[Feature] MultiGen Eval (Backend) (#117)

Fixes #16

Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#117
This commit is contained in:
2025-09-18 18:40:45 +12:00
parent 762a6b7baf
commit 50db2fb372
24 changed files with 816 additions and 2137274 deletions

View File

@ -864,7 +864,7 @@ class PackageManager(object):
@staticmethod @staticmethod
@transaction.atomic @transaction.atomic
def import_pacakge(data: Dict[str, Any], owner: User, preserve_uuids=False, add_import_timestamp=True, def import_package(data: Dict[str, Any], owner: User, preserve_uuids=False, add_import_timestamp=True,
trust_reviewed=False) -> Package: trust_reviewed=False) -> Package:
importer = PackageImporter(data, preserve_uuids, add_import_timestamp, trust_reviewed) importer = PackageImporter(data, preserve_uuids, add_import_timestamp, trust_reviewed)

View File

@ -7,7 +7,7 @@ import secrets
from abc import abstractmethod from abc import abstractmethod
from collections import defaultdict from collections import defaultdict
from datetime import datetime from datetime import datetime
from typing import Union, List, Optional, Dict, Tuple, Set from typing import Union, List, Optional, Dict, Tuple, Set, Any
from uuid import uuid4 from uuid import uuid4
import joblib import joblib
@ -588,33 +588,33 @@ class Package(EnviPathModel):
return f"{self.name} (pk={self.pk})" return f"{self.name} (pk={self.pk})"
@property @property
def compounds(self): def compounds(self) -> QuerySet:
return self.compound_set.all() return self.compound_set.all()
@property @property
def rules(self): def rules(self) -> QuerySet:
return self.rule_set.all() return self.rule_set.all()
@property @property
def reactions(self): def reactions(self) -> QuerySet:
return self.reaction_set.all() return self.reaction_set.all()
@property @property
def pathways(self) -> 'Pathway': def pathways(self) -> QuerySet:
return self.pathway_set.all() return self.pathway_set.all()
@property @property
def scenarios(self): def scenarios(self) -> QuerySet:
return self.scenario_set.all() return self.scenario_set.all()
@property @property
def models(self): def models(self) -> QuerySet:
return self.epmodel_set.all() return self.epmodel_set.all()
def _url(self): def _url(self):
return '{}/package/{}'.format(s.SERVER_URL, self.uuid) return '{}/package/{}'.format(s.SERVER_URL, self.uuid)
def get_applicable_rules(self): def get_applicable_rules(self) -> List['Rule']:
""" """
Returns a ordered set of rules where the following applies: Returns a ordered set of rules where the following applies:
1. All Composite will be added to result 1. All Composite will be added to result
@ -650,11 +650,11 @@ class Compound(EnviPathModel, AliasMixin, ScenarioMixin, ChemicalIdentifierMixin
external_identifiers = GenericRelation('ExternalIdentifier') external_identifiers = GenericRelation('ExternalIdentifier')
@property @property
def structures(self): def structures(self) -> QuerySet:
return CompoundStructure.objects.filter(compound=self) return CompoundStructure.objects.filter(compound=self)
@property @property
def normalized_structure(self): def normalized_structure(self) -> 'CompoundStructure' :
return CompoundStructure.objects.get(compound=self, normalized_structure=True) return CompoundStructure.objects.get(compound=self, normalized_structure=True)
def _url(self): def _url(self):
@ -1635,8 +1635,8 @@ class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
return new_pathway return new_pathway
@transaction.atomic @transaction.atomic
def add_node(self, smiles: str, name: Optional[str] = None, description: Optional[str] = None): def add_node(self, smiles: str, name: Optional[str] = None, description: Optional[str] = None, depth: Optional[int] = 0):
return Node.create(self, smiles, 0) return Node.create(self, smiles, depth, name=name, description=description)
@transaction.atomic @transaction.atomic
def add_edge(self, start_nodes: List['Node'], end_nodes: List['Node'], rule: Optional['Rule'] = None, def add_edge(self, start_nodes: List['Node'], end_nodes: List['Node'], rule: Optional['Rule'] = None,
@ -1836,6 +1836,7 @@ class PackageBasedModel(EPModel):
eval_results = JSONField(null=True, blank=True, default=dict) eval_results = JSONField(null=True, blank=True, default=dict)
app_domain = models.ForeignKey('epdb.ApplicabilityDomain', on_delete=models.SET_NULL, null=True, blank=True, app_domain = models.ForeignKey('epdb.ApplicabilityDomain', on_delete=models.SET_NULL, null=True, blank=True,
default=None) default=None)
multigen_eval = models.BooleanField(null=False, blank=False, default=False)
INITIAL = "INITIAL" INITIAL = "INITIAL"
INITIALIZING = "INITIALIZING" INITIALIZING = "INITIALIZING"
@ -1861,6 +1862,24 @@ class PackageBasedModel(EPModel):
def ready_for_prediction(self) -> bool: def ready_for_prediction(self) -> bool:
return self.model_status in [self.BUILT_NOT_EVALUATED, self.EVALUATING, self.FINISHED] return self.model_status in [self.BUILT_NOT_EVALUATED, self.EVALUATING, self.FINISHED]
@property
def pr_curve(self):
if self.model_status != self.FINISHED:
raise ValueError(f"Expected {self.FINISHED} but model is in status {self.model_status}")
res = []
thresholds = self.eval_results['average_precision_per_threshold'].keys()
for t in thresholds:
res.append({
'precision': self.eval_results['average_precision_per_threshold'][t],
'recall': self.eval_results['average_recall_per_threshold'][t],
'threshold': float(t)
})
return res
@cached_property @cached_property
def applicable_rules(self) -> List['Rule']: def applicable_rules(self) -> List['Rule']:
""" """
@ -1897,14 +1916,6 @@ class PackageBasedModel(EPModel):
# TODO # TODO
return [] return []
def _get_pathways(self):
pathway_qs = Pathway.objects.none()
for p in self.data_packages.all():
pathway_qs |= p.pathways
pathway_qs = pathway_qs.distinct()
return pathway_qs
def _get_reactions(self) -> QuerySet: def _get_reactions(self) -> QuerySet:
return Reaction.objects.filter(package__in=self.data_packages.all()).distinct() return Reaction.objects.filter(package__in=self.data_packages.all()).distinct()
@ -1937,9 +1948,277 @@ class PackageBasedModel(EPModel):
self.build_model() self.build_model()
@abstractmethod @abstractmethod
def build_model(self): def _fit_model(self, ds: Dataset):
pass pass
@abstractmethod
def _model_args(self) -> Dict[str, Any]:
pass
def build_model(self):
self.model_status = self.BUILDING
self.save()
ds = self.load_dataset()
mod = self._fit_model(ds)
f = os.path.join(s.MODEL_DIR, f"{self.uuid}_mod.pkl")
joblib.dump(mod, f)
if self.app_domain is not None:
logger.debug("Building applicability domain...")
self.app_domain.build()
logger.debug("Done building applicability domain.")
self.model_status = self.BUILT_NOT_EVALUATED
self.save()
def evaluate_model(self):
if self.model_status != self.BUILT_NOT_EVALUATED:
raise ValueError(f"Can't evaluate a model in state {self.model_status}!")
self.model_status = self.EVALUATING
self.save()
def train_func(X, y, train_index, model_kwargs):
clz = model_kwargs.pop('clz')
if clz == 'RuleBaseRelativeReasoning':
mod = RelativeReasoning(
**model_kwargs
)
else:
mod = EnsembleClassifierChain(
**model_kwargs
)
if train_index is not None:
X, y = X[train_index], y[train_index]
mod.fit(X, y)
return mod
def evaluate_sg(model, X, y, test_index, threshold):
X_test = X[test_index]
y_test = y[test_index]
y_pred = model.predict_proba(X_test)
y_thresholded = (y_pred >= threshold).astype(int)
# Flatten them to get rid of np.nan
y_test = np.asarray(y_test).flatten()
y_pred = np.asarray(y_pred).flatten()
y_thresholded = np.asarray(y_thresholded).flatten()
mask = ~np.isnan(y_test)
y_test_filtered = y_test[mask]
y_pred_filtered = y_pred[mask]
y_thresholded_filtered = y_thresholded[mask]
acc = jaccard_score(y_test_filtered, y_thresholded_filtered, zero_division=0)
prec, rec = dict(), dict()
for t in np.arange(0, 1.05, 0.05):
temp_thresholded = (y_pred_filtered >= t).astype(int)
prec[f"{t:.2f}"] = precision_score(y_test_filtered, temp_thresholded, zero_division=0)
rec[f"{t:.2f}"] = recall_score(y_test_filtered, temp_thresholded, zero_division=0)
return acc, prec, rec
def evaluate_mg(model, pathways: Union[QuerySet['Pathway']| List['Pathway']], threshold):
thresholds = np.arange(0.1, 1.1, 0.1)
precision = {f"{t:.2f}": [] for t in thresholds}
recall = {f"{t:.2f}": [] for t in thresholds}
# Note: only one root compound supported at this time
root_compounds = [[p.default_node_label.smiles for p in p.root_nodes][0] for p in pathways]
# As we need a Model Instance in our setting, get a fresh copy from db, overwrite the serialized mode and
# pass it to the setting used in prediction
if isinstance(self, MLRelativeReasoning):
mod = MLRelativeReasoning.objects.get(pk=self.pk)
elif isinstance(self, RuleBasedRelativeReasoning):
mod = RuleBasedRelativeReasoning.objects.get(pk=self.pk)
mod.model = model
s = Setting()
s.model = mod
s.model_threshold = thresholds.min()
s.max_depth = 10
s.max_nodes = 50
from epdb.logic import SPathway
from utilities.ml import multigen_eval
pred_pathways = []
for i, root in enumerate(root_compounds):
logger.debug(f"Evaluating pathway {i + 1} of {len(root_compounds)}...")
spw = SPathway(root_nodes=root, prediction_setting=s)
level = 0
while not spw.done:
spw.predict_step(from_depth=level)
level += 1
pred_pathways.append(spw)
mg_acc = 0.0
for t in thresholds:
for true, pred in zip(test_pathways, pred_pathways):
acc, pre, rec = multigen_eval(true, pred, t)
if abs(t - threshold) < 0.01:
mg_acc = acc
precision[f"{t:.2f}"].append(pre)
recall[f"{t:.2f}"].append(rec)
precision = {k: sum(v) / len(v) if len(v) > 0 else 0 for k, v in precision.items()}
recall = {k: sum(v) / len(v) if len(v) > 0 else 0 for k, v in recall.items()}
return mg_acc, precision, recall
ds = self.load_dataset()
if isinstance(self, RuleBasedRelativeReasoning):
X = np.array(ds.X(exclude_id_col=False, na_replacement=None))
y = np.array(ds.y(na_replacement=np.nan))
else:
X = np.array(ds.X(na_replacement=np.nan))
y = np.array(ds.y(na_replacement=np.nan))
n_splits = 20
shuff = ShuffleSplit(n_splits=n_splits, test_size=0.25, random_state=42)
splits = list(shuff.split(X))
from joblib import Parallel, delayed
models = Parallel(n_jobs=10)(delayed(train_func)(X, y, train_index, self._model_args()) for train_index, _ in splits)
evaluations = Parallel(n_jobs=10)(delayed(evaluate_sg)(model, X, y, test_index, self.threshold)
for model, (_, test_index) in zip(models, splits))
def compute_averages(data):
num_items = len(data)
avg_first_item = sum(item[0] for item in data) / num_items
sum_dict2 = defaultdict(float)
sum_dict3 = defaultdict(float)
for _, dict2, dict3 in data:
for key in dict2:
sum_dict2[key] += dict2[key]
for key in dict3:
sum_dict3[key] += dict3[key]
avg_dict2 = {key: val / num_items for key, val in sum_dict2.items()}
avg_dict3 = {key: val / num_items for key, val in sum_dict3.items()}
return {
"average_accuracy": float(avg_first_item),
"average_precision_per_threshold": avg_dict2,
"average_recall_per_threshold": avg_dict3
}
self.eval_results = compute_averages(evaluations)
if self.multigen_eval:
# We have to consider 2 cases here:
# 1. No eval packages provided -> Split Train data X times and train and evaluate model
# 2. eval packages provided -> Use the already built model and do evaluation on the set provided.
if self.eval_packages.count() > 0:
pathway_qs = Pathway.objects.filter(package__in=self.eval_packages.all()).distinct()
evaluate_mg(self.model, pathway_qs, self.threshold)
return
pathway_qs = Pathway.objects.prefetch_related(
'node_set',
'node_set__out_edges',
'node_set__default_node_label',
'node_set__scenarios',
'edge_set',
'edge_set__start_nodes',
'edge_set__end_nodes',
'edge_set__edge_label',
'edge_set__scenarios'
).filter(package__in=self.data_packages.all()).distinct()
pathways = []
for pathway in pathway_qs:
# There is one pathway with no root compounds, so this check is required
if len(pathway.root_nodes) > 0:
pathways.append(pathway)
else:
logging.warning(f"No root compound in pathway {pathway.name}, excluding from multigen evaluation")
# build lookup reaction -> {uuid1, uuid2} for overlap check
reaction_to_educts = defaultdict(set)
for pathway in pathways:
for reaction in pathway.edges:
for e in reaction.edge_label.educts.all():
reaction_to_educts[str(reaction.edge_label.uuid)].add(str(e.uuid))
# build lookup to avoid recalculation of features, labels
id_to_index = {uuid: i for i, uuid in enumerate(ds[:, 0])}
# Compute splits of the collected pathway
splits = []
for train, test in ShuffleSplit(n_splits=n_splits, test_size=0.25, random_state=42).split(pathways):
train_pathways = [pathways[i] for i in train]
test_pathways = [pathways[i] for i in test]
# Collect structures from test pathways
test_educts = set()
for pathway in test_pathways:
for reaction in pathway.edges:
test_educts.update(reaction_to_educts[str(reaction.edge_label.uuid)])
split_ids = []
overlap = 0
# Collect indices of the structures contained in train pathways iff they're not present in any of
# the test pathways
for pathway in train_pathways:
for reaction in pathway.edges:
for educt in reaction_to_educts[str(reaction.edge_label.uuid)]:
# Ensure compounds in the training set do not appear in the test set
if educt not in test_educts:
if educt in id_to_index:
split_ids.append(id_to_index[str(educt)])
try:
split_ids.append(id_to_index[str(educt)])
except KeyError:
logger.debug(f"Couldn't find features in X for compound {educt}")
else:
overlap += 1
logging.debug(
f"{overlap} compounds had to be removed from multigen split due to overlap within pathways")
# Get the rows from the dataset corresponding to compounds in the training set pathways
split_x, split_y = X[split_ids], y[split_ids]
splits.append([(split_x, split_y), test_pathways])
# Build model on subsets obtained by pathway split
trained_models = Parallel(n_jobs=10)(
delayed(train_func)(split_x, split_y, np.arange(split_x.shape[0]), self._model_args()) for (split_x, split_y), _ in splits
)
# Parallelizing multigen evaluate would be non-trivial, potentially possible but requires a lot of work
multi_ret_vals = Parallel(n_jobs=1)(
delayed(evaluate_mg)(model, test_pathways, self.threshold) for model, (_, test_pathways) in
zip(trained_models, splits)
)
self.eval_results.update({f"multigen_{k}": v for k, v in compute_averages(multi_ret_vals).items()})
self.model_status = self.FINISHED
self.save()
@staticmethod @staticmethod
def combine_products_and_probs(rules: List['Rule'], probabilities, products): def combine_products_and_probs(rules: List['Rule'], probabilities, products):
res = [] res = []
@ -2011,21 +2290,22 @@ class RuleBasedRelativeReasoning(PackageBasedModel):
return rbrr return rbrr
def build_model(self): def _fit_model(self, ds: Dataset):
self.model_status = self.BUILDING X, y = ds.X(exclude_id_col=False, na_replacement=None), ds.y(na_replacement=None)
self.save() model = RelativeReasoning(
start_index= ds.triggered()[0],
end_index= ds.triggered()[1],
)
model.fit(X, y)
return model
def _model_args(self):
ds = self.load_dataset() ds = self.load_dataset()
labels = ds.y(na_replacement=None) return {
'clz': 'RuleBaseRelativeReasoning',
mod = RelativeReasoning(*ds.triggered()) 'start_index': ds.triggered()[0],
mod.fit(ds.X(exclude_id_col=False, na_replacement=None), ds.y(na_replacement=None)) 'end_index': ds.triggered()[1],
}
f = os.path.join(s.MODEL_DIR, f"{self.uuid}_mod.pkl")
joblib.dump(mod, f)
self.model_status = self.BUILT_NOT_EVALUATED
self.save()
@cached_property @cached_property
def model(self) -> 'RelativeReasoning': def model(self) -> 'RelativeReasoning':
@ -2038,7 +2318,6 @@ class RuleBasedRelativeReasoning(PackageBasedModel):
classify_ds, classify_prods = ds.classification_dataset([smiles], self.applicable_rules) classify_ds, classify_prods = ds.classification_dataset([smiles], self.applicable_rules)
mod = self.model mod = self.model
pred = mod.predict(classify_ds.X(exclude_id_col=False, na_replacement=None)) pred = mod.predict(classify_ds.X(exclude_id_col=False, na_replacement=None))
res = RuleBasedRelativeReasoning.combine_products_and_probs(self.applicable_rules, pred[0], classify_prods[0]) res = RuleBasedRelativeReasoning.combine_products_and_probs(self.applicable_rules, pred[0], classify_prods[0])
@ -2102,118 +2381,23 @@ class MLRelativeReasoning(PackageBasedModel):
return mlrr return mlrr
def build_model(self): def _fit_model(self, ds: Dataset):
self.model_status = self.BUILDING
self.save()
start = datetime.now()
ds = self.load_dataset()
X, y = ds.X(na_replacement=np.nan), ds.y(na_replacement=np.nan) X, y = ds.X(na_replacement=np.nan), ds.y(na_replacement=np.nan)
mod = EnsembleClassifierChain(
**s.DEFAULT_MODEL_PARAMS
)
mod.fit(X, y)
end = datetime.now()
logger.debug(f"fitting model took {(end - start).total_seconds()} seconds")
f = os.path.join(s.MODEL_DIR, f"{self.uuid}_mod.pkl")
joblib.dump(mod, f)
if self.app_domain is not None:
logger.debug("Building applicability domain...")
self.app_domain.build()
logger.debug("Done building applicability domain.")
self.model_status = self.BUILT_NOT_EVALUATED
self.save()
def evaluate_model(self):
if self.model_status != self.BUILT_NOT_EVALUATED:
raise ValueError(f"Can't evaluate a model in state {self.model_status}!")
self.model_status = self.EVALUATING
self.save()
ds = self.load_dataset()
X = np.array(ds.X(na_replacement=np.nan))
y = np.array(ds.y(na_replacement=np.nan))
n_splits = 20
shuff = ShuffleSplit(n_splits=n_splits, test_size=0.25, random_state=42)
def train_and_evaluate(X, y, train_index, test_index, threshold):
X_train, X_test = X[train_index], X[test_index]
y_train, y_test = y[train_index], y[test_index]
model = EnsembleClassifierChain( model = EnsembleClassifierChain(
**s.DEFAULT_MODEL_PARAMS **s.DEFAULT_MODEL_PARAMS
) )
model.fit(X_train, y_train) model.fit(X, y)
return model
y_pred = model.predict_proba(X_test)
y_thresholded = (y_pred >= threshold).astype(int)
# Flatten them to get rid of np.nan
y_test = np.asarray(y_test).flatten()
y_pred = np.asarray(y_pred).flatten()
y_thresholded = np.asarray(y_thresholded).flatten()
mask = ~np.isnan(y_test)
y_test_filtered = y_test[mask]
y_pred_filtered = y_pred[mask]
y_thresholded_filtered = y_thresholded[mask]
acc = jaccard_score(y_test_filtered, y_thresholded_filtered, zero_division=0)
prec, rec = dict(), dict()
for t in np.arange(0, 1.05, 0.05):
temp_thresholded = (y_pred_filtered >= t).astype(int)
prec[f"{t:.2f}"] = precision_score(y_test_filtered, temp_thresholded, zero_division=0)
rec[f"{t:.2f}"] = recall_score(y_test_filtered, temp_thresholded, zero_division=0)
return acc, prec, rec
from joblib import Parallel, delayed
ret_vals = Parallel(n_jobs=10)(
delayed(train_and_evaluate)(X, y, train_index, test_index, self.threshold)
for train_index, test_index in shuff.split(X)
)
def compute_averages(data):
num_items = len(data)
avg_first_item = sum(item[0] for item in data) / num_items
sum_dict2 = defaultdict(float)
sum_dict3 = defaultdict(float)
for _, dict2, dict3 in data:
for key in dict2:
sum_dict2[key] += dict2[key]
for key in dict3:
sum_dict3[key] += dict3[key]
avg_dict2 = {key: val / num_items for key, val in sum_dict2.items()}
avg_dict3 = {key: val / num_items for key, val in sum_dict3.items()}
def _model_args(self):
return { return {
"average_accuracy": float(avg_first_item), 'clz': 'MLRelativeReasoning',
"average_precision_per_threshold": avg_dict2, **s.DEFAULT_MODEL_PARAMS,
"average_recall_per_threshold": avg_dict3
} }
self.eval_results = compute_averages(ret_vals)
self.model_status = self.FINISHED
self.save()
@cached_property @cached_property
def model(self): def model(self) -> 'EnsembleClassifierChain':
mod = joblib.load(os.path.join(s.MODEL_DIR, f'{self.uuid}_mod.pkl')) mod = joblib.load(os.path.join(s.MODEL_DIR, f'{self.uuid}_mod.pkl'))
mod.base_clf.n_jobs = -1 mod.base_clf.n_jobs = -1
return mod return mod
@ -2230,24 +2414,6 @@ class MLRelativeReasoning(PackageBasedModel):
logger.info(f"Full predict took {(end - start).total_seconds()}s") logger.info(f"Full predict took {(end - start).total_seconds()}s")
return res return res
@property
def pr_curve(self):
if self.model_status != self.FINISHED:
raise ValueError(f"Expected {self.FINISHED} but model is in status {self.model_status}")
res = []
thresholds = self.eval_results['average_precision_per_threshold'].keys()
for t in thresholds:
res.append({
'precision': self.eval_results['average_precision_per_threshold'][t],
'recall': self.eval_results['average_recall_per_threshold'][t],
'threshold': float(t)
})
return res
class ApplicabilityDomain(EnviPathModel): class ApplicabilityDomain(EnviPathModel):
model = models.ForeignKey(MLRelativeReasoning, on_delete=models.CASCADE) model = models.ForeignKey(MLRelativeReasoning, on_delete=models.CASCADE)

View File

@ -1,6 +1,5 @@
import logging import logging
import os import os
import shutil
from django.conf import settings as s from django.conf import settings as s
from django.db import transaction from django.db import transaction
@ -35,4 +34,4 @@ def delete_epmodel_files(sender, instance, **kwargs):
for f in os.listdir(s.MODEL_DIR): for f in os.listdir(s.MODEL_DIR):
if f.startswith(mod_uuid): if f.startswith(mod_uuid):
logger.info(f"Deleting {os.path.join(s.MODEL_DIR, f)}") logger.info(f"Deleting {os.path.join(s.MODEL_DIR, f)}")
shutil.rmtree(os.path.join(s.MODEL_DIR, f)) os.remove(os.path.join(s.MODEL_DIR, f))

View File

@ -1,12 +1,10 @@
import logging import logging
from typing import Optional from typing import Optional
from celery.signals import worker_process_init
from celery import shared_task from celery import shared_task
from epdb.models import Pathway, Node, Edge, EPModel, Setting from epdb.models import Pathway, Node, Edge, EPModel, Setting
from epdb.logic import SPathway from epdb.logic import SPathway
from utilities.chem import FormatConverter
logger = logging.getLogger(__name__) logger = logging.getLogger(__name__)

View File

@ -294,7 +294,7 @@ def packages(request):
if hidden == 'import-legacy-package-json': if hidden == 'import-legacy-package-json':
pack = PackageManager.import_legacy_package(data, current_user) pack = PackageManager.import_legacy_package(data, current_user)
else: else:
pack = PackageManager.import_pacakge(data, current_user) pack = PackageManager.import_package(data, current_user)
return redirect(pack.url) return redirect(pack.url)
except UnicodeDecodeError: except UnicodeDecodeError:
@ -772,10 +772,13 @@ def package_model(request, package_uuid, model_uuid):
if hidden == 'delete': if hidden == 'delete':
current_model.delete() current_model.delete()
return redirect(current_package.url + '/model') return redirect(current_package.url + '/model')
elif hidden == 'evaluate':
from .tasks import evaluate_model
evaluate_model.delay(current_model.pk)
return redirect(current_model.url)
else: else:
return HttpResponseBadRequest() return HttpResponseBadRequest()
else: else:
name = request.POST.get('model-name', '').strip() name = request.POST.get('model-name', '').strip()
description = request.POST.get('model-description', '').strip() description = request.POST.get('model-description', '').strip()

File diff suppressed because it is too large Load Diff

File diff suppressed because it is too large Load Diff

File diff suppressed because one or more lines are too long

Binary file not shown.

Binary file not shown.

View File

@ -18,6 +18,7 @@ dependencies = [
"envipy-plugins", "envipy-plugins",
"epam-indigo>=1.30.1", "epam-indigo>=1.30.1",
"gunicorn>=23.0.0", "gunicorn>=23.0.0",
"networkx>=3.4.2",
"psycopg2-binary>=2.9.10", "psycopg2-binary>=2.9.10",
"python-dotenv>=1.1.0", "python-dotenv>=1.1.0",
"rdkit>=2025.3.2", "rdkit>=2025.3.2",

View File

@ -10,7 +10,7 @@
<h4 class="modal-title">Evaluate Model</h4> <h4 class="modal-title">Evaluate Model</h4>
</div> </div>
<div class="modal-body"> <div class="modal-body">
<form id="evaluate_model_form" accept-charset="UTF-8" action="{{ meta.current_package.url }}/model" <form id="evaluate_model_form" accept-charset="UTF-8" action="{{ current_object.url }}"
data-remote="true" method="post"> data-remote="true" method="post">
{% csrf_token %} {% csrf_token %}
<div class="jumbotron"> <div class="jumbotron">
@ -35,6 +35,7 @@
{% endif %} {% endif %}
{% endfor %} {% endfor %}
</select> </select>
<input type="hidden" name="hidden" value="evaluate">
</form> </form>
</div> </div>
<div class="modal-footer"> <div class="modal-footer">

View File

@ -5,7 +5,7 @@ from epdb.models import Compound, User, CompoundStructure
class CompoundTest(TestCase): class CompoundTest(TestCase):
fixtures = ["test_fixtures.json.gz"] fixtures = ["test_fixtures.jsonl.gz"]
def setUp(self): def setUp(self):
pass pass

View File

@ -7,7 +7,7 @@ from epdb.models import Compound, User, Reaction
class CopyTest(TestCase): class CopyTest(TestCase):
fixtures = ["test_fixtures.json.gz"] fixtures = ["test_fixtures.jsonl.gz"]
@classmethod @classmethod
def setUpClass(cls): def setUpClass(cls):

View File

@ -6,7 +6,7 @@ from utilities.ml import Dataset
class DatasetTest(TestCase): class DatasetTest(TestCase):
fixtures = ["test_fixtures.json.gz"] fixtures = ["test_fixtures.jsonl.gz"]
def setUp(self): def setUp(self):
self.cs1 = Compound.create( self.cs1 = Compound.create(

View File

@ -1,13 +1,14 @@
from django.test import TestCase from tempfile import TemporaryDirectory
import numpy as np
from django.test import TestCase from django.test import TestCase
from epdb.logic import PackageManager from epdb.logic import PackageManager
from epdb.models import User, MLRelativeReasoning, Package from epdb.models import User, MLRelativeReasoning, RuleBasedRelativeReasoning, Package
class ModelTest(TestCase): class ModelTest(TestCase):
fixtures = ["test_fixtures.json.gz"] fixtures = ["test_fixtures.jsonl.gz"]
@classmethod @classmethod
def setUpClass(cls): def setUpClass(cls):
@ -17,9 +18,10 @@ class ModelTest(TestCase):
cls.BBD_SUBSET = Package.objects.get(name='Fixtures') cls.BBD_SUBSET = Package.objects.get(name='Fixtures')
def test_smoke(self): def test_smoke(self):
with TemporaryDirectory() as tmpdir:
with self.settings(MODEL_DIR=tmpdir):
threshold = float(0.5) threshold = float(0.5)
# get Package objects from urls
rule_package_objs = [self.BBD_SUBSET] rule_package_objs = [self.BBD_SUBSET]
data_package_objs = [self.BBD_SUBSET] data_package_objs = [self.BBD_SUBSET]
eval_packages_objs = [] eval_packages_objs = []
@ -29,16 +31,42 @@ class ModelTest(TestCase):
rule_package_objs, rule_package_objs,
data_package_objs, data_package_objs,
eval_packages_objs, eval_packages_objs,
threshold, threshold=threshold,
'ECC - BBD - 0.5', name='ECC - BBD - 0.5',
'Created MLRelativeReasoning in Testcase', description='Created MLRelativeReasoning in Testcase',
) )
# mod = RuleBasedRelativeReasoning.create(
# self.package,
# rule_package_objs,
# data_package_objs,
# eval_packages_objs,
# threshold=threshold,
# min_count=5,
# max_count=0,
# name='ECC - BBD - 0.5',
# description='Created MLRelativeReasoning in Testcase',
# )
mod.build_dataset() mod.build_dataset()
mod.build_model() mod.build_model()
print("Model built!") mod.multigen_eval = True
mod.evaluate_model() mod.save()
print("Model Evaluated") # mod.evaluate_model()
results = mod.predict('CCN(CC)C(=O)C1=CC(=CC=C1)C') results = mod.predict('CCN(CC)C(=O)C1=CC(=CC=C1)C')
print(results)
products = dict()
for r in results:
for ps in r.product_sets:
products[tuple(sorted(ps.product_set))] = (r.rule.name, r.probability)
expected = {
('CC=O', 'CCNC(=O)C1=CC(C)=CC=C1'): ('bt0243-4301', np.float64(0.33333333333333337)),
('CC1=CC=CC(C(=O)O)=C1', 'CCNCC'): ('bt0430-4011', np.float64(0.25)),
}
self.assertEqual(products, expected)
# from pprint import pprint
# pprint(mod.eval_results)

137
tests/test_multigen_eval.py Normal file
View File

@ -0,0 +1,137 @@
import json
from django.test import TestCase
from networkx.utils.misc import graphs_equal
from epdb.logic import PackageManager, SPathway
from epdb.models import Pathway, User, Package
from utilities.ml import multigen_eval, pathway_edit_eval, graph_from_pathway
class MultiGenTest(TestCase):
fixtures = ["test_fixtures.jsonl.gz"]
@classmethod
def setUpClass(cls):
super(MultiGenTest, cls).setUpClass()
cls.user: 'User' = User.objects.get(username='anonymous')
cls.package: 'Package' = PackageManager.create_package(cls.user, 'Anon Test Package', 'No Desc')
cls.BBD_SUBSET: 'Package' = Package.objects.get(name='Fixtures')
def test_equal_pathways(self):
"""Test that two identical pathways return a precision and recall of 1.0"""
pathways = self.BBD_SUBSET.pathways.all()
for pathway in pathways:
if len(pathway.edge_set.all()) == 0: # Do not test pathways with no edges
continue
score, precision, recall = multigen_eval(pathway, pathway)
self.assertEqual(precision, 1.0, f"Precision should be one for identical pathways. "
f"Failed on pathway: {pathway.name}")
self.assertEqual(recall, 1.0, f"Recall should be one for identical pathways. "
f"Failed on pathway: {pathway.name}")
def test_intermediates(self):
"""Test that an intermediate can be correctly identified and the metrics are correctly adjusted"""
score, precision, recall, intermediates = multigen_eval(*self.intermediate_case(), return_intermediates=True)
self.assertEqual(len(intermediates), 1, "There should be 1 found intermediate")
self.assertEqual(precision, 1, "Precision should be 1")
self.assertEqual(recall, 1, "Recall should be 1")
def test_fp(self):
"""Test that a false-positive (extra compound) is correctly penalised"""
score, precision, recall = multigen_eval(*self.fp_case())
self.assertAlmostEqual(precision, 0.75, 3, "Precision should be 0.75")
self.assertEqual(recall, 1, "Recall should be 1")
def test_fn(self):
"""Test that a false-negative (missed compound) is correctly penalised"""
score, precision, recall = multigen_eval(*self.fn_case())
self.assertEqual(precision, 1, "Precision should be 1.0")
self.assertAlmostEqual(recall, 0.667, 3, "Recall should be 0.667")
def test_all(self):
"""Test an intermediate, false-positive and false-negative together"""
score, precision, recall, intermediates = multigen_eval(*self.all_case(), return_intermediates=True)
self.assertEqual(len(intermediates), 1, "There should be 1 found intermediate")
self.assertAlmostEqual(precision, 0.6, 3, "Precision should be 0.6")
self.assertAlmostEqual(recall, 0.75, 3, "Recall should be 0.75")
def test_shallow_pathway(self):
pathways = self.BBD_SUBSET.pathways.all()
for pathway in pathways:
pathway_name = pathway.name
if len(pathway.edge_set.all()) == 0: # Do not test pathways with no edges
continue
shallow_pathway = graph_from_pathway(SPathway.from_pathway(pathway))
pathway = graph_from_pathway(pathway)
if not graphs_equal(shallow_pathway, pathway):
print('\n\nS', shallow_pathway.adj)
print('\n\nPW', pathway.adj)
# print(shallow_pathway.nodes, pathway.nodes)
# print(shallow_pathway.graph, pathway.graph)
self.assertTrue(graphs_equal(shallow_pathway, pathway), f"Networkx graph from shallow pathway not "
f"equal to pathway for pathway {pathway.name}")
def test_graph_edit_eval(self):
"""Performs all the previous tests but with graph_edit_eval
Unlike multigen_eval, these test cases have not been hand verified"""
pathways = self.BBD_SUBSET.pathways.all()
for pathway in pathways:
if len(pathway.edge_set.all()) == 0: # Do not test pathways with no edges
continue
score = pathway_edit_eval(pathway, pathway)
self.assertEqual(score, 0.0, "Pathway edit distance should be zero for identical pathways. "
f"Failed on pathway: {pathway.name}")
inter_score = pathway_edit_eval(*self.intermediate_case())
self.assertAlmostEqual(inter_score, 1.75, 3, "Pathway edit distance failed on intermediate case")
fp_score = pathway_edit_eval(*self.fp_case())
self.assertAlmostEqual(fp_score, 1.25, 3, "Pathway edit distance failed on fp case")
fn_score = pathway_edit_eval(*self.fn_case())
self.assertAlmostEqual(fn_score, 1.25, 3, "Pathway edit distance failed on fn case")
all_score = pathway_edit_eval(*self.all_case())
self.assertAlmostEqual(all_score, 1.0, 3, "Pathway edit distance failed on all case")
def intermediate_case(self):
"""Create an example with an intermediate in the predicted pathway"""
true_pathway = Pathway.create(self.package, "CCO")
true_pathway.add_edge([true_pathway.root_nodes.all()[0]], [true_pathway.add_node("CC(=O)O", depth=1)])
pred_pathway = Pathway.create(self.package, "CCO")
pred_pathway.add_edge([pred_pathway.root_nodes.all()[0]],
[acetaldehyde := pred_pathway.add_node("CC=O", depth=1)])
pred_pathway.add_edge([acetaldehyde], [pred_pathway.add_node("CC(=O)O", depth=2)])
return true_pathway, pred_pathway
def fp_case(self):
"""Create an example with an extra compound in the predicted pathway"""
true_pathway = Pathway.create(self.package, "CCO")
true_pathway.add_edge([true_pathway.root_nodes.all()[0]],
[acetaldehyde := true_pathway.add_node("CC=O", depth=1)])
true_pathway.add_edge([acetaldehyde], [true_pathway.add_node("CC(=O)O", depth=2)])
pred_pathway = Pathway.create(self.package, "CCO")
pred_pathway.add_edge([pred_pathway.root_nodes.all()[0]],
[acetaldehyde := pred_pathway.add_node("CC=O", depth=1)])
pred_pathway.add_edge([acetaldehyde], [pred_pathway.add_node("CC(=O)O", depth=2)])
pred_pathway.add_edge([acetaldehyde], [pred_pathway.add_node("C", depth=2)])
return true_pathway, pred_pathway
def fn_case(self):
"""Create an example with a missing compound in the predicted pathway"""
true_pathway = Pathway.create(self.package, "CCO")
true_pathway.add_edge([true_pathway.root_nodes.all()[0]],
[acetaldehyde := true_pathway.add_node("CC=O", depth=1)])
true_pathway.add_edge([acetaldehyde], [true_pathway.add_node("CC(=O)O", depth=2)])
pred_pathway = Pathway.create(self.package, "CCO")
pred_pathway.add_edge([pred_pathway.root_nodes.all()[0]], [pred_pathway.add_node("CC=O", depth=1)])
return true_pathway, pred_pathway
def all_case(self):
"""Create an example with an intermediate, extra compound and missing compound"""
true_pathway = Pathway.create(self.package, "CCO")
true_pathway.add_edge([true_pathway.root_nodes.all()[0]],
[acetaldehyde := true_pathway.add_node("CC=O", depth=1)])
true_pathway.add_edge([acetaldehyde], [true_pathway.add_node("C", depth=2)])
true_pathway.add_edge([acetaldehyde], [true_pathway.add_node("CC(=O)O", depth=2)])
pred_pathway = Pathway.create(self.package, "CCO")
pred_pathway.add_edge([pred_pathway.root_nodes.all()[0]], [methane := pred_pathway.add_node("C", depth=1)])
pred_pathway.add_edge([methane], [true_pathway.add_node("CC=O", depth=2)])
pred_pathway.add_edge([methane], [true_pathway.add_node("c1ccccc1", depth=2)])
return true_pathway, pred_pathway

View File

@ -5,7 +5,7 @@ from epdb.models import Compound, User, Reaction, Rule
class ReactionTest(TestCase): class ReactionTest(TestCase):
fixtures = ["test_fixtures.json.gz"] fixtures = ["test_fixtures.jsonl.gz"]
@classmethod @classmethod
def setUpClass(cls): def setUpClass(cls):

View File

@ -5,10 +5,7 @@ from epdb.models import Rule, User
class RuleTest(TestCase): class RuleTest(TestCase):
fixtures = ["test_fixtures.json.gz"] fixtures = ["test_fixtures.jsonl.gz"]
def setUp(self):
pass
@classmethod @classmethod
def setUpClass(cls): def setUpClass(cls):

View File

@ -7,7 +7,7 @@ from epdb.models import User, SimpleAmbitRule
class SimpleAmbitRuleTest(TestCase): class SimpleAmbitRuleTest(TestCase):
fixtures = ["test_fixtures.json.gz"] fixtures = ["test_fixtures.jsonl.gz"]
@classmethod @classmethod
def setUpClass(cls): def setUpClass(cls):

View File

@ -183,7 +183,7 @@ class FormatConverter(object):
return smiles return smiles
@staticmethod @staticmethod
def standardize(smiles): def standardize(smiles, remove_stereo=False):
# Taken from https://bitsilla.com/blog/2021/06/standardizing-a-molecule-using-rdkit/ # Taken from https://bitsilla.com/blog/2021/06/standardizing-a-molecule-using-rdkit/
# follows the steps in # follows the steps in
# https://github.com/greglandrum/RSC_OpenScience_Standardization_202104/blob/main/MolStandardize%20pieces.ipynb # https://github.com/greglandrum/RSC_OpenScience_Standardization_202104/blob/main/MolStandardize%20pieces.ipynb
@ -208,6 +208,9 @@ class FormatConverter(object):
# te = rdMolStandardize.TautomerEnumerator() # idem # te = rdMolStandardize.TautomerEnumerator() # idem
# taut_uncharged_parent_clean_mol = te.Canonicalize(uncharged_parent_clean_mol) # taut_uncharged_parent_clean_mol = te.Canonicalize(uncharged_parent_clean_mol)
if remove_stereo:
Chem.RemoveStereochemistry(uncharged_parent_clean_mol)
return Chem.MolToSmiles(uncharged_parent_clean_mol, kekuleSmiles=True) return Chem.MolToSmiles(uncharged_parent_clean_mol, kekuleSmiles=True)
@staticmethod @staticmethod

View File

@ -919,7 +919,7 @@ class PackageImporter:
name=edge_data['name'], name=edge_data['name'],
description=edge_data['description'], description=edge_data['description'],
kv=edge_data.get('kv', {}), kv=edge_data.get('kv', {}),
edge_label=None # Will be set later edge_label=self._get_cached_object('Reaction', edge_data['edge_label']['uuid'])
) )
# Set aliases if present # Set aliases if present

View File

@ -1,12 +1,19 @@
from __future__ import annotations from __future__ import annotations
import copy
import numpy as np
from numpy.random import default_rng
from sklearn.dummy import DummyClassifier
from sklearn.tree import DecisionTreeClassifier
import logging import logging
from abc import ABC, abstractmethod from abc import ABC, abstractmethod
from collections import defaultdict from collections import defaultdict
from datetime import datetime from datetime import datetime
from typing import List, Dict, Set, Tuple from typing import List, Dict, Set, Tuple
import numpy as np import networkx as nx
from sklearn.base import BaseEstimator, ClassifierMixin from sklearn.base import BaseEstimator, ClassifierMixin
from sklearn.decomposition import PCA from sklearn.decomposition import PCA
from sklearn.ensemble import RandomForestClassifier from sklearn.ensemble import RandomForestClassifier
@ -22,61 +29,6 @@ from dataclasses import dataclass, field
from utilities.chem import FormatConverter, PredictionResult from utilities.chem import FormatConverter, PredictionResult
@dataclass
class SCompound:
smiles: str
uuid: str = field(default=None, compare=False, hash=False)
def __hash__(self):
if not hasattr(self, '_hash'):
self._hash = hash((
self.smiles
))
return self._hash
@dataclass
class SReaction:
educts: List[SCompound]
products: List[SCompound]
rule_uuid: SRule = field(default=None, compare=False, hash=False)
reaction_uuid: str = field(default=None, compare=False, hash=False)
def __hash__(self):
if not hasattr(self, '_hash'):
self._hash = hash((
tuple(sorted(self.educts, key=lambda x: x.smiles)),
tuple(sorted(self.products, key=lambda x: x.smiles)),
))
return self._hash
def __eq__(self, other):
if not isinstance(other, SReaction):
return NotImplemented
return (
sorted(self.educts, key=lambda x: x.smiles) == sorted(other.educts, key=lambda x: x.smiles) and
sorted(self.products, key=lambda x: x.smiles) == sorted(other.products, key=lambda x: x.smiles)
)
@dataclass
class SRule(ABC):
@abstractmethod
def apply(self):
pass
@dataclass
class SSimpleRule:
pass
@dataclass
class SParallelRule:
pass
class Dataset: class Dataset:
def __init__(self, columns: List[str], num_labels: int, data: List[List[str | int | float]] = None): def __init__(self, columns: List[str], num_labels: int, data: List[List[str | int | float]] = None):
@ -385,7 +337,7 @@ class SparseLabelECC(BaseEstimator, ClassifierMixin):
self.chains_ = [ClassifierChain(self.base_clf) for i in range(self.num_chains)] self.chains_ = [ClassifierChain(self.base_clf) for i in range(self.num_chains)]
for i, chain in enumerate(self.chains_): for i, chain in enumerate(self.chains_):
print(f"{datetime.now()} fitting {i + 1}/{self.num_chains}") logger.debug(f"{datetime.now()} fitting {i + 1}/{self.num_chains}")
chain.fit(X, y_reduced) chain.fit(X, y_reduced)
return self return self
@ -423,14 +375,6 @@ class SparseLabelECC(BaseEstimator, ClassifierMixin):
return accuracy_score(y_true, y_pred, sample_weight=sample_weight) return accuracy_score(y_true, y_pred, sample_weight=sample_weight)
import copy
import numpy as np
from sklearn.dummy import DummyClassifier
from sklearn.tree import DecisionTreeClassifier
class BinaryRelevance: class BinaryRelevance:
def __init__(self, baseline_clf): def __init__(self, baseline_clf):
self.clf = baseline_clf self.clf = baseline_clf
@ -483,7 +427,8 @@ class MissingValuesClassifierChain:
X = np.array(X) X = np.array(X)
Y = np.array(Y) Y = np.array(Y)
if self.permutation is None: if self.permutation is None:
self.permutation = np.random.permutation(len(Y[0])) rng = default_rng(42)
self.permutation = rng.permutation(len(Y[0]))
Y = Y[:, self.permutation] Y = Y[:, self.permutation]
@ -541,7 +486,7 @@ class EnsembleClassifierChain:
self.num_labels = len(Y[0]) self.num_labels = len(Y[0])
for p in range(self.num_chains): for p in range(self.num_chains):
print(f"{datetime.now()} fitting {p + 1}/{self.num_chains}") logger.debug(f"{datetime.now()} fitting {p + 1}/{self.num_chains}")
clf = MissingValuesClassifierChain(self.base_clf) clf = MissingValuesClassifierChain(self.base_clf)
clf.fit(X, Y) clf.fit(X, Y)
self.classifiers.append(clf) self.classifiers.append(clf)
@ -609,12 +554,22 @@ class RelativeReasoning:
def predict(self, X): def predict(self, X):
res = np.zeros((len(X), (self.end_index + 1 - self.start_index))) res = np.zeros((len(X), (self.end_index + 1 - self.start_index)))
# Loop through all instances
for inst_idx, inst in enumerate(X): for inst_idx, inst in enumerate(X):
# Loop through all "triggered" features
for i, t in enumerate(inst[self.start_index: self.end_index + 1]): for i, t in enumerate(inst[self.start_index: self.end_index + 1]):
# Set label
res[inst_idx][i] = t res[inst_idx][i] = t
# If we predict a 1, check if the rule gets dominated by another
if t: if t:
# Second loop to check other triggered rules
for i2, t2 in enumerate(inst[self.start_index: self.end_index + 1]): for i2, t2 in enumerate(inst[self.start_index: self.end_index + 1]):
if i != i2 and i2 in self.winmap.get(i, []) and X[t2]: if i != i2:
# Check if rule idx is in "dominated by" list
if i2 in self.winmap.get(i, []):
# if thatat rule also triggered, it dominated the current
# set label to 0
if X[inst_idx][i2]:
res[inst_idx][i] = 0 res[inst_idx][i] = 0
return res return res
@ -671,3 +626,259 @@ def tanimoto_distance(a: List[int], b: List[int]):
return 0.0 return 0.0
return 1 - (sum_c / (sum_a + sum_b - sum_c)) return 1 - (sum_c / (sum_a + sum_b - sum_c))
def graph_from_pathway(data):
"""Convert Pathway or SPathway to networkx"""
from epdb.models import Pathway
from epdb.logic import SPathway
graph = nx.DiGraph()
co2 = {"O=C=O", "C(=O)=O"} # We ignore CO2 for multigen evaluation
def get_edges():
if isinstance(data, Pathway):
return data.edges.all()
elif isinstance(data, SPathway):
return data.edges
else:
raise TypeError(f"Can't convert type {type(data)} to networkx for multigen eval")
def get_sources_targets():
if isinstance(data, Pathway):
return [n.node for n in edge.start_nodes.constrained_target.all()], [n.node for n in edge.end_nodes.constrained_target.all()]
elif isinstance(data, SPathway):
return edge.educts, edge.products
else:
raise TypeError(f"Can't convert type {type(data)} to networkx for multigen eval")
def get_smiles_depth(node):
if isinstance(data, Pathway):
return FormatConverter.standardize(node.default_node_label.smiles, True), node.depth
elif isinstance(data, SPathway):
return FormatConverter.standardize(node.smiles, True), node.depth
else:
raise TypeError(f"Can't convert type {type(data)} to networkx for multigen eval")
def get_probability():
try:
if isinstance(data, Pathway):
return edge.kv.get('probability')
elif isinstance(data, SPathway):
return edge.probability
else:
raise TypeError(f"Can't convert type {type(data)} to networkx for multigen eval")
except AttributeError:
return 1
root_smiles = {get_smiles_depth(n) for n in data.root_nodes}
for root, depth in root_smiles:
graph.add_node(root, depth=depth, smiles=root, root=True)
for edge in get_edges():
sources, targets = get_sources_targets()
probability = get_probability()
for source in sources:
source_smiles, source_depth = get_smiles_depth(source)
if source_smiles not in graph:
graph.add_node(source_smiles, depth=source_depth, smiles=source_smiles,
root=source_smiles in root_smiles)
else:
graph.nodes[source_smiles]["depth"] = min(source_depth, graph.nodes[source_smiles]["depth"])
for target in targets:
target_smiles, target_depth = get_smiles_depth(target)
if target_smiles not in graph and target_smiles not in co2:
graph.add_node(target_smiles, depth=target_depth, smiles=target_smiles,
root=target_smiles in root_smiles)
elif target_smiles not in co2:
graph.nodes[target_smiles]["depth"] = min(target_depth, graph.nodes[target_smiles]["depth"])
if target_smiles not in co2 and target_smiles != source_smiles:
graph.add_edge(source_smiles, target_smiles, probability=probability)
return graph
def get_shortest_path(pathway, in_start_node, in_end_node):
try:
pred = nx.shortest_path(pathway, source=in_start_node, target=in_end_node)
except nx.NetworkXNoPath:
return []
pred.remove(in_start_node)
pred.remove(in_end_node)
return pred
def set_pathway_eval_weight(pathway):
node_eval_weights = {}
for node in pathway.nodes:
# Scale score according to depth level
node_eval_weights[node] = 1 / (2 ** pathway.nodes[node]["depth"]) if pathway.nodes[node]["depth"] >= 0 else 0
return node_eval_weights
def get_depth_adjusted_pathway(data_pathway, pred_pathway, intermediates):
if len(intermediates) < 1:
return pred_pathway
root_nodes = pred_pathway.graph["root_nodes"]
for node in pred_pathway.nodes:
if node in root_nodes:
continue
if node in intermediates and node not in data_pathway:
pred_pathway.nodes[node]["depth"] = -99
else:
shortest_path_list = []
for root_node in root_nodes:
shortest_path_nodes = get_shortest_path(pred_pathway, root_node, node)
if shortest_path_nodes:
shortest_path_list.append(shortest_path_nodes)
if shortest_path_list:
shortest_path_nodes = min(shortest_path_list, key=len)
num_ints = sum(1 for shortest_path_node in shortest_path_nodes if
shortest_path_node in intermediates)
pred_pathway.nodes[node]["depth"] -= num_ints
return pred_pathway
def initialise_pathway(pathway):
"""Convert pathway to networkx graph for evaluation"""
pathway = graph_from_pathway(pathway)
pathway.graph["root_nodes"] = {n for n in pathway.nodes if pathway.nodes[n]["depth"] == 0}
pathway = get_pathway_with_depth(pathway)
return pathway
def get_pathway_with_depth(pathway):
"""Recalculates depths in the pathway.
Can fix incorrect depths from json parse if there were multiple nodes with the same SMILES at
different depths that got merged."""
current_depth = 0
for node in pathway.nodes:
if node in pathway.graph["root_nodes"]:
pathway.nodes[node]["depth"] = current_depth
else:
pathway.nodes[node]["depth"] = -99
while assign_next_depth(pathway, current_depth):
current_depth += 1
return pathway
def assign_next_depth(pathway, current_depth):
new_assigned_nodes = False
current_depth_nodes = {n for n in pathway.nodes if pathway.nodes[n]["depth"] == current_depth}
for node in current_depth_nodes:
successors = pathway.successors(node)
for s in successors:
if pathway.nodes[s]["depth"] < 0:
pathway.nodes[s]["depth"] = current_depth + 1
new_assigned_nodes = True
return new_assigned_nodes
def find_intermediates(data_pathway, pred_pathway):
"""Find any intermediate nodes in the predicted pathway"""
common_nodes = get_common_nodes(pred_pathway, data_pathway)
intermediates = set()
for node in common_nodes:
down_stream_nodes = data_pathway.successors(node)
for down_stream_node in down_stream_nodes:
if down_stream_node in pred_pathway:
all_ints = get_shortest_path(pred_pathway, node, down_stream_node)
intermediates.update(all_ints)
return intermediates
def get_common_nodes(pred_pathway, data_pathway):
"""A node is a common node if it is in both pathways and is either a root in both or not a root in both."""
common_nodes = set()
for node in data_pathway.nodes:
is_pathway_root_node = node in data_pathway.graph["root_nodes"]
is_this_root_node = node in pred_pathway.graph["root_nodes"]
if node in pred_pathway.nodes:
if is_pathway_root_node is False and is_this_root_node is False:
common_nodes.add(node)
elif is_pathway_root_node and is_this_root_node:
common_nodes.add(node)
return common_nodes
def prune_graph(graph, threshold):
"""
Removes edges with probability below the threshold, then keep the subgraph reachable from the root node.
"""
while True:
try:
cycle = nx.find_cycle(graph)
graph.remove_edge(*cycle[-1]) # Remove the last edge in the cycle
except nx.NetworkXNoCycle:
break
for u, v, data in list(graph.edges(data=True)): # Remove edges below threshold
if data["probability"] < threshold:
graph.remove_edge(u, v)
root_node = [n for n in graph.nodes if graph.nodes[n]["root"]][0]
reachable = nx.descendants(graph, root_node) # Get all reachable nodes from root
reachable.add(root_node)
for node in list(graph.nodes): # Remove nodes not reachable from root
if node not in reachable:
graph.remove_node(node)
def multigen_eval(data_pathway, pred_pathway, threshold=None, return_intermediates=False):
"""Compare two pathways for multi-gen evaluation.
It is assumed the smiles in both pathways have been standardised in the same manner."""
data_pathway = initialise_pathway(data_pathway)
pred_pathway = initialise_pathway(pred_pathway)
if threshold is not None:
prune_graph(pred_pathway, threshold)
intermediates = find_intermediates(data_pathway, pred_pathway)
if intermediates:
pred_pathway = get_depth_adjusted_pathway(data_pathway, pred_pathway, intermediates)
test_pathway_eval_weights = set_pathway_eval_weight(data_pathway)
pred_pathway_eval_weights = set_pathway_eval_weight(pred_pathway)
common_nodes = get_common_nodes(pred_pathway, data_pathway)
data_only_nodes = set(n for n in data_pathway.nodes if n not in common_nodes)
pred_only_nodes = set(n for n in pred_pathway.nodes if n not in common_nodes)
score_TP, score_FP, score_FN, final_score, precision, recall = 0.0, 0.0, 0.0, 0.0, 0.0, 0.0
for node in common_nodes:
if pred_pathway.nodes[node]["depth"] > 0:
score_TP += test_pathway_eval_weights[node]
for node in data_only_nodes:
if data_pathway.nodes[node]["depth"] > 0:
score_FN += test_pathway_eval_weights[node]
for node in pred_only_nodes:
if pred_pathway.nodes[node]["depth"] > 0:
score_FP += pred_pathway_eval_weights[node]
final_score = score_TP / denom if (denom := score_TP + score_FP + score_FN) > 0 else 0.0
precision = score_TP / denom if (denom := score_TP + score_FP) > 0 else 0.0
recall = score_TP / denom if (denom := score_TP + score_FN) > 0 else 0.0
if return_intermediates:
return final_score, precision, recall, intermediates
return final_score, precision, recall
def node_subst_cost(node1, node2):
if node1["smiles"] == node2["smiles"] and node1["depth"] == node2["depth"]:
return 0
return 1 / (2 ** max(node1["depth"], node2["depth"])) # Maybe could be min instead of max
def node_ins_del_cost(node):
return 1 / (2 ** node["depth"])
def pathway_edit_eval(data_pathway, pred_pathway):
"""Compute the graph edit distance for two pathways, a potential alternative to multigen_eval"""
data_pathway = initialise_pathway(data_pathway)
pred_pathway = initialise_pathway(pred_pathway)
roots = (list(data_pathway.graph["root_nodes"])[0], list(pred_pathway.graph["root_nodes"])[0])
return nx.graph_edit_distance(data_pathway, pred_pathway,
node_subst_cost=node_subst_cost, node_del_cost=node_ins_del_cost,
node_ins_cost=node_ins_del_cost, roots=roots)

2
uv.lock generated
View File

@ -557,6 +557,7 @@ dependencies = [
{ name = "envipy-plugins" }, { name = "envipy-plugins" },
{ name = "epam-indigo" }, { name = "epam-indigo" },
{ name = "gunicorn" }, { name = "gunicorn" },
{ name = "networkx" },
{ name = "psycopg2-binary" }, { name = "psycopg2-binary" },
{ name = "python-dotenv" }, { name = "python-dotenv" },
{ name = "rdkit" }, { name = "rdkit" },
@ -588,6 +589,7 @@ requires-dist = [
{ name = "epam-indigo", specifier = ">=1.30.1" }, { name = "epam-indigo", specifier = ">=1.30.1" },
{ name = "gunicorn", specifier = ">=23.0.0" }, { name = "gunicorn", specifier = ">=23.0.0" },
{ name = "msal", marker = "extra == 'ms-login'", specifier = ">=1.33.0" }, { name = "msal", marker = "extra == 'ms-login'", specifier = ">=1.33.0" },
{ name = "networkx", specifier = ">=3.4.2" },
{ name = "psycopg2-binary", specifier = ">=2.9.10" }, { name = "psycopg2-binary", specifier = ">=2.9.10" },
{ name = "python-dotenv", specifier = ">=1.1.0" }, { name = "python-dotenv", specifier = ">=1.1.0" },
{ name = "rdkit", specifier = ">=2025.3.2" }, { name = "rdkit", specifier = ">=2025.3.2" },