diff --git a/templates/framework_modern.html b/templates/framework_modern.html
index b808550c..ba9b28a0 100644
--- a/templates/framework_modern.html
+++ b/templates/framework_modern.html
@@ -178,6 +178,23 @@
         }
       });
 
+      // Open search modal function
+      function openSearchModal() {
+        const searchModal = document.getElementById("search_modal");
+        if (searchModal) {
+          searchModal.showModal();
+        }
+      }
+
+      // Click handler for search badge
+      const searchTrigger = document.getElementById("search-trigger");
+      if (searchTrigger) {
+        searchTrigger.addEventListener("click", function (event) {
+          event.preventDefault();
+          openSearchModal();
+        });
+      }
+
       // Global keyboard shortcut for search (Cmd+K on Mac, Ctrl+K on Windows/Linux)
       document.addEventListener("keydown", function (event) {
         // Check if user is typing in an input field
@@ -198,7 +215,7 @@
 
         if (isCorrectModifier && event.key === "k") {
           event.preventDefault();
-          search_modal.showModal();
+          openSearchModal();
         }
       });
     </script>
diff --git a/templates/includes/navbar.html b/templates/includes/navbar.html
index af14d4b3..ff5fef67 100644
--- a/templates/includes/navbar.html
+++ b/templates/includes/navbar.html
@@ -57,7 +57,7 @@
 
   <div class="navbar-end">
     {% if not public_mode %}
-      <a href="/search" role="button">
+      <a id="search-trigger" role="button" class="cursor-pointer">
         <div
           class="flex items-center badge badge-dash space-x-1 bg-base-200 text-base-content/50 p-2 m-1"
         >
diff --git a/templates/index/index.html b/templates/index/index.html
index b3193da6..8f793cee 100644
--- a/templates/index/index.html
+++ b/templates/index/index.html
@@ -2,74 +2,86 @@
 {% load static %}
 {% block main_content %}
   <!-- Hero Section with Logo and Search -->
-  <section class="hero h-fit max-w-5xl w-full shadow-none mx-auto relative">
+  <section class="hero relative mx-auto h-fit w-full max-w-5xl shadow-none">
     <div
-      class="hero min-h-[calc(100vh*0.4)] bg-gradient-to-br from-primary-800 to-primary-600"
+      class="hero from-primary-800 to-primary-600 min-h-[calc(100vh*0.4)] bg-gradient-to-br"
       style="background-image: url('{% static "/images/hero.png" %}'); background-size: cover; background-position: center;"
     >
       <div class="hero-overlay"></div>
       <!-- Predict Pathway text over the image -->
-      <div class="absolute bottom-40 left-1/8 -translate-x-8 z-10">
-        <h2 class="text-3xl text-base-100 text-shadow-lg text-left">
+      <div class="absolute bottom-40 left-1/8 z-10 -translate-x-8">
+        <h2 class="text-base-100 text-left text-3xl text-shadow-lg">
           Predict Your Pathway
         </h2>
       </div>
     </div>
   </section>
 
-  <div class="shadow-md max-w-5xl mx-auto bg-base-200">
+  <div class="bg-base-200 mx-auto max-w-5xl shadow-md">
     <!-- Predict Pathway Section -->
     <div
-      class="flex-col lg:flex-row-reverse w-full mx-auto -mt-32 relative z-20 mb-10 "
+      class="relative z-20 mx-auto -mt-32 mb-10 w-full flex-col lg:flex-row-reverse"
     >
       <div
-        class="card bg-base-100 shrink-0 shadow-xl w-3/4 mx-auto transition-all duration-300 ease-in-out"
+        class="card bg-base-100 mx-auto w-3/4 shrink-0 shadow-xl transition-all duration-300 ease-in-out"
       >
         <div class="card-body">
-          <!-- Input Mode Toggle - Fixed position outside fieldset -->
-          <div class="flex flex-row justify-start items-center h-fit ml-8 my-4">
-            <div class="flex items-center gap-2">
-              <!-- <span class="text-sm text-neutral-500">Input Mode:</span> -->
-              <label class="toggle text-base-content toggle-md">
+          <div class="my-4 ml-8 flex h-fit flex-row items-center justify-start">
+            <div class="flex items-center gap-1">
+              <label class="swap btn btn-ghost btn-sm p-1" title="Input Mode">
                 <input type="checkbox" />
-                <svg
-                  aria-label="smiles mode"
-                  xmlns="http://www.w3.org/2000/svg"
-                  viewBox="0 0 20 20"
-                  class="size-5"
-                >
-                  <g
-                    stroke-linejoin="round"
-                    stroke-linecap="round"
-                    stroke-width="2"
-                    fill="currentColor"
-                    stroke="none"
+                <span class="swap-on flex items-center gap-1">
+                  <div
+                    class="bg-neutral/50 text-neutral-content flex items-center justify-center rounded-full p-1"
                   >
-                    <path
-                      fill-rule="evenodd"
-                      d="M8 2.75A.75.75 0 0 1 8.75 2h7.5a.75.75 0 0 1 0 1.5h-3.215l-4.483 13h2.698a.75.75 0 0 1 0 1.5h-7.5a.75.75 0 0 1 0-1.5h3.215l4.483-13H8.75A.75.75 0 0 1 8 2.75Z"
-                      clip-rule="evenodd"
-                    />
-                  </g>
-                </svg>
-                <svg
-                  aria-label="draw mode"
-                  xmlns="http://www.w3.org/2000/svg"
-                  viewBox="0 0 20 20"
-                  fill="currentColor"
-                  stroke="none"
-                  class="size-5"
-                >
-                  <path
-                    d="m2.695 14.762-1.262 3.155a.5.5 0 0 0 .65.65l3.155-1.262a4 4 0 0 0 1.343-.886L17.5 5.501a2.121 2.121 0 0 0-3-3L3.58 13.419a4 4 0 0 0-.885 1.343Z"
-                  />
-                </svg>
+                    <svg
+                      aria-label="smiles mode"
+                      xmlns="http://www.w3.org/2000/svg"
+                      viewBox="0 0 20 20"
+                      class="size-5"
+                    >
+                      <g
+                        stroke-linejoin="round"
+                        stroke-linecap="round"
+                        stroke-width="2"
+                        fill="currentColor"
+                        stroke="none"
+                      >
+                        <path
+                          fill-rule="evenodd"
+                          d="M8 2.75A.75.75 0 0 1 8.75 2h7.5a.75.75 0 0 1 0 1.5h-3.215l-4.483 13h2.698a.75.75 0 0 1 0 1.5h-7.5a.75.75 0 0 1 0-1.5h3.215l4.483-13H8.75A.75.75 0 0 1 8 2.75Z"
+                          clip-rule="evenodd"
+                        />
+                      </g>
+                    </svg>
+                  </div>
+                  <span class="ext-xs">SMILES</span>
+                </span>
+                <span class="swap-off flex items-center gap-1">
+                  <div
+                    class="bg-neutral/50 text-neutral-content flex items-center justify-center rounded-full p-1"
+                  >
+                    <svg
+                      aria-label="draw mode"
+                      xmlns="http://www.w3.org/2000/svg"
+                      viewBox="0 0 20 20"
+                      fill="currentColor"
+                      stroke="none"
+                      class="size-5"
+                    >
+                      <path
+                        d="m2.695 14.762-1.262 3.155a.5.5 0 0 0 .65.65l3.155-1.262a4 4 0 0 0 1.343-.886L17.5 5.501a2.121 2.121 0 0 0-3-3L3.58 13.419a4 4 0 0 0-.885 1.343Z"
+                      />
+                    </svg>
+                  </div>
+                  <span class="text-base/50 text-xs">Draw</span>
+                </span>
               </label>
             </div>
           </div>
 
           <fieldset
-            class="fieldset transition-all duration-300 ease-in-out overflow-hidden"
+            class="fieldset overflow-hidden transition-all duration-300 ease-in-out"
           >
             <form
               id="index-form"
@@ -79,29 +91,29 @@
               {% csrf_token %}
               <div
                 id="text-input-container"
-                class="transition-all duration-300 ease-in-out opacity-100 transform scale-100"
+                class="scale-100 transform opacity-100 transition-all duration-300 ease-in-out"
               >
-                <div class="join w-full mx-auto">
+                <div class="join mx-auto w-full">
                   <input
                     type="text"
                     id="index-form-text-input"
                     placeholder="canonical SMILES string"
-                    class="input grow input-md join-item"
+                    class="input input-md join-item grow"
                   />
                   <button class="btn btn-neutral join-item">Predict!</button>
                 </div>
-                <div class="label relative w-full mt-1">
+                <div class="label relative mt-1 w-full">
                   <div class="flex gap-2">
                     <a
                       href="#"
-                      class="example-link cursor-pointer hover:text-primary"
+                      class="example-link hover:text-primary cursor-pointer"
                       data-smiles="CN1C=NC2=C1C(=O)N(C(=O)N2C)C"
                       title="load example"
                       >Caffeine</a
                     >
                     <a
                       href="#"
-                      class="example-link cursor-pointer hover:text-primary"
+                      class="example-link hover:text-primary cursor-pointer"
                       data-smiles="CC(C)CC1=CC=C(C=C1)C(C)C(=O)O"
                       title="load example"
                       >Ibuprofen</a
@@ -114,7 +126,7 @@
               </div>
               <div
                 id="ketcher-container"
-                class="hidden w-full transition-all duration-300 ease-in-out opacity-0 transform scale-95"
+                class="hidden w-full scale-95 transform opacity-0 transition-all duration-300 ease-in-out"
               >
                 <iframe
                   id="index-ketcher"
@@ -124,11 +136,13 @@
                   class="rounded-lg"
                 ></iframe>
                 <button
-                  class="btn btn-lg bg-primary-950 text-primary-50 join-item w-full mt-2"
+                  class="btn btn-lg bg-primary-950 text-primary-50 join-item mt-2 w-full"
                 >
                   Predict!
                 </button>
-                <a class="label mx-auto w-full mt-1" href="#">Advanced</a>
+                <div class="mt-1 flex w-full justify-end">
+                  <a class="label justify-end" href="/predict">Advanced</a>
+                </div>
               </div>
               <input
                 type="hidden"
@@ -150,18 +164,18 @@
     </div>
 
     <!-- Community News Section -->
-    <section class="py-16 bg-base-200 z-10 mx-8">
-      <div class="max-w-7xl mx-auto px-4">
-        <h2 class="h2 font-bold text-left mb-8">Community Updates</h2>
+    <section class="bg-base-200 z-10 mx-8 py-16">
+      <div class="mx-auto max-w-7xl px-4">
+        <h2 class="h2 mb-8 text-left font-bold">Community Updates</h2>
 
-        <div id="community-news-container" class="flex gap-4 justify-center">
+        <div id="community-news-container" class="flex justify-center gap-4">
           <!-- News cards will be populated here -->
-          <div id="loading" class="flex justify-center w-full">
+          <div id="loading" class="flex w-full justify-center">
             <span class="loading loading-spinner loading-lg"></span>
           </div>
         </div>
 
-        <div class="text-right mt-6">
+        <div class="mt-6 text-right">
           <a
             href="https://community.envipath.org/c/announcements/10"
             target="_blank"
@@ -177,18 +191,18 @@
     </section>
 
     <!-- Mission Statement Section -->
-    <section class="py-16 from-base-200 to-base-100 bg-gradient-to-b">
+    <section class="from-base-200 to-base-100 bg-gradient-to-b py-16">
       <div class="mx-auto px-8 md:px-12">
         <div class="flex flex-row gap-4">
           <div class="w-1/3">
             <img
               src="{% static "/images/ep-rule-artwork.png" %}"
               alt="rule-based iterative tree greneration"
-              class="w-full h-full object-contain"
+              class="h-full w-full object-contain"
             />
           </div>
-          <div class="space-y-4 text-left w-2/3 mr-8">
-            <h2 class="h2 font-bold mb-8">About enviPath</h2>
+          <div class="mr-8 w-2/3 space-y-4 text-left">
+            <h2 class="h2 mb-8 font-bold">About enviPath</h2>
             <p class="">
               enviPath is a database and prediction system for the microbial
               biotransformation of organic environmental contaminants. The
@@ -201,7 +215,7 @@
               products. Explore our tools and contribute to advancing
               environmental biotransformation research.
             </p>
-            <div class="flex flex-row gap-4 float-right">
+            <div class="float-right flex flex-row gap-4">
               <a href="/about" class="btn btn-ghost-neutral">Read More</a>
               <a href="/about" class="btn btn-neutral">Publications</a>
             </div>
@@ -211,7 +225,7 @@
     </section>
 
     <!-- Partners Section -->
-    <section class="py-14 sm:py-12 bg-base-100">
+    <section class="bg-base-100 py-14 sm:py-12">
       <div class="mx-auto px-6 lg:px-8">
         <div class="divider">
           <h2 class="text-center text-lg/8 font-semibold">Backed by Science</h2>
@@ -222,12 +236,12 @@
           <img
             src="{% static "/images/uoa-logo-small.png" %}"
             alt="The University of Auckland"
-            class=" max-h-20 w-full object-contain lg:col-span-1"
+            class="max-h-20 w-full object-contain lg:col-span-1"
           />
           <img
             src="{% static "/images/logo-eawag.svg" %}"
             alt="Eawag"
-            class=" max-h-12 w-full object-contain lg:col-span-1"
+            class="max-h-12 w-full object-contain lg:col-span-1"
           />
           <img
             src="{% static "/images/uzh-logo.svg" %}"
diff --git a/templates/modals/search_modal.html b/templates/modals/search_modal.html
index a22623e9..1b7bd745 100644
--- a/templates/modals/search_modal.html
+++ b/templates/modals/search_modal.html
@@ -1,312 +1,435 @@
 {% load static %}
 <dialog id="search_modal" class="modal @max-sm:modal-top justify-center">
-    <div class="modal-box w-lvw sm:w-[85vw] sm:max-w-5xl h-full sm:h-8/12 p-1" >
-
-        <!-- Search Input and Mode Selector -->
-        <div class="form-control mb-4 flex-shrink-0 w-full">
-            <div class="join w-full m-0 p-3 items-center">
-                <label class="input join-item input-ghost grow">
-                    <svg xmlns="http://www.w3.org/2000/svg" width="16" height="16" viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round" class="lucide lucide-search-icon lucide-search"><path d="m21 21-4.34-4.34"/><circle cx="11" cy="11" r="8"/></svg>
-                    <input type="text" autofocus
-                    id="modal_searchbar"
-                    placeholder="Benfuracarb"
-                    class="grow" aria-label="Search" />
-                </label>
-
-                <!-- Mode Dropdown -->
-                <div>
-                    <button type="button"
-                            tabindex="0"
-                            id="modal_mode_button"
-                            popovertarget="search_dropdown_menu" style="anchor-name:--anchor-1"
-                            class="btn join-item btn-ghost">
-                        Text
-                        <svg class="w-4 h-4 ml-1" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                            <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M19 9l-7 7-7-7"/>
-                        </svg>
-                    </button>
-                    <ul tabindex="0"" class="dropdown dropdown-end menu bg-base-200 rounded-box  z-[100] w-64 p-2 shadow-lg" popover id="search_dropdown_menu" style="position-anchor:--anchor-1">
-                        <li class="menu-title">Text</li>
-                        <li>
-                            <a id="modal_dropdown_text"
-                               class="tooltip tooltip-left"
-                               data-tip="Search on object names and descriptions">
-                                Text
-                            </a>
-                        </li>
-                        <li class="menu-title">SMILES</li>
-                        <li>
-                            <a id="modal_dropdown_smiles_default"
-                               class="tooltip tooltip-left"
-                               data-tip="Ignores stereochemistry and charge">
-                                Default
-                            </a>
-                        </li>
-                        <li>
-                            <a id="modal_dropdown_smiles_canonical"
-                               class="tooltip tooltip-left"
-                               data-tip="Ignores stereochemistry, preserves charge">
-                                Canonical
-                            </a>
-                        </li>
-                        <li>
-                            <a id="modal_dropdown_smiles_exact"
-                               class="tooltip tooltip-left"
-                               data-tip="Exact match for stereochemistry and charge">
-                                Exact
-                            </a>
-                        </li>
-                        <li class="menu-title">InChI</li>
-                        <li>
-                            <a id="modal_dropdown_inchikey"
-                               class="tooltip tooltip-left"
-                               data-tip="Search by InChIKey">
-                                InChIKey
-                            </a>
-                        </li>
-                    </ul>
-                </div>
-
-                <button type="button" id="modal_search_button" class="btn btn-xs btn-ghost join-item">
-                    <kbd class="kbd kbd-sm p-1 text-base-content/50">
-                        <svg xmlns="http://www.w3.org/2000/svg" width="16" height="16" viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round" class="lucide lucide-corner-down-left-icon lucide-corner-down-left"><path d="M20 4v7a4 4 0 0 1-4 4H4"/><path d="m9 10-5 5 5 5"/></svg>
-                    </kbd>
-                </button>
-            </div>
+  <div class="modal-box h-full w-lvw p-1 sm:h-8/12 sm:w-[85vw] sm:max-w-5xl">
+    <!-- Search Input and Mode Selector -->
+    <div class="form-control mb-4 w-full shrink-0">
+      <div class="join m-0 w-full items-center p-3">
+        <label class="input join-item input-ghost grow">
+          <svg
+            xmlns="http://www.w3.org/2000/svg"
+            width="16"
+            height="16"
+            viewBox="0 0 24 24"
+            fill="none"
+            stroke="currentColor"
+            stroke-width="2"
+            stroke-linecap="round"
+            stroke-linejoin="round"
+            class="lucide lucide-search-icon lucide-search"
+          >
+            <path d="m21 21-4.34-4.34" />
+            <circle cx="11" cy="11" r="8" />
+          </svg>
+          <input
+            type="text"
+            autofocus
+            id="modal_searchbar"
+            placeholder="Benfuracarb"
+            class="grow"
+            aria-label="Search"
+          />
+        </label>
 
+        <!-- Mode Dropdown -->
+        <div>
+          <button
+            type="button"
+            tabindex="0"
+            id="modal_mode_button"
+            popovertarget="search_dropdown_menu"
+            style="anchor-name:--1"
+            class="btn join-item btn-ghost"
+          >
+            Text
+            <svg
+              class="ml-1 h-4 w-4"
+              fill="none"
+              stroke="currentColor"
+              viewBox="0 0 24 24"
+            >
+              <path
+                stroke-linecap="round"
+                stroke-linejoin="round"
+                stroke-width="2"
+                d="M19 9l-7 7-7-7"
+              />
+            </svg>
+          </button>
+          <ul
+            tabindex="0"
+            class="dropdown dropdown-end menu bg-base-200 rounded-box w-64 p-2 shadow-lg"
+            popover
+            id="search_dropdown_menu"
+            style="position-anchor:--anchor-2"
+          >
+            <li class="menu-title">Text</li>
+            <li>
+              <a
+                id="modal_dropdown_text"
+                class="tooltip tooltip-left"
+                data-tip="Search on object names and descriptions"
+              >
+                Text
+              </a>
+            </li>
+            <li class="menu-title">SMILES</li>
+            <li>
+              <a
+                id="modal_dropdown_smiles_default"
+                class="tooltip tooltip-left"
+                data-tip="Ignores stereochemistry and charge"
+              >
+                Default
+              </a>
+            </li>
+            <li>
+              <a
+                id="modal_dropdown_smiles_canonical"
+                class="tooltip tooltip-left"
+                data-tip="Ignores stereochemistry, preserves charge"
+              >
+                Canonical
+              </a>
+            </li>
+            <li>
+              <a
+                id="modal_dropdown_smiles_exact"
+                class="tooltip tooltip-left"
+                data-tip="Exact match for stereochemistry and charge"
+              >
+                Exact
+              </a>
+            </li>
+            <li class="menu-title">InChI</li>
+            <li>
+              <a
+                id="modal_dropdown_inchikey"
+                class="tooltip tooltip-left"
+                data-tip="Search by InChIKey"
+              >
+                InChIKey
+              </a>
+            </li>
+          </ul>
         </div>
 
-        <!-- Package Selector with Pills -->
-        <div class="form-control mb-4 flex-shrink-0">
-            <!-- Pills Container -->
-            <div id="modal_package_pills_container"
-                 class="flex flex-wrap gap-2 p-3 border-2 border-dashed border-base-300 rounded-lg m-3 min-h-[3rem] items-center">
-                <!-- Pills will be added here dynamically -->
-
-            </div>
-
-            <!-- Package Dropdown Menu -->
-            <ul class="dropdown dropdown-end menu bg-base-200 rounded-box z-[100] w-80 max-h-96 overflow-y-auto p-2 shadow-lg"
-                popover
-                id="package_dropdown_menu"
-                style="position-anchor:--anchor-packages">
-                {% if unreviewed_packages %}
-                    <li class="menu-title">Reviewed Packages</li>
-                    {% for obj in reviewed_packages %}
-                    <li>
-                        <a class="package-option flex justify-between items-center"
-                           data-package-url="{{ obj.url }}"
-                           data-package-name="{{ obj.name }}">
-                            <span>{{ obj.name }}</span>
-                            <svg xmlns="http://www.w3.org/2000/svg" class="h-4 w-4 package-checkmark hidden" fill="none" viewBox="0 0 24 24" stroke="currentColor">
-                                <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M5 13l4 4L19 7"/>
-                            </svg>
-                        </a>
-                    </li>
-                    {% endfor %}
-                    <li class="menu-title">Unreviewed Packages</li>
-                    {% for obj in unreviewed_packages %}
-                    <li>
-                        <a class="package-option flex justify-between items-center"
-                           data-package-url="{{ obj.url }}"
-                           data-package-name="{{ obj.name }}">
-                            <span>{{ obj.name }}</span>
-                            <svg xmlns="http://www.w3.org/2000/svg" class="h-4 w-4 package-checkmark hidden" fill="none" viewBox="0 0 24 24" stroke="currentColor">
-                                <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M5 13l4 4L19 7"/>
-                            </svg>
-                        </a>
-                    </li>
-                    {% endfor %}
-                {% else %}
-                    <li class="menu-title">Reviewed Packages</li>
-                    {% for obj in reviewed_packages %}
-                    <li>
-                        <a class="package-option flex justify-between items-center"
-                           data-package-url="{{ obj.url }}"
-                           data-package-name="{{ obj.name }}">
-                            <span>{{ obj.name }}</span>
-                            <svg xmlns="http://www.w3.org/2000/svg" class="h-4 w-4 package-checkmark hidden" fill="none" viewBox="0 0 24 24" stroke="currentColor">
-                                <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M5 13l4 4L19 7"/>
-                            </svg>
-                        </a>
-                    </li>
-                    {% endfor %}
-                {% endif %}
-            </ul>
-        </div>
-
-        <!-- Loading Indicator -->
-        <div id="search_loading" class="hidden justify-center py-8 flex-shrink-0">
-            <span class="loading loading-spinner loading-lg text-primary"></span>
-        </div>
-
-        <!-- Results Container - scrollable -->
-        <div id="search_results" class="flex-1 overflow-y-auto min-h-0 p-2"></div>
+        <button
+          type="button"
+          id="modal_search_button"
+          class="btn btn-xs btn-ghost join-item"
+        >
+          <kbd class="kbd kbd-sm text-base-content/50 p-1">
+            <svg
+              xmlns="http://www.w3.org/2000/svg"
+              width="16"
+              height="16"
+              viewBox="0 0 24 24"
+              fill="none"
+              stroke="currentColor"
+              stroke-width="2"
+              stroke-linecap="round"
+              stroke-linejoin="round"
+              class="lucide lucide-corner-down-left-icon lucide-corner-down-left"
+            >
+              <path d="M20 4v7a4 4 0 0 1-4 4H4" />
+              <path d="m9 10-5 5 5 5" />
+            </svg>
+          </kbd>
+        </button>
+      </div>
     </div>
 
-    <!-- Backdrop to close -->
-    <form method="dialog" class="modal-backdrop">
-        <button>close</button>
-    </form>
+    <!-- Package Selector with Pills -->
+    <div class="form-control mb-4 shrink-0">
+      <!-- Pills Container -->
+      <div
+        id="modal_package_pills_container"
+        class="border-base-300 m-3 flex min-h-12 flex-wrap items-center gap-2 rounded-lg border-2 border-dashed p-3"
+      >
+        <!-- Pills will be added here dynamically -->
+      </div>
+
+      <!-- Package Dropdown Menu -->
+      <ul
+        class="dropdown dropdown-center menu bg-base-200 rounded-box max-h-96 w-80 overflow-y-auto p-2 shadow-lg"
+        popover
+        id="package_dropdown_menu"
+        style="position-anchor:--anchor-packages"
+      >
+        {% if unreviewed_packages %}
+          <li class="menu-title">Reviewed Packages</li>
+          {% for obj in reviewed_packages %}
+            <li>
+              <a
+                class="package-option flex items-center justify-between"
+                data-package-url="{{ obj.url }}"
+                data-package-name="{{ obj.name }}"
+              >
+                <span>{{ obj.name }}</span>
+                <svg
+                  xmlns="http://www.w3.org/2000/svg"
+                  class="package-checkmark hidden h-4 w-4"
+                  fill="none"
+                  viewBox="0 0 24 24"
+                  stroke="currentColor"
+                >
+                  <path
+                    stroke-linecap="round"
+                    stroke-linejoin="round"
+                    stroke-width="2"
+                    d="M5 13l4 4L19 7"
+                  />
+                </svg>
+              </a>
+            </li>
+          {% endfor %}
+          <li class="menu-title">Unreviewed Packages</li>
+          {% for obj in unreviewed_packages %}
+            <li>
+              <a
+                class="package-option flex items-center justify-between"
+                data-package-url="{{ obj.url }}"
+                data-package-name="{{ obj.name }}"
+              >
+                <span>{{ obj.name }}</span>
+                <svg
+                  xmlns="http://www.w3.org/2000/svg"
+                  class="package-checkmark hidden h-4 w-4"
+                  fill="none"
+                  viewBox="0 0 24 24"
+                  stroke="currentColor"
+                >
+                  <path
+                    stroke-linecap="round"
+                    stroke-linejoin="round"
+                    stroke-width="2"
+                    d="M5 13l4 4L19 7"
+                  />
+                </svg>
+              </a>
+            </li>
+          {% endfor %}
+        {% else %}
+          <li class="menu-title">Reviewed Packages</li>
+          {% for obj in reviewed_packages %}
+            <li>
+              <a
+                class="package-option flex items-center justify-between"
+                data-package-url="{{ obj.url }}"
+                data-package-name="{{ obj.name }}"
+              >
+                <span>{{ obj.name }}</span>
+                <svg
+                  xmlns="http://www.w3.org/2000/svg"
+                  class="package-checkmark hidden h-4 w-4"
+                  fill="none"
+                  viewBox="0 0 24 24"
+                  stroke="currentColor"
+                >
+                  <path
+                    stroke-linecap="round"
+                    stroke-linejoin="round"
+                    stroke-width="2"
+                    d="M5 13l4 4L19 7"
+                  />
+                </svg>
+              </a>
+            </li>
+          {% endfor %}
+        {% endif %}
+      </ul>
+    </div>
+
+    <!-- Loading Indicator -->
+    <div id="search_loading" class="hidden shrink-0 justify-center py-8">
+      <span class="loading loading-spinner loading-lg text-primary"></span>
+    </div>
+
+    <!-- Results Container - scrollable -->
+    <div id="search_results" class="min-h-0 flex-1 overflow-y-auto p-2"></div>
+  </div>
+
+  <!-- Backdrop to close -->
+  <form method="dialog" class="modal-backdrop">
+    <button>close</button>
+  </form>
 </dialog>
 
 <script>
-(function() {
+  (function () {
     // Package Selector Module - Data-driven multiselect package selection
     const PackageSelector = {
-        // Single source of truth: array of selected packages
-        selectedPackages: [],
+      // Single source of truth: array of selected packages
+      selectedPackages: [],
 
-        elements: {
-            pillsContainer: null,
-            packageDropdown: null,
-            packageOptions: null
-        },
+      elements: {
+        pillsContainer: null,
+        packageDropdown: null,
+        packageOptions: null,
+      },
 
-        init() {
-            this.cacheElements();
-            this.loadInitialSelection();
-            this.attachEventListeners();
-            this.render();
-        },
+      init() {
+        this.cacheElements();
+        this.loadInitialSelection();
+        this.attachEventListeners();
+        this.render();
+      },
 
-        cacheElements() {
-            this.elements.pillsContainer = document.getElementById('modal_package_pills_container');
-            this.elements.packageDropdown = document.getElementById('package_dropdown_menu');
-            this.elements.packageOptions = document.querySelectorAll('.package-option');
-        },
+      cacheElements() {
+        this.elements.pillsContainer = document.getElementById(
+          "modal_package_pills_container",
+        );
+        this.elements.packageDropdown = document.getElementById(
+          "package_dropdown_menu",
+        );
+        this.elements.packageOptions =
+          document.querySelectorAll(".package-option");
+      },
 
-        loadInitialSelection() {
-            // Load pre-selected packages from server-rendered pills
-            const existingPills = this.elements.pillsContainer.querySelectorAll('.badge');
-            existingPills.forEach(pill => {
-                this.selectedPackages.push({
-                    url: pill.dataset.packageUrl,
-                    name: pill.dataset.packageName
-                });
-            });
+      loadInitialSelection() {
+        // Load pre-selected packages from server-rendered pills
+        const existingPills =
+          this.elements.pillsContainer.querySelectorAll(".badge");
+        existingPills.forEach((pill) => {
+          this.selectedPackages.push({
+            url: pill.dataset.packageUrl,
+            name: pill.dataset.packageName,
+          });
+        });
 
-            // If no pills found, select all reviewed packages by default
-            if (this.selectedPackages.length === 0) {
-                // Iterate through all menu items and collect reviewed packages
-                const menuItems = this.elements.packageDropdown.querySelectorAll('li');
+        // If no pills found, select all reviewed packages by default
+        if (this.selectedPackages.length === 0) {
+          // Iterate through all menu items and collect reviewed packages
+          const menuItems =
+            this.elements.packageDropdown.querySelectorAll("li");
 
-                for (const item of menuItems) {
-                    // Check if this is the "Unreviewed Packages" menu title
-                    if (item.classList.contains('menu-title') &&
-                        item.textContent.trim() === 'Unreviewed Packages') {
-                        break; // Stop processing after this point
-                    }
-
-                    // Check for package options (only reviewed packages reach here)
-                    const packageOption = item.querySelector('.package-option');
-                    if (packageOption) {
-                        this.selectedPackages.push({
-                            url: packageOption.dataset.packageUrl,
-                            name: packageOption.dataset.packageName
-                        });
-                    }
-                }
-            }
-        },
-
-        attachEventListeners() {
-            // Toggle package selection on dropdown item click
-            this.elements.packageOptions.forEach(option => {
-                option.addEventListener('click', (e) => {
-                    e.preventDefault();
-                    e.stopPropagation(); // Prevent dropdown from closing
-                    const packageUrl = option.dataset.packageUrl;
-                    const packageName = option.dataset.packageName;
-                    this.togglePackageSelection(packageUrl, packageName);
-                });
-            });
-
-            // Remove package when X is clicked (using event delegation)
-            this.elements.pillsContainer.addEventListener('click', (e) => {
-                if (e.target.classList.contains('package-remove-btn') || e.target.closest('.package-remove-btn')) {
-                    const pill = e.target.closest('.badge');
-                    if (pill) {
-                        const packageUrl = pill.dataset.packageUrl;
-                        this.removePackage(packageUrl);
-                    }
-                }
-            });
-        },
-
-        togglePackageSelection(packageUrl, packageName) {
-            const index = this.selectedPackages.findIndex(pkg => pkg.url === packageUrl);
-
-            if (index !== -1) {
-                // Remove from selection
-                this.selectedPackages.splice(index, 1);
-            } else {
-                // Add to selection
-                this.selectedPackages.push({ url: packageUrl, name: packageName });
+          for (const item of menuItems) {
+            // Check if this is the "Unreviewed Packages" menu title
+            if (
+              item.classList.contains("menu-title") &&
+              item.textContent.trim() === "Unreviewed Packages"
+            ) {
+              break; // Stop processing after this point
             }
 
-            this.render();
-        },
-
-        removePackage(packageUrl) {
-            const index = this.selectedPackages.findIndex(pkg => pkg.url === packageUrl);
-            if (index !== -1) {
-                this.selectedPackages.splice(index, 1);
-                this.render();
+            // Check for package options (only reviewed packages reach here)
+            const packageOption = item.querySelector(".package-option");
+            if (packageOption) {
+              this.selectedPackages.push({
+                url: packageOption.dataset.packageUrl,
+                name: packageOption.dataset.packageName,
+              });
             }
-        },
+          }
+        }
+      },
 
-        render() {
-            this.renderPills();
-            this.renderAddButton();
-            this.renderCheckmarks();
-        },
+      attachEventListeners() {
+        // Toggle package selection on dropdown item click
+        this.elements.packageOptions.forEach((option) => {
+          option.addEventListener("click", (e) => {
+            e.preventDefault();
+            e.stopPropagation(); // Prevent dropdown from closing
+            const packageUrl = option.dataset.packageUrl;
+            const packageName = option.dataset.packageName;
+            this.togglePackageSelection(packageUrl, packageName);
+          });
+        });
 
-        renderPills() {
-            // Clear existing pills and button (except placeholder)
-            const pills = this.elements.pillsContainer.querySelectorAll('.badge');
-            pills.forEach(pill => pill.remove());
-
-            const existingButton = this.elements.pillsContainer.querySelector('#modal_package_add_button');
-            if (existingButton) {
-                existingButton.remove();
+        // Remove package when X is clicked (using event delegation)
+        this.elements.pillsContainer.addEventListener("click", (e) => {
+          if (
+            e.target.classList.contains("package-remove-btn") ||
+            e.target.closest(".package-remove-btn")
+          ) {
+            const pill = e.target.closest(".badge");
+            if (pill) {
+              const packageUrl = pill.dataset.packageUrl;
+              this.removePackage(packageUrl);
             }
+          }
+        });
+      },
 
-            // Create pills from data
-            this.selectedPackages.forEach(pkg => {
-                const pill = this.createPillElement(pkg.url, pkg.name);
-                this.elements.pillsContainer.appendChild(pill);
-            });
-        },
+      togglePackageSelection(packageUrl, packageName) {
+        const index = this.selectedPackages.findIndex(
+          (pkg) => pkg.url === packageUrl,
+        );
 
-        renderAddButton() {
-            // Only render button if there are packages available
-            if (this.elements.packageOptions.length === 0) {
-                return;
-            }
+        if (index !== -1) {
+          // Remove from selection
+          this.selectedPackages.splice(index, 1);
+        } else {
+          // Add to selection
+          this.selectedPackages.push({ url: packageUrl, name: packageName });
+        }
 
-            const button = document.createElement('button');
-            button.type = 'button';
-            button.id = 'modal_package_add_button';
-            button.setAttribute('popovertarget', 'package_dropdown_menu');
-            button.style.cssText = 'anchor-name:--anchor-packages';
-            button.className = 'btn btn-sm btn-ghost gap-2 text-base-content/50';
+        this.render();
+      },
 
-            button.innerHTML = `
+      removePackage(packageUrl) {
+        const index = this.selectedPackages.findIndex(
+          (pkg) => pkg.url === packageUrl,
+        );
+        if (index !== -1) {
+          this.selectedPackages.splice(index, 1);
+          this.render();
+        }
+      },
+
+      render() {
+        this.renderPills();
+        this.renderAddButton();
+        this.renderCheckmarks();
+      },
+
+      renderPills() {
+        // Clear existing pills and button (except placeholder)
+        const pills = this.elements.pillsContainer.querySelectorAll(".badge");
+        pills.forEach((pill) => pill.remove());
+
+        const existingButton = this.elements.pillsContainer.querySelector(
+          "#modal_package_add_button",
+        );
+        if (existingButton) {
+          existingButton.remove();
+        }
+
+        // Create pills from data
+        this.selectedPackages.forEach((pkg) => {
+          const pill = this.createPillElement(pkg.url, pkg.name);
+          this.elements.pillsContainer.appendChild(pill);
+        });
+      },
+
+      renderAddButton() {
+        // Only render button if there are packages available
+        if (this.elements.packageOptions.length === 0) {
+          return;
+        }
+
+        const button = document.createElement("button");
+        button.type = "button";
+        button.id = "modal_package_add_button";
+        button.setAttribute("popovertarget", "package_dropdown_menu");
+        button.style.cssText = "anchor-name:--anchor-packages";
+        button.className = "btn btn-sm btn-ghost gap-2 text-base-content/50";
+
+        button.innerHTML = `
                 <svg xmlns="http://www.w3.org/2000/svg" width="16" height="16" viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round" class="lucide lucide-plus-icon lucide-plus"><path d="M5 12h14"/><path d="M12 5v14"/></svg>
                 Add Package
             `;
 
-            this.elements.pillsContainer.appendChild(button);
-        },
+        this.elements.pillsContainer.appendChild(button);
+      },
 
-        createPillElement(packageUrl, packageName) {
-            const pill = document.createElement('span');
-            pill.className = 'badge badge-outline gap-2 max-w-xs';
-            pill.dataset.packageUrl = packageUrl;
-            pill.dataset.packageName = packageName;
+      createPillElement(packageUrl, packageName) {
+        const pill = document.createElement("span");
+        pill.className = "badge badge-outline gap-2 max-w-xs";
+        pill.dataset.packageUrl = packageUrl;
+        pill.dataset.packageName = packageName;
 
-            pill.innerHTML = `
+        pill.innerHTML = `
                 <span class="truncate" title="${packageName}">${packageName}</span>
 
                 <svg xmlns="http://www.w3.org/2000/svg"
@@ -321,81 +444,103 @@
                 </svg>
             `;
 
-            return pill;
-        },
+        return pill;
+      },
 
-        renderCheckmarks() {
-            // Update all checkmarks based on selected packages
-            this.elements.packageOptions.forEach(option => {
-                const packageUrl = option.dataset.packageUrl;
-                const isSelected = this.selectedPackages.some(pkg => pkg.url === packageUrl);
-                const checkmark = option.querySelector('.package-checkmark');
+      renderCheckmarks() {
+        // Update all checkmarks based on selected packages
+        this.elements.packageOptions.forEach((option) => {
+          const packageUrl = option.dataset.packageUrl;
+          const isSelected = this.selectedPackages.some(
+            (pkg) => pkg.url === packageUrl,
+          );
+          const checkmark = option.querySelector(".package-checkmark");
 
-                if (checkmark) {
-                    checkmark.classList.toggle('hidden', !isSelected);
-                }
-            });
-        },
+          if (checkmark) {
+            checkmark.classList.toggle("hidden", !isSelected);
+          }
+        });
+      },
 
-
-        getSelectedPackages() {
-            return this.selectedPackages.map(pkg => pkg.url);
-        }
+      getSelectedPackages() {
+        return this.selectedPackages.map((pkg) => pkg.url);
+      },
     };
 
     // Modal and Search Management
-    const modal = document.getElementById('search_modal');
-    const searchbar = document.getElementById('modal_searchbar');
-    const searchButton = document.getElementById('modal_search_button');
-    const modeButton = document.getElementById('modal_mode_button');
-    const resultsDiv = document.getElementById('search_results');
-    const loadingDiv = document.getElementById('search_loading');
+    const modal = document.getElementById("search_modal");
+    const searchbar = document.getElementById("modal_searchbar");
+    const searchButton = document.getElementById("modal_search_button");
+    const modeButton = document.getElementById("modal_mode_button");
+    const resultsDiv = document.getElementById("search_results");
+    const loadingDiv = document.getElementById("search_loading");
 
     // MutationObserver to detect when modal opens
     const observer = new MutationObserver((mutations) => {
-        mutations.forEach((mutation) => {
-            if (mutation.attributeName === 'open' && modal.open) {
-                PackageSelector.render();
-                // Delay focus to allow CSS transitions to complete (modal has 0.3s transition)
-                setTimeout(() => {
-                    searchbar.focus();
-                }, 320);
-            }
-        });
+      mutations.forEach((mutation) => {
+        if (mutation.attributeName === "open" && modal.open) {
+          PackageSelector.render();
+          // Delay focus to allow CSS transitions to complete (modal has 0.3s transition)
+          setTimeout(() => {
+            searchbar.focus();
+          }, 320);
+        }
+      });
     });
 
     observer.observe(modal, { attributes: true });
 
-    // Clear results when modal closes
-    modal.addEventListener('close', function() {
-        resultsDiv.innerHTML = '';
-        loadingDiv.classList.add('hidden');
-        searchbar.value = '';
+    // Close modal when clicking outside (on the backdrop)
+    // According to DaisyUI docs: https://daisyui.com/components/modal/
+    // The backdrop form with method="dialog" should handle closing automatically when its button is clicked.
+    // We also handle clicks directly on the dialog element (backdrop area) or the backdrop form.
+    modal.addEventListener("click", function (event) {
+      const backdrop = modal.querySelector(".modal-backdrop");
+      const modalBox = modal.querySelector(".modal-box");
+
+      // Close if clicking directly on the dialog element (backdrop area)
+      // or on the backdrop form (but ensure we're not clicking on modal-box content)
+      if (
+        event.target === modal ||
+        (backdrop &&
+          (event.target === backdrop || backdrop.contains(event.target)) &&
+          !modalBox.contains(event.target))
+      ) {
+        modal.close();
+      }
     });
 
+    // Clear results when modal closes
+    modal.addEventListener("close", function () {
+      resultsDiv.innerHTML = "";
+      loadingDiv.classList.add("hidden");
+      searchbar.value = "";
+    });
 
     // Mode dropdown handlers
-    const dropdownMenu = document.getElementById('search_dropdown_menu');
+    const dropdownMenu = document.getElementById("search_dropdown_menu");
 
     const modeButtons = [
-        { id: 'modal_dropdown_text', text: 'Text' },
-        { id: 'modal_dropdown_smiles_default', text: 'Default' },
-        { id: 'modal_dropdown_smiles_canonical', text: 'Canonical' },
-        { id: 'modal_dropdown_smiles_exact', text: 'Exact' },
-        { id: 'modal_dropdown_inchikey', text: 'InChIKey' }
+      { id: "modal_dropdown_text", text: "Text" },
+      { id: "modal_dropdown_smiles_default", text: "Default" },
+      { id: "modal_dropdown_smiles_canonical", text: "Canonical" },
+      { id: "modal_dropdown_smiles_exact", text: "Exact" },
+      { id: "modal_dropdown_inchikey", text: "InChIKey" },
     ];
 
     modeButtons.forEach(({ id, text }) => {
-        document.getElementById(id).addEventListener('click', function(e) {
-            e.preventDefault();
-            modeButton.innerHTML = text + ` <svg class="w-4 h-4 ml-1" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+      document.getElementById(id).addEventListener("click", function (e) {
+        e.preventDefault();
+        modeButton.innerHTML =
+          text +
+          ` <svg class="w-4 h-4 ml-1" fill="none" stroke="currentColor" viewBox="0 0 24 24">
                 <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M19 9l-7 7-7-7"/>
             </svg>`;
-            // Close dropdown using popover API
-            if (dropdownMenu && typeof dropdownMenu.hidePopover === 'function') {
-                dropdownMenu.hidePopover();
-            }
-        });
+        // Close dropdown using popover API
+        if (dropdownMenu && typeof dropdownMenu.hidePopover === "function") {
+          dropdownMenu.hidePopover();
+        }
+      });
     });
 
     // Initialize Package Selector
@@ -403,29 +548,35 @@
 
     // Search Response Handler
     function handleSearchResponse(data) {
-        resultsDiv.innerHTML = '';
+      resultsDiv.innerHTML = "";
 
-        function makeContent(objs) {
-            let links = '';
-            objs.forEach(obj => {
-                links += `<a href="${obj.url}" class="block px-4 py-2 hover:bg-base-300 rounded-lg transition-colors">${obj.name}</a>`;
-            });
-            return links;
+      function makeContent(objs) {
+        let links = "";
+        objs.forEach((obj) => {
+          links += `<a href="${obj.url}" class="block px-4 py-2 hover:bg-base-300 rounded-lg transition-colors">${obj.name}</a>`;
+        });
+        return links;
+      }
+
+      let allEmpty = true;
+      let content = "";
+
+      // Category order for better UX
+      const categoryOrder = [
+        "Compounds",
+        "Compound Structures",
+        "Rules",
+        "Reactions",
+        "Pathways",
+      ];
+
+      categoryOrder.forEach((key) => {
+        if (!data[key] || data[key].length < 1) {
+          return;
         }
+        allEmpty = false;
 
-        let allEmpty = true;
-        let content = '';
-
-        // Category order for better UX
-        const categoryOrder = ['Compounds', 'Compound Structures', 'Rules', 'Reactions', 'Pathways'];
-
-        categoryOrder.forEach(key => {
-            if (!data[key] || data[key].length < 1) {
-                return;
-            }
-            allEmpty = false;
-
-            content += `
+        content += `
                 <div class="collapse collapse-arrow bg-base-200 mb-2">
                     <input type="checkbox" checked />
                     <div class="collapse-title font-medium">
@@ -436,10 +587,10 @@
                     </div>
                 </div>
             `;
-        });
+      });
 
-        if (allEmpty) {
-            resultsDiv.innerHTML = `
+      if (allEmpty) {
+        resultsDiv.innerHTML = `
                 <div class="alert alert-warning">
                     <svg class="w-6 h-6" fill="none" stroke="currentColor" viewBox="0 0 24 24">
                         <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M12 9v2m0 4h.01m-6.938 4h13.856c1.54 0 2.502-1.667 1.732-3L13.732 4c-.77-1.333-2.694-1.333-3.464 0L3.34 16c-.77 1.333.192 3 1.732 3z"/>
@@ -447,32 +598,32 @@
                     <span>No results found</span>
                 </div>
             `;
-        } else {
-            resultsDiv.innerHTML = `
+      } else {
+        resultsDiv.innerHTML = `
                 <div class="mb-2">
                     <div class="text-sm font-semibold text-base-content/70 mb-2">Results</div>
                     ${content}
                 </div>
             `;
-        }
+      }
     }
 
     // Search Execution
     function performSearch(e) {
-        e.preventDefault();
+      e.preventDefault();
 
-        const query = searchbar.value.trim();
+      const query = searchbar.value.trim();
 
-        if (!query) {
-            console.log('Search phrase empty, won\'t do search');
-            return;
-        }
+      if (!query) {
+        console.log("Search phrase empty, won't do search");
+        return;
+      }
 
-        const selPacks = PackageSelector.getSelectedPackages();
+      const selPacks = PackageSelector.getSelectedPackages();
 
-        if (selPacks.length < 1) {
-            console.log('No package selected, won\'t do search');
-            resultsDiv.innerHTML = `
+      if (selPacks.length < 1) {
+        console.log("No package selected, won't do search");
+        resultsDiv.innerHTML = `
                 <div class="alert alert-info">
                     <svg class="w-6 h-6" fill="none" stroke="currentColor" viewBox="0 0 24 24">
                         <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M13 16h-1v-4h-1m1-4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"/>
@@ -480,40 +631,40 @@
                     <span>Please select at least one package</span>
                 </div>
             `;
-            return;
-        }
+        return;
+      }
 
-        const mode = modeButton.textContent.trim().toLowerCase();
+      const mode = modeButton.textContent.trim().toLowerCase();
 
-        const params = new URLSearchParams();
-        selPacks.forEach(pack => params.append('packages', pack));
-        params.append('search', query);
-        params.append('mode', mode);
+      const params = new URLSearchParams();
+      selPacks.forEach((pack) => params.append("packages", pack));
+      params.append("search", query);
+      params.append("mode", mode);
 
-        // Show loading
-        loadingDiv.classList.remove('hidden');
-        resultsDiv.innerHTML = '';
+      // Show loading
+      loadingDiv.classList.remove("hidden");
+      resultsDiv.innerHTML = "";
 
-        fetch(`{{ SERVER_BASE }}/search?${params.toString()}`, {
-            method: 'GET',
-            headers: {
-                'Accept': 'application/json'
-            }
+      fetch(`{{ SERVER_BASE }}/search?${params.toString()}`, {
+        method: "GET",
+        headers: {
+          Accept: "application/json",
+        },
+      })
+        .then((response) => {
+          if (!response.ok) {
+            throw new Error("Search request failed");
+          }
+          return response.json();
         })
-        .then(response => {
-            if (!response.ok) {
-                throw new Error('Search request failed');
-            }
-            return response.json();
+        .then((result) => {
+          loadingDiv.classList.add("hidden");
+          handleSearchResponse(result);
         })
-        .then(result => {
-            loadingDiv.classList.add('hidden');
-            handleSearchResponse(result);
-        })
-        .catch(error => {
-            loadingDiv.classList.add('hidden');
-            console.error('Search error:', error);
-            resultsDiv.innerHTML = `
+        .catch((error) => {
+          loadingDiv.classList.add("hidden");
+          console.error("Search error:", error);
+          resultsDiv.innerHTML = `
                 <div class="alert alert-error">
                     <svg class="w-6 h-6" fill="none" stroke="currentColor" viewBox="0 0 24 24">
                         <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M12 8v4m0 4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"/>
@@ -525,11 +676,11 @@
     }
 
     // Event listeners for search
-    searchButton.addEventListener('click', performSearch);
-    searchbar.addEventListener('keydown', function(e) {
-        if (e.key === 'Enter') {
-            performSearch(e);
-        }
+    searchButton.addEventListener("click", performSearch);
+    searchbar.addEventListener("keydown", function (e) {
+      if (e.key === "Enter") {
+        performSearch(e);
+      }
     });
-})();
+  })();
 </script>
diff --git a/templates/search.html b/templates/search.html
deleted file mode 100644
index eee1fbad..00000000
--- a/templates/search.html
+++ /dev/null
@@ -1,197 +0,0 @@
-{% extends "framework.html" %}
-{% load static %}
-{% block content %}
-
-    <div id=searchContent>
-        <div id="packSelector">
-            <label>Select Packages</label><br>
-            <select id="selPackages" name="selPackages" data-actions-box='true' class="selPackages" multiple
-                    data-width='100%'>
-                {% if unreviewed_objects %}
-                    <option disabled>Reviewed Packages</option>
-                {% endif %}
-                {% for obj in reviewed_objects %}
-                    <option value="{{ obj.url }}" selected>{{ obj.name|safe }}</option>
-                {% endfor %}
-                {% if unreviewed_objects %}
-                    <option disabled>Unreviewed Packages</option>
-                {% endif %}
-                {% for obj in unreviewed_objects %}
-                    <option value="{{ obj.url }}">{{ obj.name|safe }}</option>
-                {% endfor %}
-            </select>
-        </div>
-        <p></p>
-        <div>
-            <label>Search Term</label><br>
-            <div class="input-group" id="index-form-bar">
-                <input type="text" class="form-control" id='searchbar' placeholder="Benfuracarb">
-                <div class="input-group-btn">
-                    <button type="button" class="btn btn-default dropdown-toggle" data-toggle="dropdown"
-                            id="mode-button"
-                            aria-haspopup="true" aria-expanded="false">Text <span class="caret"></span></button>
-                    <ul class="dropdown-menu">
-                        <li class="dropdown-header">Text</li>
-                        <li><a id="dropdown-predict-text-text">Text</a></li>
-                        <li class="dropdown-header">SMILES</li>
-                        <li><a id="dropdown-search-smiles-default" data-toggle="tooltip">Default</a></li>
-                        <li><a id="dropdown-search-smiles-canonical">Canonical</a></li>
-                        <li><a id="dropdown-search-smiles-exact">Exact</a></li>
-                        <li class="dropdown-header">InChI</li>
-                        <li><a id="dropdown-search-inchi-inchikey">InChIKey</a></li>
-                    </ul>
-                    <button class="btn" style="background-color:#222222;color:#9d9d9d" type="button" id="search-button">
-                        Go!
-                    </button>
-                </div>
-            </div>
-            <p></p>
-            <div id="results"></div>
-            <p></p>
-            <div id="loading"></div>
-        </div>
-    </div>
-    <script>
-        function modeDropdownClicked() {
-            var suffix = ' <span class="caret"></span>';
-            var dropdownVal = $(this).text();
-            $('#mode-button').html(dropdownVal + suffix);
-        }
-
-        function handleSearchResponse(id, data) {
-            content = `
-                <div class='panel-group' id='search-accordion'>
-                    <div class='panel panel-default'>
-                        <div class='panel-heading' id='headingPanel' style='font-size:2rem;height: 46px'>
-                        Results
-                        </div>
-                        <div id='descDiv'></div>
-                    </div>`;
-
-            function makeContent(objs) {
-                links = "";
-                for (idx in objs) {
-                    obj = objs[idx];
-                    links += `<a class='list-group-item' href='${obj.url}'>${obj.name}</a>`
-                }
-                return links;
-            }
-
-            allEmpty = true;
-            for (key in data) {
-                if (key === 'searchterm') {
-                    continue;
-                }
-
-                if (data[key].length < 1) {
-                    continue;
-                }
-                allEmpty = false;
-                content += `
-                    <div class='panel panel-default panel-heading list-group-item' style='background-color:silver'>
-                        <h4 class='panel-title'>
-                            <a id='${key}_link' data-toggle='collapse' data-parent='#search-accordion' href='#${key}_panel'>
-                                ${key}
-                            </a>
-                        </h4>
-                    </div>
-                    <div id='${key}_panel' class='panel-collapse collapse in'>
-                        <div class='panel-body list-group-item'>
-                        ${makeContent(data[key])}
-                        </div>
-                    </div>
-
-        `;
-            }
-            if (allEmpty) {
-                $('#' + id).append('<div class="alert alert-danger" role="alert"><p>' + "No results..." + '</p></div>');
-            } else {
-                $('#' + id).append(content);
-            }
-        }
-
-        function search(e) {
-            e.preventDefault();
-
-            query = $("#searchbar").val()
-
-            if (!query) {
-                // Nothing to search...
-                console.log("Search phrase empty, won't do search")
-                return;
-            }
-
-            var selPacks = [];
-            $("#selPackages :selected").each(function () {
-                var id = this.value;
-                selPacks.push(id);
-            });
-
-            if (selPacks.length < 1) {
-                console.log("No package selected, won't do search")
-                return;
-            }
-
-            var mode = $('#mode-button').text().trim().toLowerCase();
-
-            var par = {};
-            par['packages'] = selPacks;
-            par['search'] = query;
-            par['mode'] = mode;
-
-            console.log(par);
-
-            var queryString = $.param(par, true);
-
-            makeLoadingGif("#loading", "{% static '/images/wait.gif' %}");
-
-            $("#results").empty();
-
-            $.getJSON("{{ SERVER_BASE }}/search?" + queryString, function (result) {
-                handleSearchResponse("results", result);
-                $("#loading").empty();
-            }).fail(function (d) {
-                $("#loading").empty();
-                console.log(d.responseText);
-                handleError(JSON.parse(d.responseText));
-            });
-        }
-
-
-        $(function () {
-
-            tooltips = {
-                'dropdown-predict-text-text': 'The inserted pattern will be searched on all enviPath object names and descriptions',
-                'dropdown-search-smiles-default': 'Search by SMILES, stereochemistry and charge are ignored',
-                'dropdown-search-smiles-canonical': 'Search by SMILES, stereochemistry is ignored but charge is preserved',
-                'dropdown-search-smiles-exact': 'Search by SMILES, exact match for stereochemistry and charge',
-                'dropdown-search-inchi-inchikey': 'Search by InChIKey',
-            }
-
-            Object.keys(tooltips).forEach(key => {
-                $('#' + key).tooltip({
-                    placement: "top",
-                    title: tooltips[key]
-                });
-
-                $('#' + key).on('click', modeDropdownClicked);
-            });
-
-            $("#selPackages").selectpicker();
-            $("#search-button").on("click", search);
-
-            $("#searchbar").on("keydown", function (e) {
-                if (e.key === "Enter") {
-                    e.preventDefault();
-                    search(e);
-                }
-            });
-
-        });
-        {% if search_result %}
-            $('#searchbar').val('{{ search_result.searchterm }}')
-            handleSearchResponse("results", {{ search_result|safe }});
-        {% endif %}
-    </script>
-
-{% endblock content %}