type="hidden" name="action" value="add" />
-            <div class="col-xs-2"></div>
+          </div>
-            <div class="col-xs-2">
+          <button type="submit" class="btn btn-primary">Add</button>
-              <button type="submit" style="width:60%;" class="btn col-xs-2">
-                <span class="glyphicon glyphicon-ok"></span>
-              </button>
-            </div>
-          </form>
         </div>
-        <p></p>
+      </form>
-        {% for u in group.user_member.all %}
+
-          <div class="row">
+      <!-- User Members -->
+      {% if group.user_member.all %}
+        <div class="divider">User Members</div>
+        <div class="space-y-2">
+          {% for u in group.user_member.all %}
             <form
               id="modal-form-group-member_{{ u.uuid }}"
-              class="form-inline"
-              role="form"
               accept-charset="UTF-8"
               action=""
-              data-remote="true"
               method="post"
             >
               {% csrf_token %}
-              <div class="col-xs-8">
+              <div class="flex items-center gap-2">
-                {{ u.username }}
+                <span class="flex-1">{{ u.username }}</span>
                 <input type="hidden" name="member" value="{{ u.url }}" />
                 <input type="hidden" name="action" value="remove" />
-              </div>
+                <button type="submit" class="btn btn-error btn-sm">
-              <div class="col-xs-2"></div>
+                  Remove
-              <div class="col-xs-2">
-                <button type="submit" style="width:60%;" class="btn col-xs-2">
-                  <span class="glyphicon glyphicon-trash"></span>
                 </button>
               </div>
             </form>
-          </div>
+          {% endfor %}
-        {% endfor %}
+        </div>
-        <p></p>
+      {% endif %}
-        {% for g in group.group_member.all %}
+
-          <div class="row">
+      <!-- Group Members -->
+      {% if group.group_member.all %}
+        <div class="divider">Group Members</div>
+        <div class="space-y-2">
+          {% for g in group.group_member.all %}
             <form
               id="modal-form-group-member_{{ g.uuid }}"
-              class="form-inline"
-              role="form"
               accept-charset="UTF-8"
               action=""
-              data-remote="true"
               method="post"
             >
               {% csrf_token %}
-              <div class="col-xs-8">
+              <div class="flex items-center gap-2">
-                {{ g.name|safe }}
+                <span class="flex-1">{{ g.name|safe }}</span>
                 <input type="hidden" name="member" value="{{ g.url }}" />
                 <input type="hidden" name="action" value="remove" />
-              </div>
+                <button type="submit" class="btn btn-error btn-sm">
-              <div class="col-xs-2"></div>
+                  Remove
-              <div class="col-xs-2">
-                <button type="submit" style="width:60%;" class="btn col-xs-2">
-                  <span class="glyphicon glyphicon-trash"></span>
                 </button>
               </div>
             </form>
-          </div>
+          {% endfor %}
-        {% endfor %}
+        </div>
-      </div>
+      {% endif %}
-      <div class="modal-footer">
+    </div>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+
-          Close
+    <!-- Footer -->
-        </button>
+    <div class="modal-action">
-        <button
+      <button
-          type="button"
+        type="button"
-          class="btn btn-primary"
+        class="btn"
-          id="edit-package-modal-submit"
+        onclick="this.closest('dialog').close()"
-        >
+      >
-          Update
+        Close
-        </button>
+      </button>
-      </div>
     </div>
   </div>
-</div>
-<script>
-  $(function () {
-    $("#edit-package-modal-submit").click(function (e) {
-      e.preventDefault();
-      $("#edit-package-modal-form").submit();
-    });
 
-    $("#select_member").selectpicker();
+  <!-- Backdrop -->
-  });
+  <form method="dialog" class="modal-backdrop">
-</script>
+    <button>close</button>
+  </form>
+</dialog>

templates/modals/objects/edit_model_modal.html

@@ -1,71 +1,94 @@
 {% load static %}
-<!-- Edit Model -->
+
-<div id="edit_model_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_model_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <button
+  @close="reset()"
-          type="button"
+>
-          class="close"
+  <div class="modal-box">
-          data-dismiss="modal"
+    <!-- Header -->
-          aria-label="Close"
+    <h3 class="font-bold text-lg">Update Model</h3>
-        >
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-        </button>
+    <form method="dialog">
-        <h3 class="modal-title">Update Model</h3>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <p>Alter Name and Description of the Model.</p>
+      >
-        <form
+        ✕
-          id="edit-model-modal-form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action=""
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <p class="mb-4">Alter Name and Description of the Model.</p>
-          {% csrf_token %}
+
-          <p>
+      <form
-            <label for="model-name">Name</label>
+        id="edit-model-modal-form"
-            <input
+        accept-charset="UTF-8"
-              id="model-name"
+        action=""
-              type="text"
+        method="post"
-              class="form-control"
+      >
-              name="model-name"
+        {% csrf_token %}
-              value="{{ model.name|safe }}"
+
-            />
+        <div class="form-control mb-3">
-          </p>
+          <label class="label" for="model-name">
-          <p>
+            <span class="label-text">Name</span>
-            <label for="model-description">Description</label>
+          </label>
-            <input
+          <input
-              id="model-description"
+            id="model-name"
-              type="text"
+            type="text"
-              class="form-control"
+            class="input input-bordered w-full"
-              name="model-description"
+            name="model-name"
-              value="{{ model.description|safe }}"
+            value="{{ model.name|safe }}"
-            />
+            required
-          </p>
+          />
-        </form>
+        </div>
-      </div>
+
-      <div class="modal-footer">
+        <div class="form-control mb-3">
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+          <label class="label" for="model-description">
-          Close
+            <span class="label-text">Description</span>
-        </button>
+          </label>
-        <button
+          <input
-          type="button"
+            id="model-description"
-          class="btn btn-primary"
+            type="text"
-          id="edit-model-modal-submit"
+            class="input input-bordered w-full"
-        >
+            name="model-description"
-          Update
+            value="{{ model.description|safe }}"
-        </button>
+          />
-      </div>
+        </div>
+      </form>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('edit-model-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-model-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-model-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_node_modal.html

@@ -1,70 +1,91 @@
 {% load static %}
-<!-- Edit Node -->
+
-<div id="edit_node_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_node_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h5 class="modal-title">Edit Node</h5>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Edit Node</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <p>Edit Node.</p>
+      >
-        <form
+        ✕
-          id="edit-node-modal-form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action=""
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          {% csrf_token %}
+        id="edit-node-modal-form"
-          <p>
+        accept-charset="UTF-8"
-            <label for="node-name">Name</label>
+        action=""
-            <input
+        method="post"
-              id="node-name"
+      >
-              class="form-control"
+        {% csrf_token %}
-              name="node-name"
+
-              value="{{ node.name|safe }}"
+        <div class="form-control mb-3">
-            />
+          <label class="label" for="node-name">
-          </p>
+            <span class="label-text">Name</span>
-          <p>
+          </label>
-            <label for="node-description">Description</label>
+          <input
-            <input
+            id="node-name"
-              id="node-description"
+            class="input input-bordered w-full"
-              type="text"
+            name="node-name"
-              class="form-control"
+            value="{{ node.name|safe }}"
-              value="{{ node.description|safe }}"
+            required
-              name="node-description"
+          />
-            />
+        </div>
-          </p>
+
-        </form>
+        <div class="form-control mb-3">
-      </div>
+          <label class="label" for="node-description">
-      <div class="modal-footer">
+            <span class="label-text">Description</span>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+          </label>
-          Close
+          <input
-        </button>
+            id="node-description"
-        <button
+            type="text"
-          type="button"
+            class="input input-bordered w-full"
-          class="btn btn-primary"
+            value="{{ node.description|safe }}"
-          id="edit-node-modal-submit"
+            name="node-description"
-        >
+          />
-          Create
+        </div>
-        </button>
+      </form>
-      </div>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('edit-node-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-node-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-node-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_package_modal.html

@@ -1,70 +1,91 @@
 {% load static %}
-<!-- Edit Package -->
+
-<div id="edit_package_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_package_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h5 class="modal-title">Update Package</h5>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Update Package</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <p>Edit a Package.</p>
+      >
-        <form
+        ✕
-          id="edit-package-modal-form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action=""
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          {% csrf_token %}
+        id="edit-package-modal-form"
-          <p>
+        accept-charset="UTF-8"
-            <label for="package-name">Name</label>
+        action=""
-            <input
+        method="post"
-              id="package-name"
+      >
-              class="form-control"
+        {% csrf_token %}
-              name="package-name"
+
-              value="{{ package.name|safe }}"
+        <div class="form-control mb-3">
-            />
+          <label class="label" for="package-name">
-          </p>
+            <span class="label-text">Name</span>
-          <p>
+          </label>
-            <label for="package-description">Description</label>
+          <input
-            <input
+            id="package-name"
-              id="package-description"
+            class="input input-bordered w-full"
-              type="text"
+            name="package-name"
-              class="form-control"
+            value="{{ package.name|safe }}"
-              value="{{ package.description|safe }}"
+            required
-              name="package-description"
+          />
-            />
+        </div>
-          </p>
+
-        </form>
+        <div class="form-control mb-3">
-      </div>
+          <label class="label" for="package-description">
-      <div class="modal-footer">
+            <span class="label-text">Description</span>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+          </label>
-          Close
+          <input
-        </button>
+            id="package-description"
-        <button
+            type="text"
-          type="button"
+            class="input input-bordered w-full"
-          class="btn btn-primary"
+            value="{{ package.description|safe }}"
-          id="edit-package-modal-submit"
+            name="package-description"
-        >
+          />
-          Update
+        </div>
-        </button>
+      </form>
-      </div>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('edit-package-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-package-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-package-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_package_permissions_modal.html

@@ -1,264 +1,271 @@
 {% load static %}
-<!-- Edit Package Permission -->
+<!-- Edit Package Permissions -->
-<div id="edit_package_permissions_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_package_permissions_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="{
-        <h5 class="modal-title">Grant or Revoke Permissions</h5>
+    updatePermissions(checkbox) {
-        <button
+      const parts = checkbox.id.split('_');
-          type="button"
+      const perm = parts[0];
-          class="close"
+      const id = parts[1];
-          data-dismiss="modal"
-          aria-label="Close"
-        >
-          <span aria-hidden="true">&times;</span>
-        </button>
-      </div>
-      <div class="modal-body">
-        <p>
-          Modify permissions for this package. Note that if you give
-          <code>write</code> permissions to a user or group,
-          <code>read</code> permissions will be granted automatically.
-          <br />
-          To allow users to perform destructive actions, such as deleting the
-          package, <code>owner</code>
-          permissions must be granted.
-        </p>
 
-        <div class="row">
+      const readBox = document.getElementById('read_' + id);
-          <div class="col-xs-4">
+      const writeBox = document.getElementById('write_' + id);
-            <legend>User or Group</legend>
+      const ownerBox = document.getElementById('owner_' + id);
-          </div>
-          <div class="col-xs-2">
-            <legend>Read</legend>
-          </div>
-          <div class="col-xs-2">
-            <legend>Write</legend>
-          </div>
-          <div class="col-xs-2">
-            <legend>Owner</legend>
-          </div>
-        </div>
 
-        <div class="row">
+      if (perm === 'read' && !readBox.checked) {
-          <form
+        writeBox.checked = false;
-            id="modal-form-permissions"
+        ownerBox.checked = false;
-            class="form-inline"
+      }
-            role="form"
+
-            accept-charset="UTF-8"
+      if (perm === 'write') {
-            action=""
+        if (writeBox.checked) {
-            data-remote="true"
+          readBox.checked = true;
-            method="post"
+        } else {
-          >
+          ownerBox.checked = false;
-            {% csrf_token %}
+        }
-            <div class="col-xs-4">
+      }
-              <select
+
-                id="select_grantee"
+      if (perm === 'owner' && ownerBox.checked) {
-                name="grantee"
+        readBox.checked = true;
-                data-actions-box="true"
+        writeBox.checked = true;
-                class="selPackages"
+      }
-                data-width="100%"
+    }
-              >
+  }"
-                <option disabled selected>User</option>
+>
+  <div class="modal-box max-w-2xl">
+    <!-- Header -->
+    <h3 class="text-lg font-bold">Grant or Revoke Permissions</h3>
+
+    <!-- Close button (X) -->
+    <form method="dialog">
+      <button class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2">
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <p class="mb-4">
+        Modify permissions for this package. Note that if you give
+        <code class="badge badge-ghost">write</code> permissions to a user or
+        group, <code class="badge badge-ghost">read</code> permissions will be
+        granted automatically.
+        <br />
+        To allow users to perform destructive actions, such as deleting the
+        package, <code class="badge badge-ghost">owner</code> permissions must
+        be granted.
+      </p>
+
+      <!-- Add New Permission -->
+      <form
+        id="modal-form-permissions"
+        accept-charset="UTF-8"
+        action=""
+        method="post"
+        class="mb-4"
+      >
+        {% csrf_token %}
+        <div class="grid grid-cols-12 gap-2 items-end">
+          <div class="col-span-5">
+            <label class="label">
+              <span class="label-text">User or Group</span>
+            </label>
+            <select
+              id="select_grantee"
+              name="grantee"
+              class="select select-bordered w-full select-sm"
+              required
+            >
+              <optgroup label="Users">
                 {% for u in users %}
                   <option value="{{ u.url }}">{{ u.username }}</option>
                 {% endfor %}
-                <option disabled>Groups</option>
+              </optgroup>
+              <optgroup label="Groups">
                 {% for g in groups %}
                   <option value="{{ g.url }}">{{ g.name|safe }}</option>
                 {% endfor %}
-              </select>
+              </optgroup>
-            </div>
+            </select>
-            <div class="col-xs-2">
+          </div>
-              <input type="checkbox" name="read" id="read_new" />
+          <div class="col-span-2 text-center">
-            </div>
+            <label class="label justify-center">
-            <div class="col-xs-2">
+              <span class="label-text">Read</span>
-              <input type="checkbox" name="write" id="write_new" />
+            </label>
-            </div>
+            <input
-            <div class="col-xs-2">
+              type="checkbox"
-              <input type="checkbox" name="owner" id="owner_new" />
+              name="read"
-            </div>
+              id="read_new"
-            <div class="col-xs-2">
+              class="checkbox"
-              <button
+              @click="updatePermissions($el)"
-                type="submit"
+            />
-                style="width:60%;"
+          </div>
-                class="btn col-xs-2 modify-perm-button"
+          <div class="col-span-2 text-center">
-              >
+            <label class="label justify-center">
-                <span class="glyphicon glyphicon-plus"></span>
+              <span class="label-text">Write</span>
-              </button>
+            </label>
-            </div>
+            <input
-          </form>
+              type="checkbox"
+              name="write"
+              id="write_new"
+              class="checkbox"
+              @click="updatePermissions($el)"
+            />
+          </div>
+          <div class="col-span-2 text-center">
+            <label class="label justify-center">
+              <span class="label-text">Owner</span>
+            </label>
+            <input
+              type="checkbox"
+              name="owner"
+              id="owner_new"
+              class="checkbox"
+              @click="updatePermissions($el)"
+            />
+          </div>
+          <div class="col-span-1">
+            <button type="submit" class="btn btn-primary btn-sm">+</button>
+          </div>
         </div>
-        <p></p>
+      </form>
-        {% for up in user_permissions %}
+
-          <div class="row">
+      <!-- User Permissions -->
+      {% if user_permissions %}
+        <div class="divider">User Permissions</div>
+        <div class="space-y-2">
+          {% for up in user_permissions %}
             <form
               id="modal-form-permissions_{{ up.user.uuid }}"
-              class="form-inline"
-              role="form"
               accept-charset="UTF-8"
               action=""
-              data-remote="true"
               method="post"
             >
               {% csrf_token %}
-              <div class="col-xs-4">
+              <div class="grid grid-cols-12 gap-2 items-center">
-                {{ up.user.username }}
+                <div class="col-span-5 truncate">
-                <input type="hidden" name="grantee" value="{{ up.user.url }}" />
+                  {{ up.user.username }}
-              </div>
+                  <input
-              <div class="col-xs-2">
+                    type="hidden"
-                <input
+                    name="grantee"
-                  type="checkbox"
+                    value="{{ up.user.url }}"
-                  name="read"
+                  />
-                  id="read_{{ up.user.uuid }}"
+                </div>
-                  {% if up.has_read %}checked{% endif %}
+                <div class="col-span-2 text-center">
-                />
+                  <input
-              </div>
+                    type="checkbox"
-              <div class="col-xs-2">
+                    name="read"
-                <input
+                    id="read_{{ up.user.uuid }}"
-                  type="checkbox"
+                    class="checkbox"
-                  name="write"
+                    {% if up.has_read %}checked{% endif %}
-                  id="write_{{ up.user.uuid }}"
+                    @click="updatePermissions($el)"
-                  {% if up.has_write %}checked{% endif %}
+                  />
-                />
+                </div>
-              </div>
+                <div class="col-span-2 text-center">
-              <div class="col-xs-2">
+                  <input
-                <input
+                    type="checkbox"
-                  type="checkbox"
+                    name="write"
-                  name="owner"
+                    id="write_{{ up.user.uuid }}"
-                  id="owner_{{ up.user.uuid }}"
+                    class="checkbox"
-                  {% if up.has_all %}checked{% endif %}
+                    {% if up.has_write %}checked{% endif %}
-                />
+                    @click="updatePermissions($el)"
-              </div>
+                  />
-              <div class="col-xs-2">
+                </div>
-                <button
+                <div class="col-span-2 text-center">
-                  type="submit"
+                  <input
-                  style="width:60%;"
+                    type="checkbox"
-                  class="btn col-xs-2 modify-perm-button"
+                    name="owner"
-                >
+                    id="owner_{{ up.user.uuid }}"
-                  <span class="glyphicon glyphicon-ok"></span>
+                    class="checkbox"
-                </button>
+                    {% if up.has_all %}checked{% endif %}
+                    @click="updatePermissions($el)"
+                  />
+                </div>
+                <div class="col-span-1">
+                  <button type="submit" class="btn btn-sm btn-ghost">✓</button>
+                </div>
               </div>
             </form>
-          </div>
+          {% endfor %}
-        {% endfor %}
+        </div>
-        <p></p>
+      {% endif %}
-        {% for gp in group_permissions %}
+
-          <div class="row">
+      <!-- Group Permissions -->
+      {% if group_permissions %}
+        <div class="divider">Group Permissions</div>
+        <div class="space-y-2">
+          {% for gp in group_permissions %}
             <form
-              id="modal-form-permissions_{{ gp.user.uuid }}"
+              id="modal-form-permissions_{{ gp.group.uuid }}"
-              class="form-inline"
-              role="form"
               accept-charset="UTF-8"
               action=""
-              data-remote="true"
               method="post"
             >
               {% csrf_token %}
-              <div class="col-xs-4">
+              <div class="grid grid-cols-12 gap-2 items-center">
-                {{ gp.group.name|safe }}
+                <div class="col-span-5 truncate">
-                <input
+                  {{ gp.group.name|safe }}
-                  type="hidden"
+                  <input
-                  name="grantee"
+                    type="hidden"
-                  value="{{ gp.group.url }}"
+                    name="grantee"
-                />
+                    value="{{ gp.group.url }}"
-              </div>
+                  />
-              <div class="col-xs-2">
+                </div>
-                <input
+                <div class="col-span-2 text-center">
-                  type="checkbox"
+                  <input
-                  name="read"
+                    type="checkbox"
-                  id="read_{{ gp.group.uuid }}"
+                    name="read"
-                  {% if gp.has_read %}checked{% endif %}
+                    id="read_{{ gp.group.uuid }}"
-                />
+                    class="checkbox"
-              </div>
+                    {% if gp.has_read %}checked{% endif %}
-              <div class="col-xs-2">
+                    @click="updatePermissions($el)"
-                <input
+                  />
-                  type="checkbox"
+                </div>
-                  name="write"
+                <div class="col-span-2 text-center">
-                  id="write_{{ gp.group.uuid }}"
+                  <input
-                  {% if gp.has_write %}checked{% endif %}
+                    type="checkbox"
-                />
+                    name="write"
-              </div>
+                    id="write_{{ gp.group.uuid }}"
-              <div class="col-xs-2">
+                    class="checkbox"
-                <input
+                    {% if gp.has_write %}checked{% endif %}
-                  type="checkbox"
+                    @click="updatePermissions($el)"
-                  name="owner"
+                  />
-                  id="owner_{{ gp.group.uuid }}"
+                </div>
-                  {% if gp.has_all %}checked{% endif %}
+                <div class="col-span-2 text-center">
-                />
+                  <input
-              </div>
+                    type="checkbox"
-              <div class="col-xs-2">
+                    name="owner"
-                <button
+                    id="owner_{{ gp.group.uuid }}"
-                  type="submit"
+                    class="checkbox"
-                  style="width:60%;"
+                    {% if gp.has_all %}checked{% endif %}
-                  class="btn col-xs-2 modify-perm-button"
+                    @click="updatePermissions($el)"
-                >
+                  />
-                  <span class="glyphicon glyphicon-ok"></span>
+                </div>
-                </button>
+                <div class="col-span-1">
+                  <button type="submit" class="btn btn-sm btn-ghost">✓</button>
+                </div>
               </div>
             </form>
-          </div>
+          {% endfor %}
-        {% endfor %}
+        </div>
-      </div>
+      {% endif %}
-      <div class="modal-footer">
+    </div>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+
-          Close
+    <!-- Footer -->
-        </button>
+    <div class="modal-action">
-        <button
+      <button
-          type="button"
+        type="button"
-          class="btn btn-primary"
+        class="btn"
-          id="edit-package-modal-submit"
+        onclick="this.closest('dialog').close()"
-        >
+      >
-          Update
+        Close
-        </button>
+      </button>
-      </div>
     </div>
   </div>
-</div>
-<script>
-  function checkboxClick() {
-    // id looks like read_3cadef24-220e-4587-9fa5-0e9a17aca2da
-    parts = this.id.split("_");
-    perm = parts[0];
-    id = parts[1];
 
-    readbox = "#read_" + id;
+  <!-- Backdrop -->
-    writebox = "#write_" + id;
+  <form method="dialog" class="modal-backdrop">
-    ownerbox = "#owner_" + id;
+    <button>close</button>
-
+  </form>
-    if (perm == "read" && !$(readbox).prop("checked")) {
+</dialog>
-      $(writebox).prop("checked", false);
-      $(ownerbox).prop("checked", false);
-    }
-
-    if (perm == "write") {
-      if ($(writebox).prop("checked")) {
-        $(readbox).prop("checked", true);
-      }
-      if (!$(writebox).prop("checked")) {
-        $(ownerbox).prop("checked", false);
-      }
-    }
-
-    if (perm == "owner") {
-      if ($(ownerbox).prop("checked")) {
-        $(readbox).prop("checked", true);
-        $(writebox).prop("checked", true);
-      }
-    }
-  }
-
-  $(function () {
-    $("#edit-package-modal-submit").click(function (e) {
-      e.preventDefault();
-      $("#edit-package-modal-form").submit();
-    });
-
-    $("#select_grantee").selectpicker();
-
-    // Add click functions to permission checkboxes
-    $('[id^="read_"]').on("click", checkboxClick);
-    $('[id^="write_"]').on("click", checkboxClick);
-    $('[id^="owner_"]').on("click", checkboxClick);
-  });
-</script>

templates/modals/objects/edit_password_modal.html

@@ -1,82 +1,119 @@
 {% load static %}
-<!-- Edit Package -->
+
-<div id="edit_password_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_password_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h5 class="modal-title">Update your Password</h5>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Update your Password</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <p>To change your password please fill out the following inputs</p>
+      >
-        <form
+        ✕
-          id="edit-password-modal-form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action=""
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <p class="mb-4">
-          {% csrf_token %}
+        To change your password please fill out the following inputs
-          <p>
+      </p>
-            <label for="old-password">Old Password</label>
+
-            <input
+      <form
-              id="old-password"
+        id="edit-password-modal-form"
-              class="form-control"
+        accept-charset="UTF-8"
-              name="old-password"
+        action=""
-              type="password"
+        method="post"
-              autocomplete="current-password"
+      >
-            />
+        {% csrf_token %}
-          </p>
+        <input type="hidden" name="hidden" value="update-password" />
-          <p>
+
-            <label for="new-password">New Password</label>
+        <div class="form-control mb-3">
-            <input
+          <label class="label" for="old-password">
-              id="new-password"
+            <span class="label-text">Old Password</span>
-              class="form-control"
+          </label>
-              name="new-password"
+          <input
-              type="password"
+            id="old-password"
-              ,
+            class="input input-bordered w-full"
-              autocomplete="new-password"
+            name="old-password"
-            />
+            type="password"
-          </p>
+            autocomplete="current-password"
-          <p>
+            required
-            <label for="new-password-repeat">Repeat New Password</label>
+          />
-            <input
+        </div>
-              id="new-password-repeat"
+
-              class="form-control"
+        <div class="form-control mb-3">
-              name="new-password-repeat"
+          <label class="label" for="new-password">
-              type="password"
+            <span class="label-text">New Password</span>
-              autocomplete="new-password"
+          </label>
-            />
+          <input
-          </p>
+            id="new-password"
-        </form>
+            class="input input-bordered w-full"
-      </div>
+            name="new-password"
-      <div class="modal-footer">
+            type="password"
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+            autocomplete="new-password"
-          Close
+            required
-        </button>
+          />
-        <button
+        </div>
-          type="button"
+
-          class="btn btn-primary"
+        <div class="form-control mb-3">
-          id="edit-password-modal-submit"
+          <label class="label" for="new-password-repeat">
-        >
+            <span class="label-text">Repeat New Password</span>
-          Update
+          </label>
-        </button>
+          <input
-      </div>
+            id="new-password-repeat"
+            class="input input-bordered w-full"
+            name="new-password-repeat"
+            type="password"
+            autocomplete="new-password"
+            required
+            @input="validatePasswordMatch('new-password', 'new-password-repeat')"
+          />
+          <label class="label" x-show="errors['new-password-repeat']">
+            <span
+              class="label-text-alt text-error"
+              x-text="errors['new-password-repeat']"
+            ></span>
+          </label>
+        </div>
+      </form>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="if (validatePasswordMatch('new-password', 'new-password-repeat')) submit('edit-password-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-password-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-password-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_pathway_modal.html

@@ -1,72 +1,92 @@
 {% load static %}
-<!-- Edit Pathway -->
+
-<div id="edit_pathway_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_pathway_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h5 class="modal-title">Edit Pathway</h5>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Edit Pathway</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <p>Edit Pathway.</p>
+      >
-        <form
+        ✕
-          id="edit-pathway-modal-form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action=""
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          {% csrf_token %}
+        id="edit-pathway-modal-form"
-          <p>
+        accept-charset="UTF-8"
-            <label for="pathway-name">Name</label>
+        action=""
-            <input
+        method="post"
-              id="pathway-name"
+      >
-              class="form-control"
+        {% csrf_token %}
-              name="pathway-name"
+
-              value="{{ pathway.name|safe }}"
+        <div class="form-control mb-3">
-            />
+          <label class="label" for="pathway-name">
-          </p>
+            <span class="label-text">Name</span>
-          <p>
+          </label>
-            <label for="pathway-description">Description</label>
+          <input
-            <textarea
+            id="pathway-name"
-              id="pathway-description"
+            class="input input-bordered w-full"
-              type="text"
+            name="pathway-name"
-              class="form-control"
+            value="{{ pathway.name|safe }}"
-              name="pathway-description"
+            required
-              rows="10"
+          />
-            >
+        </div>
+
+        <div class="form-control mb-3">
+          <label class="label" for="pathway-description">
+            <span class="label-text">Description</span>
+          </label>
+          <textarea
+            id="pathway-description"
+            class="textarea textarea-bordered w-full"
+            name="pathway-description"
+            rows="10"
+          >
 {{ pathway.description|safe }}</textarea
-            >
+          >
-          </p>
+        </div>
-        </form>
+      </form>
-      </div>
+    </div>
-      <div class="modal-footer">
+
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+    <!-- Footer -->
-          Close
+    <div class="modal-action">
-        </button>
+      <button
-        <button
+        type="button"
-          type="button"
+        class="btn"
-          class="btn btn-primary"
+        onclick="this.closest('dialog').close()"
-          id="edit-pathway-modal-submit"
+        :disabled="isSubmitting"
-        >
+      >
-          Update
+        Close
-        </button>
+      </button>
-      </div>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('edit-pathway-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-pathway-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-pathway-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_prediction_setting_modal.html

@@ -1,163 +1,156 @@
 {% load static %}
-<!-- Edit Package -->
+<!-- Edit Prediction Setting -->
-<div id="update_prediction_settings_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="update_prediction_settings_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h5 class="modal-title">Update Prediction Setting</h5>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box max-w-3xl">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="text-lg font-bold">Update Prediction Setting</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <p>
+      >
-          To update your prediction setting modify parameters in the form below
+        ✕
-          und click "Update"
+      </button>
-        </p>
+    </form>
-        <form
+
-          id="edit-prediction-setting-modal-form"
+    <!-- Body -->
-          accept-charset="UTF-8"
+    <div class="py-4">
-          action=""
+      <p class="mb-4">
-          data-remote="true"
+        To update your prediction setting modify parameters in the form below
-          method="post"
+        and click "Update"
-        >
+      </p>
-          {% csrf_token %}
+      <form
-          <div id="prediction-setting" class="panel-collapse in collapse">
+        id="edit-prediction-setting-modal-form"
-            <div class="panel-body list-group-item">
+        accept-charset="UTF-8"
-              <table class="table-bordered table-hover table">
+        action=""
-                <tr style="background-color: rgba(0, 0, 0, 0.08);">
+        method="post"
-                  <th scope="col" width="20%">Parameter</th>
+      >
-                  <th scope="col" width="80%">Value</th>
+        {% csrf_token %}
+        <div class="overflow-x-auto">
+          <table class="table table-zebra w-full">
+            <thead>
+              <tr>
+                <th class="w-1/5">Parameter</th>
+                <th class="w-4/5">Value</th>
+              </tr>
+            </thead>
+            <tbody>
+              {% if 'model' in user.prediction_settings %}
+                <tr>
+                  <td>Model</td>
+                  <td>
+                    <div class="form-control">
+                      <select
+                        id="model"
+                        name="model"
+                        class="select select-bordered w-full"
+                      >
+                        {% for m in models %}
+                          <option
+                            value="{{ m.id }}"
+                            {% if user.prediction_settings.model.url == m.url %}selected{% endif %}
+                          >
+                            {{ m.name|safe }}
+                          </option>
+                        {% endfor %}
+                      </select>
+                    </div>
+                    {% for k, v in user.prediction_settings.model_parameters.items %}
+                      {% if k == 'threshold' %}
+                        <div class="form-control mt-2">
+                          <label class="label">
+                            <span class="label-text">Threshold</span>
+                          </label>
+                          <input
+                            type="number"
+                            class="input input-bordered w-full"
+                            name="{{ k }}"
+                            value="{{ v }}"
+                            min="0"
+                            max="1"
+                            step="0.05"
+                          />
+                        </div>
+                      {% endif %}
+                    {% endfor %}
+                  </td>
                 </tr>
-                <tbody>
+              {% endif %}
-                  {% if 'model' in user.prediction_settings %}
+              {% for k, v in user.prediction_settings.truncator.items %}
-                    <tr>
+                <tr>
-                      <td width="20%">Model</td>
+                  <td>
-                      <td width="80%">
+                    {% if k == 'max_nodes' %}
-                        <table
+                      Max Nodes
-                          width="100%"
+                    {% elif k == 'max_depth' %}
-                          class="table-bordered table-hover table"
+                      Max Depth
-                        >
+                    {% endif %}
-                          <tbody>
+                  </td>
-                            <tr>
+                  <td>
-                              <td colspan="2">
+                    {% if k == 'max_nodes' %}
-                                <select
+                      <input
-                                  id="model"
+                        type="number"
-                                  name="model"
+                        class="input input-bordered w-full"
-                                  class="form-control"
+                        name="{{ k }}"
-                                  data-width="100%"
+                        value="{{ v }}"
-                                >
+                        min="1"
-                                  {% for m in models %}
+                        max="50"
-                                    <option
+                        step="1"
-                                      value="{{ m.id }}"
+                      />
-                                      {% if user.prediction_settings.model.url == m.url %}selected{% endif %}
+                    {% elif k == 'max_depth' %}
-                                    >
+                      <input
-                                      {{ m.name|safe }}
+                        type="number"
-                                    </option>
+                        class="input input-bordered w-full"
-                                  {% endfor %}
+                        name="{{ k }}"
-                                </select>
+                        value="{{ v }}"
-                              </td>
+                        min="1"
-                            </tr>
+                        max="8"
-                            {% for k, v in user.prediction_settings.model_parameters.items %}
+                        step="1"
-                              <tr>
+                      />
-                                <th width="20%">Model Parameter</th>
+                    {% endif %}
-                                <th width="80%">Parameter Value</th>
+                  </td>
-                              </tr>
+                </tr>
-                              <tr>
+              {% endfor %}
-                                <td width="20%">
+            </tbody>
-                                  {% if k == 'threshold' %}
+          </table>
-                                    Threshold
+        </div>
-                                  {% endif %}
+      </form>
-                                </td>
+    </div>
-                                <td width="80%">
+
-                                  {% if k == 'threshold' %}
+    <!-- Footer -->
-                                    <input
+    <div class="modal-action">
-                                      type="number"
+      <button
-                                      class="form-control"
+        type="button"
-                                      name="{{ k }}"
+        class="btn"
-                                      value="{{ v }}"
+        onclick="this.closest('dialog').close()"
-                                      min="0"
+        :disabled="isSubmitting"
-                                      max="1"
+      >
-                                      step="0.05"
+        Close
-                                    />
+      </button>
-                                  {% endif %}
+      <button
-                                </td>
+        type="button"
-                              </tr>
+        class="btn btn-primary"
-                            {% endfor %}
+        @click="submit('edit-prediction-setting-modal-form')"
-                          </tbody>
+        :disabled="isSubmitting"
-                        </table>
+      >
-                      </td>
+        <span x-show="!isSubmitting">Update</span>
-                    </tr>
+        <span
-                  {% endif %}
+          x-show="isSubmitting"
-                  {% for k, v in user.prediction_settings.truncator.items %}
+          class="loading loading-spinner loading-sm"
-                    <tr>
+        ></span>
-                      <td>
+        <span x-show="isSubmitting">Updating...</span>
-                        <p>
+      </button>
-                          {% if k == 'max_nodes' %}
-                            Max Nodes
-                          {% elif k == 'max_depth' %}
-                            Max Depth
-                          {% endif %}
-                        </p>
-                      </td>
-                      <td>
-                        <p>
-                          {% if k == 'max_nodes' %}
-                            <input
-                              type="number"
-                              class="form-control"
-                              name="{{ k }}"
-                              value="{{ v }}"
-                              min="1"
-                              max="50"
-                              step="1"
-                            />
-                          {% elif k == 'max_depth' %}
-                            <input
-                              type="number"
-                              class="form-control"
-                              name="{{ k }}"
-                              value="{{ v }}"
-                              min="1"
-                              max="8"
-                              step="1"
-                            />
-                          {% endif %}
-                        </p>
-                      </td>
-                    </tr>
-                  {% endfor %}
-                </tbody>
-              </table>
-            </div>
-          </div>
-        </form>
-      </div>
-      <div class="modal-footer">
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
-          Close
-        </button>
-        <button
-          type="button"
-          class="btn btn-primary"
-          id="edit-prediction-setting-modal-submit"
-        >
-          Update
-        </button>
-      </div>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-prediction-setting-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-prediction-setting-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_reaction_modal.html

@@ -1,69 +1,91 @@
 {% load static %}
-<!-- Edit Reaction -->
+
-<div id="edit_reaction_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_reaction_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <button
+  @close="reset()"
-          type="button"
+>
-          class="close"
+  <div class="modal-box">
-          data-dismiss="modal"
+    <!-- Header -->
-          aria-label="Close"
+    <h3 class="font-bold text-lg">Update Reaction</h3>
-        >
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-        </button>
+    <form method="dialog">
-        <h3 class="modal-title">Update Reaction</h3>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <form
+      >
-          id="edit-reaction-modal-form"
+        ✕
-          accept-charset="UTF-8"
+      </button>
-          action=""
+    </form>
-          data-remote="true"
+
-          method="post"
+    <!-- Body -->
-        >
+    <div class="py-4">
-          {% csrf_token %}
+      <form
-          <p>
+        id="edit-reaction-modal-form"
-            <label for="reaction-name">Name</label>
+        accept-charset="UTF-8"
-            <input
+        action=""
-              id="reaction-name"
+        method="post"
-              class="form-control"
+      >
-              name="reaction-name"
+        {% csrf_token %}
-              value="{{ reaction.name|safe }}"
+
-            />
+        <div class="form-control mb-3">
-          </p>
+          <label class="label" for="reaction-name">
-          <p>
+            <span class="label-text">Name</span>
-            <label for="reaction-description">Description</label>
+          </label>
-            <input
+          <input
-              id="reaction-description"
+            id="reaction-name"
-              type="text"
+            class="input input-bordered w-full"
-              class="form-control"
+            name="reaction-name"
-              value="{{ reaction.description|safe }}"
+            value="{{ reaction.name|safe }}"
-              name="reaction-description"
+            required
-            />
+          />
-          </p>
+        </div>
-        </form>
+
-      </div>
+        <div class="form-control mb-3">
-      <div class="modal-footer">
+          <label class="label" for="reaction-description">
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+            <span class="label-text">Description</span>
-          Close
+          </label>
-        </button>
+          <input
-        <button
+            id="reaction-description"
-          type="button"
+            type="text"
-          class="btn btn-primary"
+            class="input input-bordered w-full"
-          id="edit-reaction-modal-submit"
+            value="{{ reaction.description|safe }}"
-        >
+            name="reaction-description"
-          Update
+          />
-        </button>
+        </div>
-      </div>
+      </form>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('edit-reaction-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-reaction-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-reaction-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_rule_modal.html

@@ -1,69 +1,91 @@
 {% load static %}
-<!-- Edit Rule -->
+
-<div id="edit_rule_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_rule_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <button
+  @close="reset()"
-          type="button"
+>
-          class="close"
+  <div class="modal-box">
-          data-dismiss="modal"
+    <!-- Header -->
-          aria-label="Close"
+    <h3 class="font-bold text-lg">Update Rule</h3>
-        >
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-        </button>
+    <form method="dialog">
-        <h3 class="modal-title">Update Rule</h3>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <form
+      >
-          id="edit-rule-modal-form"
+        ✕
-          accept-charset="UTF-8"
+      </button>
-          action=""
+    </form>
-          data-remote="true"
+
-          method="post"
+    <!-- Body -->
-        >
+    <div class="py-4">
-          {% csrf_token %}
+      <form
-          <p>
+        id="edit-rule-modal-form"
-            <label for="rule-name">Name</label>
+        accept-charset="UTF-8"
-            <input
+        action=""
-              id="rule-name"
+        method="post"
-              class="form-control"
+      >
-              name="rule-name"
+        {% csrf_token %}
-              value="{{ rule.name|safe }}"
+
-            />
+        <div class="form-control mb-3">
-          </p>
+          <label class="label" for="rule-name">
-          <p>
+            <span class="label-text">Name</span>
-            <label for="rule-description">Description</label>
+          </label>
-            <input
+          <input
-              id="rule-description"
+            id="rule-name"
-              type="text"
+            class="input input-bordered w-full"
-              class="form-control"
+            name="rule-name"
-              value="{{ rule.description|safe }}"
+            value="{{ rule.name|safe }}"
-              name="rule-description"
+            required
-            />
+          />
-          </p>
+        </div>
-        </form>
+
-      </div>
+        <div class="form-control mb-3">
-      <div class="modal-footer">
+          <label class="label" for="rule-description">
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+            <span class="label-text">Description</span>
-          Close
+          </label>
-        </button>
+          <input
-        <button
+            id="rule-description"
-          type="button"
+            type="text"
-          class="btn btn-primary"
+            class="input input-bordered w-full"
-          id="edit-rule-modal-submit"
+            value="{{ rule.description|safe }}"
-        >
+            name="rule-description"
-          Update
+          />
-        </button>
+        </div>
-      </div>
+      </form>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('edit-rule-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-rule-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-rule-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/edit_user_modal.html

@@ -1,110 +1,128 @@
 {% load static %}
-<!-- Edit User -->
+
-<div id="edit_user_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="edit_user_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h5 class="modal-title">Update User Defaults</h5>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Update User Defaults</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
-        <p>Edit User Defaults.</p>
+      >
-        <form
+        ✕
-          id="edit-user-modal-form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action=""
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          {% csrf_token %}
+        id="edit-user-modal-form"
-          <p>
+        accept-charset="UTF-8"
-            <label for="default-package">Default Package</label>
+        action=""
-            <select
+        method="post"
-              id="default-package"
+      >
-              name="default-package"
+        {% csrf_token %}
-              class="form-control"
+
-              data-width="100%"
+        <div class="form-control mb-3">
-            >
+          <label class="label" for="default-package">
-              <option disabled>Select a Package</option>
+            <span class="label-text">Default Package</span>
-              {% for p in meta.writeable_packages %}
+          </label>
-                <option
+          <select
-                  value="{{ p.url }}"
+            id="default-package"
-                  {% if p.id == meta.user.default_package.id %}selected{% endif %}
+            name="default-package"
-                >
+            class="select select-bordered w-full"
-                  {{ p.name|safe }}
+          >
-                </option>
+            <option disabled>Select a Package</option>
-              {% endfor %}
+            {% for p in meta.writeable_packages %}
-            </select>
+              <option
-          </p>
+                value="{{ p.url }}"
-          <p>
+                {% if p.id == meta.user.default_package.id %}selected{% endif %}
-            <label for="default-group">Default Group</label>
+              >
-            <select
+                {{ p.name|safe }}
-              id="default-group"
+              </option>
-              name="default-group"
+            {% endfor %}
-              class="form-control"
+          </select>
-              data-width="100%"
+        </div>
-            >
+
-              <option disabled>Select a Group</option>
+        <div class="form-control mb-3">
-              {% for g in meta.available_groups %}
+          <label class="label" for="default-group">
-                <option
+            <span class="label-text">Default Group</span>
-                  value="{{ g.url }}"
+          </label>
-                  {% if g.id == meta.user.default_group.id %}selected{% endif %}
+          <select
-                >
+            id="default-group"
-                  {{ g.name|safe }}
+            name="default-group"
-                </option>
+            class="select select-bordered w-full"
-              {% endfor %}
+          >
-            </select>
+            <option disabled>Select a Group</option>
-          </p>
+            {% for g in meta.available_groups %}
-          <p>
+              <option
-            <label for="default-prediction-setting"
+                value="{{ g.url }}"
-              >Default Prediction Setting</label
+                {% if g.id == meta.user.default_group.id %}selected{% endif %}
-            >
+              >
-            <select
+                {{ g.name|safe }}
-              id="default-prediction-setting"
+              </option>
-              name="default-prediction-setting"
+            {% endfor %}
-              class="form-control"
+          </select>
-              data-width="100%"
+        </div>
-            >
+
-              <option disabled>Select a Setting</option>
+        <div class="form-control mb-3">
-              {% for s in meta.available_settings %}
+          <label class="label" for="default-prediction-setting">
-                <option
+            <span class="label-text">Default Prediction Setting</span>
-                  value="{{ s.url }}"
+          </label>
-                  {% if s.id == meta.user.default_setting.id %}selected{% endif %}
+          <select
-                >
+            id="default-prediction-setting"
-                  {{ s.name|safe }}
+            name="default-prediction-setting"
-                </option>
+            class="select select-bordered w-full"
-              {% endfor %}
+          >
-            </select>
+            <option disabled>Select a Setting</option>
-          </p>
+            {% for s in meta.available_settings %}
-        </form>
+              <option
-      </div>
+                value="{{ s.url }}"
-      <div class="modal-footer">
+                {% if s.id == meta.user.default_setting.id %}selected{% endif %}
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+              >
-          Close
+                {{ s.name|safe }}
-        </button>
+              </option>
-        <button
+            {% endfor %}
-          type="button"
+          </select>
-          class="btn btn-primary"
+        </div>
-          id="edit-user-modal-submit"
+      </form>
-        >
+    </div>
-          Update
+
-        </button>
+    <!-- Footer -->
-      </div>
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('edit-user-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-user-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-user-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/evaluate_model_modal.html

@@ -1,93 +1,123 @@
-<div
+<dialog
-  class="modal fade"
-  tabindex="-1"
   id="evaluate_model_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="evaluate_model_modal"
+  x-data="modalForm()"
-  aria-hidden="true"
+  @close="reset()"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-3xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Evaluate Model</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h4 class="modal-title">Evaluate Model</h4>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-body">
+      >
-        <form
+        ✕
-          id="evaluate_model_form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action="{{ current_object.url }}"
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          {% csrf_token %}
+        id="evaluate_model_form"
-          <div class="jumbotron">
+        accept-charset="UTF-8"
+        action="{{ current_object.url }}"
+        method="post"
+      >
+        {% csrf_token %}
+        <div class="alert alert-info mb-4">
+          <span>
             For evaluation, you need to select the packages you want to use.
             While the model is evaluating, you can use the model for
             predictions.
-          </div>
+          </span>
-          <!-- Evaluation Packages -->
+        </div>
-          <label for="model-evaluation-packages">Evaluation Packages</label>
+
+        <!-- Evaluation Packages -->
+        <div class="form-control">
+          <label class="label" for="model-evaluation-packages">
+            <span class="label-text">Evaluation Packages</span>
+          </label>
           <select
             id="model-evaluation-packages"
             name="model-evaluation-packages"
-            data-actions-box="true"
+            class="select select-bordered w-full h-48"
-            class="form-control"
             multiple
-            data-width="100%"
+            required
           >
-            <option disabled>Reviewed Packages</option>
+            <optgroup label="Reviewed Packages">
-            {% for obj in meta.readable_packages %}
+              {% for obj in meta.readable_packages %}
-              {% if obj.reviewed %}
+                {% if obj.reviewed %}
-                <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
+                  <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
-              {% endif %}
+                {% endif %}
-            {% endfor %}
+              {% endfor %}
-
+            </optgroup>
-            <option disabled>Unreviewed Packages</option>
+            <optgroup label="Unreviewed Packages">
-            {% for obj in meta.readable_packages %}
+              {% for obj in meta.readable_packages %}
-              {% if not obj.reviewed %}
+                {% if not obj.reviewed %}
-                <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
+                  <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
-              {% endif %}
+                {% endif %}
-            {% endfor %}
+              {% endfor %}
+            </optgroup>
           </select>
+          <label class="label">
+            <span class="label-text-alt"
+              >Hold Ctrl/Cmd to select multiple packages</span
+            >
+          </label>
+        </div>
 
-          <!-- Eval Type -->
+        <!-- Eval Type -->
-          <label for="model-evaluation-type">Evaluation Type</label>
+        <div class="form-control mt-4">
+          <label class="label" for="model-evaluation-type">
+            <span class="label-text">Evaluation Type</span>
+          </label>
           <select
             id="model-evaluation-type"
             name="model-evaluation-type"
-            class="form-control"
+            class="select select-bordered w-full"
+            required
           >
-            <option disabled selected>Select evaluation type</option>
+            <option value="" disabled selected>Select evaluation type</option>
             <option value="sg">Single Generation</option>
             <option value="mg">Multiple Generations</option>
           </select>
+        </div>
 
-          <input type="hidden" name="hidden" value="evaluate" />
+        <input type="hidden" name="hidden" value="evaluate" />
-        </form>
+      </form>
-      </div>
+    </div>
-      <div class="modal-footer">
+
-        <a id="evaluate_model_form_submit" class="btn btn-primary" href="#"
+    <!-- Footer -->
-          >Evaluate</a
+    <div class="modal-action">
-        >
+      <button
-        <button type="button" class="btn btn-default" data-dismiss="modal">
+        type="button"
-          Cancel
+        class="btn"
-        </button>
+        onclick="this.closest('dialog').close()"
-      </div>
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('evaluate_model_form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Evaluate</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Evaluating...</span>
+      </button>
     </div>
   </div>
-</div>
 
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#model-evaluation-packages").selectpicker();
+    <button :disabled="isSubmitting">close</button>
-
+  </form>
-    $("#evaluate_model_form_submit").on("click", function (e) {
+</dialog>
-      e.preventDefault();
-      $("#evaluate_model_form").submit();
-    });
-  });
-</script>

templates/modals/objects/export_package_modal.html

@@ -1,53 +1,56 @@
 {% load static %}
-<!-- Export Package -->
+
-<div id="export_package_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="export_package_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h3 class="modal-title">Export Package as JSON</h3>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Export Package as JSON</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <p>
         By clicking on Export the Package will be serialized into a JSON and
-        directly downloaded.
+        opened in a new tab.
-        <form
+      </p>
-          id="export-package-modal-form"
+    </div>
-          accept-charset="UTF-8"
+
-          action="{{ package.url }}"
+    <!-- Footer -->
-          data-remote="true"
+    <div class="modal-action">
-          method="GET"
+      <button
-        >
+        type="button"
-          <input type="hidden" name="export" value="true" />
+        class="btn"
-        </form>
+        onclick="this.closest('dialog').close()"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-footer">
+      >
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+        Close
-          Close
+      </button>
-        </button>
+      <button
-        <button
+        type="button"
-          type="button"
+        class="btn btn-primary"
-          class="btn btn-primary"
+        @click="window.open('{{ package.url }}?export=true', '_blank'); $el.closest('dialog').close();"
-          id="export-package-modal-form-submit"
+        :disabled="isSubmitting"
-        >
+      >
-          Export
+        Export
-        </button>
+      </button>
-      </div>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#export-package-modal-form-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#export-package-modal-form").submit();
+</dialog>
-      $("#export_package_modal").modal("hide");
-    });
-  });
-</script>

templates/modals/objects/generic_copy_object_modal.html

@@ -1,109 +1,142 @@
 {% load static %}
 <!-- Copy Object -->
-<div id="generic_copy_object_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="generic_copy_object_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="{
-        <h3 class="modal-title">Copy {{ object_type|capfirst }}</h3>
+    isSubmitting: false,
-        <button
+    errorMessage: '',
-          type="button"
+    targetPackage: '',
-          class="close"
+
-          data-dismiss="modal"
+    reset() {
-          aria-label="Close"
+      this.isSubmitting = false;
-        >
+      this.errorMessage = '';
-          <span aria-hidden="true">&times;</span>
+      this.targetPackage = '';
-        </button>
+    },
-      </div>
+
-      <div class="modal-body">
+    async submit() {
-        <form
+      if (!this.targetPackage) return;
-          id="generic-copy-object-modal-form"
+
-          accept-charset="UTF-8"
+      this.isSubmitting = true;
-          data-remote="true"
+      this.errorMessage = '';
-          method="post"
+
-        >
+      try {
-          {% csrf_token %}
+        const response = await fetch(this.targetPackage, {
-          <label for="target-package"
+          method: 'POST',
-            >Select the Target Package you want to copy this {{ object_type }}
+          headers: {
-            into</label
+            'Content-Type': 'application/x-www-form-urlencoded',
-          >
+            'X-CSRFToken': document.querySelector('[name=csrfmiddlewaretoken]').value
+          },
+          body: new URLSearchParams({
+            hidden: 'copy',
+            object_to_copy: '{{ current_object.url }}'
+          })
+        });
+
+        const data = await response.json();
+
+        if (response.ok) {
+          window.location.href = data.success;
+        } else {
+          if (data.error && data.error.indexOf('to the same package') > -1) {
+            this.errorMessage = 'The target Package is the same as the source Package. Please select another target!';
+          } else {
+            this.errorMessage = data.error || 'An error occurred';
+          }
+        }
+      } catch (error) {
+        this.errorMessage = 'An error occurred while copying';
+      } finally {
+        this.isSubmitting = false;
+      }
+    }
+  }"
+  @close="reset()"
+>
+  <div class="modal-box">
+    <!-- Header -->
+    <h3 class="text-lg font-bold">Copy {{ object_type|capfirst }}</h3>
+
+    <!-- Close button (X) -->
+    <form method="dialog">
+      <button
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <form
+        id="generic-copy-object-modal-form"
+        accept-charset="UTF-8"
+        method="post"
+      >
+        {% csrf_token %}
+        <div class="form-control">
+          <label class="label" for="target-package">
+            <span class="label-text">
+              Select the Target Package you want to copy this {{ object_type }}
+              into
+            </span>
+          </label>
           <select
             id="target-package"
             name="target-package"
-            data-actions-box="true"
+            class="select select-bordered w-full"
-            class="form-control"
+            x-model="targetPackage"
-            data-width="100%"
+            required
           >
-            <option disabled selected>Select Target Package</option>
+            <option value="" disabled selected>Select Target Package</option>
             {% for p in meta.writeable_packages %}
               <option value="{{ p.url }}">{{ p.name|safe }}</option>
-              `
             {% endfor %}
           </select>
-          <input type="hidden" name="hidden" value="copy" />
+        </div>
-        </form>
+        <input type="hidden" name="hidden" value="copy" />
-        <div
+      </form>
-          id="copy-object-error-message"
+
-          class="alert alert-danger"
+      <!-- Error Message -->
-          role="alert"
+      <div
-          style="display: none"
+        x-show="errorMessage"
-        ></div>
+        x-cloak
-      </div>
+        class="alert alert-error mt-4"
-      <div class="modal-footer">
+        role="alert"
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+      >
-          Close
+        <span x-text="errorMessage"></span>
-        </button>
-        <button
-          type="button"
-          class="btn btn-primary"
-          id="generic-copy-object-modal-form-submit"
-        >
-          Copy
-        </button>
       </div>
     </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit()"
+        :disabled="isSubmitting || !targetPackage"
+      >
+        <span x-show="!isSubmitting">Copy</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Copying...</span>
+      </button>
+    </div>
   </div>
-</div>
-<script>
-  $(function () {
-    $("#generic-copy-object-modal-form-submit").click(function (e) {
-      e.preventDefault();
-      $("#copy-object-error-message").hide();
 
-      const packageUrl = $("#target-package").find(":selected").val();
+  <!-- Backdrop -->
-
+  <form method="dialog" class="modal-backdrop">
-      if (
+    <button :disabled="isSubmitting">close</button>
-        packageUrl === "Select Target Package" ||
+  </form>
-        packageUrl === "" ||
+</dialog>
-        packageUrl === null ||
-        packageUrl === undefined
-      ) {
-        return;
-      }
-      const formData = {
-        hidden: "copy",
-        object_to_copy: "{{ current_object.url }}",
-      };
-
-      $.ajax({
-        type: "post",
-        data: formData,
-        url: packageUrl,
-        success: function (data, textStatus) {
-          window.location.href = data.success;
-        },
-        error: function (jqXHR, textStatus, errorThrown) {
-          if (jqXHR.responseJSON.error.indexOf("to the same package") > -1) {
-            $("#copy-object-error-message").append(
-              "<p>The target Package is the same as the source Package. Please select another target!</p>",
-            );
-          } else {
-            $("#copy-object-error-message").append(
-              "<p>" + jqXHR.responseJSON.error + "</p>",
-            );
-          }
-          $("#copy-object-error-message").show();
-        },
-      });
-    });
-  });
-</script>

templates/modals/objects/generic_delete_modal.html

@@ -1,58 +1,99 @@
 {% load static %}
-<!-- Delete Object -->
+<!--
-<div id="generic_delete_modal" class="modal" tabindex="-1">
+  Generic Delete Modal - Delete object with confirmation
-  <div class="modal-dialog">
+
-    <div class="modal-content">
+  Migrated from Bootstrap + jQuery to DaisyUI + Alpine.js
-      <div class="modal-header">
+  Uses native <dialog> element with .showModal() API
-        <h3 class="modal-title">Delete {{ object_type|capfirst }}</h3>
+-->
-        <button
+
-          type="button"
+<dialog
-          class="close"
+  id="generic_delete_modal"
-          data-dismiss="modal"
+  class="modal"
-          aria-label="Close"
+  x-data="modalForm()"
+  @close="reset()"
+>
+  <div class="modal-box">
+    <!-- Header -->
+    <h3 class="font-bold text-lg">Delete {{ object_type|capfirst }}</h3>
+
+    <!-- Close button (X) -->
+    <form method="dialog">
+      <button
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <!-- Warning message -->
+      <div class="alert alert-warning">
+        <svg
+          xmlns="http://www.w3.org/2000/svg"
+          class="stroke-current shrink-0 h-6 w-6"
+          fill="none"
+          viewBox="0 0 24 24"
         >
-          <span aria-hidden="true">&times;</span>
+          <path
-        </button>
+            stroke-linecap="round"
-      </div>
+            stroke-linejoin="round"
-      <div class="modal-body">
+            stroke-width="2"
-        {% if object_type == 'user' %}
+            d="M12 9v2m0 4h.01m-6.938 4h13.856c1.54 0 2.502-1.667 1.732-3L13.732 4c-.77-1.333-2.694-1.333-3.464 0L3.34 16c-.77 1.333.192 3 1.732 3z"
-          Clicking "Delete" will <strong>permanently</strong> delete the User
+          />
-          and associated data. This action can't be undone!
+        </svg>
-        {% else %}
+        <span>
-          Deletes the {{ object_type|capfirst }}. Related objects that depend on
+          {% if object_type == 'user' %}
-          this {{ object_type|capfirst }} will be deleted as well.
+            Clicking "Delete" will <strong>permanently</strong> delete the User
-        {% endif %}
+            and associated data. This action can't be undone!
-        <form
+          {% else %}
-          id="generic-delete-modal-form"
+            Deletes the {{ object_type|capfirst }}. Related objects that depend
-          accept-charset="UTF-8"
+            on this {{ object_type|capfirst }} will be deleted as well.
-          action="{{ current_object.url }}"
+          {% endif %}
-          data-remote="true"
+        </span>
-          method="post"
-        >
-          {% csrf_token %}
-          <input type="hidden" id="hidden" name="hidden" value="delete" />
-        </form>
-      </div>
-      <div class="modal-footer">
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
-          Close
-        </button>
-        <button
-          type="button"
-          class="btn btn-primary"
-          id="generic-delete-modal-form-submit"
-        >
-          Delete
-        </button>
       </div>
+
+      <!-- Hidden form -->
+      <form
+        id="generic-delete-modal-form"
+        accept-charset="UTF-8"
+        action="{{ current_object.url }}"
+        method="post"
+      >
+        {% csrf_token %}
+        <input type="hidden" name="hidden" value="delete" />
+      </form>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-error"
+        @click="submit('generic-delete-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Delete</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Deleting...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop (click to close) -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#generic-delete-modal-form-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#generic-delete-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/generic_set_aliases_modal.html

@@ -1,213 +1,173 @@
 {% load static %}
 
-<style>
+<dialog
-  .alias-container {
-    display: flex;
-    flex-wrap: wrap;
-    align-items: center;
-    border: 1px solid #ccc;
-    border-radius: 4px;
-    padding: 4px 6px;
-    cursor: text;
-    min-height: 38px;
-    background-color: #fff;
-  }
-
-  .alias {
-    display: inline-flex;
-    align-items: center;
-    background-color: #5bc0de;
-    color: white;
-    padding: 4px 8px;
-    margin: 3px 3px;
-    border-radius: 4px;
-    font-size: 13px;
-    line-height: 1.4;
-  }
-
-  .alias .remove {
-    margin-left: 6px;
-    cursor: pointer;
-    font-weight: bold;
-    line-height: 1;
-  }
-
-  .alias-input {
-    flex: 1;
-    min-width: 120px;
-    border: none;
-    outline: none;
-    margin: 3px 3px;
-    font-size: 14px;
-  }
-
-  .form-control.alias-container {
-    height: auto;
-    box-shadow: none;
-  }
-</style>
-
-<div
-  class="modal fade bs-modal-lg"
   id="set_aliases_modal"
-  tabindex="-1"
+  class="modal"
-  aria-labelledby="set_aliases_modal"
+  x-data="{
-  aria-modal="true"
+    isSubmitting: false,
-  role="dialog"
+    aliases: [{% for alias in current_object.aliases %}'{{ alias|escapejs }}'{% if not forloop.last %},{% endif %}{% endfor %}],
->
+    newAlias: '',
-  <div class="modal-dialog modal-lg">
+    errorMessage: '',
-    <div class="modal-content">
-      <div class="modal-header">
-        <button
-          type="button"
-          class="close"
-          data-dismiss="modal"
-          aria-label="Close"
-        >
-          <span aria-hidden="true">×</span>
-        </button>
-        <h4 class="modal-title">
-          Set Aliases for {{ current_object.name|safe }}
-        </h4>
-      </div>
-      <div class="modal-body">
-        <form
-          id="set_aliases_modal_form"
-          accept-charset="UTF-8"
-          action="{{ current_object.url }}"
-          data-remote="true"
-          method="post"
-        >
-          {% csrf_token %}
-          <label for="alias-input">Aliases:</label>
-          <div class="form-control alias-container" id="alias-box">
-            {% for alias in current_object.aliases %}
-              <span class="alias"
-                >{{ alias|escape }}<span class="remove">&times;</span></span
-              >
-            {% endfor %}
-            <input
-              type="text"
-              id="alias-input"
-              class="alias-input"
-              placeholder="Add Alias..."
-            />
-          </div>
-        </form>
-        <div
-          id="add-alias-error-message"
-          class="alert alert-danger"
-          role="alert"
-          style="display: none"
-        ></div>
-      </div>
-      <div class="modal-footer">
-        <button
-          type="button"
-          class="btn btn-secondary pull-left"
-          data-dismiss="modal"
-        >
-          Close
-        </button>
-        <button
-          type="button"
-          class="btn btn-primary"
-          id="set_aliases_modal_form_submit"
-        >
-          Submit
-        </button>
-      </div>
-    </div>
-  </div>
-</div>
-<script>
-  $(function () {
-    function addAlias(aliasText) {
-      aliasText = aliasText.trim();
-      if (aliasText === "") return;
 
-      // Avoid duplicate aliass
+    reset() {
-      var exists = false;
+      this.isSubmitting = false;
-      $("#alias-box .alias").each(function () {
+      this.errorMessage = '';
-        if (
+    },
-          $(this).text().replace("×", "").trim().toLowerCase() ===
+
-          aliasText.toLowerCase()
+    addAlias() {
-        ) {
+      const aliasText = this.newAlias.trim();
-          exists = true;
+      if (aliasText === '') return;
-          return false;
+
-        }
+      // Check for duplicates (case-insensitive)
-      });
+      const exists = this.aliases.some(
+        a => a.toLowerCase() === aliasText.toLowerCase()
+      );
 
       if (!exists) {
-        var aliasHtml =
+        this.aliases.push(aliasText);
-          '<span class="alias">' +
-          $("<div>").text(aliasText).html() +
-          '<span class="remove">&times;</span></span>';
-        $(aliasHtml).insertBefore("#alias-input");
       }
 
-      $("#alias-input").val("");
+      this.newAlias = '';
-    }
+    },
 
-    // Add alias when Enter is pressed
+    removeAlias(index) {
-    $("#alias-input").on("keypress", function (e) {
+      this.aliases.splice(index, 1);
-      if (e.which === 13) {
+    },
+
+    handleKeypress(e) {
+      if (e.key === 'Enter') {
         e.preventDefault();
-        addAlias($(this).val());
+        this.addAlias();
       }
-    });
+    },
 
-    // Add alias when input loses focus
+    handleBlur() {
-    $("#alias-input").on("blur", function () {
+      if (this.newAlias.trim() !== '') {
-      var val = $(this).val();
+        this.addAlias();
-      if (val.trim() !== "") {
-        addAlias(val);
       }
-    });
+    },
 
-    // Remove alias when clicking ×
+    async submit() {
-    $("#alias-box").on("click", ".remove", function () {
+      this.isSubmitting = true;
-      $(this).closest(".alias").remove();
+      this.errorMessage = '';
-    });
 
-    // Focus input when clicking the container
+      const formData = new URLSearchParams();
-    $("#alias-box").on("click", function () {
+      if (this.aliases.length === 0) {
-      $("#alias-input").focus();
+        formData.append('aliases', '');
-    });
+      } else {
-
+        this.aliases.forEach(alias => {
-    $("#set_aliases_modal_form_submit").on("click", function (e) {
+          formData.append('aliases', alias);
-      e.preventDefault();
+        });
-
-      let aliases = [];
-      $("#alias-box .alias").each(function () {
-        aliases.push($(this).text().replace("×", "").trim());
-      });
-
-      if (aliases.length === 0) {
-        // Set empty string for deletion of all aliases
-        // If empty list is sent, its gets removed entirely from post data
-        aliases = [""];
       }
 
-      formData = {
+      try {
-        aliases: aliases,
+        const response = await fetch('{{ current_object.url }}', {
-      };
+          method: 'POST',
+          headers: {
+            'Content-Type': 'application/x-www-form-urlencoded',
+          },
+          body: formData
+        });
 
-      $.ajax({
+        if (response.ok) {
-        type: "post",
+          const data = await response.json();
-        data: formData,
-        url: "{{ current_object.url }}",
-        traditional: true,
-        success: function (data, textStatus) {
           window.location.href = data.success;
-        },
+        } else {
-        error: function (jqXHR, textStatus, errorThrown) {
+          this.errorMessage = 'Setting aliases failed!';
-          $("#add-alias-error-message").append(
+        }
-            "<p>Setting aliases failed!</p>",
+      } catch (error) {
-          );
+        this.errorMessage = 'Setting aliases failed!';
-          $("#add-alias-error-message").show();
+      } finally {
-        },
+        this.isSubmitting = false;
-      });
+      }
-    });
+    }
-  });
+  }"
-</script>
+  @close="reset()"
+>
+  <div class="modal-box max-w-4xl">
+    <!-- Header -->
+    <h3 class="text-lg font-bold">
+      Set Aliases for {{ current_object.name|safe }}
+    </h3>
+
+    <!-- Close button (X) -->
+    <form method="dialog">
+      <button
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <div class="form-control">
+        <label class="label">
+          <span class="label-text">Aliases:</span>
+        </label>
+        <div
+          class="flex flex-wrap items-center gap-1 p-2 border border-base-300 rounded-lg bg-base-100 min-h-[38px] cursor-text"
+          @click="$refs.aliasInput.focus()"
+        >
+          <template x-for="(alias, index) in aliases" :key="index">
+            <span class="badge badge-info gap-1 py-3">
+              <span x-text="alias"></span>
+              <button
+                type="button"
+                class="btn btn-ghost btn-xs p-0 h-auto min-h-0"
+                @click.stop="removeAlias(index)"
+              >
+                ✕
+              </button>
+            </span>
+          </template>
+          <input
+            type="text"
+            x-ref="aliasInput"
+            x-model="newAlias"
+            class="flex-1 min-w-[120px] border-none outline-none bg-transparent text-sm"
+            placeholder="Add Alias..."
+            @keypress="handleKeypress($event)"
+            @blur="handleBlur()"
+          />
+        </div>
+      </div>
+
+      <!-- Error Message -->
+      <div x-show="errorMessage" x-cloak class="alert alert-error mt-4">
+        <span x-text="errorMessage"></span>
+      </div>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit()"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Submitting...</span>
+      </button>
+    </div>
+  </div>
+
+  <!-- Backdrop -->
+  <form method="dialog" class="modal-backdrop">
+    <button :disabled="isSubmitting">close</button>
+  </form>
+</dialog>

templates/modals/objects/generic_set_external_reference_modal.html

@@ -1,97 +1,137 @@
 {% load static %}
-<!-- Delete Object -->
+<!-- Set External Reference -->
-<div id="generic_set_external_reference_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="generic_set_external_reference_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="{
-        <h3 class="modal-title">Add External References</h3>
+    isSubmitting: false,
-        <button
+    selectedDatabase: '',
-          type="button"
+    placeholder: '',
-          class="close"
+
-          data-dismiss="modal"
+    reset() {
-          aria-label="Close"
+      this.isSubmitting = false;
-        >
+      this.selectedDatabase = '';
-          <span aria-hidden="true">&times;</span>
+      this.placeholder = '';
-        </button>
+    },
-      </div>
+
-      <div class="modal-body">
+    updatePlaceholder() {
-        <form
+      if (this.selectedDatabase) {
-          id="generic-set-external-reference-modal-form"
+        const option = document.querySelector('#database-select option[value=\'' + this.selectedDatabase + '\']');
-          accept-charset="UTF-8"
+        if (option) {
-          action="{{ current_object.url }}"
+          this.placeholder = option.dataset.inputPlaceholder || '';
-          data-remote="true"
+        }
-          method="post"
+      }
-        >
+    },
-          {% csrf_token %}
+
-          <label for="database-select"
+    submit(formId) {
-            >Select the Database you want to attach an External Reference
+      const form = document.getElementById(formId);
-            for</label
+      if (form && form.checkValidity()) {
-          >
+        this.isSubmitting = true;
+        form.submit();
+      } else if (form) {
+        form.reportValidity();
+      }
+    }
+  }"
+  @close="reset()"
+>
+  <div class="modal-box">
+    <!-- Header -->
+    <h3 class="text-lg font-bold">Add External References</h3>
+
+    <!-- Close button (X) -->
+    <form method="dialog">
+      <button
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <form
+        id="generic-set-external-reference-modal-form"
+        accept-charset="UTF-8"
+        action="{{ current_object.url }}"
+        method="post"
+      >
+        {% csrf_token %}
+        <div class="form-control">
+          <label class="label" for="database-select">
+            <span class="label-text">
+              Select the Database you want to attach an External Reference for
+            </span>
+          </label>
           <select
             id="database-select"
             name="selected-database"
-            data-actions-box="true"
+            class="select select-bordered w-full"
-            class="form-control"
+            x-model="selectedDatabase"
-            data-width="100%"
+            @change="updatePlaceholder()"
+            required
           >
-            <option disabled selected>Select Database</option>
+            <option value="" disabled selected>Select Database</option>
             {% for entity, databases in meta.external_databases.items %}
               {% if entity == object_type %}
                 {% for db in databases %}
                   <option
-                    id="db-select-{{ db.database.pk }}"
-                    data-input-placeholder="{{ db.placeholder }}"
                     value="{{ db.database.id }}"
+                    data-input-placeholder="{{ db.placeholder }}"
                   >
                     {{ db.database.name|safe }}
                   </option>
-                  `
                 {% endfor %}
               {% endif %}
             {% endfor %}
           </select>
-          <p></p>
+        </div>
-          <div id="input-div" style="display: none">
+
-            <label for="identifier">The reference</label>
+        <div class="form-control mt-4" x-show="selectedDatabase" x-cloak>
-            <input
+          <label class="label" for="identifier">
-              type="text"
+            <span class="label-text">The reference</span>
-              id="identifier"
+          </label>
-              name="identifier"
+          <input
-              class="form-control"
+            type="text"
-              placeholder=""
+            id="identifier"
-            />
+            name="identifier"
-          </div>
+            class="input input-bordered w-full"
-        </form>
+            :placeholder="placeholder"
-      </div>
+            required
-      <div class="modal-footer">
+          />
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+        </div>
-          Close
+      </form>
-        </button>
+    </div>
-        <button
+
-          type="button"
+    <!-- Footer -->
-          class="btn btn-primary"
+    <div class="modal-action">
-          id="generic-set-external-reference-modal-form-submit"
+      <button
-        >
+        type="button"
-          Submit
+        class="btn"
-        </button>
+        onclick="this.closest('dialog').close()"
-      </div>
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('generic-set-external-reference-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Submitting...</span>
+      </button>
     </div>
   </div>
-</div>
-<script>
-  $(function () {
-    $("#database-select").on("change", function () {
-      let selected = $(this).val();
-      $("#identifier").attr(
-        "placeholder",
-        $("#db-select-" + selected).data("input-placeholder"),
-      );
-      $("#input-div").show();
-    });
 
-    $("#generic-set-external-reference-modal-form-submit").click(function (e) {
+  <!-- Backdrop -->
-      e.preventDefault();
+  <form method="dialog" class="modal-backdrop">
-      $("#generic-set-external-reference-modal-form").submit();
+    <button :disabled="isSubmitting">close</button>
-    });
+  </form>
-  });
+</dialog>
-</script>

templates/modals/objects/generic_set_scenario_modal.html

@@ -1,112 +1,142 @@
 {% load static %}
-<div
+<dialog
-  class="modal fade bs-modal-lg"
   id="set_scenario_modal"
-  tabindex="-1"
+  class="modal"
-  aria-labelledby="set_scenario_modal"
+  x-data="{
-  aria-modal="true"
+    isSubmitting: false,
-  role="dialog"
+    isLoading: false,
+    loaded: false,
+    scenarios: [],
+    attachedScenarios: [{% for scen in current_object.scenarios.all %}'{{ scen.url }}'{% if not forloop.last %},{% endif %}{% endfor %}],
+
+    reset() {
+      this.isSubmitting = false;
+    },
+
+    async loadScenarios() {
+      if (this.loaded) return;
+
+      this.isLoading = true;
+      try {
+        const response = await fetch('{% url "package scenario list" meta.current_package.uuid %}');
+        const data = await response.json();
+        this.scenarios = data;
+        this.loaded = true;
+      } catch (error) {
+        console.error('Error loading scenarios:', error);
+      } finally {
+        this.isLoading = false;
+      }
+    },
+
+    isSelected(url) {
+      return this.attachedScenarios.includes(url);
+    },
+
+    submit() {
+      this.isSubmitting = true;
+      const select = document.getElementById('scenario-select');
+      if (select.selectedOptions.length === 0) {
+        // Add hidden empty option to indicate clearing all scenarios
+        const emptyOption = document.createElement('option');
+        emptyOption.value = '';
+        emptyOption.selected = true;
+        select.appendChild(emptyOption);
+      }
+      document.getElementById('set_scenario_modal_form').submit();
+    }
+  }"
+  @close="reset()"
+  x-init="$watch('$el.open', value => { if (value) loadScenarios(); })"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-4xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">
-        <button
+      Set Scenarios for {{ current_object.name|safe }}
-          type="button"
+    </h3>
-          class="close"
+
-          data-dismiss="modal"
+    <!-- Close button (X) -->
-          aria-label="Close"
+    <form method="dialog">
-        >
+      <button
-          <span aria-hidden="true">×</span>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-        </button>
+        :disabled="isSubmitting"
-        <h4 class="modal-title">
+      >
-          Set Scenarios for {{ current_object.name|safe }}
+        ✕
-        </h4>
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <!-- Loading indicator -->
+      <div x-show="isLoading" x-cloak class="mb-4 text-center">
+        <span class="loading loading-spinner loading-lg"></span>
+        <div class="alert alert-info mt-2">Loading Scenarios...</div>
       </div>
-      <div class="modal-body">
+
-        <div id="loading_scenario_div" class="text-center"></div>
+      <form
-        <form
+        id="set_scenario_modal_form"
-          id="set_scenario_modal_form"
+        accept-charset="UTF-8"
-          accept-charset="UTF-8"
+        action="{{ current_object.url }}"
-          action="{{ current_object.url }}"
+        data-remote="true"
-          data-remote="true"
+        method="post"
-          method="post"
+        x-show="!isLoading"
-        >
+      >
-          {% csrf_token %}
+        {% csrf_token %}
-          <label for="scenario-select">Scenarios</label>
+        <div class="form-control">
+          <label class="label" for="scenario-select">
+            <span class="label-text">Scenarios</span>
+          </label>
           <select
             id="scenario-select"
             name="selected-scenarios"
-            data-actions-box="true"
+            class="select select-bordered h-48 w-full"
-            class="form-control"
             multiple
-            data-width="100%"
           >
-            <option disabled>Select Scenarios</option>
+            <template x-for="scenario in scenarios" :key="scenario.url">
-            <option value="" hidden></option>
+              <option
+                :value="scenario.url"
+                :selected="isSelected(scenario.url)"
+                x-text="scenario.name"
+              ></option>
+            </template>
           </select>
-        </form>
+          <label class="label">
-      </div>
+            <span class="label-text-alt"
-      <div class="modal-footer">
+              >Hold Ctrl/Cmd to select multiple scenarios</span
-        <button
+            >
-          type="button"
+          </label>
-          class="btn btn-secondary pull-left"
+        </div>
-          data-dismiss="modal"
+      </form>
-        >
+    </div>
-          Close
+
-        </button>
+    <!-- Footer -->
-        <button
+    <div class="modal-action">
-          type="button"
+      <button
-          class="btn btn-primary"
+        type="button"
-          id="set_scenario_modal_form_submit"
+        class="btn"
-        >
+        onclick="this.closest('dialog').close()"
-          Submit
+        :disabled="isSubmitting"
-        </button>
+      >
-      </div>
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit()"
+        :disabled="isSubmitting || isLoading"
+      >
+        <span x-show="!isSubmitting">Submit</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Submitting...</span>
+      </button>
     </div>
   </div>
-</div>
-{# prettier-ignore-start #}
-<script>
 
-    $(function () {
+  <!-- Backdrop -->
-        var loaded = false;
+  <form method="dialog" class="modal-backdrop">
-
+    <button :disabled="isSubmitting">close</button>
-        var attachedScenarios = []
+  </form>
-        {% if current_object.scenarios.all %}
+</dialog>
-            {% for scen in current_object.scenarios.all %}
-            attachedScenarios.push('{{ scen.url }}')
-            {% endfor %}
-        {% endif %}
-
-        $('#scenario-select').selectpicker();
-
-        $('#set_scenario_modal').on('shown.bs.modal', function () {
-
-            if (!loaded) {
-                makeLoadingGif("#loading_scenario_div", "{% static '/images/wait.gif' %}");
-                $('#loading_scenario_div').append("<p></p><div class='alert alert-info'>Loading Scenarios...</div>");
-
-                $.getJSON("{% url 'package scenario list' meta.current_package.uuid %}").then(function (data) {
-                    for(s in data) {
-                        scenario = data[s]
-                        var selected = attachedScenarios.includes(scenario.url);
-                        $('#scenario-select').append(`<option value="${scenario.url}" ${selected ? 'selected' : ''}>${scenario.name}</option>`);
-                    }
-                    $('#scenario-select').selectpicker('refresh');
-                    $("#loading_scenario_div").empty();
-                });
-                loaded = true;
-            }
-
-            $('#set_scenario_modal_form_submit').on('click', function (e) {
-                e.preventDefault();
-                if ($('#scenario-select').val().length == 0) {
-                    $('#scenario-select').val("")
-                }
-                $('#set_scenario_modal_form').submit();
-            });
-        });
-    });
-
-</script>
-{# prettier-ignore-end #}

templates/modals/objects/identify_missing_rules_modal.html

@@ -1,75 +1,89 @@
 {% load static %}
 <!-- Identify Missing Rules -->
-<div id="identify_missing_rules_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="identify_missing_rules_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h3 class="modal-title">Identify Missing Rules</h3>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="text-lg font-bold">Identify Missing Rules</h3>
-          aria-label="Close"
+
-        >
+    <!-- Close button (X) -->
-          <span aria-hidden="true">&times;</span>
+    <form method="dialog">
-        </button>
+      <button
-      </div>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      <div class="modal-body">
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <p class="mb-4">
         By clicking on Download we'll search the Pathway for Reactions that are
         not backed by a Rule or which can be assembled by chaining two rules.
-        <form
+      </p>
-          id="identify-missing-rules-modal-form"
+      <form
-          accept-charset="UTF-8"
+        id="identify-missing-rules-modal-form"
-          action="{{ pathway.url }}"
+        accept-charset="UTF-8"
-          data-remote="true"
+        action="{{ pathway.url }}"
-          method="GET"
+        method="GET"
-        >
+      >
-          <label for="rule-package">Select the Rule Package</label>
+        <div class="form-control">
+          <label class="label" for="rule-package">
+            <span class="label-text">Select the Rule Package</span>
+          </label>
           <select
             id="rule-package"
             name="rule-package"
-            data-actions-box="true"
+            class="select select-bordered w-full"
-            class="form-control"
+            required
-            data-width="100%"
           >
-            <option disabled>Reviewed Packages</option>
+            <optgroup label="Reviewed Packages">
-            {% for obj in meta.readable_packages %}
+              {% for obj in meta.readable_packages %}
-              {% if obj.reviewed %}
+                {% if obj.reviewed %}
-                <option value="{{ obj.url }}">{{ obj.name }}</option>
+                  <option value="{{ obj.url }}">{{ obj.name }}</option>
-              {% endif %}
+                {% endif %}
-            {% endfor %}
+              {% endfor %}
-
+            </optgroup>
-            <option disabled>Unreviewed Packages</option>
+            <optgroup label="Unreviewed Packages">
-            {% for obj in meta.readable_packages %}
+              {% for obj in meta.readable_packages %}
-              {% if not obj.reviewed %}
+                {% if not obj.reviewed %}
-                <option value="{{ obj.url }}">{{ obj.name }}</option>
+                  <option value="{{ obj.url }}">{{ obj.name }}</option>
-              {% endif %}
+                {% endif %}
-            {% endfor %}
+              {% endfor %}
+            </optgroup>
           </select>
-          <input type="hidden" name="identify-missing-rules" value="true" />
+        </div>
-        </form>
+        <input type="hidden" name="identify-missing-rules" value="true" />
-      </div>
+      </form>
-      <div class="modal-footer">
+    </div>
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+
-          Close
+    <!-- Footer -->
-        </button>
+    <div class="modal-action">
-        <button
+      <button
-          type="button"
+        type="button"
-          class="btn btn-primary"
+        class="btn"
-          id="identify-missing-rules-modal-submit"
+        onclick="this.closest('dialog').close()"
-        >
+        :disabled="isSubmitting"
-          Download
+      >
-        </button>
+        Close
-      </div>
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="document.getElementById('identify-missing-rules-modal-form').submit(); $el.closest('dialog').close()"
+      >
+        Download
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#identify-missing-rules-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#identify-missing-rules-modal-form").submit();
+</dialog>
-      $("#identify_missing_rules_modal").modal("hide");
-    });
-  });
-</script>

templates/modals/objects/manage_api_token_modal.html

@@ -1,118 +1,174 @@
-<div
+<dialog
-  class="modal fade"
-  tabindex="-1"
   id="manage_api_token_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="manage_api_token_modal"
+  x-data="{
-  aria-hidden="true"
+    isSubmitting: false,
+    newToken: '',
+    tokens: [],
+
+    reset() {
+      this.isSubmitting = false;
+      this.newToken = '';
+    },
+
+    async requestToken() {
+      this.isSubmitting = true;
+      const form = document.getElementById('request_api_token_form');
+      const formData = new FormData(form);
+
+      try {
+        const response = await fetch('{{ meta.user.url }}', {
+          method: 'POST',
+          body: new URLSearchParams(formData)
+        });
+        const data = await response.json();
+        this.newToken = data.raw_token;
+      } catch (error) {
+        console.error('Error requesting token:', error);
+      } finally {
+        this.isSubmitting = false;
+      }
+    },
+
+    async deleteToken(form) {
+      const formData = new FormData(form);
+      try {
+        await fetch(form.action, {
+          method: 'POST',
+          body: new URLSearchParams(formData)
+        });
+        form.closest('.token-item').remove();
+      } catch (error) {
+        console.error('Error deleting token:', error);
+      }
+    }
+  }"
+  @close="reset()"
 >
-  <div class="modal-dialog">
+  <div class="modal-box">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Manage API Token</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h3 class="modal-title">Manage API Token</h3>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-body">
+      >
-        <p>
+        ✕
-          Requesting a Token will invalidate all potential existing tokens. The
+      </button>
-          new token will only be shown once, so ensure to store it in secure
+    </form>
-          place
+
-        </p>
+    <!-- Body -->
-        <form
+    <div class="py-4">
-          id="request_api_token_form"
+      <p class="mb-4">
-          accept-charset="UTF-8"
+        Requesting a Token will invalidate all potential existing tokens. The
-          action=""
+        new token will only be shown once, so ensure to store it in a secure
-          data-remote="true"
+        place.
-          method="post"
+      </p>
-        >
+
-          {% csrf_token %}
+      <form id="request_api_token_form" accept-charset="UTF-8" method="post">
-          <p>
+        {% csrf_token %}
-            <label for="token-name">Name</label>
+        <div class="form-control mb-3">
-            <input
+          <label class="label" for="token-name">
-              type="text"
+            <span class="label-text">Name</span>
-              id="token-name"
+          </label>
-              class="form-control"
+          <input
-              name="name"
+            type="text"
-              placeholder="Generic Token for {{ meta.user.username }}"
+            id="token-name"
-            />
+            class="input input-bordered w-full"
-            <label for="valid-for">Valid for (in days)</label>
+            name="name"
-            <input
+            placeholder="Generic Token for {{ meta.user.username }}"
-              type="number"
+          />
-              id="valid-for"
-              class="form-control"
-              name="valid-for"
-              value="90"
-            />
-            <input type="hidden" name="hidden" value="request-api-token" />
-          </p>
-        </form>
-        <div id="new-token">
-          <pre id="new-token-pre"></pre>
         </div>
-        <div id="existing-tokens">
+        <div class="form-control mb-3">
-          {% for t in tokens %}
+          <label class="label" for="valid-for">
+            <span class="label-text">Valid for (in days)</span>
+          </label>
+          <input
+            type="number"
+            id="valid-for"
+            class="input input-bordered w-full"
+            name="valid-for"
+            value="90"
+          />
+        </div>
+        <input type="hidden" name="hidden" value="request-api-token" />
+      </form>
+
+      <!-- New Token Display -->
+      <div x-show="newToken" x-cloak class="alert alert-success mb-4">
+        <div class="w-full">
+          <span class="font-bold">New Token:</span>
+          <pre
+            class="mt-2 p-2 bg-base-200 rounded overflow-x-auto"
+            x-text="newToken"
+          ></pre>
+        </div>
+      </div>
+
+      <!-- Existing Tokens -->
+      <div class="space-y-2">
+        {% for t in tokens %}
+          <div class="token-item">
             <form
               id="delete-token-{{ forloop.counter0 }}"
               accept-charset="UTF-8"
               action="{{ meta.user.url }}"
-              data-remote="true"
               method="post"
             >
               {% csrf_token %}
-              <div class="input-group">
+              <div class="join w-full">
                 <input type="hidden" name="hidden" value="delete" />
                 <input type="hidden" name="token-id" value="{{ t.pk }}" />
                 <input
                   type="text"
-                  class="form-control"
+                  class="input input-bordered join-item w-full"
                   value="{{ t.name|safe }}"
                   disabled
                 />
-                <span class="input-group-btn">
+                <button
-                  <button type="submit" class="btn btn-danger">Delete</button>
+                  type="button"
-                </span>
+                  class="btn btn-error join-item"
+                  @click="deleteToken($el.closest('form'))"
+                >
+                  Delete
+                </button>
               </div>
             </form>
-          {% endfor %}
+          </div>
-        </div>
+        {% endfor %}
-      </div>
-      <div class="modal-footer">
-        <a id="manage_api_token_form_submit" class="btn btn-primary" href="#"
-          >Submit</a
-        >
-        <button type="button" class="btn btn-default" data-dismiss="modal">
-          Cancel
-        </button>
       </div>
     </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="requestToken()"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Request Token</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Requesting...</span>
+      </button>
+    </div>
   </div>
-</div>
-<script>
-  $(function () {
-    $("#new-token").hide();
 
-    $("#manage_api_token_form_submit").on("click", function (e) {
+  <!-- Backdrop -->
-      e.preventDefault();
+  <form method="dialog" class="modal-backdrop">
-
+    <button :disabled="isSubmitting">close</button>
-      const formData = $("#request_api_token_form").serialize();
+  </form>
-      $.post("", formData, function (response) {
+</dialog>
-        $("#new-token-pre").text(response.raw_token);
-        $("#new-token").show();
-      });
-    });
-
-    // Select all elements that start with 'delete-token-'
-    $("[id^='delete-token-']").on("submit", function (e) {
-      e.preventDefault();
-      const formData = $(this).serialize();
-      const form = $(this);
-      $.post(this.action, formData, function (response) {
-        console.log(this);
-        form.remove();
-      });
-    });
-  });
-</script>

templates/modals/objects/publish_package_modal.html

@@ -1,52 +1,85 @@
 {% load static %}
-<!-- Publish a Package -->
+
-<div id="publish_package_modal" class="modal" tabindex="-1">
+<dialog
-  <div class="modal-dialog">
+  id="publish_package_modal"
-    <div class="modal-content">
+  class="modal"
-      <div class="modal-header">
+  x-data="modalForm()"
-        <h5 class="modal-title">Publish Package</h5>
+  @close="reset()"
-        <button
+>
-          type="button"
+  <div class="modal-box">
-          class="close"
+    <!-- Header -->
-          data-dismiss="modal"
+    <h3 class="font-bold text-lg">Publish Package</h3>
-          aria-label="Close"
+
+    <!-- Close button (X) -->
+    <form method="dialog">
+      <button
+        class="btn btn-sm btn-circle btn-ghost absolute right-2 top-2"
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <div class="alert alert-info">
+        <svg
+          xmlns="http://www.w3.org/2000/svg"
+          fill="none"
+          viewBox="0 0 24 24"
+          class="h-6 w-6 shrink-0 stroke-current"
         >
-          <span aria-hidden="true">&times;</span>
+          <path
-        </button>
+            stroke-linecap="round"
-      </div>
+            stroke-linejoin="round"
-      <div class="modal-body">
+            stroke-width="2"
-        <p>Clicking on Publish will make this Package publicly available!</p>
+            d="M13 16h-1v-4h-1m1-4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"
-        <form
+          ></path>
-          id="publish-package-modal-form"
+        </svg>
-          accept-charset="UTF-8"
+        <span
-          action="{{ current_package.url }}"
+          >Clicking on Publish will make this Package publicly available!</span
-          data-remote="true"
-          method="post"
         >
-          {% csrf_token %}
-          <input type="hidden" name="hidden" value="publish-package" />
-        </form>
-      </div>
-      <div class="modal-footer">
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
-          Close
-        </button>
-        <button
-          type="button"
-          class="btn btn-primary"
-          id="publish-package-modal-form-submit"
-        >
-          Publish
-        </button>
       </div>
+
+      <form
+        id="publish-package-modal-form"
+        accept-charset="UTF-8"
+        action="{{ current_package.url }}"
+        method="post"
+      >
+        {% csrf_token %}
+        <input type="hidden" name="hidden" value="publish-package" />
+      </form>
+    </div>
+
+    <!-- Footer -->
+    <div class="modal-action">
+      <button
+        type="button"
+        class="btn"
+        onclick="this.closest('dialog').close()"
+        :disabled="isSubmitting"
+      >
+        Close
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('publish-package-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Publish</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Publishing...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#publish-package-modal-form-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#publish-package-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/retrain_model_modal.html

@@ -1,55 +1,72 @@
-<div
+<dialog
-  class="modal fade"
-  tabindex="-1"
   id="retrain_model_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="retrain_model_modal"
+  x-data="modalForm()"
-  aria-hidden="true"
+  @close="reset()"
 >
-  <div class="modal-dialog modal-lg">
+  <div class="modal-box max-w-3xl">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Retrain Model</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h4 class="modal-title">Retrain Model</h4>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-      </div>
+        :disabled="isSubmitting"
-      <div class="modal-body">
+      >
-        <form
+        ✕
-          id="retrain_model_form"
+      </button>
-          accept-charset="UTF-8"
+    </form>
-          action="{{ meta.current_object.url }}"
+
-          data-remote="true"
+    <!-- Body -->
-          method="post"
+    <div class="py-4">
-        >
+      <form
-          <div class="jumbotron">
+        id="retrain_model_form"
+        accept-charset="UTF-8"
+        action="{{ meta.current_object.url }}"
+        method="post"
+      >
+        {% csrf_token %}
+        <div class="alert alert-info mb-4">
+          <span>
             To reflect changes in the rule or data packages, you can use the
             "Retrain" button, to let the model reflect the changes without
             creating a new model. While the model is retraining, it will be
             unavailable for prediction.
-          </div>
+          </span>
-          {% csrf_token %}
+        </div>
-          <input type="hidden" name="hidden" value="retrain" />
+        <input type="hidden" name="hidden" value="retrain" />
-        </form>
+      </form>
-      </div>
+    </div>
-      <div class="modal-footer">
+
-        <a id="retrain_model_form_submit" class="btn btn-primary" href="#"
+    <!-- Footer -->
-          >Retrain</a
+    <div class="modal-action">
-        >
+      <button
-        <button type="button" class="btn btn-default" data-dismiss="modal">
+        type="button"
-          Cancel
+        class="btn"
-        </button>
+        onclick="this.closest('dialog').close()"
-      </div>
+        :disabled="isSubmitting"
+      >
+        Cancel
+      </button>
+      <button
+        type="button"
+        class="btn btn-primary"
+        @click="submit('retrain_model_form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Retrain</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Retraining...</span>
+      </button>
     </div>
   </div>
-</div>
 
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#retrain_model_form_submit").on("click", function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#retrain_model_form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/objects/set_license_modal.html

@@ -1,198 +1,193 @@
-<div
+<dialog
-  class="modal fade"
-  tabindex="-1"
   id="set_license_modal"
-  role="dialog"
+  class="modal"
-  aria-labelledby="set_license_modal"
+  x-data="{
-  aria-hidden="true"
+    isSubmitting: false,
+    licenseType: '',
+    ccRemix: false,
+    ccNoCom: false,
+    ccAlike: false,
+
+    reset() {
+      this.isSubmitting = false;
+      this.licenseType = '';
+      this.ccRemix = false;
+      this.ccNoCom = false;
+      this.ccAlike = false;
+    },
+
+    get licenseString() {
+      if (this.licenseType !== 'cc') return 'no-license';
+
+      let str = 'by';
+      if (this.ccNoCom) str += '-nc';
+      if (!this.ccRemix) {
+        str += '-nd';
+      } else if (this.ccAlike) {
+        str += '-sa';
+      }
+      return str;
+    },
+
+    get licenseUrl() {
+      if (this.licenseType !== 'cc') return '';
+      return 'https://creativecommons.org/licenses/' + this.licenseString + '/4.0/';
+    },
+
+    get licenseImageUrl() {
+      if (this.licenseType !== 'cc') return '';
+      return 'https://licensebuttons.net/l/' + this.licenseString + '/4.0/88x31.png';
+    },
+
+    submit(formId) {
+      const form = document.getElementById(formId);
+      document.getElementById('license').value = this.licenseString;
+      if (form && form.checkValidity()) {
+        this.isSubmitting = true;
+        form.submit();
+      } else if (form) {
+        form.reportValidity();
+      }
+    }
+  }"
+  @close="reset()"
 >
-  <div class="modal-dialog">
+  <div class="modal-box">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Set License</h3>
-        <button type="button" class="close" data-dismiss="modal">
+
-          <span aria-hidden="true">&times;</span>
+    <!-- Close button (X) -->
-          <span class="sr-only">Close</span>
+    <form method="dialog">
-        </button>
+      <button
-        <h3 class="modal-title">Set License</h3>
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
+        :disabled="isSubmitting"
+      >
+        ✕
+      </button>
+    </form>
+
+    <!-- Body -->
+    <div class="py-4">
+      <div class="flex gap-4 mb-4">
+        <div class="flex-1">
+          <p>
+            Set the license for all data in this package:
+            <br /><br />
+            (For more information please visit our
+            <a
+              target="_blank"
+              href="https://wiki.envipath.org/index.php/License"
+              class="link link-primary"
+              >wiki</a
+            >.)
+          </p>
+        </div>
+        <div class="flex-none" x-show="licenseType === 'cc'" x-cloak>
+          <a :href="licenseUrl" target="_blank">
+            <img :src="licenseImageUrl" alt="CC License" />
+          </a>
+        </div>
       </div>
 
-      <div class="modal-body">
+      <form
-        <div class="row">
+        id="set_license_form"
-          <div class="col-md-9">
+        accept-charset="UTF-8"
-            <p>
+        action=""
-              Set the license for all data in this package:
+        method="post"
-              <br />
+      >
-              <br />
+        {% csrf_token %}
-              (For more information please visit our
+
-              <a target="#" href="https://wiki.envipath.org/index.php/License"
+        <div class="form-control">
-                >wiki</a
+          <label class="label cursor-pointer justify-start gap-3">
-              >.)
+            <input
-            </p>
+              type="radio"
+              name="optlicense"
+              class="radio"
+              value="cc"
+              x-model="licenseType"
+            />
+            <span class="label-text">Creative commons license</span>
+          </label>
+        </div>
+
+        <div class="ml-8 space-y-2" x-show="licenseType === 'cc'" x-cloak>
+          <div class="form-control">
+            <label class="label cursor-pointer justify-start gap-3">
+              <input type="checkbox" class="checkbox" x-model="ccRemix" />
+              <span class="label-text"
+                >Allow adaptations of your work to be shared</span
+              >
+            </label>
           </div>
-          <div class="col-md-3">
+
-            <div id="ccfig"></div>
+          <div class="form-control">
+            <label class="label cursor-pointer justify-start gap-3">
+              <input type="checkbox" class="checkbox" x-model="ccNoCom" />
+              <span class="label-text">Prohibit commercial use</span>
+            </label>
+          </div>
+
+          <div class="form-control">
+            <label class="label cursor-pointer justify-start gap-3">
+              <input
+                type="checkbox"
+                class="checkbox"
+                x-model="ccAlike"
+                :disabled="!ccRemix"
+              />
+              <span class="label-text">Share only if others share alike</span>
+            </label>
           </div>
         </div>
-        <form
+
-          id="set_license_form"
+        <div class="form-control mt-2">
-          accept-charset="UTF-8"
+          <label class="label cursor-pointer justify-start gap-3">
-          action=""
+            <input
-          data-remote="true"
+              type="radio"
-          method="post"
+              name="optlicense"
-        >
+              class="radio"
-          {% csrf_token %}
+              value="nocc"
-          <div class="input-group">
+              x-model="licenseType"
-            <div class="radio">
+            />
-              <label
+            <span class="label-text"
-                ><input
+              >No creative commons license, contact package owner for license
-                  type="radio"
+              information</span
-                  name="optlicense"
+            >
-                  onclick="cc()"
+          </label>
-                  id="ccradio"
+        </div>
-                />Creative commons license</label
+
-              >
+        <input type="hidden" id="license" name="license" />
-            </div>
+      </form>
-            <div>
+    </div>
-              <div class="checkbox">
+
-                <label
+    <!-- Footer -->
-                  ><input
+    <div class="modal-action">
-                    type="checkbox"
+      <button
-                    value=""
+        type="button"
-                    onclick="cc()"
+        class="btn"
-                    id="ccremix"
+        onclick="this.closest('dialog').close()"
-                    disabled
+        :disabled="isSubmitting"
-                  />Allow adaptations of your work to be shared</label
+      >
-                >
+        Cancel
-              </div>
+      </button>
-              <div class="checkbox">
+      <button
-                <label
+        type="button"
-                  ><input
+        class="btn btn-primary"
-                    type="checkbox"
+        @click="submit('set_license_form')"
-                    value=""
+        :disabled="isSubmitting || !licenseType"
-                    onclick="cc()"
+      >
-                    id="ccnocom"
+        <span x-show="!isSubmitting">Submit</span>
-                    disabled
+        <span
-                  />Prohibit commercial use</label
+          x-show="isSubmitting"
-                >
+          class="loading loading-spinner loading-sm"
-              </div>
+        ></span>
-              <div class="checkbox">
+        <span x-show="isSubmitting">Submitting...</span>
-                <label
+      </button>
-                  ><input
-                    type="checkbox"
-                    value=""
-                    onclick="cc()"
-                    id="ccalike"
-                    disabled
-                  />Share only if others share alike</label
-                >
-              </div>
-            </div>
-            <div class="radio">
-              <label
-                ><input
-                  type="radio"
-                  name="optlicense"
-                  onclick="cc()"
-                  id="noccradio"
-                />No creative commons license, contact package owner for license
-                information</label
-              >
-            </div>
-          </div>
-          <input type="hidden" id="license" name="license" />
-        </form>
-      </div>
-      <div class="modal-footer">
-        <button id="set_license_form_submit" class="btn btn-primary">
-          Submit
-        </button>
-        <button type="button" class="btn btn-default" data-dismiss="modal">
-          Cancel
-        </button>
-      </div>
     </div>
   </div>
-</div>
-<script>
-  function ccstring(ccremix, ccnocom, ccalike) {
-    var ccstring = "by";
 
-    if (ccnocom) {
+  <!-- Backdrop -->
-      ccstring += "-nc";
+  <form method="dialog" class="modal-backdrop">
-    }
+    <button :disabled="isSubmitting">close</button>
-
+  </form>
-    if (!ccremix) {
+</dialog>
-      ccstring += "-nd";
-    } else {
-      if (ccalike) {
-        ccstring += "-sa";
-      }
-    }
-    return ccstring;
-  }
-
-  function cc() {
-    var nocc = $("#noccradio").prop("checked");
-    var iscc = $("#ccradio").prop("checked");
-
-    if (nocc) {
-      $("#ccradio").prop("checked", false);
-      $("#ccremix").prop("checked", false);
-      $("#ccnocom").prop("checked", false);
-      $("#ccalike").prop("checked", false);
-
-      $("#ccremix").prop("disabled", true);
-      $("#ccnocom").prop("disabled", true);
-      $("#ccalike").prop("disabled", true);
-    } else if (iscc) {
-      $("#ccremix").prop("disabled", false);
-      $("#ccnocom").prop("disabled", false);
-
-      if ($("#ccremix").prop("checked")) {
-        $("#ccalike").prop("disabled", false);
-      } else {
-        $("#ccalike").prop("disabled", true);
-      }
-    }
-
-    var remix = $("#ccremix").prop("checked");
-    var nocom = $("#ccnocom").prop("checked");
-    var alike = $("#ccalike").prop("checked");
-
-    if (nocc) {
-      $("#set_license_form_submit").prop("disabled", false);
-      $("#ccfig").empty();
-      $("#license").val("no-license");
-    } else if (iscc) {
-      $("#set_license_form_submit").prop("disabled", false);
-      $("#ccfig").empty();
-      var ccstr = ccstring(remix, nocom, alike);
-
-      var link = `https://creativecommons.org/licenses/${ccstr}/4.0/`;
-      var imageLink = `https://licensebuttons.net/l/${ccstr}/4.0/88x31.png`;
-
-      var img_tpl = `<a href='${link}' target="_blank">
-                       <img src='${imageLink}'>
-                       </a>`;
-
-      $("#ccfig").append(img_tpl);
-      $("#license").val(ccstr);
-    } else {
-      $("#ccfig").empty();
-      $("#set_license_form_submit").prop("disabled", true);
-      $("#license").val("no-license");
-    }
-  }
-
-  $(function () {
-    // Disable by default as nothing is selected
-
-    cc();
-    $("#set_license_form_submit").prop("disabled", true);
-
-    $("#set_license_form_submit").on("click", function (e) {
-      e.preventDefault();
-      $("#set_license_form").submit();
-    });
-  });
-</script>

templates/modals/objects/update_scenario_additional_information_modal.html

@@ -1,62 +1,69 @@
 {% load static %}
-<!-- Update Scenario Additional Information-->
+
-<div
+<dialog
   id="update_scenario_additional_information_modal"
   class="modal"
-  tabindex="-1"
+  x-data="modalForm()"
+  @close="reset()"
 >
-  <div class="modal-dialog">
+  <div class="modal-box">
-    <div class="modal-content">
+    <!-- Header -->
-      <div class="modal-header">
+    <h3 class="text-lg font-bold">Update Additional Information</h3>
-        <button
+
-          type="button"
+    <!-- Close button (X) -->
-          class="close"
+    <form method="dialog">
-          data-dismiss="modal"
+      <button
-          aria-label="Close"
+        class="btn btn-sm btn-circle btn-ghost absolute top-2 right-2"
-        >
+        :disabled="isSubmitting"
-          <span aria-hidden="true">&times;</span>
+      >
-        </button>
+        ✕
-        <h3 class="modal-title">Update Additional Information</h3>
+      </button>
-      </div>
+    </form>
-      <div class="modal-body">
+
-        <form
+    <!-- Body -->
-          id="edit-scenario-additional-information-modal-form"
+    <div class="py-4">
-          accept-charset="UTF-8"
+      <form
-          action=""
+        id="edit-scenario-additional-information-modal-form"
-          data-remote="true"
+        accept-charset="UTF-8"
-          method="post"
+        action=""
-        >
+        method="post"
-          {% csrf_token %}
+      >
-          {% for widget in update_widgets %}
+        {% csrf_token %}
-            {{ widget|safe }}
+        {% for widget in update_widgets %}
-          {% endfor %}
+          {{ widget|safe }}
-          <input
+        {% endfor %}
-            type="hidden"
+        <input type="hidden" name="hidden" value="set-additional-information" />
-            name="hidden"
+      </form>
-            value="set-additional-information"
+    </div>
-          />
+
-        </form>
+    <!-- Footer -->
-      </div>
+    <div class="modal-action">
-      <div class="modal-footer">
+      <button
-        <button type="button" class="btn btn-secondary" data-dismiss="modal">
+        type="button"
-          Close
+        class="btn"
-        </button>
+        onclick="this.closest('dialog').close()"
-        <button
+        :disabled="isSubmitting"
-          type="button"
+      >
-          class="btn btn-primary"
+        Close
-          id="edit-scenario-additional-information-modal-submit"
+      </button>
-        >
+      <button
-          Update
+        type="button"
-        </button>
+        class="btn btn-primary"
-      </div>
+        @click="submit('edit-scenario-additional-information-modal-form')"
+        :disabled="isSubmitting"
+      >
+        <span x-show="!isSubmitting">Update</span>
+        <span
+          x-show="isSubmitting"
+          class="loading loading-spinner loading-sm"
+        ></span>
+        <span x-show="isSubmitting">Updating...</span>
+      </button>
     </div>
   </div>
-</div>
+
-<script>
+  <!-- Backdrop -->
-  $(function () {
+  <form method="dialog" class="modal-backdrop">
-    $("#edit-scenario-additional-information-modal-submit").click(function (e) {
+    <button :disabled="isSubmitting">close</button>
-      e.preventDefault();
+  </form>
-      $("#edit-scenario-additional-information-modal-form").submit();
+</dialog>
-    });
-  });
-</script>

templates/modals/predict_modal.html

@@ -1,178 +0,0 @@
-{% load static %}
-<div
-  class="modal fade bs-modal-lg"
-  id="predict_modal"
-  tabindex="-1"
-  aria-labelledby="predict_modal"
-  aria-modal="true"
-  role="dialog"
->
-  <div class="modal-dialog modal-lg">
-    <div class="modal-content">
-      <div class="modal-header">
-        <button
-          type="button"
-          class="close"
-          data-dismiss="modal"
-          aria-label="Close"
-        >
-          <span aria-hidden="true">×</span>
-        </button>
-        <h4 class="modal-title">Predict a Pathway</h4>
-      </div>
-      <div class="modal-body">
-        <form
-          id="predict_modal_form"
-          accept-charset="UTF-8"
-          action="{{ meta.current_package.url }}/pathway"
-          data-remote="true"
-          method="post"
-        >
-          {% csrf_token %}
-          <div class="row">
-            <div class="col-md-6">
-              <label for="name">Name</label>
-              <input
-                id="name"
-                class="form-control"
-                name="name"
-                placeholder="Name"
-              />
-              <label for="description">Description</label>
-              <input
-                id="description"
-                class="form-control"
-                name="description"
-                placeholder="Description"
-              />
-            </div>
-            <div class="col-md-6">
-              <label for="predict">Predict pathway or build yourself?</label>
-              <div class="radio" id="predict">
-                <p>
-                  <label>
-                    <input
-                      type="radio"
-                      name="predict"
-                      id="radioPredict"
-                      value="predict"
-                      checked
-                    />Predict pathway
-                  </label>
-                </p>
-                <p>
-                  <label>
-                    <input
-                      type="radio"
-                      name="predict"
-                      id="radioIncremental"
-                      value="incremental"
-                    />Incremental prediction
-                  </label>
-                </p>
-                <p>
-                  <label>
-                    <input
-                      type="radio"
-                      name="predict"
-                      id="radioBuild"
-                      value="build"
-                    />Build pathway
-                  </label>
-                </p>
-              </div>
-            </div>
-          </div>
-          <label for="predict-modal-smiles">SMILES</label>
-          <input
-            type="text"
-            class="form-control"
-            name="smiles"
-            placeholder="SMILES"
-            id="predict-modal-smiles"
-          />
-          <p id="ketcher_container"></p>
-          <div>
-            <iframe
-              id="predict-modal-ketcher"
-              src="{% static '/js/ketcher2/ketcher.html' %}"
-              width="100%"
-              height="510"
-            ></iframe>
-          </div>
-
-          <label for="prediction-setting">Default Prediction Setting</label>
-          <select
-            id="prediction-setting"
-            name="prediction-setting"
-            class="form-control"
-            data-width="100%"
-          >
-            <option disabled>Select a Setting</option>
-            {% for s in meta.available_settings %}
-              <option
-                value="{{ s.url }}"
-                {% if s.id == meta.user.default_setting.id %}selected{% endif %}
-              >
-                {{ s.name|safe }}{% if s.id == meta.user.default_setting.id %}
-                  <i>(User default)</i>
-                {% endif %}
-              </option>
-            {% endfor %}
-          </select>
-        </form>
-      </div>
-      <div class="modal-footer">
-        <button
-          type="button"
-          class="btn btn-secondary pull-left"
-          data-dismiss="modal"
-        >
-          Close
-        </button>
-        <button type="button" class="btn btn-primary" id="predictButton">
-          Predict
-        </button>
-      </div>
-    </div>
-  </div>
-</div>
-<script>
-  function predictModalketcherToPredictModalTextInput() {
-    $("#predict-modal-smiles").val(this.ketcher.getSmiles());
-  }
-
-  $(function () {
-    $("#predict-modal-ketcher").on("load", function () {
-      const checkKetcherReady = () => {
-        win = this.contentWindow;
-        if (win.ketcher && "editor" in win.ketcher) {
-          win.ketcher.editor.event.change.handlers.push({
-            once: false,
-            priority: 0,
-            f: predictModalketcherToPredictModalTextInput,
-            ketcher: win.ketcher,
-          });
-        } else {
-          setTimeout(checkKetcherReady, 100);
-        }
-      };
-
-      checkKetcherReady();
-    });
-
-    $("#predictButton").on("click", function (e) {
-      e.preventDefault();
-      $(this).prop("disabled", true);
-
-      // loading button
-
-      // validation
-
-      // existing pws...
-
-      // submit form
-      $("#predict_modal_form").submit();
-    });
-  });
-</script>

templates/modals/search_modal.html

@@ -1,5 +1,10 @@
 {% load static %}
-<dialog id="search_modal" class="modal @max-sm:modal-top justify-center">
+<dialog
+  id="search_modal"
+  class="modal @max-sm:modal-top justify-center"
+  x-data="searchModal()"
+  @close="reset()"
+>
   <div class="modal-box h-full w-lvw p-1 sm:h-8/12 sm:w-[85vw] sm:max-w-5xl">
     <!-- Search Input and Mode Selector -->
     <div class="form-control mb-4 w-full shrink-0">
@@ -23,7 +28,9 @@
           <input
             type="text"
             autofocus
-            id="modal_searchbar"
+            x-ref="searchbar"
+            x-model="query"
+            @keydown.enter="performSearch('{{ SERVER_BASE }}')"
             placeholder="Benfuracarb"
             class="grow"
             aria-label="Search"
@@ -35,12 +42,11 @@
           <button
             type="button"
             tabindex="0"
-            id="modal_mode_button"
             popovertarget="search_dropdown_menu"
-            style="anchor-name:--1"
+            style="anchor-name: --1"
             class="btn join-item btn-ghost"
           >
-            Text
+            <span x-text="searchModeLabel"></span>
             <svg
               class="ml-1 h-4 w-4"
               fill="none"
@@ -59,13 +65,14 @@
             tabindex="0"
             class="dropdown dropdown-end menu bg-base-200 rounded-box w-64 p-2 shadow-lg"
             popover
+            x-ref="modeDropdown"
             id="search_dropdown_menu"
-            style="position-anchor:--anchor-2"
+            style="position-anchor: --anchor-2"
           >
             <li class="menu-title">Text</li>
             <li>
               <a
-                id="modal_dropdown_text"
+                @click.prevent="setSearchMode('text', 'Text')"
                 class="tooltip tooltip-left"
                 data-tip="Search on object names and descriptions"
               >
@@ -75,7 +82,7 @@
             <li class="menu-title">SMILES</li>
             <li>
               <a
-                id="modal_dropdown_smiles_default"
+                @click.prevent="setSearchMode('smiles_default', 'Default')"
                 class="tooltip tooltip-left"
                 data-tip="Ignores stereochemistry and charge"
               >
@@ -84,7 +91,7 @@
             </li>
             <li>
               <a
-                id="modal_dropdown_smiles_canonical"
+                @click.prevent="setSearchMode('smiles_canonical', 'Canonical')"
                 class="tooltip tooltip-left"
                 data-tip="Ignores stereochemistry, preserves charge"
               >
@@ -93,7 +100,7 @@
             </li>
             <li>
               <a
-                id="modal_dropdown_smiles_exact"
+                @click.prevent="setSearchMode('smiles_exact', 'Exact')"
                 class="tooltip tooltip-left"
                 data-tip="Exact match for stereochemistry and charge"
               >
@@ -103,7 +110,7 @@
             <li class="menu-title">InChI</li>
             <li>
               <a
-                id="modal_dropdown_inchikey"
+                @click.prevent="setSearchMode('inchikey', 'InChIKey')"
                 class="tooltip tooltip-left"
                 data-tip="Search by InChIKey"
               >
@@ -115,7 +122,7 @@
 
         <button
           type="button"
-          id="modal_search_button"
+          @click="performSearch('{{ SERVER_BASE }}')"
           class="btn btn-xs btn-ghost join-item"
         >
           <kbd class="kbd kbd-sm text-base-content/50 p-1">
@@ -143,18 +150,62 @@
     <div class="form-control mb-4 shrink-0">
       <!-- Pills Container -->
       <div
-        id="modal_package_pills_container"
         class="border-base-300 m-3 flex min-h-12 flex-wrap items-center gap-2 rounded-lg border-2 border-dashed p-3"
       >
-        <!-- Pills will be added here dynamically -->
+        <!-- Dynamic Pills -->
+        <template x-for="pkg in selectedPackages" :key="pkg.url">
+          <span class="badge badge-outline gap-2 max-w-xs">
+            <span class="truncate" :title="pkg.name" x-text="pkg.name"></span>
+            <svg
+              xmlns="http://www.w3.org/2000/svg"
+              class="h-4 w-4 cursor-pointer hover:text-error shrink-0 rotate-45"
+              viewBox="0 0 24 24"
+              fill="none"
+              stroke="currentColor"
+              stroke-width="2"
+              stroke-linecap="round"
+              stroke-linejoin="round"
+              @click="removePackage(pkg.url)"
+            >
+              <path d="M5 12h14" />
+              <path d="M12 5v14" />
+            </svg>
+          </span>
+        </template>
+
+        <!-- Add Package Button -->
+        <button
+          type="button"
+          popovertarget="package_dropdown_menu"
+          style="anchor-name: --anchor-packages"
+          class="btn btn-sm btn-ghost gap-2 text-base-content/50"
+        >
+          <svg
+            xmlns="http://www.w3.org/2000/svg"
+            width="16"
+            height="16"
+            viewBox="0 0 24 24"
+            fill="none"
+            stroke="currentColor"
+            stroke-width="2"
+            stroke-linecap="round"
+            stroke-linejoin="round"
+            class="lucide lucide-plus-icon lucide-plus"
+          >
+            <path d="M5 12h14" />
+            <path d="M12 5v14" />
+          </svg>
+          Add Package
+        </button>
       </div>
 
       <!-- Package Dropdown Menu -->
       <ul
         class="dropdown dropdown-center menu bg-base-200 rounded-box max-h-96 w-80 overflow-y-auto p-2 shadow-lg"
         popover
+        x-ref="packageDropdown"
         id="package_dropdown_menu"
-        style="position-anchor:--anchor-packages"
+        style="position-anchor: --anchor-packages"
       >
         {% if unreviewed_packages %}
           <li class="menu-title">Reviewed Packages</li>
@@ -164,11 +215,13 @@
                 class="package-option flex items-center justify-between"
                 data-package-url="{{ obj.url }}"
                 data-package-name="{{ obj.name }}"
+                @click.prevent.stop="togglePackage('{{ obj.url }}', '{{ obj.name }}')"
               >
                 <span>{{ obj.name }}</span>
                 <svg
                   xmlns="http://www.w3.org/2000/svg"
-                  class="package-checkmark hidden h-4 w-4"
+                  class="h-4 w-4"
+                  :class="isPackageSelected('{{ obj.url }}') ? '' : 'hidden'"
                   fill="none"
                   viewBox="0 0 24 24"
                   stroke="currentColor"
@@ -190,11 +243,13 @@
                 class="package-option flex items-center justify-between"
                 data-package-url="{{ obj.url }}"
                 data-package-name="{{ obj.name }}"
+                @click.prevent.stop="togglePackage('{{ obj.url }}', '{{ obj.name }}')"
               >
                 <span>{{ obj.name }}</span>
                 <svg
                   xmlns="http://www.w3.org/2000/svg"
-                  class="package-checkmark hidden h-4 w-4"
+                  class="h-4 w-4"
+                  :class="isPackageSelected('{{ obj.url }}') ? '' : 'hidden'"
                   fill="none"
                   viewBox="0 0 24 24"
                   stroke="currentColor"
@@ -217,11 +272,13 @@
                 class="package-option flex items-center justify-between"
                 data-package-url="{{ obj.url }}"
                 data-package-name="{{ obj.name }}"
+                @click.prevent.stop="togglePackage('{{ obj.url }}', '{{ obj.name }}')"
               >
                 <span>{{ obj.name }}</span>
                 <svg
                   xmlns="http://www.w3.org/2000/svg"
-                  class="package-checkmark hidden h-4 w-4"
+                  class="h-4 w-4"
+                  :class="isPackageSelected('{{ obj.url }}') ? '' : 'hidden'"
                   fill="none"
                   viewBox="0 0 24 24"
                   stroke="currentColor"
@@ -241,12 +298,201 @@
     </div>
 
     <!-- Loading Indicator -->
-    <div id="search_loading" class="hidden shrink-0 justify-center py-8">
+    <div x-show="isSearching" class="flex shrink-0 justify-center py-8">
       <span class="loading loading-spinner loading-lg text-primary"></span>
     </div>
 
-    <!-- Results Container - scrollable -->
+    <!-- Results Container -->
-    <div id="search_results" class="min-h-0 flex-1 overflow-y-auto p-2"></div>
+    <div class="min-h-0 flex-1 overflow-y-auto p-2">
+      <!-- No packages selected error -->
+      <template x-if="results && results.error === 'no_packages'">
+        <div class="alert alert-info">
+          <svg
+            class="w-6 h-6"
+            fill="none"
+            stroke="currentColor"
+            viewBox="0 0 24 24"
+          >
+            <path
+              stroke-linecap="round"
+              stroke-linejoin="round"
+              stroke-width="2"
+              d="M13 16h-1v-4h-1m1-4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"
+            />
+          </svg>
+          <span>Please select at least one package</span>
+        </div>
+      </template>
+
+      <!-- Search error -->
+      <template x-if="error">
+        <div class="alert alert-error">
+          <svg
+            class="w-6 h-6"
+            fill="none"
+            stroke="currentColor"
+            viewBox="0 0 24 24"
+          >
+            <path
+              stroke-linecap="round"
+              stroke-linejoin="round"
+              stroke-width="2"
+              d="M12 8v4m0 4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"
+            />
+          </svg>
+          <span x-text="error"></span>
+        </div>
+      </template>
+
+      <!-- No results -->
+      <template x-if="results && !results.error && !hasResults()">
+        <div class="alert alert-warning">
+          <svg
+            class="w-6 h-6"
+            fill="none"
+            stroke="currentColor"
+            viewBox="0 0 24 24"
+          >
+            <path
+              stroke-linecap="round"
+              stroke-linejoin="round"
+              stroke-width="2"
+              d="M12 9v2m0 4h.01m-6.938 4h13.856c1.54 0 2.502-1.667 1.732-3L13.732 4c-.77-1.333-2.694-1.333-3.464 0L3.34 16c-.77 1.333.192 3 1.732 3z"
+            />
+          </svg>
+          <span>No results found</span>
+        </div>
+      </template>
+
+      <!-- Results display -->
+      <template x-if="results && !results.error && hasResults()">
+        <div class="mb-2">
+          <div class="text-sm font-semibold text-base-content/70 mb-2">
+            Results
+          </div>
+
+          <!-- Compounds -->
+          <template x-if="results.Compounds && results.Compounds.length > 0">
+            <div class="collapse collapse-arrow bg-base-200 mb-2">
+              <input type="checkbox" checked />
+              <div class="collapse-title font-medium">
+                Compounds
+                <span
+                  class="badge badge-neutral badge-sm ml-2"
+                  x-text="results.Compounds.length"
+                ></span>
+              </div>
+              <div class="collapse-content">
+                <template x-for="item in results.Compounds" :key="item.url">
+                  <a
+                    :href="item.url"
+                    class="block px-4 py-2 hover:bg-base-300 rounded-lg transition-colors"
+                    x-text="item.name"
+                  ></a>
+                </template>
+              </div>
+            </div>
+          </template>
+
+          <!-- Compound Structures -->
+          <template
+            x-if="results['Compound Structures'] && results['Compound Structures'].length > 0"
+          >
+            <div class="collapse collapse-arrow bg-base-200 mb-2">
+              <input type="checkbox" checked />
+              <div class="collapse-title font-medium">
+                Compound Structures
+                <span
+                  class="badge badge-neutral badge-sm ml-2"
+                  x-text="results['Compound Structures'].length"
+                ></span>
+              </div>
+              <div class="collapse-content">
+                <template
+                  x-for="item in results['Compound Structures']"
+                  :key="item.url"
+                >
+                  <a
+                    :href="item.url"
+                    class="block px-4 py-2 hover:bg-base-300 rounded-lg transition-colors"
+                    x-text="item.name"
+                  ></a>
+                </template>
+              </div>
+            </div>
+          </template>
+
+          <!-- Rules -->
+          <template x-if="results.Rules && results.Rules.length > 0">
+            <div class="collapse collapse-arrow bg-base-200 mb-2">
+              <input type="checkbox" checked />
+              <div class="collapse-title font-medium">
+                Rules
+                <span
+                  class="badge badge-neutral badge-sm ml-2"
+                  x-text="results.Rules.length"
+                ></span>
+              </div>
+              <div class="collapse-content">
+                <template x-for="item in results.Rules" :key="item.url">
+                  <a
+                    :href="item.url"
+                    class="block px-4 py-2 hover:bg-base-300 rounded-lg transition-colors"
+                    x-text="item.name"
+                  ></a>
+                </template>
+              </div>
+            </div>
+          </template>
+
+          <!-- Reactions -->
+          <template x-if="results.Reactions && results.Reactions.length > 0">
+            <div class="collapse collapse-arrow bg-base-200 mb-2">
+              <input type="checkbox" checked />
+              <div class="collapse-title font-medium">
+                Reactions
+                <span
+                  class="badge badge-neutral badge-sm ml-2"
+                  x-text="results.Reactions.length"
+                ></span>
+              </div>
+              <div class="collapse-content">
+                <template x-for="item in results.Reactions" :key="item.url">
+                  <a
+                    :href="item.url"
+                    class="block px-4 py-2 hover:bg-base-300 rounded-lg transition-colors"
+                    x-text="item.name"
+                  ></a>
+                </template>
+              </div>
+            </div>
+          </template>
+
+          <!-- Pathways -->
+          <template x-if="results.Pathways && results.Pathways.length > 0">
+            <div class="collapse collapse-arrow bg-base-200 mb-2">
+              <input type="checkbox" checked />
+              <div class="collapse-title font-medium">
+                Pathways
+                <span
+                  class="badge badge-neutral badge-sm ml-2"
+                  x-text="results.Pathways.length"
+                ></span>
+              </div>
+              <div class="collapse-content">
+                <template x-for="item in results.Pathways" :key="item.url">
+                  <a
+                    :href="item.url"
+                    class="block px-4 py-2 hover:bg-base-300 rounded-lg transition-colors"
+                    x-text="item.name"
+                  ></a>
+                </template>
+              </div>
+            </div>
+          </template>
+        </div>
+      </template>
+    </div>
   </div>
 
   <!-- Backdrop to close -->
@@ -254,433 +500,3 @@
     <button>close</button>
   </form>
 </dialog>
-
-<script>
-  (function () {
-    // Package Selector Module - Data-driven multiselect package selection
-    const PackageSelector = {
-      // Single source of truth: array of selected packages
-      selectedPackages: [],
-
-      elements: {
-        pillsContainer: null,
-        packageDropdown: null,
-        packageOptions: null,
-      },
-
-      init() {
-        this.cacheElements();
-        this.loadInitialSelection();
-        this.attachEventListeners();
-        this.render();
-      },
-
-      cacheElements() {
-        this.elements.pillsContainer = document.getElementById(
-          "modal_package_pills_container",
-        );
-        this.elements.packageDropdown = document.getElementById(
-          "package_dropdown_menu",
-        );
-        this.elements.packageOptions =
-          document.querySelectorAll(".package-option");
-      },
-
-      loadInitialSelection() {
-        // Load pre-selected packages from server-rendered pills
-        const existingPills =
-          this.elements.pillsContainer.querySelectorAll(".badge");
-        existingPills.forEach((pill) => {
-          this.selectedPackages.push({
-            url: pill.dataset.packageUrl,
-            name: pill.dataset.packageName,
-          });
-        });
-
-        // If no pills found, select all reviewed packages by default
-        if (this.selectedPackages.length === 0) {
-          // Iterate through all menu items and collect reviewed packages
-          const menuItems =
-            this.elements.packageDropdown.querySelectorAll("li");
-
-          for (const item of menuItems) {
-            // Check if this is the "Unreviewed Packages" menu title
-            if (
-              item.classList.contains("menu-title") &&
-              item.textContent.trim() === "Unreviewed Packages"
-            ) {
-              break; // Stop processing after this point
-            }
-
-            // Check for package options (only reviewed packages reach here)
-            const packageOption = item.querySelector(".package-option");
-            if (packageOption) {
-              this.selectedPackages.push({
-                url: packageOption.dataset.packageUrl,
-                name: packageOption.dataset.packageName,
-              });
-            }
-          }
-        }
-      },
-
-      attachEventListeners() {
-        // Toggle package selection on dropdown item click
-        this.elements.packageOptions.forEach((option) => {
-          option.addEventListener("click", (e) => {
-            e.preventDefault();
-            e.stopPropagation(); // Prevent dropdown from closing
-            const packageUrl = option.dataset.packageUrl;
-            const packageName = option.dataset.packageName;
-            this.togglePackageSelection(packageUrl, packageName);
-          });
-        });
-
-        // Remove package when X is clicked (using event delegation)
-        this.elements.pillsContainer.addEventListener("click", (e) => {
-          if (
-            e.target.classList.contains("package-remove-btn") ||
-            e.target.closest(".package-remove-btn")
-          ) {
-            const pill = e.target.closest(".badge");
-            if (pill) {
-              const packageUrl = pill.dataset.packageUrl;
-              this.removePackage(packageUrl);
-            }
-          }
-        });
-      },
-
-      togglePackageSelection(packageUrl, packageName) {
-        const index = this.selectedPackages.findIndex(
-          (pkg) => pkg.url === packageUrl,
-        );
-
-        if (index !== -1) {
-          // Remove from selection
-          this.selectedPackages.splice(index, 1);
-        } else {
-          // Add to selection
-          this.selectedPackages.push({ url: packageUrl, name: packageName });
-        }
-
-        this.render();
-      },
-
-      removePackage(packageUrl) {
-        const index = this.selectedPackages.findIndex(
-          (pkg) => pkg.url === packageUrl,
-        );
-        if (index !== -1) {
-          this.selectedPackages.splice(index, 1);
-          this.render();
-        }
-      },
-
-      render() {
-        this.renderPills();
-        this.renderAddButton();
-        this.renderCheckmarks();
-      },
-
-      renderPills() {
-        // Clear existing pills and button (except placeholder)
-        const pills = this.elements.pillsContainer.querySelectorAll(".badge");
-        pills.forEach((pill) => pill.remove());
-
-        const existingButton = this.elements.pillsContainer.querySelector(
-          "#modal_package_add_button",
-        );
-        if (existingButton) {
-          existingButton.remove();
-        }
-
-        // Create pills from data
-        this.selectedPackages.forEach((pkg) => {
-          const pill = this.createPillElement(pkg.url, pkg.name);
-          this.elements.pillsContainer.appendChild(pill);
-        });
-      },
-
-      renderAddButton() {
-        // Only render button if there are packages available
-        if (this.elements.packageOptions.length === 0) {
-          return;
-        }
-
-        const button = document.createElement("button");
-        button.type = "button";
-        button.id = "modal_package_add_button";
-        button.setAttribute("popovertarget", "package_dropdown_menu");
-        button.style.cssText = "anchor-name:--anchor-packages";
-        button.className = "btn btn-sm btn-ghost gap-2 text-base-content/50";
-
-        button.innerHTML = `
-                <svg xmlns="http://www.w3.org/2000/svg" width="16" height="16" viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round" class="lucide lucide-plus-icon lucide-plus"><path d="M5 12h14"/><path d="M12 5v14"/></svg>
-                Add Package
-            `;
-
-        this.elements.pillsContainer.appendChild(button);
-      },
-
-      createPillElement(packageUrl, packageName) {
-        const pill = document.createElement("span");
-        pill.className = "badge badge-outline gap-2 max-w-xs";
-        pill.dataset.packageUrl = packageUrl;
-        pill.dataset.packageName = packageName;
-
-        pill.innerHTML = `
-                <span class="truncate" title="${packageName}">${packageName}</span>
-
-                <svg xmlns="http://www.w3.org/2000/svg"
-                class="h-4 w-4 cursor-pointer hover:text-error package-remove-btn flex-shrink-0 rotate-45"
-                viewBox="0 0 24 24"
-                fill="none" stroke="currentColor"
-                stroke-width="2"
-                stroke-linecap="round"
-                stroke-linejoin="round"
-                >
-                <path d="M5 12h14"/><path d="M12 5v14"/>
-                </svg>
-            `;
-
-        return pill;
-      },
-
-      renderCheckmarks() {
-        // Update all checkmarks based on selected packages
-        this.elements.packageOptions.forEach((option) => {
-          const packageUrl = option.dataset.packageUrl;
-          const isSelected = this.selectedPackages.some(
-            (pkg) => pkg.url === packageUrl,
-          );
-          const checkmark = option.querySelector(".package-checkmark");
-
-          if (checkmark) {
-            checkmark.classList.toggle("hidden", !isSelected);
-          }
-        });
-      },
-
-      getSelectedPackages() {
-        return this.selectedPackages.map((pkg) => pkg.url);
-      },
-    };
-
-    // Modal and Search Management
-    const modal = document.getElementById("search_modal");
-    const searchbar = document.getElementById("modal_searchbar");
-    const searchButton = document.getElementById("modal_search_button");
-    const modeButton = document.getElementById("modal_mode_button");
-    const resultsDiv = document.getElementById("search_results");
-    const loadingDiv = document.getElementById("search_loading");
-
-    // MutationObserver to detect when modal opens
-    const observer = new MutationObserver((mutations) => {
-      mutations.forEach((mutation) => {
-        if (mutation.attributeName === "open" && modal.open) {
-          PackageSelector.render();
-          // Delay focus to allow CSS transitions to complete (modal has 0.3s transition)
-          setTimeout(() => {
-            searchbar.focus();
-          }, 320);
-        }
-      });
-    });
-
-    observer.observe(modal, { attributes: true });
-
-    // Close modal when clicking outside (on the backdrop)
-    // According to DaisyUI docs: https://daisyui.com/components/modal/
-    // The backdrop form with method="dialog" should handle closing automatically when its button is clicked.
-    // We also handle clicks directly on the dialog element (backdrop area) or the backdrop form.
-    modal.addEventListener("click", function (event) {
-      const backdrop = modal.querySelector(".modal-backdrop");
-      const modalBox = modal.querySelector(".modal-box");
-
-      // Close if clicking directly on the dialog element (backdrop area)
-      // or on the backdrop form (but ensure we're not clicking on modal-box content)
-      if (
-        event.target === modal ||
-        (backdrop &&
-          (event.target === backdrop || backdrop.contains(event.target)) &&
-          !modalBox.contains(event.target))
-      ) {
-        modal.close();
-      }
-    });
-
-    // Clear results when modal closes
-    modal.addEventListener("close", function () {
-      resultsDiv.innerHTML = "";
-      loadingDiv.classList.add("hidden");
-      searchbar.value = "";
-    });
-
-    // Mode dropdown handlers
-    const dropdownMenu = document.getElementById("search_dropdown_menu");
-
-    const modeButtons = [
-      { id: "modal_dropdown_text", text: "Text" },
-      { id: "modal_dropdown_smiles_default", text: "Default" },
-      { id: "modal_dropdown_smiles_canonical", text: "Canonical" },
-      { id: "modal_dropdown_smiles_exact", text: "Exact" },
-      { id: "modal_dropdown_inchikey", text: "InChIKey" },
-    ];
-
-    modeButtons.forEach(({ id, text }) => {
-      document.getElementById(id).addEventListener("click", function (e) {
-        e.preventDefault();
-        modeButton.innerHTML =
-          text +
-          ` <svg class="w-4 h-4 ml-1" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M19 9l-7 7-7-7"/>
-            </svg>`;
-        // Close dropdown using popover API
-        if (dropdownMenu && typeof dropdownMenu.hidePopover === "function") {
-          dropdownMenu.hidePopover();
-        }
-      });
-    });
-
-    // Initialize Package Selector
-    PackageSelector.init();
-
-    // Search Response Handler
-    function handleSearchResponse(data) {
-      resultsDiv.innerHTML = "";
-
-      function makeContent(objs) {
-        let links = "";
-        objs.forEach((obj) => {
-          links += `<a href="${obj.url}" class="block px-4 py-2 hover:bg-base-300 rounded-lg transition-colors">${obj.name}</a>`;
-        });
-        return links;
-      }
-
-      let allEmpty = true;
-      let content = "";
-
-      // Category order for better UX
-      const categoryOrder = [
-        "Compounds",
-        "Compound Structures",
-        "Rules",
-        "Reactions",
-        "Pathways",
-      ];
-
-      categoryOrder.forEach((key) => {
-        if (!data[key] || data[key].length < 1) {
-          return;
-        }
-        allEmpty = false;
-
-        content += `
-                <div class="collapse collapse-arrow bg-base-200 mb-2">
-                    <input type="checkbox" checked />
-                    <div class="collapse-title font-medium">
-                        ${key} <span class="badge badge-neutral badge-sm ml-2">${data[key].length}</span>
-                    </div>
-                    <div class="collapse-content">
-                        ${makeContent(data[key])}
-                    </div>
-                </div>
-            `;
-      });
-
-      if (allEmpty) {
-        resultsDiv.innerHTML = `
-                <div class="alert alert-warning">
-                    <svg class="w-6 h-6" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                        <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M12 9v2m0 4h.01m-6.938 4h13.856c1.54 0 2.502-1.667 1.732-3L13.732 4c-.77-1.333-2.694-1.333-3.464 0L3.34 16c-.77 1.333.192 3 1.732 3z"/>
-                    </svg>
-                    <span>No results found</span>
-                </div>
-            `;
-      } else {
-        resultsDiv.innerHTML = `
-                <div class="mb-2">
-                    <div class="text-sm font-semibold text-base-content/70 mb-2">Results</div>
-                    ${content}
-                </div>
-            `;
-      }
-    }
-
-    // Search Execution
-    function performSearch(e) {
-      e.preventDefault();
-
-      const query = searchbar.value.trim();
-
-      if (!query) {
-        console.log("Search phrase empty, won't do search");
-        return;
-      }
-
-      const selPacks = PackageSelector.getSelectedPackages();
-
-      if (selPacks.length < 1) {
-        console.log("No package selected, won't do search");
-        resultsDiv.innerHTML = `
-                <div class="alert alert-info">
-                    <svg class="w-6 h-6" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                        <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M13 16h-1v-4h-1m1-4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"/>
-                    </svg>
-                    <span>Please select at least one package</span>
-                </div>
-            `;
-        return;
-      }
-
-      const mode = modeButton.textContent.trim().toLowerCase();
-
-      const params = new URLSearchParams();
-      selPacks.forEach((pack) => params.append("packages", pack));
-      params.append("search", query);
-      params.append("mode", mode);
-
-      // Show loading
-      loadingDiv.classList.remove("hidden");
-      resultsDiv.innerHTML = "";
-
-      fetch(`{{ SERVER_BASE }}/search?${params.toString()}`, {
-        method: "GET",
-        headers: {
-          Accept: "application/json",
-        },
-      })
-        .then((response) => {
-          if (!response.ok) {
-            throw new Error("Search request failed");
-          }
-          return response.json();
-        })
-        .then((result) => {
-          loadingDiv.classList.add("hidden");
-          handleSearchResponse(result);
-        })
-        .catch((error) => {
-          loadingDiv.classList.add("hidden");
-          console.error("Search error:", error);
-          resultsDiv.innerHTML = `
-                <div class="alert alert-error">
-                    <svg class="w-6 h-6" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                        <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M12 8v4m0 4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"/>
-                    </svg>
-                    <span>Search failed. Please try again.</span>
-                </div>
-            `;
-        });
-    }
-
-    // Event listeners for search
-    searchButton.addEventListener("click", performSearch);
-    searchbar.addEventListener("keydown", function (e) {
-      if (e.key === "Enter") {
-        performSearch(e);
-      }
-    });
-  })();
-</script>

templates/objects/composite_rule.html

@@ -1,4 +1,4 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 
 {% block content %}
 
@@ -10,171 +10,146 @@
     {% include "modals/objects/generic_delete_modal.html" %}
   {% endblock action_modals %}
 
-  <div class="panel-group" id="rule-detail">
+  <div class="space-y-2 p-4">
-    <div class="panel panel-default">
+    <!-- Header Section -->
-      <div
+    <div class="card bg-base-100">
-        class="panel-heading"
+      <div class="card-body">
-        id="headingPanel"
+        <div class="flex items-center justify-between">
-        style="font-size:2rem;height: 46px"
+          <h2 class="card-title text-2xl">{{ rule.name }}</h2>
-      >
+          <div id="actionsButton" class="dropdown dropdown-end hidden">
-        {{ rule.name|safe }}
+            <div tabindex="0" role="button" class="btn btn-ghost btn-sm">
-        <div
+              <svg
-          id="actionsButton"
+                xmlns="http://www.w3.org/2000/svg"
-          style="float: right;font-weight: normal;font-size: medium;position: relative; top: 50%; transform: translateY(-50%);z-index:100;display: none;"
+                width="16"
-          class="dropdown"
+                height="16"
-        >
+                viewBox="0 0 24 24"
-          <a
+                fill="none"
-            href="#"
+                stroke="currentColor"
-            class="dropdown-toggle"
+                stroke-width="2"
-            data-toggle="dropdown"
+                stroke-linecap="round"
-            role="button"
+                stroke-linejoin="round"
-            aria-haspopup="true"
+                class="lucide lucide-wrench"
-            aria-expanded="false"
+              >
-            ><span class="glyphicon glyphicon-wrench"></span> Actions
+                <path
-            <span class="caret"></span><span style="padding-right:1em"></span
+                  d="M14.7 6.3a1 1 0 0 0 0 1.4l1.6 1.6a1 1 0 0 0 1.4 0l3.77-3.77a6 6 0 0 1-7.94 7.94l-6.91 6.91a2.12 2.12 0 0 1-3-3l6.91-6.91a6 6 0 0 1 7.94-7.94l-3.76 3.76z"
-          ></a>
+                />
-          <ul id="actionsList" class="dropdown-menu">
+              </svg>
-            {% block actions %}
+              Actions
-              {% include "actions/objects/rule.html" %}
+            </div>
-            {% endblock %}
+            <ul
+              tabindex="-1"
+              class="dropdown-content menu bg-base-100 rounded-box z-50 w-52 p-2"
+            >
+              {% block actions %}
+                {% include "actions/objects/rule.html" %}
+              {% endblock %}
+            </ul>
+          </div>
+        </div>
+        <p class="mt-2">{{ rule.description|safe }}</p>
+      </div>
+    </div>
+
+    {% if rule.aliases %}
+      <!-- Aliases -->
+      <div class="collapse-arrow bg-base-200 collapse">
+        <input type="checkbox" checked />
+        <div class="collapse-title text-xl font-medium">Aliases</div>
+        <div class="collapse-content">
+          <ul class="menu bg-base-100 rounded-box">
+            {% for alias in rule.aliases %}
+              <li><a class="hover:bg-base-200">{{ alias }}</a></li>
+            {% endfor %}
           </ul>
         </div>
       </div>
-      <div class="panel-body">
+    {% endif %}
-        <p>{{ rule.description|safe }}</p>
-      </div>
 
-      {% if rule.aliases %}
+    <!-- Reaction Patterns -->
-        <!-- Aliases -->
+    <div class="collapse-arrow bg-base-200 collapse">
-        <div
+      <input type="checkbox" checked />
-          class="panel panel-default panel-heading list-group-item"
+      <div class="collapse-title text-xl font-medium">Reaction Patterns</div>
-          style="background-color:silver"
+      <div class="collapse-content">
-        >
+        <div class="space-y-4">
-          <h4 class="panel-title">
-            <a
-              id="rule-aliases-link"
-              data-toggle="collapse"
-              data-parent="#rule-detail"
-              href="#rule-aliases"
-              >Aliases</a
-            >
-          </h4>
-        </div>
-        <div id="rule-aliases" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
-            {% for alias in rule.aliases %}
-              <a class="list-group-item">{{ alias }}</a>
-            {% endfor %}
-          </div>
-        </div>
-      {% endif %}
-
-      <!-- Reaction Patterns -->
-      <div
-        class="panel panel-default panel-heading list-group-item"
-        style="background-color:silver"
-      >
-        <h4 class="panel-title">
-          <a
-            id="rule-reaction-patterns-link"
-            data-toggle="collapse"
-            data-parent="#rule-detail"
-            href="#rule-reaction-patterns"
-            >Reaction Patterns</a
-          >
-        </h4>
-      </div>
-      <div id="rule-reaction-patterns" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
           {% for r in rule.srs %}
-            <a class="list-group-item" href="{{ r.url }}">{{ r.name|safe }}</a>
+            <div class="card bg-base-100">
-            <div align="center">
+              <div class="card-body">
-              <p>{{ r.as_svg|safe }}</p>
+                <a href="{{ r.url }}" class="link link-primary font-semibold"
+                  >{{ r.name }}</a
+                >
+                <div class="mt-2 flex justify-center">{{ r.as_svg|safe }}</div>
+              </div>
             </div>
           {% endfor %}
         </div>
       </div>
+    </div>
 
-      <!-- Scenarios -->
+    <!-- Scenarios -->
-      {% if rule.scenarios.all %}
+    {% if rule.scenarios.all %}
-        <div
+      <div class="collapse-arrow bg-base-200 collapse">
-          class="panel panel-default panel-heading list-group-item"
+        <input type="checkbox" checked />
-          style="background-color:silver"
+        <div class="collapse-title text-xl font-medium">Scenarios</div>
-        >
+        <div class="collapse-content">
-          <h4 class="panel-title">
+          <ul class="menu bg-base-100 rounded-box">
-            <a
-              id="rule-scenario-link"
-              data-toggle="collapse"
-              data-parent="#rule-detail"
-              href="#rule-scenario"
-              >Scenarios</a
-            >
-          </h4>
-        </div>
-        <div id="rule-scenario" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
             {% for s in rule.scenarios.all %}
-              <a class="list-group-item" href="{{ s.url }}"
+              <li>
-                >{{ s.name|safe }} <i>({{ s.package.name|safe }})</i></a
+                <a href="{{ s.url }}" class="hover:bg-base-200"
-              >
+                  >{{ s.name }} <i>({{ s.package.name }})</i></a
+                >
+              </li>
             {% endfor %}
-          </div>
+          </ul>
         </div>
-      {% endif %}
+      </div>
+    {% endif %}
 
-      {% if rule.enzymelinks %}
+    {% if rule.enzymelinks %}
-        <!-- EC Numbers -->
+      <!-- EC Numbers -->
-        <div
+      <div class="collapse-arrow bg-base-200 collapse">
-          class="panel panel-default panel-heading list-group-item"
+        <input type="checkbox" checked />
-          style="background-color:silver"
+        <div class="collapse-title text-xl font-medium">EC Numbers</div>
-        >
+        <div class="collapse-content">
-          <h4 class="panel-title">
+          <div class="space-y-2">
-            <a
-              id="rule-ec-numbers-link"
-              data-toggle="collapse"
-              data-parent="#rule-detail"
-              href="#rule-ec-numbers"
-              >EC Numbers</a
-            >
-          </h4>
-        </div>
-        <div id="rule-ec-numbers" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
             {% for k, v in rule.get_grouped_enzymelinks.items %}
-              <div
+              <div class="collapse-arrow bg-base-100 collapse">
-                class="panel panel-default panel-heading list-group-item"
+                <input type="checkbox" checked />
-                style="background-color:silver"
+                <div class="collapse-title text-lg font-medium">{{ k }}</div>
-              >
+                <div class="collapse-content">
-                <h4 class="panel-title">
+                  <ul class="menu bg-base-200 rounded-box">
-                  <a
+                    {% for enzyme in v %}
-                    id="{{ k|slugify }}_Link"
+                      <li>
-                    data-toggle="collapse"
+                        <a href="{{ enzyme.url }}" class="hover:bg-base-300">
-                    data-parent="#{{ k|slugify }}_Accordion"
+                          <div class="flex w-full items-center justify-between">
-                    href="#{{ k|slugify }}"
+                            <span>{{ enzyme.ec_number }}</span>
-                  >
+                            <span class="text-sm opacity-70"
-                    {{ k }}
+                              >{{ enzyme.linking_method }}</span
-                  </a>
+                            >
-                </h4>
+                          </div>
-              </div>
+                          <div class="text-sm opacity-60">
-              <div id="{{ k|slugify }}" class="panel-collapse in collapse">
+                            {{ enzyme.name }}
-                <div class="panel-body list-group-item">
+                          </div>
-                  {% for enzyme in v %}
+                        </a>
-                    <a class="list-group-item" href="{{ enzyme.url }}">
+                      </li>
-                      {{ enzyme.ec_number }}
+                    {% endfor %}
-                      <div style="position:absolute;bottom:10px;left:100px;">
+                  </ul>
-                        {{ enzyme.name }}
-                      </div>
-                      <div style="float:right;">
-                        {{ enzyme.linking_method }}
-                      </div>
-                    </a>
-                  {% endfor %}
                 </div>
               </div>
             {% endfor %}
           </div>
         </div>
-      {% endif %}
+      </div>
-    </div>
+    {% endif %}
   </div>
+
+  <script>
+    // Show actions button if there are actions
+    document.addEventListener("DOMContentLoaded", function () {
+      const actionsButton = document.getElementById("actionsButton");
+      const actionsList = actionsButton?.querySelector("ul");
+      if (actionsList && actionsList.children.length > 0) {
+        actionsButton?.classList.remove("hidden");
+      }
+    });
+  </script>
 {% endblock content %}

templates/objects/compound.html

@@ -1,4 +1,4 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 
 {% block content %}
 
@@ -12,360 +12,261 @@
     {% include "modals/objects/generic_delete_modal.html" %}
   {% endblock action_modals %}
 
-  <div class="panel-group" id="compound-detail">
+  <div class="space-y-2 p-4">
-    <div class="panel panel-default">
+    <!-- Header Section -->
-      <div
+    <div class="card bg-base-100">
-        class="panel-heading"
+      <div class="card-body">
-        id="headingPanel"
+        <div class="flex items-center justify-between">
-        style="font-size:2rem;height: 46px"
+          <h2 class="card-title text-2xl">{{ compound.name }}</h2>
-      >
+          <div id="actionsButton" class="dropdown dropdown-end hidden">
-        {{ compound.name|safe }}
+            <div tabindex="0" role="button" class="btn btn-ghost btn-sm">
-        <div
+              <svg
-          id="actionsButton"
+                xmlns="http://www.w3.org/2000/svg"
-          style="float: right;font-weight: normal;font-size: medium;position: relative; top: 50%; transform: translateY(-50%);z-index:100;display: none;"
+                width="16"
-          class="dropdown"
+                height="16"
-        >
+                viewBox="0 0 24 24"
-          <a
+                fill="none"
-            href="#"
+                stroke="currentColor"
-            class="dropdown-toggle"
+                stroke-width="2"
-            data-toggle="dropdown"
+                stroke-linecap="round"
-            role="button"
+                stroke-linejoin="round"
-            aria-haspopup="true"
+                class="lucide lucide-wrench"
-            aria-expanded="false"
+              >
-            ><span class="glyphicon glyphicon-wrench"></span> Actions
+                <path
-            <span class="caret"></span><span style="padding-right:1em"></span
+                  d="M14.7 6.3a1 1 0 0 0 0 1.4l1.6 1.6a1 1 0 0 0 1.4 0l3.77-3.77a6 6 0 0 1-7.94 7.94l-6.91 6.91a2.12 2.12 0 0 1-3-3l6.91-6.91a6 6 0 0 1 7.94-7.94l-3.76 3.76z"
-          ></a>
+                />
-          <ul id="actionsList" class="dropdown-menu">
+              </svg>
-            {% block actions %}
+              Actions
-              {% include "actions/objects/compound.html" %}
+            </div>
-            {% endblock %}
+            <ul
-          </ul>
+              tabindex="-1"
+              class="dropdown-content menu bg-base-100 rounded-box z-50 w-52 p-2"
+            >
+              {% block actions %}
+                {% include "actions/objects/compound.html" %}
+              {% endblock %}
+            </ul>
+          </div>
         </div>
-      </div>
+        <p class="mt-2">
-      <div class="panel-body">
-        <p>
           The structures stored in this compound can be found at
-          <a target="_blank" href="{{ compound.url }}/structure" role="button"
+          <a
+            target="_blank"
+            href="{{ compound.url }}/structure"
+            class="link link-primary"
             >Compound structures &gt;&gt;</a
           >
         </p>
       </div>
+    </div>
 
-      {% if compound.aliases %}
+    {% if compound.aliases %}
-        <!-- Aliases -->
+      <!-- Aliases -->
-        <div
+      <div class="collapse-arrow bg-base-200 collapse">
-          class="panel panel-default panel-heading list-group-item"
+        <input type="checkbox" checked />
-          style="background-color:silver"
+        <div class="collapse-title text-xl font-medium">Aliases</div>
-        >
+        <div class="collapse-content">
-          <h4 class="panel-title">
+          <ul class="menu bg-base-100 rounded-box">
-            <a
-              id="compound-aliases-link"
-              data-toggle="collapse"
-              data-parent="#compound-detail"
-              href="#compound-aliases"
-              >Aliases</a
-            >
-          </h4>
-        </div>
-        <div id="compound-aliases" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
             {% for alias in compound.aliases %}
-              <a class="list-group-item">{{ alias }}</a>
+              <li><a class="hover:bg-base-200">{{ alias }}</a></li>
             {% endfor %}
-          </div>
+          </ul>
         </div>
-      {% endif %}
+      </div>
+    {% endif %}
 
-      <!-- Description -->
+    <!-- Description -->
-      <div
+    <div class="collapse-arrow bg-base-200 collapse">
-        class="panel panel-default panel-heading list-group-item"
+      <input type="checkbox" checked />
-        style="background-color:silver"
+      <div class="collapse-title text-xl font-medium">Description</div>
-      >
+      <div class="collapse-content">{{ compound.description }}</div>
-        <h4 class="panel-title">
+    </div>
-          <a
-            id="compound-desc-link"
-            data-toggle="collapse"
-            data-parent="#compound-detail"
-            href="#compound-desc"
-            >Description</a
-          >
-        </h4>
-      </div>
-      <div id="compound-desc" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          {{ compound.description|safe }}
-        </div>
-      </div>
 
-      <!-- Image -->
+    <!-- Image Representation -->
-      <div
+    <div class="collapse-arrow bg-base-200 collapse">
-        class="panel panel-default panel-heading list-group-item"
+      <input type="checkbox" checked />
-        style="background-color:silver"
+      <div class="collapse-title text-xl font-medium">Image Representation</div>
-      >
+      <div class="collapse-content">
-        <h4 class="panel-title">
+        <div class="flex justify-center">
-          <a
+          {{ compound.default_structure.as_svg|safe }}
-            id="compound-image-link"
-            data-toggle="collapse"
-            data-parent="#compound-detail"
-            href="#compound-image"
-            >Image Representation</a
-          >
-        </h4>
-      </div>
-      <div id="compound-image" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          <div id="image-div" align="center">
-            {{ compound.default_structure.as_svg|safe }}
-          </div>
         </div>
       </div>
+    </div>
 
-      <!-- SMILES -->
+    <!-- SMILES Representation -->
-      <div
+    <div class="collapse-arrow bg-base-200 collapse">
-        class="panel panel-default panel-heading list-group-item"
+      <input type="checkbox" checked />
-        style="background-color:silver"
+      <div class="collapse-title text-xl font-medium">
-      >
+        SMILES Representation
-        <h4 class="panel-title">
-          <a
-            id="compound-smiles-link"
-            data-toggle="collapse"
-            data-parent="#compound-detail"
-            href="#compound-smiles"
-            >SMILES Representation</a
-          >
-        </h4>
       </div>
-      <div id="compound-smiles" class="panel-collapse in collapse">
+      <div class="collapse-content">
-        <div class="panel-body list-group-item">
+        {{ compound.default_structure.smiles }}
-          {{ compound.default_structure.smiles }}
-        </div>
       </div>
+    </div>
 
-      <!-- Canonical SMILES -->
+    <!-- Canonical SMILES Representation -->
-      <div
+    <div class="collapse-arrow bg-base-200 collapse">
-        class="panel panel-default panel-heading list-group-item"
+      <input type="checkbox" checked />
-        style="background-color:silver"
+      <div class="collapse-title text-xl font-medium">
-      >
+        Canonical SMILES Representation
-        <h4 class="panel-title">
-          <a
-            id="compound-canonical-smiles-link"
-            data-toggle="collapse"
-            data-parent="#compound-detail"
-            href="#compound-canonical-smiles"
-            >Canonical SMILES Representation</a
-          >
-        </h4>
       </div>
-      <div id="compound-canonical-smiles" class="panel-collapse in collapse">
+      <div class="collapse-content">
-        <div class="panel-body list-group-item">
+        {{ compound.default_structure.canonical_smiles }}
-          {{ compound.default_structure.canonical_smiles }}
-        </div>
       </div>
+    </div>
 
-      <!-- InChiKey -->
+    <!-- InChIKey -->
-      <div
+    <div class="collapse-arrow bg-base-200 collapse">
-        class="panel panel-default panel-heading list-group-item"
+      <input type="checkbox" checked />
-        style="background-color:silver"
+      <div class="collapse-title text-xl font-medium">InChIKey</div>
-      >
+      <div class="collapse-content">
-        <h4 class="panel-title">
+        {{ compound.default_structure.inchikey }}
-          <a
-            id="compound-inchi-link"
-            data-toggle="collapse"
-            data-parent="#compound-detail"
-            href="#compound-inchi"
-            >InChIKey</a
-          >
-        </h4>
-      </div>
-      <div id="compound-inchi" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          {{ compound.default_structure.inchikey }}
-        </div>
       </div>
+    </div>
 
-      <!-- Reactions -->
+    <!-- Reactions -->
-      {% if compound.related_reactions %}
+    {% if compound.related_reactions %}
-        <div
+      <div class="collapse-arrow bg-base-200 collapse">
-          class="panel panel-default panel-heading list-group-item"
+        <input type="checkbox" checked />
-          style="background-color:silver"
+        <div class="collapse-title text-xl font-medium">Reactions</div>
-        >
+        <div class="collapse-content">
-          <h4 class="panel-title">
+          <ul class="menu bg-base-100 rounded-box">
-            <a
-              id="compound-reaction-link"
-              data-toggle="collapse"
-              data-parent="#compound-detail"
-              href="#compound-reaction"
-              >Reactions</a
-            >
-          </h4>
-        </div>
-        <div id="compound-reaction" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
             {% for r in compound.related_reactions %}
-              <a class="list-group-item" href="{{ r.url }}"
+              <li>
-                >{{ r.name|safe }} <i>({{ r.package.name|safe }})</i></a
+                <a href="{{ r.url }}" class="hover:bg-base-200"
-              >
+                  >{{ r.name }} <i>({{ r.package.name }})</i></a
+                >
+              </li>
             {% endfor %}
-          </div>
+          </ul>
         </div>
-      {% endif %}
+      </div>
+    {% endif %}
 
-      <!-- Pathways -->
+    <!-- Pathways -->
-      {% if compound.related_pathways %}
+    {% if compound.related_pathways %}
-        <div
+      <div class="collapse-arrow bg-base-200 collapse">
-          class="panel panel-default panel-heading list-group-item"
+        <input type="checkbox" checked />
-          style="background-color:silver"
+        <div class="collapse-title text-xl font-medium">Pathways</div>
-        >
+        <div class="collapse-content">
-          <h4 class="panel-title">
+          <ul class="menu bg-base-100 rounded-box">
-            <a
-              id="compound-pathway-link"
-              data-toggle="collapse"
-              data-parent="#compound-detail"
-              href="#compound-pathway"
-              >Pathways</a
-            >
-          </h4>
-        </div>
-        <div id="compound-pathway" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
             {% for r in compound.related_pathways %}
-              <a class="list-group-item" href="{{ r.url }}"
+              <li>
-                >{{ r.name|safe }} <i>({{ r.package.name|safe }})</i></a
+                <a href="{{ r.url }}" class="hover:bg-base-200"
-              >
+                  >{{ r.name }} <i>({{ r.package.name }})</i></a
+                >
+              </li>
             {% endfor %}
-          </div>
+          </ul>
         </div>
-      {% endif %}
+      </div>
+    {% endif %}
 
-      <!-- Scenarios -->
+    <!-- Scenarios -->
-      {% if compound.scenarios.all %}
+    {% if compound.scenarios.all %}
-        <div
+      <div class="collapse-arrow bg-base-200 collapse">
-          class="panel panel-default panel-heading list-group-item"
+        <input type="checkbox" checked />
-          style="background-color:silver"
+        <div class="collapse-title text-xl font-medium">Scenarios</div>
-        >
+        <div class="collapse-content">
-          <h4 class="panel-title">
+          <ul class="menu bg-base-100 rounded-box">
-            <a
-              id="compound-scenario-link"
-              data-toggle="collapse"
-              data-parent="#compound-detail"
-              href="#compound-scenario"
-              >Scenarios</a
-            >
-          </h4>
-        </div>
-        <div id="compound-scenario" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
             {% for s in compound.scenarios.all %}
-              <a class="list-group-item" href="{{ s.url }}"
+              <li>
-                >{{ s.name|safe }} <i>({{ s.package.name|safe }})</i></a
+                <a href="{{ s.url }}" class="hover:bg-base-200"
-              >
+                  >{{ s.name }} <i>({{ s.package.name }})</i></a
+                >
+              </li>
             {% endfor %}
-          </div>
+          </ul>
         </div>
-      {% endif %}
+      </div>
+    {% endif %}
 
-      <!-- External Identifiers -->
+    <!-- External Identifiers -->
-      {% if compound.get_external_identifiers %}
+    {% if compound.get_external_identifiers %}
-        <div
+      <div class="collapse-arrow bg-base-200 collapse">
-          class="panel panel-default panel-heading list-group-item"
+        <input type="checkbox" checked />
-          style="background-color:silver"
+        <div class="collapse-title text-xl font-medium">
-        >
+          External Identifier
-          <h4 class="panel-title">
-            <a
-              id="compound-external-identifier-link"
-              data-toggle="collapse"
-              data-parent="#compound-detail"
-              href="#compound-external-identifier"
-              >External Identifier</a
-            >
-          </h4>
         </div>
-        <div
+        <div class="collapse-content">
-          id="compound-external-identifier"
+          <div class="space-y-2">
-          class="panel-collapse in collapse"
-        >
-          <div class="panel-body list-group-item">
             {% if compound.get_pubchem_compound_identifiers %}
-              <div
+              <div class="collapse-arrow bg-base-100 collapse">
-                class="panel panel-default panel-heading list-group-item"
+                <input type="checkbox" checked />
-                style="background-color:silver"
+                <div class="collapse-title text-lg font-medium">
-              >
+                  PubChem Compound Identifier
-                <h4 class="panel-title">
+                </div>
-                  <a
+                <div class="collapse-content">
-                    id="compound-pubchem-identifier-link"
+                  <ul class="menu bg-base-200 rounded-box">
-                    data-toggle="collapse"
+                    {% for eid in compound.get_pubchem_compound_identifiers %}
-                    data-parent="#compound-external-identifier"
+                      <li>
-                    href="#compound-pubchem-identifier"
+                        <a
-                    >PubChem Compound Identifier</a
+                          href="{{ eid.external_url }}"
-                  >
+                          class="hover:bg-base-300"
-                </h4>
+                          >CID{{ eid.identifier_value }}</a
-              </div>
+                        >
-              <div
+                      </li>
-                id="compound-pubchem-identifier"
+                    {% endfor %}
-                class="panel-collapse in collapse"
+                  </ul>
-              >
+                </div>
-                {% for eid in compound.get_pubchem_compound_identifiers %}
-                  <a class="list-group-item" href="{{ eid.external_url }}"
-                    >CID{{ eid.identifier_value }}</a
-                  >
-                {% endfor %}
               </div>
             {% endif %}
             {% if compound.get_pubchem_substance_identifiers %}
-              <div
+              <div class="collapse-arrow bg-base-100 collapse">
-                class="panel panel-default panel-heading list-group-item"
+                <input type="checkbox" checked />
-                style="background-color:silver"
+                <div class="collapse-title text-lg font-medium">
-              >
+                  PubChem Substance Identifier
-                <h4 class="panel-title">
+                </div>
-                  <a
+                <div class="collapse-content">
-                    id="compound-pubchem-identifier-link"
+                  <ul class="menu bg-base-200 rounded-box">
-                    data-toggle="collapse"
+                    {% for eid in compound.get_pubchem_substance_identifiers %}
-                    data-parent="#compound-external-identifier"
+                      <li>
-                    href="#compound-pubchem-identifier"
+                        <a
-                    >PubChem Substance Identifier</a
+                          href="{{ eid.external_url }}"
-                  >
+                          class="hover:bg-base-300"
-                </h4>
+                          >SID{{ eid.identifier_value }}</a
-              </div>
+                        >
-              <div
+                      </li>
-                id="compound-pubchem-identifier"
+                    {% endfor %}
-                class="panel-collapse in collapse"
+                  </ul>
-              >
+                </div>
-                {% for eid in compound.get_pubchem_substance_identifiers %}
-                  <a class="list-group-item" href="{{ eid.external_url }}"
-                    >SID{{ eid.identifier_value }}</a
-                  >
-                {% endfor %}
               </div>
             {% endif %}
             {% if compound.get_chebi_identifiers %}
-              <div
+              <div class="collapse-arrow bg-base-100 collapse">
-                class="panel panel-default panel-heading list-group-item"
+                <input type="checkbox" checked />
-                style="background-color:silver"
+                <div class="collapse-title text-lg font-medium">
-              >
+                  ChEBI Identifier
-                <h4 class="panel-title">
+                </div>
-                  <a
+                <div class="collapse-content">
-                    id="compound-chebi-identifier-link"
+                  <ul class="menu bg-base-200 rounded-box">
-                    data-toggle="collapse"
+                    {% for eid in compound.get_chebi_identifiers %}
-                    data-parent="#compound-external-identifier"
+                      <li>
-                    href="#compound-chebi-identifier"
+                        <a
-                    >ChEBI Identifier</a
+                          href="{{ eid.external_url }}"
-                  >
+                          class="hover:bg-base-300"
-                </h4>
+                          >CHEBI:{{ eid.identifier_value }}</a
-              </div>
+                        >
-              <div
+                      </li>
-                id="compound-chebi-identifier"
+                    {% endfor %}
-                class="panel-collapse in collapse"
+                  </ul>
-              >
+                </div>
-                {% for eid in compound.get_chebi_identifiers %}
-                  <a class="list-group-item" href="{{ eid.external_url }}"
-                    >CHEBI:{{ eid.identifier_value }}</a
-                  >
-                {% endfor %}
               </div>
             {% endif %}
           </div>
         </div>
-      {% endif %}
+      </div>
-    </div>
+    {% endif %}
   </div>
+
+  <script>
+    // Show actions button if there are actions
+    document.addEventListener("DOMContentLoaded", function () {
+      const actionsButton = document.getElementById("actionsButton");
+      const actionsList = actionsButton?.querySelector("ul");
+      if (actionsList && actionsList.children.length > 0) {
+        actionsButton?.classList.remove("hidden");
+      }
+    });
+  </script>
 {% endblock content %}

templates/objects/compound_structure.html

@@ -1,4 +1,4 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 
 {% block content %}
 
@@ -10,141 +10,109 @@
     {% include "modals/objects/generic_delete_modal.html" %}
   {% endblock action_modals %}
 
-  <div class="panel-group" id="compound-structure-detail">
+  <div class="space-y-2 p-4">
-    <div class="panel panel-default">
+    <!-- Header Section -->
-      <div
+    <div class="card bg-base-100">
-        class="panel-heading"
+      <div class="card-body">
-        id="headingPanel"
+        <div class="flex items-center justify-between">
-        style="font-size:2rem;height: 46px"
+          <h2 class="card-title text-2xl">{{ compound_structure.name }}</h2>
-      >
+          <div id="actionsButton" class="dropdown dropdown-end hidden">
-        {{ compound_structure.name|safe }}
+            <div tabindex="0" role="button" class="btn btn-ghost btn-sm">
-        <div
+              <svg
-          id="actionsButton"
+                xmlns="http://www.w3.org/2000/svg"
-          style="float: right;font-weight: normal;font-size: medium;position: relative; top: 50%; transform: translateY(-50%);z-index:100;display: none;"
+                width="16"
-          class="dropdown"
+                height="16"
-        >
+                viewBox="0 0 24 24"
-          <a
+                fill="none"
-            href="#"
+                stroke="currentColor"
-            class="dropdown-toggle"
+                stroke-width="2"
-            data-toggle="dropdown"
+                stroke-linecap="round"
-            role="button"
+                stroke-linejoin="round"
-            aria-haspopup="true"
+                class="lucide lucide-wrench"
-            aria-expanded="false"
+              >
-            ><span class="glyphicon glyphicon-wrench"></span> Actions
+                <path
-            <span class="caret"></span><span style="padding-right:1em"></span
+                  d="M14.7 6.3a1 1 0 0 0 0 1.4l1.6 1.6a1 1 0 0 0 1.4 0l3.77-3.77a6 6 0 0 1-7.94 7.94l-6.91 6.91a2.12 2.12 0 0 1-3-3l6.91-6.91a6 6 0 0 1 7.94-7.94l-3.76 3.76z"
-          ></a>
+                />
-          <ul id="actionsList" class="dropdown-menu">
+              </svg>
-            {% block actions %}
+              Actions
-              {% include "actions/objects/compound_structure.html" %}
+            </div>
-            {% endblock %}
+            <ul
+              tabindex="-1"
+              class="dropdown-content menu bg-base-100 rounded-box z-50 w-52 p-2"
+            >
+              {% block actions %}
+                {% include "actions/objects/compound_structure.html" %}
+              {% endblock %}
+            </ul>
+          </div>
+        </div>
+        <p class="mt-2">{{ compound_structure.description }}</p>
+      </div>
+    </div>
+
+    <!-- Image Representation -->
+    <div class="collapse-arrow bg-base-200 collapse">
+      <input type="checkbox" checked />
+      <div class="collapse-title text-xl font-medium">Image Representation</div>
+      <div class="collapse-content">
+        <div class="flex justify-center">
+          {{ compound_structure.as_svg|safe }}
+        </div>
+      </div>
+    </div>
+
+    <!-- SMILES Representation -->
+    <div class="collapse-arrow bg-base-200 collapse">
+      <input type="checkbox" checked />
+      <div class="collapse-title text-xl font-medium">
+        SMILES Representation
+      </div>
+      <div class="collapse-content">{{ compound_structure.smiles }}</div>
+    </div>
+
+    {% if compound_structure.aliases %}
+      <!-- Aliases -->
+      <div class="collapse-arrow bg-base-200 collapse">
+        <input type="checkbox" checked />
+        <div class="collapse-title text-xl font-medium">Aliases</div>
+        <div class="collapse-content">
+          <ul class="menu bg-base-100 rounded-box">
+            {% for alias in compound_structure.aliases %}
+              <li><a class="hover:bg-base-200">{{ alias }}</a></li>
+            {% endfor %}
           </ul>
         </div>
       </div>
-      <div class="panel-body">
+    {% endif %}
-        <p>{{ compound_structure.description|safe }}</p>
-      </div>
 
-      <!-- Image -->
+    {% if compound_structure.scenarios.all %}
-      <div
+      <!-- Scenarios -->
-        class="panel panel-default panel-heading list-group-item"
+      <div class="collapse-arrow bg-base-200 collapse">
-        style="background-color:silver"
+        <input type="checkbox" checked />
-      >
+        <div class="collapse-title text-xl font-medium">Scenarios</div>
-        <h4 class="panel-title">
+        <div class="collapse-content">
-          <a
+          <ul class="menu bg-base-100 rounded-box">
-            id="compound-structure-image-link"
-            data-toggle="collapse"
-            data-parent="#compound-structure-detail"
-            href="#compound-structure-image"
-            >Image Representation</a
-          >
-        </h4>
-      </div>
-      <div id="compound-structure-image" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          <div id="image-div" align="center">
-            {{ compound_structure.as_svg|safe }}
-          </div>
-        </div>
-      </div>
-
-      <!-- SMILES -->
-      <div
-        class="panel panel-default panel-heading list-group-item"
-        style="background-color:silver"
-      >
-        <h4 class="panel-title">
-          <a
-            id="compound-structure-smiles-link"
-            data-toggle="collapse"
-            data-parent="#compound-structure-detail"
-            href="#compound-structure-smiles"
-            >SMILES Representation</a
-          >
-        </h4>
-      </div>
-      <div id="compound-structure-smiles" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          {{ compound_structure.smiles }}
-        </div>
-      </div>
-
-      {% if compound_structure.aliases %}
-        <!-- Aliases -->
-        <div
-          class="panel panel-default panel-heading list-group-item"
-          style="background-color:silver"
-        >
-          <h4 class="panel-title">
-            <a
-              id="compound-structure-aliases-link"
-              data-toggle="collapse"
-              data-parent="#compound-structure-detail"
-              href="#compound-structure-aliases"
-              >Aliases</a
-            >
-          </h4>
-        </div>
-        <div id="compound-structure-aliases" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
-            {% for alias in compound_structure.aliases %}
-              <a class="list-group-item">{{ alias }}</a>
-            {% endfor %}
-          </div>
-        </div>
-      {% endif %}
-
-      {% if compound_structure.scenarios.all %}
-        <div
-          class="panel panel-default panel-heading list-group-item"
-          style="background-color:silver"
-        >
-          <h4 class="panel-title">
-            <a
-              id="compound-structure-scenario-link"
-              data-toggle="collapse"
-              data-parent="#compound-structure-detail"
-              href="#compound-structure-scenario"
-              >Scenarios</a
-            >
-          </h4>
-        </div>
-        <div
-          id="compound-structure-scenario"
-          class="panel-collapse in collapse"
-        >
-          <div class="panel-body list-group-item">
             {% for s in compound_structure.scenarios.all %}
-              <a class="list-group-item" href="{{ s.url }}"
+              <li>
-                >{{ s.name|safe }} <i>({{ s.package.name|safe }})</i></a
+                <a href="{{ s.url }}" class="hover:bg-base-200"
-              >
+                  >{{ s.name }} <i>({{ s.package.name }})</i></a
+                >
+              </li>
             {% endfor %}
-          </div>
+          </ul>
         </div>
-      {% endif %}
+      </div>
-
+    {% endif %}
-      <!-- Reactions -->
-
-      <!-- Pathways -->
-    </div>
   </div>
+
+  <script>
+    // Show actions button if there are actions
+    document.addEventListener("DOMContentLoaded", function () {
+      const actionsButton = document.getElementById("actionsButton");
+      const actionsList = actionsButton?.querySelector("ul");
+      if (actionsList && actionsList.children.length > 0) {
+        actionsButton?.classList.remove("hidden");
+      }
+    });
+  </script>
 {% endblock content %}

templates/objects/edge.html

@@ -1,4 +1,4 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 
 {% block content %}
 
@@ -9,214 +9,165 @@
     {% include "modals/objects/generic_delete_modal.html" %}
   {% endblock action_modals %}
 
-  <div class="panel-group" id="edge-detail">
+  <div class="space-y-2 p-4">
-    <div class="panel panel-default">
+    <!-- Header Section -->
-      <div
+    <div class="card bg-base-100">
-        class="panel-heading"
+      <div class="card-body">
-        id="headingPanel"
+        <div class="flex items-center justify-between">
-        style="font-size:2rem;height: 46px"
+          <h2 class="card-title text-2xl">{{ edge.edge_label.name }}</h2>
-      >
+          <div id="actionsButton" class="dropdown dropdown-end hidden">
-        {{ edge.edge_label.name|safe }}
+            <div tabindex="0" role="button" class="btn btn-ghost btn-sm">
-        <div
+              <svg
-          id="actionsButton"
+                xmlns="http://www.w3.org/2000/svg"
-          style="float: right;font-weight: normal;font-size: medium;position: relative; top: 50%; transform: translateY(-50%);z-index:100;display: none;"
+                width="16"
-          class="dropdown"
+                height="16"
-        >
+                viewBox="0 0 24 24"
-          <a
+                fill="none"
-            href="#"
+                stroke="currentColor"
-            class="dropdown-toggle"
+                stroke-width="2"
-            data-toggle="dropdown"
+                stroke-linecap="round"
-            role="button"
+                stroke-linejoin="round"
-            aria-haspopup="true"
+                class="lucide lucide-wrench"
-            aria-expanded="false"
+              >
-            ><span class="glyphicon glyphicon-wrench"></span> Actions
+                <path
-            <span class="caret"></span><span style="padding-right:1em"></span
+                  d="M14.7 6.3a1 1 0 0 0 0 1.4l1.6 1.6a1 1 0 0 0 1.4 0l3.77-3.77a6 6 0 0 1-7.94 7.94l-6.91 6.91a2.12 2.12 0 0 1-3-3l6.91-6.91a6 6 0 0 1 7.94-7.94l-3.76 3.76z"
-          ></a>
+                />
-          <ul id="actionsList" class="dropdown-menu">
+              </svg>
-            {% block actions %}
+              Actions
-              {% include "actions/objects/edge.html" %}
+            </div>
-            {% endblock %}
+            <ul
+              tabindex="-1"
+              class="dropdown-content menu bg-base-100 rounded-box z-50 w-52 p-2"
+            >
+              {% block actions %}
+                {% include "actions/objects/edge.html" %}
+              {% endblock %}
+            </ul>
+          </div>
+        </div>
+      </div>
+    </div>
+
+    <!-- Description -->
+    <div class="collapse-arrow bg-base-200 collapse">
+      <input type="checkbox" checked />
+      <div class="collapse-title text-xl font-medium">Description</div>
+      <div class="collapse-content">{{ edge.description }}</div>
+    </div>
+
+    {% if edge.aliases %}
+      <!-- Aliases -->
+      <div class="collapse-arrow bg-base-200 collapse">
+        <input type="checkbox" checked />
+        <div class="collapse-title text-xl font-medium">Aliases</div>
+        <div class="collapse-content">
+          <ul class="menu bg-base-100 rounded-box">
+            {% for alias in edge.aliases %}
+              <li><a class="hover:bg-base-200">{{ alias }}</a></li>
+            {% endfor %}
           </ul>
         </div>
       </div>
+    {% endif %}
 
-      <!-- Description -->
+    <!-- Image Representation -->
-      <div
+    <div class="collapse-arrow bg-base-200 collapse">
-        class="panel panel-default panel-heading list-group-item"
+      <input type="checkbox" checked />
-        style="background-color:silver"
+      <div class="collapse-title text-xl font-medium">Image Representation</div>
-      >
+      <div class="collapse-content">
-        <h4 class="panel-title">
+        <div class="flex justify-center">{{ edge.edge_label.as_svg|safe }}</div>
-          <a
-            id="edge-desc-link"
-            data-toggle="collapse"
-            data-parent="#edge-detail"
-            href="#edge-desc"
-            >Description</a
-          >
-        </h4>
       </div>
-      <div id="edge-desc" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          {{ edge.description|safe }}
-        </div>
-      </div>
-
-      {% if edge.aliases %}
-        <!-- Aliases -->
-        <div
-          class="panel panel-default panel-heading list-group-item"
-          style="background-color:silver"
-        >
-          <h4 class="panel-title">
-            <a
-              id="edge-aliases-link"
-              data-toggle="collapse"
-              data-parent="#edge-detail"
-              href="#edge-aliases"
-              >Aliases</a
-            >
-          </h4>
-        </div>
-        <div id="edge-aliases" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
-            {% for alias in edge.aliases %}
-              <a class="list-group-item">{{ alias }}</a>
-            {% endfor %}
-          </div>
-        </div>
-      {% endif %}
-
-      <!-- Image -->
-      <div
-        class="panel panel-default panel-heading list-group-item"
-        style="background-color:silver"
-      >
-        <h4 class="panel-title">
-          <a
-            id="edge-image-link"
-            data-toggle="collapse"
-            data-parent="#edge-detail"
-            href="#edge-image"
-            >Image Representation</a
-          >
-        </h4>
-      </div>
-      <div id="edge-image" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          <div id="image-div" align="center">
-            {{ edge.edge_label.as_svg|safe }}
-          </div>
-        </div>
-      </div>
-
-      <!-- Reaction Description -->
-      <div
-        class="panel panel-default panel-heading list-group-item"
-        style="background-color:silver"
-      >
-        <h4 class="panel-title">
-          <a
-            id="edge-description-link"
-            data-toggle="collapse"
-            data-parent="#edge-description-detail"
-            href="#edge-description-smiles"
-            >Reaction Description</a
-          >
-        </h4>
-      </div>
-      <div id="edge-description-smiles" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          {% for educt in edge.start_nodes.all %}
-            <a class="btn btn-default" href="{{ educt.url }}"
-              >{{ educt.name|safe }}</a
-            >
-          {% endfor %}
-          <span
-            class="glyphicon glyphicon-arrow-right"
-            style="margin-left:5em;margin-right:5em;"
-            aria-hidden="true"
-          ></span>
-          {% for product in edge.end_nodes.all %}
-            <a class="btn btn-default" href="{{ product.url }}"
-              >{{ product.name|safe }}</a
-            >
-          {% endfor %}
-        </div>
-      </div>
-
-      <!-- SMIRKS -->
-      <div
-        class="panel panel-default panel-heading list-group-item"
-        style="background-color:silver"
-      >
-        <h4 class="panel-title">
-          <a
-            id="edge-smirks-link"
-            data-toggle="collapse"
-            data-parent="#edge-detail"
-            href="#edge-smirks"
-            >SMIRKS Representation</a
-          >
-        </h4>
-      </div>
-      <div id="edge-smirks" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          {{ edge.edge_label.smirks }}
-        </div>
-      </div>
-
-      {% if edge.edge_label.rules.all %}
-        <!-- Rules -->
-        <div
-          class="panel panel-default panel-heading list-group-item"
-          style="background-color:silver"
-        >
-          <h4 class="panel-title">
-            <a
-              id="edge-rules-link"
-              data-toggle="collapse"
-              data-parent="#edge-detail"
-              href="#edge-rules"
-              >Rules</a
-            >
-          </h4>
-        </div>
-        <div id="edge-rules" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
-            {% for r in edge.edge_label.rules.all %}
-              <a class="list-group-item" href="{{ r.url }}"
-                >{{ r.name|safe }}</a
-              >
-            {% endfor %}
-          </div>
-        </div>
-      {% endif %}
-
-      {% if edge.scenarios.all %}
-        <div
-          class="panel panel-default panel-heading list-group-item"
-          style="background-color:silver"
-        >
-          <h4 class="panel-title">
-            <a
-              id="edge-scenario-link"
-              data-toggle="collapse"
-              data-parent="#edge-detail"
-              href="#edge-scenario"
-              >Scenarios</a
-            >
-          </h4>
-        </div>
-        <div id="edge-scenario" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
-            {% for s in edge.scenarios.all %}
-              <a class="list-group-item" href="{{ s.url }}"
-                >{{ s.name|safe }} <i>({{ s.package.name|safe }})</i></a
-              >
-            {% endfor %}
-          </div>
-        </div>
-      {% endif %}
     </div>
+
+    <!-- Reaction Description -->
+    <div class="collapse-arrow bg-base-200 collapse">
+      <input type="checkbox" checked />
+      <div class="collapse-title text-xl font-medium">Reaction Description</div>
+      <div class="collapse-content">
+        <div class="flex flex-wrap items-center justify-center gap-4">
+          {% for educt in edge.start_nodes.all %}
+            <a href="{{ educt.url }}" class="btn btn-outline btn-sm"
+              >{{ educt.name }}</a
+            >
+          {% endfor %}
+          <svg
+            xmlns="http://www.w3.org/2000/svg"
+            width="24"
+            height="24"
+            viewBox="0 0 24 24"
+            fill="none"
+            stroke="currentColor"
+            stroke-width="2"
+            stroke-linecap="round"
+            stroke-linejoin="round"
+            class="lucide lucide-arrow-right"
+          >
+            <path d="M5 12h14" />
+            <path d="m12 5 7 7-7 7" />
+          </svg>
+          {% for product in edge.end_nodes.all %}
+            <a href="{{ product.url }}" class="btn btn-outline btn-sm"
+              >{{ product.name }}</a
+            >
+          {% endfor %}
+        </div>
+      </div>
+    </div>
+
+    <!-- SMIRKS Representation -->
+    <div class="collapse-arrow bg-base-200 collapse">
+      <input type="checkbox" checked />
+      <div class="collapse-title text-xl font-medium">
+        SMIRKS Representation
+      </div>
+      <div class="collapse-content">{{ edge.edge_label.smirks }}</div>
+    </div>
+
+    {% if edge.edge_label.rules.all %}
+      <!-- Rules -->
+      <div class="collapse-arrow bg-base-200 collapse">
+        <input type="checkbox" checked />
+        <div class="collapse-title text-xl font-medium">Rules</div>
+        <div class="collapse-content">
+          <ul class="menu bg-base-100 rounded-box">
+            {% for r in edge.edge_label.rules.all %}
+              <li>
+                <a href="{{ r.url }}" class="hover:bg-base-200">{{ r.name }}</a>
+              </li>
+            {% endfor %}
+          </ul>
+        </div>
+      </div>
+    {% endif %}
+
+    {% if edge.scenarios.all %}
+      <!-- Scenarios -->
+      <div class="collapse-arrow bg-base-200 collapse">
+        <input type="checkbox" checked />
+        <div class="collapse-title text-xl font-medium">Scenarios</div>
+        <div class="collapse-content">
+          <ul class="menu bg-base-100 rounded-box">
+            {% for s in edge.scenarios.all %}
+              <li>
+                <a href="{{ s.url }}" class="hover:bg-base-200"
+                  >{{ s.name }} <i>({{ s.package.name }})</i></a
+                >
+              </li>
+            {% endfor %}
+          </ul>
+        </div>
+      </div>
+    {% endif %}
   </div>
+
+  <script>
+    // Show actions button if there are actions
+    document.addEventListener("DOMContentLoaded", function () {
+      const actionsButton = document.getElementById("actionsButton");
+      const actionsList = actionsButton?.querySelector("ul");
+      if (actionsList && actionsList.children.length > 0) {
+        actionsButton?.classList.remove("hidden");
+      }
+    });
+  </script>
 {% endblock content %}

templates/objects/enzymelink.html

@@ -1,163 +1,109 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 
 {% block content %}
-  <div class="panel-group" id="enzyme-detail">
+  <div class="space-y-2 p-4">
-    <div class="panel panel-default">
+    <!-- Header Section -->
-      <div
+    <div class="card bg-base-100">
-        class="panel-heading"
+      <div class="card-body">
-        id="headingPanel"
+        <h2 class="card-title text-2xl">{{ enzymelink.ec_number }}</h2>
-        style="font-size:2rem;height: 46px"
-      >
-        {{ enzymelink.ec_number }}
       </div>
+    </div>
 
-      <!-- Name -->
+    <!-- Enzyme Name -->
-      <div
+    <div class="collapse-arrow bg-base-200 collapse">
-        class="panel panel-default panel-heading list-group-item"
+      <input type="checkbox" checked />
-        style="background-color:silver"
+      <div class="collapse-title text-xl font-medium">Enzyme Name</div>
-      >
+      <div class="collapse-content">{{ enzymelink.name }}</div>
-        <h4 class="panel-title">
+    </div>
-          <a
-            id="enzyme-name-link"
-            data-toggle="collapse"
-            data-parent="#enzyme-detail"
-            href="#enzyme-name"
-            >Enzyme Name</a
-          >
-        </h4>
-      </div>
-      <div id="enzyme-name" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">{{ enzymelink.name }}</div>
-      </div>
 
-      <!-- Linking Method -->
+    <!-- Linking Method -->
-      <div
+    <div class="collapse-arrow bg-base-200 collapse">
-        class="panel panel-default panel-heading list-group-item"
+      <input type="checkbox" checked />
-        style="background-color:silver"
+      <div class="collapse-title text-xl font-medium">Linking Method</div>
-      >
+      <div class="collapse-content">
-        <h4 class="panel-title">
+        {{ enzymelink.linking_method }}. &nbsp;<a
-          <a
+          href="https://wiki.envipath.org/index.php/Rules#EnzymeLinks"
-            id="enzyme-linking-link"
+          target="_blank"
-            data-toggle="collapse"
+          class="link link-primary"
-            data-parent="#enzyme-detail"
+          >Learn more &gt;&gt;</a
-            href="#enzyme-linking"
-            >Linking Method</a
-          >
-        </h4>
-      </div>
-      <div id="enzyme-linking" class="panel-collapse in collapse">
-        <div class="panel-body list-group-item">
-          {{ enzymelink.linking_method }}. &nbsp;<a
-            href="https://wiki.envipath.org/index.php/Rules#EnzymeLinks"
-            target="#"
-            >Learn more &gt;&gt;</a
-          >
-        </div>
-      </div>
-
-      {% if enzymelink.kegg_reaction_links %}
-        <div
-          class="panel panel-default panel-heading list-group-item"
-          style="background-color:silver"
         >
-          <h4 class="panel-title">
+      </div>
-            <a
+    </div>
-              id="enzyme-evidence-link"
+
-              data-toggle="collapse"
+    {% if enzymelink.kegg_reaction_links %}
-              data-parent="#enzyme-detail"
+      <!-- Linking Evidence -->
-              href="#enzyme-evidence"
+      <div class="collapse-arrow bg-base-200 collapse">
-              >Linking Evidence</a
+        <input type="checkbox" checked />
-            >
+        <div class="collapse-title text-xl font-medium">Linking Evidence</div>
-          </h4>
+        <div class="collapse-content">
-        </div>
+          <ul class="menu bg-base-100 rounded-box">
-        <div id="enzyme-evidence" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
             {% for kl in enzymelink.kegg_reaction_links %}
-              <a class="list-group-item" href="{{ kl.external_url }}"
+              <li>
-                >{{ kl.identifier_value }}</a
+                <a href="{{ kl.external_url }}" class="hover:bg-base-200"
-              >
+                  >{{ kl.identifier_value }}</a
+                >
+              </li>
             {% endfor %}
-          </div>
+          </ul>
         </div>
-      {% endif %}
-
-      {% if enzymelink.reaction_evidence.all %}
-        <div
-          class="panel panel-default panel-heading list-group-item"
-          style="background-color:silver"
-        >
-          <h4 class="panel-title">
-            <a
-              id="enzyme-reaction-evidence-link"
-              data-toggle="collapse"
-              data-parent="#enzyme-detail"
-              href="#enzyme-reaction-evidence"
-              >Linking Evidence - enviPath Reactions</a
-            >
-          </h4>
-        </div>
-        <div id="enzyme-reaction-evidence" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
-            {% for r in enzymelink.reaction_evidence.all %}
-              <a class="list-group-item" href="{{ r.url }}"
-                >{{ r.name }} <i>({{ r.package.name }})</i></a
-              >
-            {% endfor %}
-          </div>
-        </div>
-      {% endif %}
-
-      {% if enzymelink.edge_evidence.all %}
-        <div
-          class="panel panel-default panel-heading list-group-item"
-          style="background-color:silver"
-        >
-          <h4 class="panel-title">
-            <a
-              id="enzyme-edge-evidence-link"
-              data-toggle="collapse"
-              data-parent="#enzyme-detail"
-              href="#enzyme-edge-evidence"
-              >Linking Evidence - enviPath Pathways</a
-            >
-          </h4>
-        </div>
-        <div id="enzyme-edge-evidence" class="panel-collapse in collapse">
-          <div class="panel-body list-group-item">
-            {% for e in enzymelink.edge_evidence.all %}
-              <a class="list-group-item" href="{{ e.pathway.url }}"
-                >{{ e.pathway.name }} <i>({{ r.package.name }})</i></a
-              >
-            {% endfor %}
-          </div>
-        </div>
-      {% endif %}
-
-      <!-- External DB Reference -->
-      <div
-        class="panel panel-default panel-heading list-group-item"
-        style="background-color:silver"
-      >
-        <h4 class="panel-title">
-          <a
-            id="enzyme-external-identifier-link"
-            data-toggle="collapse"
-            data-parent="#enzyme-detail"
-            href="#enzyme-external-identifier"
-            >External DB References</a
-          >
-        </h4>
       </div>
-      <div id="enzyme-external-identifier" class="panel-collapse in collapse">
+    {% endif %}
-        <div class="panel-body list-group-item">
+
-          <a
+    {% if enzymelink.reaction_evidence.all %}
-            class="list-group-item"
+      <!-- Linking Evidence - enviPath Reactions -->
-            href="http://www.brenda-enzymes.org/enzyme.php?ecno={{ enzymelink.ec_number }}"
+      <div class="collapse-arrow bg-base-200 collapse">
-            target="_blank"
+        <input type="checkbox" checked />
-          >
+        <div class="collapse-title text-xl font-medium">
-            Brenda entry for {{ enzymelink.ec_number }}</a
+          Linking Evidence - enviPath Reactions
-          >
         </div>
+        <div class="collapse-content">
+          <ul class="menu bg-base-100 rounded-box">
+            {% for r in enzymelink.reaction_evidence.all %}
+              <li>
+                <a href="{{ r.url }}" class="hover:bg-base-200"
+                  >{{ r.name }} <i>({{ r.package.name }})</i></a
+                >
+              </li>
+            {% endfor %}
+          </ul>
+        </div>
+      </div>
+    {% endif %}
+
+    {% if enzymelink.edge_evidence.all %}
+      <!-- Linking Evidence - enviPath Pathways -->
+      <div class="collapse-arrow bg-base-200 collapse">
+        <input type="checkbox" checked />
+        <div class="collapse-title text-xl font-medium">
+          Linking Evidence - enviPath Pathways
+        </div>
+        <div class="collapse-content">
+          <ul class="menu bg-base-100 rounded-box">
+            {% for e in enzymelink.edge_evidence.all %}
+              <li>
+                <a href="{{ e.pathway.url }}" class="hover:bg-base-200"
+                  >{{ e.pathway.name }} <i>({{ e.pathway.package.name }})</i></a
+                >
+              </li>
+            {% endfor %}
+          </ul>
+        </div>
+      </div>
+    {% endif %}
+
+    <!-- External DB References -->
+    <div class="collapse-arrow bg-base-200 collapse">
+      <input type="checkbox" checked />
+      <div class="collapse-title text-xl font-medium">
+        External DB References
+      </div>
+      <div class="collapse-content">
+        <a
+          href="http://www.brenda-enzymes.org/enzyme.php?ecno={{ enzymelink.ec_number }}"
+          target="_blank"
+          class="link link-primary"
+          >Brenda entry for {{ enzymelink.ec_number }}</a
+        >
       </div>
     </div>
   </div>