Basic System (#31)

Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#31
This commit is contained in:
2025-07-23 06:47:07 +12:00
parent 49e02ed97d
commit df896878f1
75 changed files with 3821 additions and 1429 deletions

View File

@ -1,263 +1,322 @@
{% extends "framework.html" %}
{% load static %}
{% load envipytags %}
{% block content %}
{% block action_modals %}
{% endblock action_modals %}
{% block action_modals %}
{% include "modals/objects/delete_model_modal.html" %}
{% endblock action_modals %}
<!-- Include required libs -->
<script src="https://d3js.org/d3.v5.min.js"></script>
<script src="https://cdn.jsdelivr.net/npm/c3@0.7.20/c3.min.js"></script>
<link href="https://cdn.jsdelivr.net/npm/c3@0.7.20/c3.min.css" rel="stylesheet">
<!-- Include required libs -->
<script src="https://d3js.org/d3.v5.min.js"></script>
<script src="https://cdn.jsdelivr.net/npm/c3@0.7.20/c3.min.js"></script>
<link href="https://cdn.jsdelivr.net/npm/c3@0.7.20/c3.min.css" rel="stylesheet">
<div class="panel-group" id="model-detail">
<div class="panel panel-default">
<div class="panel-heading" id="headingPanel" style="font-size:2rem;height: 46px">
{{ model.name }}
<div id="actionsButton"
style="float: right;font-weight: normal;font-size: medium;position: relative; top: 50%; transform: translateY(-50%);z-index:100;"
class="dropdown"><a href="#" class="dropdown-toggle" data-toggle="dropdown" role="button"
aria-haspopup="true" aria-expanded="false"><span
class="glyphicon glyphicon-wrench"></span> Actions <span class="caret"></span><span
style="padding-right:1em"></span></a>
<ul id="actionsList" class="dropdown-menu">
{% block actions %}
{% endblock %}
</ul>
</div>
</div>
<div class="panel-body">
<p> {{ model.description }} </p>
</div>
<!-- Predict Panel -->
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">
<a id="predict-smiles-link" data-toggle="collapse" data-parent="#model-detail"
href="#predict-smiles">Predict</a>
</h4>
</div>
<div id="predict-smiles" class="panel-collapse collapse in">
<div class="panel-body list-group-item">
<div class="input-group">
<input id="smiles-to-predict" type="text" class="form-control" placeholder="CCN(CC)C(=O)C1=CC(=CC=C1)C">
<span class="input-group-btn">
<button class="btn btn-default" type="submit" id="predict-button">Predict!</button>
</span>
<div class="panel-group" id="model-detail">
<div class="panel panel-default">
<div class="panel-heading" id="headingPanel" style="font-size:2rem;height: 46px">
{{ model.name }}
<div id="actionsButton"
style="float: right;font-weight: normal;font-size: medium;position: relative; top: 50%; transform: translateY(-50%);z-index:100;display: none;"
class="dropdown"><a href="#" class="dropdown-toggle" data-toggle="dropdown" role="button"
aria-haspopup="true" aria-expanded="false"><span
class="glyphicon glyphicon-wrench"></span> Actions <span class="caret"></span><span
style="padding-right:1em"></span></a>
<ul id="actionsList" class="dropdown-menu">
{% block actions %}
{% include "actions/objects/model.html" %}
{% endblock %}
</ul>
</div>
<div id="loading"></div>
<div id="predictResultTable"></div>
</div>
</div>
<!-- End Predict Panel -->
{% if model.model_status == 'FINISHED' %}
<!-- Single Gen Curve Panel -->
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">
<a id="sg-curve-link" data-toggle="collapse" data-parent="#model-detail"
href="#sg-curve">Predict</a>
</h4>
</div>
<div id="sg-curve" class="panel-collapse collapse in">
<div class="panel-body list-group-item">
<!-- Center container contents -->
<div class="container" style="display: flex;justify-content: center;">
<div id="sg-curve-plotdiv" class="chart">
<div id="sg-chart"></div>
<div class="panel-body">
<p> {{ model.description }} </p>
</div>
{% if model|classname == 'MLRelativeReasoning' %}
<!-- Rule Packages -->
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">
<a id="rule-package-link" data-toggle="collapse" data-parent="#model-detail"
href="#rule-package">Rule Packages</a>
</h4>
</div>
<div id="rule-package" class="panel-collapse collapse in">
<div class="panel-body list-group-item">
{% for p in model.rule_packages.all %}
<a class="list-group-item" href="{{ p.url }}">{{ p.name }}</a>
{% endfor %}
</div>
</div>
<!-- Reaction Packages -->
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">
<a id="reaction-package-link" data-toggle="collapse" data-parent="#model-detail"
href="#reaction-package">Rule Packages</a>
</h4>
</div>
<div id="reaction-package" class="panel-collapse collapse in">
<div class="panel-body list-group-item">
{% for p in model.data_packages.all %}
<a class="list-group-item" href="{{ p.url }}">{{ p.name }}</a>
{% endfor %}
</div>
</div>
{% if model.eval_packages.all|length > 0 %}
<!-- Eval Packages -->
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">
<a id="eval-package-link" data-toggle="collapse" data-parent="#model-detail"
href="#eval-package">Rule Packages</a>
</h4>
</div>
<div id="eval-package" class="panel-collapse collapse in">
<div class="panel-body list-group-item">
{% for p in model.eval_packages.all %}
<a class="list-group-item" href="{{ p.url }}">{{ p.name }}</a>
{% endfor %}
</div>
</div>
{% endif %}
<!-- Model Status -->
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">
<a id="model-status-link" data-toggle="collapse" data-parent="#model-detail"
href="#model-status">Model Status</a>
</h4>
</div>
<div id="model-status" class="panel-collapse collapse in">
<div class="panel-body list-group-item">
{{ model.status }}
</div>
</div>
{% endif %}
<!-- Predict Panel -->
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">
<a id="predict-smiles-link" data-toggle="collapse" data-parent="#model-detail"
href="#predict-smiles">Predict</a>
</h4>
</div>
</div>
<script>
$(function() {
if(!($('#sg-chart').length > 0)) {
return;
}
console.log($('#sg-chart').length)
//$('#sg-curve-plotdiv').empty();
<div id="predict-smiles" class="panel-collapse collapse in">
<div class="panel-body list-group-item">
<div class="input-group">
<input id="smiles-to-predict" type="text" class="form-control"
placeholder="CCN(CC)C(=O)C1=CC(=CC=C1)C">
<span class="input-group-btn">
<button class="btn btn-default" type="submit" id="predict-button">Predict!</button>
</span>
</div>
<div id="loading"></div>
<div id="predictResultTable"></div>
</div>
</div>
<!-- End Predict Panel -->
{% if model.model_status == 'FINISHED' %}
<!-- Single Gen Curve Panel -->
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">
<a id="sg-curve-link" data-toggle="collapse" data-parent="#model-detail"
href="#sg-curve">Precision Recall Curve</a>
</h4>
</div>
<div id="sg-curve" class="panel-collapse collapse in">
<div class="panel-body list-group-item">
<!-- Center container contents -->
<div class="container" style="display: flex;justify-content: center;">
<div id="sg-curve-plotdiv" class="chart">
<div id="sg-chart"></div>
</div>
</div>
var x = ['Recall'];
var y = ['Precision'];
var thres = ['threshold'];
</div>
</div>
<script>
$(function () {
if (!($('#sg-chart').length > 0)) {
return;
}
// Compare function for the given array
function compare(a, b) {
if (a.threshold < b.threshold)
var x = ['Recall'];
var y = ['Precision'];
var thres = ['threshold'];
// Compare function for the given array
function compare(a, b) {
if (a.threshold < b.threshold)
return -1;
else if (a.threshold > b.threshold)
return 1;
else
return 0;
}
function getIndexForValue(data, val, val_name) {
for (var idx in data) {
if (data[idx][val_name] == val) {
return idx;
}
}
return -1;
else if (a.threshold > b.threshold)
return 1;
else
return 0;
}
function getIndexForValue(data, val, val_name) {
for(var idx in data) {
if(data[idx][val_name] == val) {
return idx;
}
}
return -1;
}
var data = {{ model.pr_curve|safe }}
var dataLength = Object.keys(data).length;
data.sort(compare);
var data = {{ model.pr_curve|safe }}
var dataLength = Object.keys(data).length;
data.sort(compare);
for (var idx in data) {
var d = data[idx];
x.push(d.recall);
y.push(d.precision);
thres.push(d.threshold);
}
var chart = c3.generate({
bindto: '#sg-chart',
data: {
onclick: function (d, e) {
var idx = d.index;
var thresh = data[dataLength-idx-1].threshold;
for (var idx in data) {
var d = data[idx];
x.push(d.recall);
y.push(d.precision);
thres.push(d.threshold);
}
var chart = c3.generate({
bindto: '#sg-chart',
data: {
onclick: function (d, e) {
var idx = d.index;
var thresh = data[dataLength - idx - 1].threshold;
//onclick(thresh)
//onclick(thresh)
},
x: 'Recall',
y: 'Precision',
columns: [
x,
y,
//thres
]
},
size: {
height: 400, // TODO: Make variable to current modal width
width: 480
},
axis: {
x: {
max: 1,
min: 0,
label: 'Recall',
padding: 0,
tick: {
fit: true,
values: [0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0]
}
},
y: {
max: 1,
min: 0,
label: 'Precision',
padding: 0,
tick: {
fit: true,
values: [0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0]
}
}
},
point: {
r: 4
},
tooltip: {
format: {
title: function (recall) {
idx = getIndexForValue(data, recall, "recall");
if(idx != -1) {
return "Threshold: " + data[idx].threshold;
}
return "";
},
value: function (precision, ratio, id) {
return undefined;
x: 'Recall',
y: 'Precision',
columns: [
x,
y,
//thres
]
},
size: {
height: 400, // TODO: Make variable to current modal width
width: 480
},
axis: {
x: {
max: 1,
min: 0,
label: 'Recall',
padding: 0,
tick: {
fit: true,
values: [0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0]
}
},
y: {
max: 1,
min: 0,
label: 'Precision',
padding: 0,
tick: {
fit: true,
values: [0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0]
}
}
},
point: {
r: 4
},
tooltip: {
format: {
title: function (recall) {
idx = getIndexForValue(data, recall, "recall");
if (idx != -1) {
return "Threshold: " + data[idx].threshold;
}
return "";
},
value: function (precision, ratio, id) {
return undefined;
}
}
},
zoom: {
enabled: true
}
},
zoom: {
enabled: true
}
});
});
});
</script>
<!-- End Single Gen Curve Panel -->
{% endif %}
</script>
<!-- End Single Gen Curve Panel -->
{% endif %}
</div>
</div>
</div>
<script>
<script>
function handleResponse(data) {
res = "<table class='table table-striped'>"
res += "<thead>"
res += "<th scope='col'>#</th>"
function handleResponse(data) {
res = "<table class='table table-striped'>"
res += "<thead>"
res += "<th scope='col'>#</th>"
columns = ['products', 'image', 'probability', 'btrule']
columns = ['products', 'image', 'probability', 'btrule']
for(col in columns) {
res += "<th scope='col'>" + columns[col] + "</th>"
}
res += "</thead>"
res += "<tbody>"
var cnt = 1;
for(transformation in data) {
res += "<tr>"
res += "<th scope='row'>" + cnt + "</th>"
res += "<th scope='row'>" + data[transformation]['products'][0].join(', ') + "</th>"
res += "<th scope='row'>" + "<img width='400' src='{% url 'depict' %}?smiles=" + encodeURIComponent(data[transformation]['products'][0].join('.')) + "'></th>"
res += "<th scope='row'>" + data[transformation]['probability'].toFixed(3) + "</th>"
if (data[transformation]['btrule'] != null) {
res += "<th scope='row'>" + "<a href='" + data[transformation]['btrule']['url'] + "'>" + data[transformation]['btrule']['name'] + "</a>" + "</th>"
} else {
res += "<th scope='row'>N/A</th>"
}
res += "</tr>"
cnt += 1;
}
res += "</tbody>"
res += "</table>"
$("#predictResultTable").append(res);
}
function clear() {
$("#predictResultTable").removeClass("alert alert-danger");
$("#predictResultTable").empty();
}
if($('#predict-button').length > 0) {
$("#predict-button").on("click", function(e) {
e.preventDefault();
data = {
"smiles": $("#smiles-to-predict").val(),
"classify": "ILikeCats!"
for (col in columns) {
res += "<th scope='col'>" + columns[col] + "</th>"
}
clear();
res += "</thead>"
res += "<tbody>"
var cnt = 1;
for (transformation in data) {
res += "<tr>"
res += "<th scope='row'>" + cnt + "</th>"
res += "<th scope='row'>" + data[transformation]['products'][0].join(', ') + "</th>"
res += "<th scope='row'>" + "<img width='400' src='{% url 'depict' %}?smiles=" + encodeURIComponent(data[transformation]['products'][0].join('.')) + "'></th>"
res += "<th scope='row'>" + data[transformation]['probability'].toFixed(3) + "</th>"
if (data[transformation]['btrule'] != null) {
res += "<th scope='row'>" + "<a href='" + data[transformation]['btrule']['url'] + "'>" + data[transformation]['btrule']['name'] + "</a>" + "</th>"
} else {
res += "<th scope='row'>N/A</th>"
}
res += "</tr>"
cnt += 1;
}
makeLoadingGif("#loading", "{% static '/images/wait.gif' %}");
$.ajax({
type : 'get',
data : data,
url : '',
success: function(data, textStatus) {
try {
$("#loading").empty();
handleResponse(data);
} catch (error) {
console.log("Error");
res += "</tbody>"
res += "</table>"
$("#predictResultTable").append(res);
}
function clear() {
$("#predictResultTable").removeClass("alert alert-danger");
$("#predictResultTable").empty();
}
if ($('#predict-button').length > 0) {
$("#predict-button").on("click", function (e) {
e.preventDefault();
data = {
"smiles": $("#smiles-to-predict").val(),
"classify": "ILikeCats!"
}
clear();
makeLoadingGif("#loading", "{% static '/images/wait.gif' %}");
$.ajax({
type: 'get',
data: data,
url: '',
success: function (data, textStatus) {
try {
$("#loading").empty();
handleResponse(data);
} catch (error) {
console.log("Error");
$("#loading").empty();
$("#predictResultTable").addClass("alert alert-danger");
$("#predictResultTable").append("Error while processing request :/");
}
},
error: function (jqXHR, textStatus, errorThrown) {
$("#loading").empty();
$("#predictResultTable").addClass("alert alert-danger");
$("#predictResultTable").append("Error while processing request :/");
}
},
error : function(jqXHR, textStatus, errorThrown) {
$("#loading").empty();
$("#predictResultTable").addClass("alert alert-danger");
$("#predictResultTable").append("Error while processing request :/");
}
});
});
});
}
</script>
}
</script>
{% endblock content %}