24 Commits

Author SHA1 Message Date
9ec5e433ea test fixes 2025-11-07 08:46:28 +13:00
dddea79daf test fixes 2025-11-07 08:32:05 +13:00
cfd8d7440b Merge remote-tracking branch 'origin/develop' into enhancement/dataset
# Conflicts:
#	epdb/models.py
#	tests/test_enviformer.py
#	tests/test_model.py
2025-11-07 08:28:03 +13:00
6a5413b492 pyproject.toml update and merge from develop 2025-11-07 08:09:06 +13:00
8282855975 add compatibility with Descriptor objects. 2025-11-06 10:42:32 +13:00
09ddd46d69 app domain assess and assess_batch. Add threshold check for compatability 2025-11-06 10:32:21 +13:00
9f0e396437 ... 2025-11-05 13:30:03 +13:00
5dc4c822c4 simple implementation for other feature types #120 2025-11-05 13:11:40 +13:00
f1f7ce344c finished app domain conversion #120 2025-11-05 12:41:33 +13:00
98d62e1d1f [Feature] Make Matomo Site ID configurable via .env (#183)
Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#183
2025-11-05 10:19:07 +13:00
13af49488e starting on app domain with new dataset #120 2025-11-04 16:33:56 +13:00
ac5d370b18 new RuleBasedDataset and EnviFormer dataset working for respective models #120 2025-11-04 10:58:16 +13:00
ff51e48f90 work towards #120 2025-11-03 15:24:28 +13:00
13ed86a780 [Feature] Identify Missing Rules (#177)
Fixes #97
Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#177
2025-10-30 00:47:45 +13:00
f1b4c5aadb [Feature] Adding list_display to various django admin sites (#180)
Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#180
2025-10-29 22:26:28 +13:00
37e0e18a28 [Fix] Fixed Incremental Prediction Typo (#176)
Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#176
2025-10-28 23:29:08 +13:00
de44c22606 [Migration] Added missing Migration for JobLog (#175)
Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#175
2025-10-27 22:41:16 +13:00
a952c08469 [Feature] Basic logging of Jobs, Model Evaluation (#169)
Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#169
2025-10-27 22:34:05 +13:00
8166df6f39 work towards #120 2025-10-24 14:40:26 +13:00
551cfc7768 [Enhancement] Create ML Models (#173)
## Changes

- Ability to change the threshold from a command line argument.
- Names of data packages included in model name
- Names of data, rule and eval packages included in the model description
- EnviFormer models are now viewable on the admin site
- Ignore CO2 for training and evaluating EnviFormer

Co-authored-by: Liam Brydon <62733830+MyCreativityOutlet@users.noreply.github.com>
Reviewed-on: enviPath/enviPy#173
Reviewed-by: jebus <lorsbach@envipath.com>
Co-authored-by: liambrydon <lbry121@aucklanduni.ac.nz>
Co-committed-by: liambrydon <lbry121@aucklanduni.ac.nz>
2025-10-23 06:20:22 +13:00
8fda2577ee [Feature] Dump/Restore of enviFormer Models (#170)
Dump:
`./manage.py  dump_enviformer d544303c-a1ca-439d-b036-5e3413ce4a48 --output test.tar.gz`

Restore:
`./manage.py load_enviformer test.tar.gz 1062eb09-5ec7-4bdd-a8f2-ae0252eb4b06`

Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#170
2025-10-22 10:39:22 +13:00
2980a75daa start towards #120 2025-10-22 08:22:29 +13:00
819a94aced [Fix] Catch Exception for Adding Structures / Show PubChem Substances (#168)
Fixes #163
Fixes #165

Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#168
2025-10-22 01:13:06 +13:00
376fd65785 [Feature] ML model caching for reducing prediction overhead (#156)
The caching is now finished. The cache is created in `settings.py` giving us the most flexibility for using it in the future.

The cache is currently updated/accessed by `tasks.py/get_ml_model` which can be called from whatever task needs to access ml models in this way (currently, `predict` and `predict_simple`).

This implementation currently caches all ml models including the relative reasoning. If we don't want this and only want to cache enviFormer, i can change it to that. However, I don't think there is a harm in having the other models be cached as well.

Co-authored-by: Liam Brydon <62733830+MyCreativityOutlet@users.noreply.github.com>
Reviewed-on: enviPath/enviPy#156
Co-authored-by: liambrydon <lbry121@aucklanduni.ac.nz>
Co-committed-by: liambrydon <lbry121@aucklanduni.ac.nz>
2025-10-16 08:58:36 +13:00
33 changed files with 2006 additions and 785 deletions

View File

@ -16,3 +16,5 @@ POSTGRES_PORT=
# MAIL
EMAIL_HOST_USER=
EMAIL_HOST_PASSWORD=
# MATOMO
MATOMO_SITE_ID

View File

@ -357,3 +357,6 @@ if MS_ENTRA_ENABLED:
MS_ENTRA_AUTHORITY = f"https://login.microsoftonline.com/{MS_ENTRA_TENANT_ID}"
MS_ENTRA_REDIRECT_URI = os.environ["MS_REDIRECT_URI"]
MS_ENTRA_SCOPES = os.environ.get("MS_SCOPES", "").split(",")
# Site ID 10 -> beta.envipath.org
MATOMO_SITE_ID = os.environ.get("MATOMO_SITE_ID", "10")

View File

@ -7,6 +7,7 @@ from .models import (
GroupPackagePermission,
Package,
MLRelativeReasoning,
EnviFormer,
Compound,
CompoundStructure,
SimpleAmbitRule,
@ -19,11 +20,12 @@ from .models import (
Setting,
ExternalDatabase,
ExternalIdentifier,
JobLog,
)
class UserAdmin(admin.ModelAdmin):
pass
list_display = ["username", "email", "is_active"]
class UserPackagePermissionAdmin(admin.ModelAdmin):
@ -38,8 +40,14 @@ class GroupPackagePermissionAdmin(admin.ModelAdmin):
pass
class JobLogAdmin(admin.ModelAdmin):
pass
class EPAdmin(admin.ModelAdmin):
search_fields = ["name", "description"]
list_display = ["name", "url", "created"]
ordering = ["-created"]
class PackageAdmin(EPAdmin):
@ -50,6 +58,10 @@ class MLRelativeReasoningAdmin(EPAdmin):
pass
class EnviFormerAdmin(EPAdmin):
pass
class CompoundAdmin(EPAdmin):
pass
@ -102,8 +114,10 @@ admin.site.register(User, UserAdmin)
admin.site.register(UserPackagePermission, UserPackagePermissionAdmin)
admin.site.register(Group, GroupAdmin)
admin.site.register(GroupPackagePermission, GroupPackagePermissionAdmin)
admin.site.register(JobLog, JobLogAdmin)
admin.site.register(Package, PackageAdmin)
admin.site.register(MLRelativeReasoning, MLRelativeReasoningAdmin)
admin.site.register(EnviFormer, EnviFormerAdmin)
admin.site.register(Compound, CompoundAdmin)
admin.site.register(CompoundStructure, CompoundStructureAdmin)
admin.site.register(SimpleAmbitRule, SimpleAmbitRuleAdmin)

View File

@ -1542,9 +1542,7 @@ class SPathway(object):
if sub.app_domain_assessment is None:
if self.prediction_setting.model:
if self.prediction_setting.model.app_domain:
app_domain_assessment = self.prediction_setting.model.app_domain.assess(
sub.smiles
)[0]
app_domain_assessment = self.prediction_setting.model.app_domain.assess(sub.smiles)
if self.persist is not None:
n = self.snode_persist_lookup[sub]
@ -1576,11 +1574,7 @@ class SPathway(object):
app_domain_assessment = None
if self.prediction_setting.model:
if self.prediction_setting.model.app_domain:
app_domain_assessment = (
self.prediction_setting.model.app_domain.assess(c)[
0
]
)
app_domain_assessment = (self.prediction_setting.model.app_domain.assess(c))
self.smiles_to_node[c] = SNode(
c, sub.depth + 1, app_domain_assessment

View File

@ -7,10 +7,11 @@ from epdb.models import MLRelativeReasoning, EnviFormer, Package
class Command(BaseCommand):
"""This command can be run with
`python manage.py create_ml_models [model_names] -d [data_packages] OPTIONAL: -e [eval_packages]`
For example, to train both EnviFormer and MLRelativeReasoning on BBD and SOIL and evaluate them on SLUDGE
the below command would be used:
`python manage.py create_ml_models enviformer mlrr -d bbd soil -e sludge
`python manage.py create_ml_models [model_names] -d [data_packages] FOR MLRR ONLY: -r [rule_packages]
OPTIONAL: -e [eval_packages] -t threshold`
For example, to train both EnviFormer and MLRelativeReasoning on BBD and SOIL and evaluate them on SLUDGE with a
threshold of 0.6, the below command would be used:
`python manage.py create_ml_models enviformer mlrr -d bbd soil -e sludge -t 0.6
"""
def add_arguments(self, parser):
@ -34,6 +35,13 @@ class Command(BaseCommand):
help="Rule Packages mandatory for MLRR",
default=[],
)
parser.add_argument(
"-t",
"--threshold",
type=float,
help="Model prediction threshold",
default=0.5,
)
@transaction.atomic
def handle(self, *args, **options):
@ -67,7 +75,11 @@ class Command(BaseCommand):
return packages
# Iteratively create models in options["model_names"]
print(f"Creating models: {options['model_names']}")
print(f"Creating models: {options['model_names']}\n"
f"Data packages: {options['data_packages']}\n"
f"Rule Packages (only for MLRR): {options['rule_packages']}\n"
f"Eval Packages: {options['eval_packages']}\n"
f"Threshold: {options['threshold']:.2f}")
data_packages = decode_packages(options["data_packages"])
eval_packages = decode_packages(options["eval_packages"])
rule_packages = decode_packages(options["rule_packages"])
@ -78,9 +90,10 @@ class Command(BaseCommand):
pack,
data_packages=data_packages,
eval_packages=eval_packages,
threshold=0.5,
name="EnviFormer - T0.5",
description="EnviFormer transformer",
threshold=options['threshold'],
name=f"EnviFormer - {', '.join(options['data_packages'])} - T{options['threshold']:.2f}",
description=f"EnviFormer transformer trained on {options['data_packages']} "
f"evaluated on {options['eval_packages']}.",
)
elif model_name == "mlrr":
model = MLRelativeReasoning.create(
@ -88,9 +101,10 @@ class Command(BaseCommand):
rule_packages=rule_packages,
data_packages=data_packages,
eval_packages=eval_packages,
threshold=0.5,
name="ECC - BBD - T0.5",
description="ML Relative Reasoning",
threshold=options['threshold'],
name=f"ECC - {', '.join(options['data_packages'])} - T{options['threshold']:.2f}",
description=f"ML Relative Reasoning trained on {options['data_packages']} with rules from "
f"{options['rule_packages']} and evaluated on {options['eval_packages']}.",
)
else:
raise ValueError(f"Cannot create model of type {model_name}, unknown model type")
@ -100,6 +114,6 @@ class Command(BaseCommand):
print(f"Training {model_name}")
model.build_model()
print(f"Evaluating {model_name}")
model.evaluate_model()
model.evaluate_model(False, eval_packages=eval_packages)
print(f"Saving {model_name}")
model.save()

View File

@ -0,0 +1,59 @@
import json
import os
import tarfile
from tempfile import TemporaryDirectory
from django.conf import settings as s
from django.core.management.base import BaseCommand
from django.db import transaction
from epdb.models import EnviFormer
class Command(BaseCommand):
def add_arguments(self, parser):
parser.add_argument(
"model",
type=str,
help="Model UUID of the Model to Dump",
)
parser.add_argument("--output", type=str)
def package_dict_and_folder(self, dict_data, folder_path, output_path):
with TemporaryDirectory() as tmpdir:
dict_filename = os.path.join(tmpdir, "data.json")
with open(dict_filename, "w", encoding="utf-8") as f:
json.dump(dict_data, f, indent=2)
with tarfile.open(output_path, "w:gz") as tar:
tar.add(dict_filename, arcname="data.json")
tar.add(folder_path, arcname=os.path.basename(folder_path))
os.remove(dict_filename)
@transaction.atomic
def handle(self, *args, **options):
output = options["output"]
if os.path.exists(output):
raise ValueError(f"Output file {output} already exists")
model = EnviFormer.objects.get(uuid=options["model"])
data = {
"uuid": str(model.uuid),
"name": model.name,
"description": model.description,
"kv": model.kv,
"data_packages_uuids": [str(p.uuid) for p in model.data_packages.all()],
"eval_packages_uuids": [str(p.uuid) for p in model.data_packages.all()],
"threshold": model.threshold,
"eval_results": model.eval_results,
"multigen_eval": model.multigen_eval,
"model_status": model.model_status,
}
model_folder = os.path.join(s.MODEL_DIR, "enviformer", str(model.uuid))
self.package_dict_and_folder(data, model_folder, output)

View File

@ -0,0 +1,81 @@
import json
import os
import shutil
import tarfile
from tempfile import TemporaryDirectory
from django.conf import settings as s
from django.core.management.base import BaseCommand
from django.db import transaction
from epdb.models import EnviFormer, Package
class Command(BaseCommand):
def add_arguments(self, parser):
parser.add_argument(
"input",
type=str,
help=".tar.gz file containing the Model dump.",
)
parser.add_argument(
"package",
type=str,
help="Package UUID where the Model should be loaded to.",
)
def read_dict_and_folder_from_archive(self, archive_path, extract_to="extracted_folder"):
with tarfile.open(archive_path, "r:gz") as tar:
tar.extractall(extract_to)
dict_path = os.path.join(extract_to, "data.json")
if not os.path.exists(dict_path):
raise FileNotFoundError("data.json not found in the archive.")
with open(dict_path, "r", encoding="utf-8") as f:
data_dict = json.load(f)
extracted_items = os.listdir(extract_to)
folders = [item for item in extracted_items if item != "data.json"]
folder_path = os.path.join(extract_to, folders[0]) if folders else None
return data_dict, folder_path
@transaction.atomic
def handle(self, *args, **options):
if not os.path.exists(options["input"]):
raise ValueError(f"Input file {options['input']} does not exist.")
target_package = Package.objects.get(uuid=options["package"])
with TemporaryDirectory() as tmpdir:
data, folder = self.read_dict_and_folder_from_archive(options["input"], tmpdir)
model = EnviFormer()
model.package = target_package
# model.uuid = data["uuid"]
model.name = data["name"]
model.description = data["description"]
model.kv = data["kv"]
model.threshold = float(data["threshold"])
model.eval_results = data["eval_results"]
model.multigen_eval = data["multigen_eval"]
model.model_status = data["model_status"]
model.save()
for p_uuid in data["data_packages_uuids"]:
p = Package.objects.get(uuid=p_uuid)
model.data_packages.add(p)
for p_uuid in data["eval_packages_uuids"]:
p = Package.objects.get(uuid=p_uuid)
model.eval_packages.add(p)
target_folder = os.path.join(s.MODEL_DIR, "enviformer", str(model.uuid))
shutil.copytree(folder, target_folder)
os.rename(
os.path.join(s.MODEL_DIR, "enviformer", str(model.uuid), f"{data['uuid']}.ckpt"),
os.path.join(s.MODEL_DIR, "enviformer", str(model.uuid), f"{model.uuid}.ckpt"),
)

View File

@ -0,0 +1,38 @@
from datetime import date, timedelta
from django.core.management.base import BaseCommand
from django.db import transaction
from epdb.models import JobLog
class Command(BaseCommand):
def add_arguments(self, parser):
parser.add_argument(
"--cleanup",
type=int,
default=None,
help="Remove all logs older than this number of days. Default is None, which does not remove any logs.",
)
@transaction.atomic
def handle(self, *args, **options):
if options["cleanup"] is not None:
cleanup_dt = date.today() - timedelta(days=options["cleanup"])
print(JobLog.objects.filter(created__lt=cleanup_dt).delete())
logs = JobLog.objects.filter(status="INITIAL")
print(f"Found {logs.count()} logs to update")
updated = 0
for log in logs:
res = log.check_for_update()
if res:
updated += 1
print(f"Updated {updated} logs")
from django.db.models import Count
qs = JobLog.objects.values("status").annotate(total=Count("status"))
for r in qs:
print(r["status"], r["total"])

View File

@ -0,0 +1,66 @@
# Generated by Django 5.2.7 on 2025-10-27 09:39
import django.db.models.deletion
import django.utils.timezone
import model_utils.fields
from django.conf import settings
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
("epdb", "0008_enzymelink"),
]
operations = [
migrations.CreateModel(
name="JobLog",
fields=[
(
"id",
models.BigAutoField(
auto_created=True, primary_key=True, serialize=False, verbose_name="ID"
),
),
(
"created",
model_utils.fields.AutoCreatedField(
default=django.utils.timezone.now, editable=False, verbose_name="created"
),
),
(
"modified",
model_utils.fields.AutoLastModifiedField(
default=django.utils.timezone.now, editable=False, verbose_name="modified"
),
),
("task_id", models.UUIDField(unique=True)),
("job_name", models.TextField()),
(
"status",
models.CharField(
choices=[
("INITIAL", "Initial"),
("SUCCESS", "Success"),
("FAILURE", "Failure"),
("REVOKED", "Revoked"),
("IGNORED", "Ignored"),
],
default="INITIAL",
max_length=20,
),
),
("done_at", models.DateTimeField(blank=True, default=None, null=True)),
("task_result", models.TextField(blank=True, default=None, null=True)),
(
"user",
models.ForeignKey(
on_delete=django.db.models.deletion.CASCADE, to=settings.AUTH_USER_MODEL
),
),
],
options={
"abstract": False,
},
),
]

View File

@ -28,7 +28,8 @@ from sklearn.metrics import precision_score, recall_score, jaccard_score
from sklearn.model_selection import ShuffleSplit
from utilities.chem import FormatConverter, ProductSet, PredictionResult, IndigoUtils
from utilities.ml import Dataset, ApplicabilityDomainPCA, EnsembleClassifierChain, RelativeReasoning
from utilities.ml import RuleBasedDataset, ApplicabilityDomainPCA, EnsembleClassifierChain, RelativeReasoning, \
EnviFormerDataset, Dataset
logger = logging.getLogger(__name__)
@ -310,7 +311,7 @@ class ExternalDatabase(TimeStampedModel):
},
{
"database": ExternalDatabase.objects.get(name="ChEBI"),
"placeholder": "ChEBI ID without prefix e.g. 12345",
"placeholder": "ChEBI ID without prefix e.g. 10576",
},
],
"structure": [
@ -328,7 +329,7 @@ class ExternalDatabase(TimeStampedModel):
},
{
"database": ExternalDatabase.objects.get(name="ChEBI"),
"placeholder": "ChEBI ID without prefix e.g. 12345",
"placeholder": "ChEBI ID without prefix e.g. 10576",
},
],
"reaction": [
@ -342,7 +343,7 @@ class ExternalDatabase(TimeStampedModel):
},
{
"database": ExternalDatabase.objects.get(name="UniProt"),
"placeholder": "Query ID for UniPro e.g. rhea:12345",
"placeholder": "Query ID for UniProt e.g. rhea:12345",
},
],
}
@ -477,7 +478,7 @@ class ChemicalIdentifierMixin(ExternalIdentifierMixin):
return self.add_external_identifier("CAS", cas_number)
def get_pubchem_identifiers(self):
return self.get_external_identifier("PubChem Compound") or self.get_external_identifier(
return self.get_external_identifier("PubChem Compound") | self.get_external_identifier(
"PubChem Substance"
)
@ -2175,7 +2176,7 @@ class PackageBasedModel(EPModel):
applicable_rules = self.applicable_rules
reactions = list(self._get_reactions())
ds = Dataset.generate_dataset(reactions, applicable_rules, educts_only=True)
ds = RuleBasedDataset.generate_dataset(reactions, applicable_rules, educts_only=True)
end = datetime.now()
logger.debug(f"build_dataset took {(end - start).total_seconds()} seconds")
@ -2184,7 +2185,7 @@ class PackageBasedModel(EPModel):
ds.save(f)
return ds
def load_dataset(self) -> "Dataset":
def load_dataset(self) -> "Dataset | RuleBasedDataset | EnviFormerDataset":
ds_path = os.path.join(s.MODEL_DIR, f"{self.uuid}_ds.pkl")
return Dataset.load(ds_path)
@ -2225,10 +2226,18 @@ class PackageBasedModel(EPModel):
self.model_status = self.BUILT_NOT_EVALUATED
self.save()
def evaluate_model(self):
def evaluate_model(self, multigen: bool, eval_packages: List["Package"] = None, **kwargs):
if self.model_status != self.BUILT_NOT_EVALUATED:
raise ValueError(f"Can't evaluate a model in state {self.model_status}!")
if multigen:
self.multigen_eval = multigen
self.save()
if eval_packages is not None:
for p in eval_packages:
self.eval_packages.add(p)
self.model_status = self.EVALUATING
self.save()
@ -2335,37 +2344,37 @@ class PackageBasedModel(EPModel):
eval_reactions = list(
Reaction.objects.filter(package__in=self.eval_packages.all()).distinct()
)
ds = Dataset.generate_dataset(eval_reactions, self.applicable_rules, educts_only=True)
ds = RuleBasedDataset.generate_dataset(eval_reactions, self.applicable_rules, educts_only=True)
if isinstance(self, RuleBasedRelativeReasoning):
X = np.array(ds.X(exclude_id_col=False, na_replacement=None))
y = np.array(ds.y(na_replacement=np.nan))
X = ds.X(exclude_id_col=False, na_replacement=None).to_numpy()
y = ds.y(na_replacement=np.nan).to_numpy()
else:
X = np.array(ds.X(na_replacement=np.nan))
y = np.array(ds.y(na_replacement=np.nan))
X = ds.X(na_replacement=np.nan).to_numpy()
y = ds.y(na_replacement=np.nan).to_numpy()
single_gen_result = evaluate_sg(self.model, X, y, np.arange(len(X)), self.threshold)
self.eval_results = self.compute_averages([single_gen_result])
else:
ds = self.load_dataset()
if isinstance(self, RuleBasedRelativeReasoning):
X = np.array(ds.X(exclude_id_col=False, na_replacement=None))
y = np.array(ds.y(na_replacement=np.nan))
X = ds.X(exclude_id_col=False, na_replacement=None).to_numpy()
y = ds.y(na_replacement=np.nan).to_numpy()
else:
X = np.array(ds.X(na_replacement=np.nan))
y = np.array(ds.y(na_replacement=np.nan))
X = ds.X(na_replacement=np.nan).to_numpy()
y = ds.y(na_replacement=np.nan).to_numpy()
n_splits = 20
n_splits = kwargs.get("n_splits", 20)
shuff = ShuffleSplit(n_splits=n_splits, test_size=0.25, random_state=42)
splits = list(shuff.split(X))
from joblib import Parallel, delayed
models = Parallel(n_jobs=10)(
models = Parallel(n_jobs=min(10, len(splits)))(
delayed(train_func)(X, y, train_index, self._model_args())
for train_index, _ in splits
)
evaluations = Parallel(n_jobs=10)(
evaluations = Parallel(n_jobs=min(10, len(splits)))(
delayed(evaluate_sg)(model, X, y, test_index, self.threshold)
for model, (_, test_index) in zip(models, splits)
)
@ -2525,7 +2534,6 @@ class RuleBasedRelativeReasoning(PackageBasedModel):
package: "Package",
rule_packages: List["Package"],
data_packages: List["Package"],
eval_packages: List["Package"],
threshold: float = 0.5,
min_count: int = 10,
max_count: int = 0,
@ -2574,19 +2582,15 @@ class RuleBasedRelativeReasoning(PackageBasedModel):
for p in rule_packages:
rbrr.data_packages.add(p)
if eval_packages:
for p in eval_packages:
rbrr.eval_packages.add(p)
rbrr.save()
return rbrr
def _fit_model(self, ds: Dataset):
def _fit_model(self, ds: RuleBasedDataset):
X, y = ds.X(exclude_id_col=False, na_replacement=None), ds.y(na_replacement=None)
model = RelativeReasoning(
start_index=ds.triggered()[0],
end_index=ds.triggered()[1],
end_index=ds.triggered()[-1],
)
model.fit(X, y)
return model
@ -2596,7 +2600,7 @@ class RuleBasedRelativeReasoning(PackageBasedModel):
return {
"clz": "RuleBaseRelativeReasoning",
"start_index": ds.triggered()[0],
"end_index": ds.triggered()[1],
"end_index": ds.triggered()[-1],
}
def _save_model(self, model):
@ -2632,7 +2636,6 @@ class MLRelativeReasoning(PackageBasedModel):
package: "Package",
rule_packages: List["Package"],
data_packages: List["Package"],
eval_packages: List["Package"],
threshold: float = 0.5,
name: "str" = None,
description: str = None,
@ -2672,10 +2675,6 @@ class MLRelativeReasoning(PackageBasedModel):
for p in rule_packages:
mlrr.data_packages.add(p)
if eval_packages:
for p in eval_packages:
mlrr.eval_packages.add(p)
if build_app_domain:
ad = ApplicabilityDomain.create(
mlrr,
@ -2689,11 +2688,11 @@ class MLRelativeReasoning(PackageBasedModel):
return mlrr
def _fit_model(self, ds: Dataset):
def _fit_model(self, ds: RuleBasedDataset):
X, y = ds.X(na_replacement=np.nan), ds.y(na_replacement=np.nan)
model = EnsembleClassifierChain(**s.DEFAULT_MODEL_PARAMS)
model.fit(X, y)
model.fit(X.to_numpy(), y.to_numpy())
return model
def _model_args(self):
@ -2716,7 +2715,7 @@ class MLRelativeReasoning(PackageBasedModel):
start = datetime.now()
ds = self.load_dataset()
classify_ds, classify_prods = ds.classification_dataset([smiles], self.applicable_rules)
pred = self.model.predict_proba(classify_ds.X())
pred = self.model.predict_proba(classify_ds.X().to_numpy())
res = MLRelativeReasoning.combine_products_and_probs(
self.applicable_rules, pred[0], classify_prods[0]
@ -2761,7 +2760,9 @@ class ApplicabilityDomain(EnviPathModel):
@cached_property
def training_set_probs(self):
return joblib.load(os.path.join(s.MODEL_DIR, f"{self.model.uuid}_train_probs.pkl"))
ds = self.model.load_dataset()
col_ids = ds.block_indices("prob")
return ds[:, col_ids]
def build(self):
ds = self.model.load_dataset()
@ -2769,9 +2770,9 @@ class ApplicabilityDomain(EnviPathModel):
start = datetime.now()
# Get Trainingset probs and dump them as they're required when using the app domain
probs = self.model.model.predict_proba(ds.X())
f = os.path.join(s.MODEL_DIR, f"{self.model.uuid}_train_probs.pkl")
joblib.dump(probs, f)
probs = self.model.model.predict_proba(ds.X().to_numpy())
ds.add_probs(probs)
ds.save(os.path.join(s.MODEL_DIR, f"{self.model.uuid}_ds.pkl"))
ad = ApplicabilityDomainPCA(num_neighbours=self.num_neighbours)
ad.build(ds)
@ -2794,16 +2795,19 @@ class ApplicabilityDomain(EnviPathModel):
joblib.dump(ad, f)
def assess(self, structure: Union[str, "CompoundStructure"]):
return self.assess_batch([structure])[0]
def assess_batch(self, structures: List["CompoundStructure | str"]):
ds = self.model.load_dataset()
if isinstance(structure, CompoundStructure):
smiles = structure.smiles
smiles = []
for struct in structures:
if isinstance(struct, CompoundStructure):
smiles.append(structures.smiles)
else:
smiles = structure
smiles.append(structures)
assessment_ds, assessment_prods = ds.classification_dataset(
[structure], self.model.applicable_rules
)
assessment_ds, assessment_prods = ds.classification_dataset(structures, self.model.applicable_rules)
# qualified_neighbours_per_rule is a nested dictionary structured as:
# {
@ -2816,82 +2820,46 @@ class ApplicabilityDomain(EnviPathModel):
# it identifies all training structures that have the same trigger reaction activated (i.e., value 1).
# This is used to find "qualified neighbours" — training examples that share the same triggered feature
# with a given assessment structure under a particular rule.
qualified_neighbours_per_rule: Dict[int, Dict[int, List[int]]] = defaultdict(
lambda: defaultdict(list)
)
qualified_neighbours_per_rule: Dict = {}
for rule_idx, feature_index in enumerate(range(*assessment_ds.triggered())):
feature = ds.columns[feature_index]
if feature.startswith("trig_"):
# TODO unroll loop
for i, cx in enumerate(assessment_ds.X(exclude_id_col=False)):
if int(cx[feature_index]) == 1:
for j, tx in enumerate(ds.X(exclude_id_col=False)):
if int(tx[feature_index]) == 1:
qualified_neighbours_per_rule[i][rule_idx].append(j)
probs = self.training_set_probs
# preds = self.model.model.predict_proba(assessment_ds.X())
import polars as pl
# Select only the triggered columns
for i, row in enumerate(assessment_ds[:, assessment_ds.triggered()].iter_rows(named=True)):
# Find the rules the structure triggers. For each rule, filter the training dataset to rows that also
# trigger that rule.
train_trig = {trig_uuid.split("_")[-1]: ds.filter(pl.col(trig_uuid).eq(1))
for trig_uuid, value in row.items() if value == 1}
qualified_neighbours_per_rule[i] = train_trig
rule_to_i = {str(r.uuid): i for i, r in enumerate(self.model.applicable_rules)}
preds = self.model.combine_products_and_probs(
self.model.applicable_rules,
self.model.model.predict_proba(assessment_ds.X())[0],
self.model.model.predict_proba(assessment_ds.X().to_numpy())[0],
assessment_prods[0],
)
assessments = list()
# loop through our assessment dataset
for i, instance in enumerate(assessment_ds):
for i, instance in enumerate(assessment_ds[:, assessment_ds.struct_features()]):
rule_reliabilities = dict()
local_compatibilities = dict()
neighbours_per_rule = dict()
neighbor_probs_per_rule = dict()
# loop through rule indices together with the collected neighbours indices from train dataset
for rule_idx, vals in qualified_neighbours_per_rule[i].items():
# collect the train dataset instances and store it along with the index (a.k.a. row number) of the
# train dataset
train_instances = []
for v in vals:
train_instances.append((v, ds.at(v)))
# sf is a tuple with start/end index of the features
sf = ds.struct_features()
# compute tanimoto distance for all neighbours
# result ist a list of tuples with train index and computed distance
dists = self._compute_distances(
instance.X()[0][sf[0] : sf[1]],
[ti[1].X()[0][sf[0] : sf[1]] for ti in train_instances],
)
dists_with_index = list()
for ti, dist in zip(train_instances, dists):
dists_with_index.append((ti[0], dist[1]))
for rule_uuid, train_instances in qualified_neighbours_per_rule[i].items():
# compute tanimoto distance for all neighbours and add to dataset
dists = self._compute_distances(assessment_ds[i, assessment_ds.struct_features()].to_numpy()[0],
train_instances[:, train_instances.struct_features()].to_numpy())
train_instances = train_instances.with_columns(dist=pl.Series(dists))
# sort them in a descending way and take at most `self.num_neighbours`
dists_with_index = sorted(dists_with_index, key=lambda x: x[1], reverse=True)
dists_with_index = dists_with_index[: self.num_neighbours]
train_instances = train_instances.sort("dist", descending=True)[:self.num_neighbours]
# compute average distance
rule_reliabilities[rule_idx] = (
sum([d[1] for d in dists_with_index]) / len(dists_with_index)
if len(dists_with_index) > 0
else 0.0
)
rule_reliabilities[rule_uuid] = train_instances.select(pl.mean("dist")).fill_nan(0.0).item()
# for local_compatibility we'll need the datasets for the indices having the highest similarity
neighbour_datasets = [(d[0], ds.at(d[0])) for d in dists_with_index]
local_compatibilities[rule_idx] = self._compute_compatibility(
rule_idx, probs, neighbour_datasets
)
neighbours_per_rule[rule_idx] = [
CompoundStructure.objects.get(uuid=ds[1].structure_id())
for ds in neighbour_datasets
]
neighbor_probs_per_rule[rule_idx] = [
probs[d[0]][rule_idx] for d in dists_with_index
]
local_compatibilities[rule_uuid] = self._compute_compatibility(rule_uuid, train_instances)
neighbours_per_rule[rule_uuid] = list(CompoundStructure.objects.filter(uuid__in=train_instances["structure_id"]))
neighbor_probs_per_rule[rule_uuid] = train_instances[f"prob_{rule_uuid}"].to_list()
ad_res = {
"ad_params": {
@ -2902,23 +2870,21 @@ class ApplicabilityDomain(EnviPathModel):
"local_compatibility_threshold": self.local_compatibilty_threshold,
},
"assessment": {
"smiles": smiles,
"inside_app_domain": self.pca.is_applicable(instance)[0],
"smiles": smiles[i],
"inside_app_domain": self.pca.is_applicable(assessment_ds[i])[0],
},
}
transformations = list()
for rule_idx in rule_reliabilities.keys():
rule = Rule.objects.get(
uuid=instance.columns[instance.observed()[0] + rule_idx].replace("obs_", "")
)
for rule_uuid in rule_reliabilities.keys():
rule = Rule.objects.get(uuid=rule_uuid)
rule_data = rule.simple_json()
rule_data["image"] = f"{rule.url}?image=svg"
neighbors = []
for n, n_prob in zip(
neighbours_per_rule[rule_idx], neighbor_probs_per_rule[rule_idx]
neighbours_per_rule[rule_uuid], neighbor_probs_per_rule[rule_uuid]
):
neighbor = n.simple_json()
neighbor["image"] = f"{n.url}?image=svg"
@ -2935,14 +2901,14 @@ class ApplicabilityDomain(EnviPathModel):
transformation = {
"rule": rule_data,
"reliability": rule_reliabilities[rule_idx],
"reliability": rule_reliabilities[rule_uuid],
# We're setting it here to False, as we don't know whether "assess" is called during pathway
# prediction or from Model Page. For persisted Nodes this field will be overwritten at runtime
"is_predicted": False,
"local_compatibility": local_compatibilities[rule_idx],
"probability": preds[rule_idx].probability,
"local_compatibility": local_compatibilities[rule_uuid],
"probability": preds[rule_to_i[rule_uuid]].probability,
"transformation_products": [
x.product_set for x in preds[rule_idx].product_sets
x.product_set for x in preds[rule_to_i[rule_uuid]].product_sets
],
"times_triggered": ds.times_triggered(str(rule.uuid)),
"neighbors": neighbors,
@ -2960,32 +2926,21 @@ class ApplicabilityDomain(EnviPathModel):
def _compute_distances(classify_instance: List[int], train_instances: List[List[int]]):
from utilities.ml import tanimoto_distance
distances = [
(i, tanimoto_distance(classify_instance, train))
for i, train in enumerate(train_instances)
]
distances = [tanimoto_distance(classify_instance, train) for train in train_instances]
return distances
@staticmethod
def _compute_compatibility(rule_idx: int, preds, neighbours: List[Tuple[int, "Dataset"]]):
tp, tn, fp, fn = 0.0, 0.0, 0.0, 0.0
def _compute_compatibility(self, rule_idx: int, neighbours: "RuleBasedDataset"):
accuracy = 0.0
for n in neighbours:
obs = n[1].y()[0][rule_idx]
pred = preds[n[0]][rule_idx]
if obs and pred:
tp += 1
elif not obs and pred:
fp += 1
elif obs and not pred:
fn += 1
else:
tn += 1
# Jaccard Index
import polars as pl
obs_pred = neighbours.select(obs=pl.col(f"obs_{rule_idx}").cast(pl.Boolean),
pred=pl.col(f"prob_{rule_idx}") >= self.model.threshold)
# Compute tp, tn, fp, fn using polars expressions
tp = obs_pred.filter((pl.col("obs")) & (pl.col("pred"))).height
tn = obs_pred.filter((~pl.col("obs")) & (~pl.col("pred"))).height
fp = obs_pred.filter((~pl.col("obs")) & (pl.col("pred"))).height
fn = obs_pred.filter((pl.col("obs")) & (~pl.col("pred"))).height
if tp + tn > 0.0:
accuracy = (tp + tn) / (tp + tn + fp + fn)
return accuracy
@ -2995,7 +2950,6 @@ class EnviFormer(PackageBasedModel):
def create(
package: "Package",
data_packages: List["Package"],
eval_packages: List["Package"],
threshold: float = 0.5,
name: "str" = None,
description: str = None,
@ -3028,10 +2982,6 @@ class EnviFormer(PackageBasedModel):
for p in data_packages:
mod.data_packages.add(p)
if eval_packages:
for p in eval_packages:
mod.eval_packages.add(p)
# if build_app_domain:
# ad = ApplicabilityDomain.create(mod, app_domain_num_neighbours, app_domain_reliability_threshold,
# app_domain_local_compatibility_threshold)
@ -3045,7 +2995,8 @@ class EnviFormer(PackageBasedModel):
from enviformer import load
ckpt = os.path.join(s.MODEL_DIR, "enviformer", str(self.uuid), f"{self.uuid}.ckpt")
return load(device=s.ENVIFORMER_DEVICE, ckpt_path=ckpt)
mod = load(device=s.ENVIFORMER_DEVICE, ckpt_path=ckpt)
return mod
def predict(self, smiles) -> List["PredictionResult"]:
return self.predict_batch([smiles])[0]
@ -3059,8 +3010,12 @@ class EnviFormer(PackageBasedModel):
for smiles in smiles_list
]
logger.info(f"Submitting {canon_smiles} to {self.name}")
start = datetime.now()
products_list = self.model.predict_batch(canon_smiles)
logger.info(f"Got results {products_list}")
end = datetime.now()
logger.info(
f"Prediction took {(end - start).total_seconds():.2f} seconds. Got results {products_list}"
)
results = []
for products in products_list:
@ -3086,42 +3041,24 @@ class EnviFormer(PackageBasedModel):
self.save()
start = datetime.now()
# Standardise reactions for the training data, EnviFormer ignores stereochemistry currently
ds = []
for reaction in self._get_reactions():
educts = ".".join(
[
FormatConverter.standardize(smile.smiles, remove_stereo=True)
for smile in reaction.educts.all()
]
)
products = ".".join(
[
FormatConverter.standardize(smile.smiles, remove_stereo=True)
for smile in reaction.products.all()
]
)
ds.append(f"{educts}>>{products}")
ds = EnviFormerDataset.generate_dataset(self._get_reactions())
end = datetime.now()
logger.debug(f"build_dataset took {(end - start).total_seconds()} seconds")
f = os.path.join(s.MODEL_DIR, f"{self.uuid}_ds.json")
with open(f, "w") as d_file:
json.dump(ds, d_file)
ds.save(f)
return ds
def load_dataset(self) -> "Dataset":
def load_dataset(self):
ds_path = os.path.join(s.MODEL_DIR, f"{self.uuid}_ds.json")
with open(ds_path) as d_file:
ds = json.load(d_file)
return ds
return EnviFormerDataset.load(ds_path)
def _fit_model(self, ds):
# Call to enviFormer's fine_tune function and return the model
from enviformer.finetune import fine_tune
start = datetime.now()
model = fine_tune(ds, s.MODEL_DIR, str(self.uuid), device=s.ENVIFORMER_DEVICE)
model = fine_tune(ds.X(), ds.y(), s.MODEL_DIR, str(self.uuid), device=s.ENVIFORMER_DEVICE)
end = datetime.now()
logger.debug(f"EnviFormer finetuning took {(end - start).total_seconds():.2f} seconds")
return model
@ -3137,28 +3074,35 @@ class EnviFormer(PackageBasedModel):
args = {"clz": "EnviFormer"}
return args
def evaluate_model(self):
def evaluate_model(self, multigen: bool, eval_packages: List["Package"] = None, **kwargs):
if self.model_status != self.BUILT_NOT_EVALUATED:
raise ValueError(f"Can't evaluate a model in state {self.model_status}!")
if multigen:
self.multigen_eval = multigen
self.save()
if eval_packages is not None:
for p in eval_packages:
self.eval_packages.add(p)
self.model_status = self.EVALUATING
self.save()
def evaluate_sg(test_reactions, predictions, model_thresh):
def evaluate_sg(test_ds, predictions, model_thresh):
# Group the true products of reactions with the same reactant together
assert len(test_ds) == len(predictions)
true_dict = {}
for r in test_reactions:
reactant, true_product_set = r.split(">>")
for r in test_ds:
reactant, true_product_set = r
true_product_set = {p for p in true_product_set.split(".")}
true_dict[reactant] = true_dict.setdefault(reactant, []) + [true_product_set]
assert len(test_reactions) == len(predictions)
assert sum(len(v) for v in true_dict.values()) == len(test_reactions)
# Group the predicted products of reactions with the same reactant together
pred_dict = {}
for k, pred in enumerate(predictions):
pred_smiles, pred_proba = zip(*pred.items())
reactant, true_product = test_reactions[k].split(">>")
reactant, true_product = test_ds[k, "educts"], test_ds[k, "products"]
pred_dict.setdefault(reactant, {"predict": [], "scores": []})
for smiles, proba in zip(pred_smiles, pred_proba):
smiles = set(smiles.split("."))
@ -3193,7 +3137,7 @@ class EnviFormer(PackageBasedModel):
break
# Recall is TP (correct) / TP + FN (len(test_reactions))
rec = {f"{k:.2f}": v / len(test_reactions) for k, v in correct.items()}
rec = {f"{k:.2f}": v / len(test_ds) for k, v in correct.items()}
# Precision is TP (correct) / TP + FP (predicted)
prec = {
f"{k:.2f}": v / predicted[k] if predicted[k] > 0 else 0 for k, v in correct.items()
@ -3272,47 +3216,32 @@ class EnviFormer(PackageBasedModel):
# If there are eval packages perform single generation evaluation on them instead of random splits
if self.eval_packages.count() > 0:
ds = []
for reaction in Reaction.objects.filter(
package__in=self.eval_packages.all()
).distinct():
educts = ".".join(
[
FormatConverter.standardize(smile.smiles, remove_stereo=True)
for smile in reaction.educts.all()
]
)
products = ".".join(
[
FormatConverter.standardize(smile.smiles, remove_stereo=True)
for smile in reaction.products.all()
]
)
ds.append(f"{educts}>>{products}")
test_result = self.model.predict_batch([smirk.split(">>")[0] for smirk in ds])
ds = EnviFormerDataset.generate_dataset(Reaction.objects.filter(
package__in=self.eval_packages.all()).distinct())
test_result = self.model.predict_batch(ds.X())
single_gen_result = evaluate_sg(ds, test_result, self.threshold)
self.eval_results = self.compute_averages([single_gen_result])
else:
from enviformer.finetune import fine_tune
ds = self.load_dataset()
n_splits = 20
shuff = ShuffleSplit(n_splits=n_splits, test_size=0.25, random_state=42)
n_splits = kwargs.get("n_splits", 20)
shuff = ShuffleSplit(n_splits=n_splits, test_size=0.1, random_state=42)
# Single gen eval is done in one loop of train then evaluate rather than storing all n_splits trained models
# this helps reduce the memory footprint.
single_gen_results = []
for split_id, (train_index, test_index) in enumerate(shuff.split(ds)):
train = [ds[i] for i in train_index]
test = [ds[i] for i in test_index]
train = ds[train_index]
test = ds[test_index]
start = datetime.now()
model = fine_tune(train, s.MODEL_DIR, str(split_id), device=s.ENVIFORMER_DEVICE)
model = fine_tune(train.X(), train.y(), s.MODEL_DIR, str(split_id), device=s.ENVIFORMER_DEVICE)
end = datetime.now()
logger.debug(
f"EnviFormer finetuning took {(end - start).total_seconds():.2f} seconds"
)
model.to(s.ENVIFORMER_DEVICE)
test_result = model.predict_batch([smirk.split(">>")[0] for smirk in test])
test_result = model.predict_batch(test.X())
single_gen_results.append(evaluate_sg(test, test_result, self.threshold))
self.eval_results = self.compute_averages(single_gen_results)
@ -3365,7 +3294,7 @@ class EnviFormer(PackageBasedModel):
# Compute splits of the collected pathway and evaluate. Like single gen we train and evaluate in each
# iteration instead of storing all trained models.
for split_id, (train, test) in enumerate(
ShuffleSplit(n_splits=n_splits, test_size=0.25, random_state=42).split(pathways)
ShuffleSplit(n_splits=n_splits, test_size=0.1, random_state=42).split(pathways)
):
train_pathways = [pathways[i] for i in train]
test_pathways = [pathways[i] for i in test]
@ -3383,31 +3312,15 @@ class EnviFormer(PackageBasedModel):
for pathway in train_pathways:
for reaction in pathway.edges:
reaction = reaction.edge_label
if any(
[
educt in test_educts
for educt in reaction_to_educts[str(reaction.uuid)]
]
):
if any([educt in test_educts for educt in reaction_to_educts[str(reaction.uuid)]]):
overlap += 1
continue
educts = ".".join(
[
FormatConverter.standardize(smile.smiles, remove_stereo=True)
for smile in reaction.educts.all()
]
)
products = ".".join(
[
FormatConverter.standardize(smile.smiles, remove_stereo=True)
for smile in reaction.products.all()
]
)
train_reactions.append(f"{educts}>>{products}")
train_reactions.append(reaction)
train_ds = EnviFormerDataset.generate_dataset(train_reactions)
logging.debug(
f"{overlap} compounds had to be removed from multigen split due to overlap within pathways"
)
model = fine_tune(train_reactions, s.MODEL_DIR, f"mg_{split_id}")
model = fine_tune(train_ds.X(), train_ds.y(), s.MODEL_DIR, f"mg_{split_id}")
multi_gen_results.append(evaluate_mg(model, test_pathways, self.threshold))
self.eval_results.update(
@ -3664,3 +3577,53 @@ class Setting(EnviPathModel):
self.public = True
self.global_default = True
self.save()
class JobLogStatus(models.TextChoices):
INITIAL = "INITIAL", "Initial"
SUCCESS = "SUCCESS", "Success"
FAILURE = "FAILURE", "Failure"
REVOKED = "REVOKED", "Revoked"
IGNORED = "IGNORED", "Ignored"
class JobLog(TimeStampedModel):
user = models.ForeignKey("epdb.User", models.CASCADE)
task_id = models.UUIDField(unique=True)
job_name = models.TextField(null=False, blank=False)
status = models.CharField(
max_length=20,
choices=JobLogStatus.choices,
default=JobLogStatus.INITIAL,
)
done_at = models.DateTimeField(null=True, blank=True, default=None)
task_result = models.TextField(null=True, blank=True, default=None)
def check_for_update(self):
async_res = self.get_result()
new_status = async_res.state
TERMINAL_STATES = [
"SUCCESS",
"FAILURE",
"REVOKED",
"IGNORED",
]
if new_status != self.status and new_status in TERMINAL_STATES:
self.status = new_status
self.done_at = async_res.date_done
if new_status == "SUCCESS":
self.task_result = async_res.result
self.save()
return True
return False
def get_result(self):
from celery.result import AsyncResult
return AsyncResult(str(self.task_id))

View File

@ -1,12 +1,58 @@
import csv
import io
import logging
from typing import Optional
from datetime import datetime
from typing import Any, Callable, List, Optional
from uuid import uuid4
from celery import shared_task
from epdb.models import Pathway, Node, EPModel, Setting
from epdb.logic import SPathway
from celery.utils.functional import LRUCache
from epdb.logic import SPathway
from epdb.models import EPModel, JobLog, Node, Package, Pathway, Rule, Setting, User, Edge
logger = logging.getLogger(__name__)
ML_CACHE = LRUCache(3) # Cache the three most recent ML models to reduce load times.
def get_ml_model(model_pk: int):
if model_pk not in ML_CACHE:
ML_CACHE[model_pk] = EPModel.objects.get(id=model_pk)
return ML_CACHE[model_pk]
def dispatch_eager(user: "User", job: Callable, *args, **kwargs):
try:
x = job(*args, **kwargs)
log = JobLog()
log.user = user
log.task_id = uuid4()
log.job_name = job.__name__
log.status = "SUCCESS"
log.done_at = datetime.now()
log.task_result = str(x) if x else None
log.save()
return x
except Exception as e:
logger.exception(e)
raise e
def dispatch(user: "User", job: Callable, *args, **kwargs):
try:
x = job.delay(*args, **kwargs)
log = JobLog()
log.user = user
log.task_id = x.task_id
log.job_name = job.__name__
log.status = "INITIAL"
log.save()
return x.result
except Exception as e:
logger.exception(e)
raise e
@shared_task(queue="background")
@ -16,7 +62,7 @@ def mul(a, b):
@shared_task(queue="predict")
def predict_simple(model_pk: int, smiles: str):
mod = EPModel.objects.get(id=model_pk)
mod = get_ml_model(model_pk)
res = mod.predict(smiles)
return res
@ -26,17 +72,55 @@ def send_registration_mail(user_pk: int):
pass
@shared_task(queue="model")
def build_model(model_pk: int):
@shared_task(bind=True, queue="model")
def build_model(self, model_pk: int):
mod = EPModel.objects.get(id=model_pk)
if JobLog.objects.filter(task_id=self.request.id).exists():
JobLog.objects.filter(task_id=self.request.id).update(status="RUNNING", task_result=mod.url)
try:
mod.build_dataset()
mod.build_model()
except Exception as e:
if JobLog.objects.filter(task_id=self.request.id).exists():
JobLog.objects.filter(task_id=self.request.id).update(
status="FAILED", task_result=mod.url
)
raise e
if JobLog.objects.filter(task_id=self.request.id).exists():
JobLog.objects.filter(task_id=self.request.id).update(status="SUCCESS", task_result=mod.url)
return mod.url
@shared_task(queue="model")
def evaluate_model(model_pk: int):
@shared_task(bind=True, queue="model")
def evaluate_model(self, model_pk: int, multigen: bool, package_pks: Optional[list] = None):
packages = None
if package_pks:
packages = Package.objects.filter(pk__in=package_pks)
mod = EPModel.objects.get(id=model_pk)
mod.evaluate_model()
if JobLog.objects.filter(task_id=self.request.id).exists():
JobLog.objects.filter(task_id=self.request.id).update(status="RUNNING", task_result=mod.url)
try:
mod.evaluate_model(multigen, eval_packages=packages)
except Exception as e:
if JobLog.objects.filter(task_id=self.request.id).exists():
JobLog.objects.filter(task_id=self.request.id).update(
status="FAILED", task_result=mod.url
)
raise e
if JobLog.objects.filter(task_id=self.request.id).exists():
JobLog.objects.filter(task_id=self.request.id).update(status="SUCCESS", task_result=mod.url)
return mod.url
@shared_task(queue="model")
@ -45,16 +129,26 @@ def retrain(model_pk: int):
mod.retrain()
@shared_task(queue="predict")
@shared_task(bind=True, queue="predict")
def predict(
pw_pk: int, pred_setting_pk: int, limit: Optional[int] = None, node_pk: Optional[int] = None
self,
pw_pk: int,
pred_setting_pk: int,
limit: Optional[int] = None,
node_pk: Optional[int] = None,
) -> Pathway:
pw = Pathway.objects.get(id=pw_pk)
setting = Setting.objects.get(id=pred_setting_pk)
# If the setting has a model add/restore it from the cache
if setting.model is not None:
setting.model = get_ml_model(setting.model.pk)
pw.kv.update(**{"status": "running"})
pw.save()
if JobLog.objects.filter(task_id=self.request.id).exists():
JobLog.objects.filter(task_id=self.request.id).update(status="RUNNING", task_result=pw.url)
try:
# regular prediction
if limit is not None:
@ -79,7 +173,111 @@ def predict(
except Exception as e:
pw.kv.update({"status": "failed"})
pw.save()
if JobLog.objects.filter(task_id=self.request.id).exists():
JobLog.objects.filter(task_id=self.request.id).update(
status="FAILED", task_result=pw.url
)
raise e
pw.kv.update(**{"status": "completed"})
pw.save()
if JobLog.objects.filter(task_id=self.request.id).exists():
JobLog.objects.filter(task_id=self.request.id).update(status="SUCCESS", task_result=pw.url)
return pw.url
@shared_task(bind=True, queue="background")
def identify_missing_rules(
self,
pw_pks: List[int],
rule_package_pk: int,
):
from utilities.misc import PathwayUtils
rules = Package.objects.get(pk=rule_package_pk).get_applicable_rules()
rows: List[Any] = []
header = [
"Package Name",
"Pathway Name",
"Educt Name",
"Educt SMILES",
"Reaction Name",
"Reaction SMIRKS",
"Triggered Rules",
"Reactant SMARTS",
"Product SMARTS",
"Product Names",
"Product SMILES",
]
rows.append(header)
for pw in Pathway.objects.filter(pk__in=pw_pks):
pu = PathwayUtils(pw)
missing_rules = pu.find_missing_rules(rules)
package_name = pw.package.name
pathway_name = pw.name
for edge_url, rule_chain in missing_rules.items():
row: List[Any] = [package_name, pathway_name]
edge = Edge.objects.get(url=edge_url)
educts = edge.start_nodes.all()
for educt in educts:
row.append(educt.default_node_label.name)
row.append(educt.default_node_label.smiles)
row.append(edge.edge_label.name)
row.append(edge.edge_label.smirks())
rule_names = []
reactant_smarts = []
product_smarts = []
for r in rule_chain:
r = Rule.objects.get(url=r[0])
rule_names.append(r.name)
rs = r.reactants_smarts
if isinstance(rs, set):
rs = list(rs)
ps = r.products_smarts
if isinstance(ps, set):
ps = list(ps)
reactant_smarts.append(rs)
product_smarts.append(ps)
row.append(rule_names)
row.append(reactant_smarts)
row.append(product_smarts)
products = edge.end_nodes.all()
product_names = []
product_smiles = []
for product in products:
product_names.append(product.default_node_label.name)
product_smiles.append(product.default_node_label.smiles)
row.append(product_names)
row.append(product_smiles)
rows.append(row)
buffer = io.StringIO()
writer = csv.writer(buffer)
writer.writerows(rows)
buffer.seek(0)
return buffer.getvalue()

View File

@ -1,8 +1,21 @@
from django import template
from pydantic import AnyHttpUrl, ValidationError
from pydantic.type_adapter import TypeAdapter
register = template.Library()
url_adapter = TypeAdapter(AnyHttpUrl)
@register.filter
def classname(obj):
return obj.__class__.__name__
@register.filter
def is_url(value):
try:
url_adapter.validate_python(value)
return True
except ValidationError:
return False

View File

@ -190,6 +190,7 @@ urlpatterns = [
re_path(r"^indigo/dearomatize$", v.dearomatize, name="indigo_dearomatize"),
re_path(r"^indigo/layout$", v.layout, name="indigo_layout"),
re_path(r"^depict$", v.depict, name="depict"),
re_path(r"^jobs", v.jobs, name="jobs"),
# OAuth Stuff
path("o/userinfo/", v.userinfo, name="oauth_userinfo"),
]

View File

@ -47,6 +47,7 @@ from .models import (
ExternalDatabase,
ExternalIdentifier,
EnzymeLink,
JobLog,
)
logger = logging.getLogger(__name__)
@ -236,6 +237,7 @@ def get_base_context(request, for_user=None) -> Dict[str, Any]:
"enabled_features": s.FLAGS,
"debug": s.DEBUG,
"external_databases": ExternalDatabase.get_databases(),
"site_id": s.MATOMO_SITE_ID,
},
}
@ -754,8 +756,8 @@ def package_models(request, package_uuid):
context["unreviewed_objects"] = unreviewed_model_qs
context["model_types"] = {
"ML Relative Reasoning": "ml-relative-reasoning",
"Rule Based Relative Reasoning": "rule-based-relative-reasoning",
"ML Relative Reasoning": "mlrr",
"Rule Based Relative Reasoning": "rbrr",
}
if s.FLAGS.get("ENVIFORMER", False):
@ -775,48 +777,40 @@ def package_models(request, package_uuid):
model_type = request.POST.get("model-type")
if model_type == "enviformer":
threshold = float(request.POST.get(f"{model_type}-threshold", 0.5))
mod = EnviFormer.create(current_package, name, description, threshold)
elif model_type == "ml-relative-reasoning" or model_type == "rule-based-relative-reasoning":
# Generic fields for ML and Rule Based
rule_packages = request.POST.getlist("package-based-relative-reasoning-rule-packages")
data_packages = request.POST.getlist("package-based-relative-reasoning-data-packages")
eval_packages = request.POST.getlist(
"package-based-relative-reasoning-evaluation-packages", []
)
rule_packages = request.POST.getlist("model-rule-packages")
data_packages = request.POST.getlist("model-data-packages")
# Generic params
params = {
"package": current_package,
"name": name,
"description": description,
"rule_packages": [
PackageManager.get_package_by_url(current_user, p) for p in rule_packages
],
"data_packages": [
PackageManager.get_package_by_url(current_user, p) for p in data_packages
],
"eval_packages": [
PackageManager.get_package_by_url(current_user, p) for p in eval_packages
],
}
if model_type == "ml-relative-reasoning":
if model_type == "enviformer":
threshold = float(request.POST.get("model-threshold", 0.5))
params["threshold"] = threshold
mod = EnviFormer.create(**params)
elif model_type == "mlrr":
# ML Specific
threshold = float(request.POST.get(f"{model_type}-threshold", 0.5))
threshold = float(request.POST.get("model-threshold", 0.5))
# TODO handle additional fingerprinter
# fingerprinter = request.POST.get(f"{model_type}-fingerprinter")
# fingerprinter = request.POST.get("model-fingerprinter")
params["rule_packages"] = [
PackageManager.get_package_by_url(current_user, p) for p in rule_packages
]
# App Domain related parameters
build_ad = request.POST.get("build-app-domain", False) == "on"
num_neighbors = request.POST.get("num-neighbors", 5)
reliability_threshold = request.POST.get("reliability-threshold", 0.5)
local_compatibility_threshold = request.POST.get(
"local-compatibility-threshold", 0.5
)
local_compatibility_threshold = request.POST.get("local-compatibility-threshold", 0.5)
params["threshold"] = threshold
# params['fingerprinter'] = fingerprinter
@ -826,18 +820,24 @@ def package_models(request, package_uuid):
params["app_domain_local_compatibility_threshold"] = local_compatibility_threshold
mod = MLRelativeReasoning.create(**params)
else:
elif model_type == "rbrr":
params["rule_packages"] = [
PackageManager.get_package_by_url(current_user, p) for p in rule_packages
]
mod = RuleBasedRelativeReasoning.create(**params)
from .tasks import build_model
build_model.delay(mod.pk)
elif s.FLAGS.get("PLUGINS", False) and model_type in s.CLASSIFIER_PLUGINS.values():
pass
else:
return error(
request, "Invalid model type.", f'Model type "{model_type}" is not supported."'
)
return redirect(mod.url)
from .tasks import dispatch, build_model
dispatch(current_user, build_model, mod.pk)
return redirect(mod.url)
else:
return HttpResponseNotAllowed(["GET", "POST"])
@ -865,6 +865,10 @@ def package_model(request, package_uuid, model_uuid):
return JsonResponse({"error": f'"{smiles}" is not a valid SMILES'}, status=400)
if classify:
from epdb.tasks import dispatch_eager, predict_simple
res = dispatch_eager(current_user, predict_simple, current_model.pk, stand_smiles)
pred_res = current_model.predict(stand_smiles)
res = []
@ -888,7 +892,7 @@ def package_model(request, package_uuid, model_uuid):
return JsonResponse(res, safe=False)
else:
app_domain_assessment = current_model.app_domain.assess(stand_smiles)[0]
app_domain_assessment = current_model.app_domain.assess(stand_smiles)
return JsonResponse(app_domain_assessment, safe=False)
context = get_base_context(request)
@ -909,9 +913,25 @@ def package_model(request, package_uuid, model_uuid):
current_model.delete()
return redirect(current_package.url + "/model")
elif hidden == "evaluate":
from .tasks import evaluate_model
from .tasks import dispatch, evaluate_model
eval_type = request.POST.get("model-evaluation-type")
if eval_type not in ["sg", "mg"]:
return error(
request,
"Invalid evaluation type",
f'Evaluation type "{eval_type}" is not supported. Only "sg" and "mg" are supported.',
)
multigen = eval_type == "mg"
eval_packages = request.POST.getlist("model-evaluation-packages")
eval_package_ids = [
PackageManager.get_package_by_url(current_user, p).id for p in eval_packages
]
dispatch(current_user, evaluate_model, current_model.pk, multigen, eval_package_ids)
evaluate_model.delay(current_model.pk)
return redirect(current_model.url)
else:
return HttpResponseBadRequest()
@ -1251,7 +1271,16 @@ def package_compound_structures(request, package_uuid, compound_uuid):
structure_smiles = request.POST.get("structure-smiles")
structure_description = request.POST.get("structure-description")
cs = current_compound.add_structure(structure_smiles, structure_name, structure_description)
try:
cs = current_compound.add_structure(
structure_smiles, structure_name, structure_description
)
except ValueError:
return error(
request,
"Adding structure failed!",
"The structure could not be added as normalized structures don't match!",
)
return redirect(cs.url)
@ -1800,9 +1829,9 @@ def package_pathways(request, package_uuid):
pw.setting = prediction_setting
pw.save()
from .tasks import predict
from .tasks import dispatch, predict
predict.delay(pw.pk, prediction_setting.pk, limit=limit)
dispatch(current_user, predict, pw.pk, prediction_setting.pk, limit=limit)
return redirect(pw.url)
@ -1838,6 +1867,25 @@ def package_pathway(request, package_uuid, pathway_uuid):
return response
if (
request.GET.get("identify-missing-rules", False) == "true"
and request.GET.get("rule-package") is not None
):
from .tasks import dispatch_eager, identify_missing_rules
rule_package = PackageManager.get_package_by_url(
current_user, request.GET.get("rule-package")
)
res = dispatch_eager(
current_user, identify_missing_rules, [current_pathway.pk], rule_package.pk
)
filename = f"{current_pathway.name.replace(' ', '_')}_{current_pathway.uuid}.csv"
response = HttpResponse(res, content_type="text/csv")
response["Content-Disposition"] = f'attachment; filename="{filename}"'
return response
# Pathway d3_json() relies on a lot of related objects (Nodes, Structures, Edges, Reaction, Rules, ...)
# we will again fetch the current pathway identified by this url, but this time together with nearly all
# related objects
@ -1921,10 +1969,16 @@ def package_pathway(request, package_uuid, pathway_uuid):
if node_url:
n = current_pathway.get_node(node_url)
from .tasks import predict
from .tasks import dispatch, predict
dispatch(
current_user,
predict,
current_pathway.pk,
current_pathway.setting.pk,
node_pk=n.pk,
)
# Dont delay?
predict(current_pathway.pk, current_pathway.setting.pk, node_pk=n.pk)
return JsonResponse({"success": current_pathway.url})
return HttpResponseBadRequest()
@ -2696,6 +2750,24 @@ def setting(request, setting_uuid):
pass
def jobs(request):
current_user = _anonymous_or_real(request)
context = get_base_context(request)
if request.method == "GET":
context["object_type"] = "joblog"
context["breadcrumbs"] = [
{"Home": s.SERVER_URL},
{"Jobs": s.SERVER_URL + "/jobs"},
]
if current_user.is_superuser:
context["jobs"] = JobLog.objects.all().order_by("-created")
else:
context["jobs"] = JobLog.objects.filter(user=current_user).order_by("-created")
return render(request, "collections/joblog.html", context)
###########
# KETCHER #
###########

View File

@ -27,10 +27,11 @@ dependencies = [
"scikit-learn>=1.6.1",
"sentry-sdk[django]>=2.32.0",
"setuptools>=80.8.0",
"polars==1.35.1",
]
[tool.uv.sources]
enviformer = { git = "ssh://git@git.envipath.com/enviPath/enviformer.git", rev = "v0.1.2" }
enviformer = { git = "ssh://git@git.envipath.com/enviPath/enviformer.git", rev = "v0.1.4" }
envipy-plugins = { git = "ssh://git@git.envipath.com/enviPath/enviPy-plugins.git", rev = "v0.1.0" }
envipy-additional-information = { git = "ssh://git@git.envipath.com/enviPath/enviPy-additional-information.git", rev = "v0.1.7"}
envipy-ambit = { git = "ssh://git@git.envipath.com/enviPath/enviPy-ambit.git" }

View File

@ -22,6 +22,10 @@
<i class="glyphicon glyphicon-floppy-save"></i> Download Pathway as Image</a>
</li>
{% if meta.can_edit %}
<li>
<a class="button" data-toggle="modal" data-target="#identify_missing_rules_modal">
<i class="glyphicon glyphicon-question-sign"></i> Identify Missing Rules</a>
</li>
<li role="separator" class="divider"></li>
<li>
<a class="button" data-toggle="modal" data-target="#edit_pathway_modal">

View File

@ -0,0 +1,71 @@
{% extends "framework.html" %}
{% load static %}
{% load envipytags %}
{% block content %}
<div class="panel-group" id="reviewListAccordion">
<div class="panel panel-default">
<div class="panel-heading" id="headingPanel" style="font-size:2rem;height: 46px">
Jobs
</div>
<div class="panel-body">
<p>
Job Logs Desc
</p>
</div>
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">
<a id="job-accordion-link" data-toggle="collapse" data-parent="#job-accordion" href="#jobs">
Jobs
</a>
</h4>
</div>
<div id="jobs"
class="panel-collapse collapse in">
<div class="panel-body list-group-item" id="job-content">
<table class="table table-bordered table-hover">
<tr style="background-color: rgba(0, 0, 0, 0.08);">
<th scope="col">ID</th>
<th scope="col">Name</th>
<th scope="col">Status</th>
<th scope="col">Queued</th>
<th scope="col">Done</th>
<th scope="col">Result</th>
</tr>
<tbody>
{% for job in jobs %}
<tr>
<td>{{ job.task_id }}</td>
<td>{{ job.job_name }}</td>
<td>{{ job.status }}</td>
<td>{{ job.created }}</td>
<td>{{ job.done_at }}</td>
{% if job.task_result and job.task_result|is_url == True %}
<td><a href="{{ job.task_result }}">Result</a></td>
{% elif job.task_result %}
<td>{{ job.task_result|slice:"40" }}...</td>
{% else %}
<td>Empty</td>
{% endif %}
</tr>
{% endfor %}
</tbody>
</table>
</div>
</div>
<!-- Unreviewable objects such as User / Group / Setting -->
<ul class='list-group'>
{% for obj in objects %}
{% if object_type == 'user' %}
<a class="list-group-item" href="{{ obj.url }}">{{ obj.username }}</a>
{% else %}
<a class="list-group-item" href="{{ obj.url }}">{{ obj.name }}</a>
{% endif %}
{% endfor %}
</ul>
</div>
</div>
{% endblock content %}

View File

@ -56,7 +56,7 @@
(function () {
var u = "//matomo.envipath.com/";
_paq.push(['setTrackerUrl', u + 'matomo.php']);
_paq.push(['setSiteId', '10']);
_paq.push(['setSiteId', '{{ meta.site_id }}']);
var d = document, g = d.createElement('script'), s = d.getElementsByTagName('script')[0];
g.async = true;
g.src = u + 'matomo.js';

View File

@ -18,13 +18,19 @@
prediction. You just need to set a name and the packages
you want the object to be based on. There are multiple types of models available.
For additional information have a look at our
<a target="_blank" href="https://wiki.envipath.org/index.php/relative-reasoning" role="button">wiki &gt;&gt;</a>
<a target="_blank" href="https://wiki.envipath.org/index.php/relative-reasoning" role="button">wiki
&gt;&gt;</a>
</div>
<!-- Name -->
<label for="model-name">Name</label>
<input id="model-name" name="model-name" class="form-control" placeholder="Name"/>
<!-- Description -->
<label for="model-description">Description</label>
<input id="model-description" name="model-description" class="form-control"
placeholder="Description"/>
<!-- Model Type -->
<label for="model-type">Model Type</label>
<select id="model-type" name="model-type" class="form-control" data-width='100%'>
<option disabled selected>Select Model Type</option>
@ -32,12 +38,12 @@
<option value="{{ v }}">{{ k }}</option>
{% endfor %}
</select>
<!-- ML and Rule Based Based Form-->
<div id="package-based-relative-reasoning-specific-form">
<!-- Rule Packages -->
<label for="package-based-relative-reasoning-rule-packages">Rule Packages</label>
<select id="package-based-relative-reasoning-rule-packages" name="package-based-relative-reasoning-rule-packages"
data-actions-box='true' class="form-control" multiple data-width='100%'>
<div id="rule-packages" class="ep-model-param mlrr rbrr">
<label for="model-rule-packages">Rule Packages</label>
<select id="model-rule-packages" name="model-rule-packages" data-actions-box='true'
class="form-control" multiple data-width='100%'>
<option disabled>Reviewed Packages</option>
{% for obj in meta.readable_packages %}
{% if obj.reviewed %}
@ -52,10 +58,13 @@
{% endif %}
{% endfor %}
</select>
</div>
<!-- Data Packages -->
<label for="package-based-relative-reasoning-data-packages" >Data Packages</label>
<select id="package-based-relative-reasoning-data-packages" name="package-based-relative-reasoning-data-packages"
data-actions-box='true' class="form-control" multiple data-width='100%'>
<div id="data-packages" class="ep-model-param mlrr rbrr enviformer">
<label for="model-data-packages">Data Packages</label>
<select id="model-data-packages" name="model-data-packages" data-actions-box='true'
class="form-control" multiple data-width='100%'>
<option disabled>Reviewed Packages</option>
{% for obj in meta.readable_packages %}
{% if obj.reviewed %}
@ -70,32 +79,31 @@
{% endif %}
{% endfor %}
</select>
</div>
<div id="ml-relative-reasoning-specific-form">
<!-- Fingerprinter -->
<label for="ml-relative-reasoning-fingerprinter">Fingerprinter</label>
<select id="ml-relative-reasoning-fingerprinter" name="ml-relative-reasoning-fingerprinter"
class="form-control">
<div id="fingerprinter" class="ep-model-param mlrr">
<label for="model-fingerprinter">Fingerprinter</label>
<select id="model-fingerprinter" name="model-fingerprinter" data-actions-box='true'
class="form-control" multiple data-width='100%'>
<option value="MACCS" selected>MACCS Fingerprinter</option>
</select>
{% if meta.enabled_features.PLUGINS and additional_descriptors %}
<!-- Property Plugins go here -->
<label for="ml-relative-reasoning-additional-fingerprinter">Additional Fingerprinter /
Descriptors</label>
<select id="ml-relative-reasoning-additional-fingerprinter"
name="ml-relative-reasoning-additional-fingerprinter" class="form-control">
<option disabled selected>Select Additional Fingerprinter / Descriptor</option>
{% for k, v in additional_descriptors.items %}
<option value="{{ v }}">{{ k }}</option>
{% endfor %}
</select>
{% endif %}
<label for="ml-relative-reasoning-threshold">Threshold</label>
<input type="number" min="0" max="1" step="0.05" value="0.5"
id="ml-relative-reasoning-threshold"
name="ml-relative-reasoning-threshold" class="form-control">
</select>
</div>
<!-- Threshold -->
<div id="threshold" class="ep-model-param mlrr enviformer">
<label for="model-threshold">Threshold</label>
<input type="number" min="0" max="1" step="0.05" value="0.5" id="model-threshold"
name="model-threshold" class="form-control">
</div>
<div id="appdomain" class="ep-model-param mlrr">
{% if meta.enabled_features.APPLICABILITY_DOMAIN %}
<!-- Build AD? -->
<div class="checkbox">
@ -107,11 +115,13 @@
<div id="ad-params" style="display:none">
<!-- Num Neighbors -->
<label for="num-neighbors">Number of Neighbors</label>
<input id="num-neighbors" name="num-neighbors" type="number" class="form-control" value="5"
<input id="num-neighbors" name="num-neighbors" type="number" class="form-control"
value="5"
step="1" min="0" max="10">
<!-- Local Compatibility -->
<label for="local-compatibility-threshold">Local Compatibility Threshold</label>
<input id="local-compatibility-threshold" name="local-compatibility-threshold" type="number"
<input id="local-compatibility-threshold" name="local-compatibility-threshold"
type="number"
class="form-control" value="0.5" step="0.01" min="0" max="1">
<!-- Reliability -->
<label for="reliability-threshold">Reliability Threshold</label>
@ -120,12 +130,6 @@
</div>
{% endif %}
</div>
<!-- EnviFormer-->
<div id="enviformer-specific-form">
<label for="enviformer-threshold">Threshold</label>
<input type="number" min="0" max="1" step="0.05" value="0.5" id="enviformer-threshold"
name="enviformer-threshold" class="form-control">
</div>
</form>
</div>
<div class="modal-footer">
@ -138,19 +142,22 @@
<script>
$(function () {
// Built in Model Types
var nativeModelTypes = [
"mlrr",
"rbrr",
"enviformer",
]
// Initially hide all "specific" forms
$("div[id$='-specific-form']").each( function() {
$(".ep-model-param").each(function () {
$(this).hide();
});
$('#model-type').selectpicker();
$("#ml-relative-reasoning-fingerprinter").selectpicker();
$("#package-based-relative-reasoning-rule-packages").selectpicker();
$("#package-based-relative-reasoning-data-packages").selectpicker();
$("#package-based-relative-reasoning-evaluation-packages").selectpicker();
if ($('#ml-relative-reasoning-additional-fingerprinter').length > 0) {
$("#ml-relative-reasoning-additional-fingerprinter").selectpicker();
}
$("#model-fingerprinter").selectpicker();
$("#model-rule-packages").selectpicker();
$("#model-data-packages").selectpicker();
$("#build-app-domain").change(function () {
if ($(this).is(":checked")) {
@ -162,18 +169,12 @@ $(function() {
// On change hide all and show only selected
$("#model-type").change(function () {
$("div[id$='-specific-form']").each( function() {
$(this).hide();
});
val = $('option:selected', this).val();
if (val === 'ml-relative-reasoning' || val === 'rule-based-relative-reasoning') {
$("#package-based-relative-reasoning-specific-form").show();
if (val === 'ml-relative-reasoning') {
$("#ml-relative-reasoning-specific-form").show();
}
$('.ep-model-param').hide();
var modelType = $('#model-type').val();
if (nativeModelTypes.indexOf(modelType) !== -1) {
$('.' + modelType).show();
} else {
$("#" + val + "-specific-form").show();
// do nothing
}
});
@ -183,7 +184,4 @@ $(function() {
});
});
</script>

View File

@ -17,10 +17,10 @@
For evaluation, you need to select the packages you want to use.
While the model is evaluating, you can use the model for predictions.
</div>
<!-- Evaluation -->
<label for="relative-reasoning-evaluation-packages">Evaluation Packages</label>
<select id="relative-reasoning-evaluation-packages" name=relative-reasoning-evaluation-packages"
data-actions-box='true' class="form-control" multiple data-width='100%'>
<!-- Evaluation Packages -->
<label for="model-evaluation-packages">Evaluation Packages</label>
<select id="model-evaluation-packages" name="model-evaluation-packages" data-actions-box='true'
class="form-control" multiple data-width='100%'>
<option disabled>Reviewed Packages</option>
{% for obj in meta.readable_packages %}
{% if obj.reviewed %}
@ -35,6 +35,15 @@
{% endif %}
{% endfor %}
</select>
<!-- Eval Type -->
<label for="model-evaluation-type">Evaluation Type</label>
<select id="model-evaluation-type" name="model-evaluation-type" class="form-control">
<option disabled selected>Select evaluation type</option>
<option value="sg">Single Generation</option>
<option value="mg">Multiple Generations</option>
</select>
<input type="hidden" name="hidden" value="evaluate">
</form>
</div>
@ -50,7 +59,7 @@
$(function () {
$("#relative-reasoning-evaluation-packages").selectpicker();
$("#model-evaluation-packages").selectpicker();
$('#evaluate_model_form_submit').on('click', function (e) {
e.preventDefault();

View File

@ -0,0 +1,54 @@
{% load static %}
<!-- Identify Missing Rules -->
<div id="identify_missing_rules_modal" class="modal" tabindex="-1">
<div class="modal-dialog">
<div class="modal-content">
<div class="modal-header">
<h3 class="modal-title">Identify Missing Rules</h3>
<button type="button" class="close" data-dismiss="modal" aria-label="Close">
<span aria-hidden="true">&times;</span>
</button>
</div>
<div class="modal-body">
By clicking on Download we'll search the Pathway for Reactions that are not backed by
a Rule or which can be assembled by chaining two rules.
<form id="identify-missing-rules-modal-form" accept-charset="UTF-8" action="{{ pathway.url }}"
data-remote="true" method="GET">
<label for="rule-package">Select the Rule Package</label>
<select id="rule-package" name="rule-package" data-actions-box='true' class="form-control"
data-width='100%'>
<option disabled>Reviewed Packages</option>
{% for obj in meta.readable_packages %}
{% if obj.reviewed %}
<option value="{{ obj.url }}">{{ obj.name }}</option>
{% endif %}
{% endfor %}
<option disabled>Unreviewed Packages</option>
{% for obj in meta.readable_packages %}
{% if not obj.reviewed %}
<option value="{{ obj.url }}">{{ obj.name }}</option>
{% endif %}
{% endfor %}
</select>
<input type="hidden" name="identify-missing-rules" value="true"/>
</form>
</div>
<div class="modal-footer">
<button type="button" class="btn btn-secondary" data-dismiss="modal">Close</button>
<button type="button" class="btn btn-primary" id="identify-missing-rules-modal-submit">Download</button>
</div>
</div>
</div>
</div>
<script>
$(function () {
$('#identify-missing-rules-modal-submit').click(function (e) {
e.preventDefault();
$('#identify-missing-rules-modal-form').submit();
$('#identify_missing_rules_modal').modal('hide');
});
})
</script>

View File

@ -183,7 +183,7 @@
</div>
<div id="compound-external-identifier" class="panel-collapse collapse in">
<div class="panel-body list-group-item">
{% if compound.get_pubchem_identifiers %}
{% if compound.get_pubchem_compound_identifiers %}
<div class="panel panel-default panel-heading list-group-item"
style="background-color:silver">
<h4 class="panel-title">
@ -193,12 +193,28 @@
</h4>
</div>
<div id="compound-pubchem-identifier" class="panel-collapse collapse in">
{% for eid in compound.get_pubchem_identifiers %}
{% for eid in compound.get_pubchem_compound_identifiers %}
<a class="list-group-item"
href="{{ eid.external_url }}">CID{{ eid.identifier_value }}</a>
{% endfor %}
</div>
{% endif %}
{% if compound.get_pubchem_substance_identifiers %}
<div class="panel panel-default panel-heading list-group-item"
style="background-color:silver">
<h4 class="panel-title">
<a id="compound-pubchem-identifier-link" data-toggle="collapse"
data-parent="#compound-external-identifier"
href="#compound-pubchem-identifier">PubChem Substance Identifier</a>
</h4>
</div>
<div id="compound-pubchem-identifier" class="panel-collapse collapse in">
{% for eid in compound.get_pubchem_substance_identifiers %}
<a class="list-group-item"
href="{{ eid.external_url }}">SID{{ eid.identifier_value }}</a>
{% endfor %}
</div>
{% endif %}
{% if compound.get_chebi_identifiers %}
<div class="panel panel-default panel-heading list-group-item"
style="background-color:silver">

View File

@ -117,7 +117,7 @@
<!-- End Predict Panel -->
{% endif %}
{% if model.app_domain %}
{% if model.ready_for_prediction and model.app_domain %}
<!-- App Domain -->
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
<h4 class="panel-title">

View File

@ -83,6 +83,7 @@
{% include "modals/objects/add_pathway_edge_modal.html" %}
{% include "modals/objects/download_pathway_csv_modal.html" %}
{% include "modals/objects/download_pathway_image_modal.html" %}
{% include "modals/objects/identify_missing_rules_modal.html" %}
{% include "modals/objects/generic_copy_object_modal.html" %}
{% include "modals/objects/edit_pathway_modal.html" %}
{% include "modals/objects/generic_set_aliases_modal.html" %}

View File

@ -1,8 +1,10 @@
import os.path
from tempfile import TemporaryDirectory
from django.test import TestCase
from epdb.logic import PackageManager
from epdb.models import Reaction, Compound, User, Rule
from utilities.ml import Dataset
from epdb.models import Reaction, Compound, User, Rule, Package
from utilities.chem import FormatConverter
from utilities.ml import RuleBasedDataset, EnviFormerDataset
class DatasetTest(TestCase):
@ -41,12 +43,108 @@ class DatasetTest(TestCase):
super(DatasetTest, cls).setUpClass()
cls.user = User.objects.get(username="anonymous")
cls.package = PackageManager.create_package(cls.user, "Anon Test Package", "No Desc")
cls.BBD_SUBSET = Package.objects.get(name="Fixtures")
def test_smoke(self):
def test_generate_dataset(self):
"""Test generating dataset does not crash"""
self.generate_rule_dataset()
def test_indexing(self):
"""Test indexing a few different ways to check for crashes"""
ds, reactions, rules = self.generate_rule_dataset()
print(ds[5])
print(ds[2, 5])
print(ds[3:6, 2:8])
print(ds[:2, "structure_id"])
def test_add_rows(self):
"""Test adding one row and adding multiple rows"""
ds, reactions, rules = self.generate_rule_dataset()
ds.add_row(list(ds.df.row(1)))
ds.add_rows([list(ds.df.row(i)) for i in range(5)])
def test_times_triggered(self):
"""Check getting times triggered for a rule id"""
ds, reactions, rules = self.generate_rule_dataset()
print(ds.times_triggered(rules[0].uuid))
def test_block_indices(self):
"""Test the usages of _block_indices"""
ds, reactions, rules = self.generate_rule_dataset()
print(ds.struct_features())
print(ds.triggered())
print(ds.observed())
def test_structure_id(self):
"""Check getting a structure id from row index"""
ds, reactions, rules = self.generate_rule_dataset()
print(ds.structure_id(0))
def test_x(self):
"""Test getting X portion of the dataframe"""
ds, reactions, rules = self.generate_rule_dataset()
print(ds.X().df.head())
def test_trig(self):
"""Test getting the triggered portion of the dataframe"""
ds, reactions, rules = self.generate_rule_dataset()
print(ds.trig().df.head())
def test_y(self):
"""Test getting the Y portion of the dataframe"""
ds, reactions, rules = self.generate_rule_dataset()
print(ds.y().df.head())
def test_classification_dataset(self):
"""Test making the classification dataset"""
ds, reactions, rules = self.generate_rule_dataset()
compounds = [c.default_structure for c in Compound.objects.filter(package=self.BBD_SUBSET)]
class_ds, products = ds.classification_dataset(compounds, rules)
print(class_ds.df.head(5))
print(products[:5])
def test_extra_features(self):
reactions = [r for r in Reaction.objects.filter(package=self.BBD_SUBSET)]
applicable_rules = [r for r in Rule.objects.filter(package=self.BBD_SUBSET)]
ds = RuleBasedDataset.generate_dataset(reactions, applicable_rules, feat_funcs=[FormatConverter.maccs, FormatConverter.morgan])
print(ds.shape)
def test_to_arff(self):
"""Test exporting the arff version of the dataset"""
ds, reactions, rules = self.generate_rule_dataset()
ds.to_arff("dataset_arff_test.arff")
def test_save_load(self):
"""Test saving and loading dataset"""
with TemporaryDirectory() as tmpdir:
ds, reactions, rules = self.generate_rule_dataset()
ds.save(os.path.join(tmpdir, "save_dataset.pkl"))
ds_loaded = RuleBasedDataset.load(os.path.join(tmpdir, "save_dataset.pkl"))
self.assertTrue(ds.df.equals(ds_loaded.df))
def test_dataset_example(self):
"""Test with a concrete example checking dataset size"""
reactions = [r for r in Reaction.objects.filter(package=self.package)]
applicable_rules = [self.rule1]
ds = Dataset.generate_dataset(reactions, applicable_rules)
ds = RuleBasedDataset.generate_dataset(reactions, applicable_rules)
self.assertEqual(len(ds.y()), 1)
self.assertEqual(sum(ds.y()[0]), 1)
self.assertEqual(ds.y().df.item(), 1)
def test_enviformer_dataset(self):
ds, reactions = self.generate_enviformer_dataset()
print(ds.X().head())
print(ds.y().head())
def generate_rule_dataset(self):
"""Generate a RuleBasedDataset from test package data"""
reactions = [r for r in Reaction.objects.filter(package=self.BBD_SUBSET)]
applicable_rules = [r for r in Rule.objects.filter(package=self.BBD_SUBSET)]
ds = RuleBasedDataset.generate_dataset(reactions, applicable_rules)
return ds, reactions, applicable_rules
def generate_enviformer_dataset(self):
reactions = [r for r in Reaction.objects.filter(package=self.BBD_SUBSET)]
ds = EnviFormerDataset.generate_dataset(reactions)
return ds, reactions

View File

@ -1,7 +1,27 @@
from collections import defaultdict
from datetime import datetime
from tempfile import TemporaryDirectory
from django.test import TestCase, tag
from epdb.logic import PackageManager
from epdb.models import User, EnviFormer, Package
from epdb.models import User, EnviFormer, Package, Setting
from epdb.tasks import predict_simple, predict
def measure_predict(mod, pathway_pk=None):
# Measure and return the prediction time
start = datetime.now()
if pathway_pk:
s = Setting()
s.model = mod
s.model_threshold = 0.2
s.max_depth = 4
s.max_nodes = 20
s.save()
pred_result = predict.delay(pathway_pk, s.pk, limit=s.max_depth)
else:
pred_result = predict_simple.delay(mod.pk, "C1=CC=C(CSCC2=CC=CC=C2)C=C1")
_ = pred_result.get()
return round((datetime.now() - start).total_seconds(), 2)
@tag("slow")
@ -22,14 +42,38 @@ class EnviFormerTest(TestCase):
threshold = float(0.5)
data_package_objs = [self.BBD_SUBSET]
eval_packages_objs = [self.BBD_SUBSET]
mod = EnviFormer.create(
self.package, data_package_objs, eval_packages_objs, threshold=threshold
)
mod = EnviFormer.create(self.package, data_package_objs, threshold=threshold)
mod.build_dataset()
mod.build_model()
mod.multigen_eval = True
mod.save()
mod.evaluate_model()
mod.evaluate_model(True, eval_packages_objs, n_splits=2)
mod.predict("CCN(CC)C(=O)C1=CC(=CC=C1)C")
def test_predict_runtime(self):
with TemporaryDirectory() as tmpdir:
with self.settings(MODEL_DIR=tmpdir):
threshold = float(0.5)
data_package_objs = [self.BBD_SUBSET]
mods = []
for _ in range(4):
mod = EnviFormer.create(self.package, data_package_objs, threshold=threshold)
mod.build_dataset()
mod.build_model()
mods.append(mod)
# Test prediction time drops after first prediction
times = [measure_predict(mods[0]) for _ in range(5)]
print(f"First prediction took {times[0]} seconds, subsequent ones took {times[1:]}")
# Test pathway prediction
times = [measure_predict(mods[1], self.BBD_SUBSET.pathways[0].pk) for _ in range(5)]
print(f"First pathway prediction took {times[0]} seconds, subsequent ones took {times[1:]}")
# Test eviction by performing three prediction with every model, twice.
times = defaultdict(list)
for _ in range(2): # Eviction should cause the second iteration here to have to reload the models
for mod in mods:
for _ in range(3):
times[mod.pk].append(measure_predict(mod))
print(times)

View File

@ -4,7 +4,7 @@ import numpy as np
from django.test import TestCase
from epdb.logic import PackageManager
from epdb.models import User, MLRelativeReasoning, Package
from epdb.models import User, MLRelativeReasoning, Package, RuleBasedRelativeReasoning
class ModelTest(TestCase):
@ -17,7 +17,7 @@ class ModelTest(TestCase):
cls.package = PackageManager.create_package(cls.user, "Anon Test Package", "No Desc")
cls.BBD_SUBSET = Package.objects.get(name="Fixtures")
def test_smoke(self):
def test_mlrr(self):
with TemporaryDirectory() as tmpdir:
with self.settings(MODEL_DIR=tmpdir):
threshold = float(0.5)
@ -30,29 +30,14 @@ class ModelTest(TestCase):
self.package,
rule_package_objs,
data_package_objs,
eval_packages_objs,
threshold=threshold,
name="ECC - BBD - 0.5",
description="Created MLRelativeReasoning in Testcase",
)
# mod = RuleBasedRelativeReasoning.create(
# self.package,
# rule_package_objs,
# data_package_objs,
# eval_packages_objs,
# threshold=threshold,
# min_count=5,
# max_count=0,
# name='ECC - BBD - 0.5',
# description='Created MLRelativeReasoning in Testcase',
# )
mod.build_dataset()
mod.build_model()
mod.multigen_eval = True
mod.save()
mod.evaluate_model()
mod.evaluate_model(True, eval_packages_objs, n_splits=2)
results = mod.predict("CCN(CC)C(=O)C1=CC(=CC=C1)C")
@ -73,3 +58,57 @@ class ModelTest(TestCase):
# from pprint import pprint
# pprint(mod.eval_results)
def test_applicability(self):
with TemporaryDirectory() as tmpdir:
with self.settings(MODEL_DIR=tmpdir):
threshold = float(0.5)
rule_package_objs = [self.BBD_SUBSET]
data_package_objs = [self.BBD_SUBSET]
eval_packages_objs = [self.BBD_SUBSET]
mod = MLRelativeReasoning.create(
self.package,
rule_package_objs,
data_package_objs,
threshold=threshold,
name="ECC - BBD - 0.5",
description="Created MLRelativeReasoning in Testcase",
build_app_domain=True, # To test the applicability domain this must be True
app_domain_num_neighbours=5,
app_domain_local_compatibility_threshold=0.5,
app_domain_reliability_threshold=0.5,
)
mod.build_dataset()
mod.build_model()
mod.evaluate_model(True, eval_packages_objs, n_splits=2)
results = mod.predict("CCN(CC)C(=O)C1=CC(=CC=C1)C")
def test_rbrr(self):
with TemporaryDirectory() as tmpdir:
with self.settings(MODEL_DIR=tmpdir):
threshold = float(0.5)
rule_package_objs = [self.BBD_SUBSET]
data_package_objs = [self.BBD_SUBSET]
eval_packages_objs = [self.BBD_SUBSET]
mod = RuleBasedRelativeReasoning.create(
self.package,
rule_package_objs,
data_package_objs,
threshold=threshold,
min_count=5,
max_count=0,
name='ECC - BBD - 0.5',
description='Created MLRelativeReasoning in Testcase',
)
mod.build_dataset()
mod.build_model()
mod.evaluate_model(True, eval_packages_objs, n_splits=2)
results = mod.predict("CCN(CC)C(=O)C1=CC(=CC=C1)C")

View File

@ -6,7 +6,7 @@ from epdb.logic import UserManager
from epdb.models import Package, User
@override_settings(MODEL_DIR=s.FIXTURE_DIRS[0] / "models")
@override_settings(MODEL_DIR=s.FIXTURE_DIRS[0] / "models", CELERY_TASK_ALWAYS_EAGER=True)
class PathwayViewTest(TestCase):
fixtures = ["test_fixtures_incl_model.jsonl.gz"]

View File

@ -6,7 +6,7 @@ from epdb.logic import UserManager, PackageManager
from epdb.models import Pathway, Edge
@override_settings(MODEL_DIR=s.FIXTURE_DIRS[0] / "models")
@override_settings(MODEL_DIR=s.FIXTURE_DIRS[0] / "models", CELERY_TASK_ALWAYS_EAGER=True)
class PathwayViewTest(TestCase):
fixtures = ["test_fixtures_incl_model.jsonl.gz"]

View File

@ -7,7 +7,7 @@ from typing import List, Optional, Dict, TYPE_CHECKING
from indigo import Indigo, IndigoException, IndigoObject
from indigo.renderer import IndigoRenderer
from rdkit import Chem, rdBase
from rdkit.Chem import MACCSkeys, Descriptors
from rdkit.Chem import MACCSkeys, Descriptors, rdFingerprintGenerator
from rdkit.Chem import rdChemReactions
from rdkit.Chem.Draw import rdMolDraw2D
from rdkit.Chem.MolStandardize import rdMolStandardize
@ -107,6 +107,13 @@ class FormatConverter(object):
bitvec = MACCSkeys.GenMACCSKeys(mol)
return bitvec.ToList()
@staticmethod
def morgan(smiles, radius=3, fpSize=2048):
finger_gen = rdFingerprintGenerator.GetMorganGenerator(radius=radius, fpSize=fpSize)
mol = Chem.MolFromSmiles(smiles)
fp = finger_gen.GetFingerprint(mol)
return fp.ToList()
@staticmethod
def get_functional_groups(smiles: str) -> List[str]:
res = list()
@ -185,7 +192,7 @@ class FormatConverter(object):
return smiles
@staticmethod
def standardize(smiles, remove_stereo=False):
def standardize(smiles, remove_stereo=False, canonicalize_tautomers=False):
# Taken from https://bitsilla.com/blog/2021/06/standardizing-a-molecule-using-rdkit/
# follows the steps in
# https://github.com/greglandrum/RSC_OpenScience_Standardization_202104/blob/main/MolStandardize%20pieces.ipynb
@ -203,19 +210,21 @@ class FormatConverter(object):
uncharger = (
rdMolStandardize.Uncharger()
) # annoying, but necessary as no convenience method exists
uncharged_parent_clean_mol = uncharger.uncharge(parent_clean_mol)
res_mol = uncharger.uncharge(parent_clean_mol)
# note that no attempt is made at reionization at this step
# nor at ionization at some pH (rdkit has no pKa caculator)
# the main aim to to represent all molecules from different sources
# in a (single) standard way, for use in ML, catalogue, etc.
# te = rdMolStandardize.TautomerEnumerator() # idem
# taut_uncharged_parent_clean_mol = te.Canonicalize(uncharged_parent_clean_mol)
if remove_stereo:
Chem.RemoveStereochemistry(uncharged_parent_clean_mol)
Chem.RemoveStereochemistry(res_mol)
return Chem.MolToSmiles(uncharged_parent_clean_mol, kekuleSmiles=True)
if canonicalize_tautomers:
te = rdMolStandardize.TautomerEnumerator() # idem
res_mol = te.Canonicalize(res_mol)
return Chem.MolToSmiles(res_mol, kekuleSmiles=True)
@staticmethod
def neutralize_smiles(smiles):
@ -363,6 +372,76 @@ class FormatConverter(object):
return parsed_smiles, errors
@staticmethod
def smiles_covered_by(
l_smiles: List[str],
r_smiles: List[str],
standardize: bool = True,
canonicalize_tautomers: bool = True,
) -> bool:
"""
Check if all SMILES in the left list are covered by (contained in) the right list.
This function performs a subset check to determine if every chemical structure
represented in l_smiles has a corresponding representation in r_smiles.
Args:
l_smiles (List[str]): List of SMILES strings to check for coverage.
r_smiles (List[str]): List of SMILES strings that should contain all l_smiles.
standardize (bool, optional): Whether to standardize SMILES before comparison.
Defaults to True. When True, applies FormatConverter.standardize() to
normalize representations for accurate comparison.
canonicalize_tautomers (bool, optional): Whether to canonicalize tautomers
Defaults to False. When True, applies rdMolStandardize.TautomerEnumerator().Canonicalize(res_mol)
to the compounds before comparison.
Returns:
bool: True if all SMILES in l_smiles are found in r_smiles (i.e., l_smiles
is a subset of r_smiles), False otherwise.
Note:
- Comparison treats lists as sets, ignoring duplicates and order
- Failed standardization attempts are silently ignored (original SMILES used)
- This is a one-directional check: l_smiles ⊆ r_smiles
- For bidirectional equality, both directions must be checked separately
Example:
>>> FormatConverter.smiles_covered_by(["CCO", "CC"], ["CCO", "CC", "CCC"])
True
>>> FormatConverter.smiles_covered_by(["CCO", "CCCC"], ["CCO", "CC", "CCC"])
False
"""
standardized_l_smiles = []
if standardize:
for smi in l_smiles:
try:
smi = FormatConverter.standardize(
smi, canonicalize_tautomers=canonicalize_tautomers
)
except Exception:
# :shrug:
# logger.debug(f'Standardizing SMILES failed for {smi}')
pass
standardized_l_smiles.append(smi)
else:
standardized_l_smiles = l_smiles
standardized_r_smiles = []
if standardize:
for smi in r_smiles:
try:
smi = FormatConverter.standardize(smi)
except Exception:
# :shrug:
# logger.debug(f'Standardizing SMILES failed for {smi}')
pass
standardized_r_smiles.append(smi)
else:
standardized_r_smiles = r_smiles
return len(set(standardized_l_smiles).difference(set(standardized_r_smiles))) == 0
class Standardizer(ABC):
def __init__(self, name):

View File

@ -9,36 +9,37 @@ from collections import defaultdict
from datetime import datetime
from enum import Enum
from types import NoneType
from typing import Dict, Any, List
from typing import Any, Dict, List
from django.db import transaction
from envipy_additional_information import Interval, EnviPyModel
from envipy_additional_information import NAME_MAPPING
from envipy_additional_information import NAME_MAPPING, EnviPyModel, Interval
from pydantic import BaseModel, HttpUrl
from epdb.models import (
Package,
Compound,
CompoundStructure,
SimpleRule,
Edge,
EnviFormer,
EPModel,
ExternalDatabase,
ExternalIdentifier,
License,
MLRelativeReasoning,
Node,
Package,
ParallelRule,
Pathway,
PluginModel,
Reaction,
Rule,
RuleBasedRelativeReasoning,
Scenario,
SequentialRule,
SimpleAmbitRule,
SimpleRDKitRule,
ParallelRule,
SequentialRule,
Reaction,
Pathway,
Node,
Edge,
Scenario,
EPModel,
MLRelativeReasoning,
RuleBasedRelativeReasoning,
EnviFormer,
PluginModel,
ExternalIdentifier,
ExternalDatabase,
License,
SimpleRule,
)
from utilities.chem import FormatConverter
logger = logging.getLogger(__name__)
@ -48,7 +49,7 @@ class HTMLGenerator:
@staticmethod
def generate_html(additional_information: "EnviPyModel", prefix="") -> str:
from typing import get_origin, get_args, Union
from typing import Union, get_args, get_origin
if isinstance(additional_information, type):
clz_name = additional_information.__name__
@ -1171,3 +1172,89 @@ class PackageImporter:
url=identifier_data.get("url", ""),
is_primary=identifier_data.get("is_primary", False),
)
class PathwayUtils:
def __init__(self, pathway: "Pathway"):
self.pathway = pathway
@staticmethod
def _get_products(smiles: str, rules: List["Rule"]):
educt_rule_products: Dict[str, Dict[str, List[str]]] = defaultdict(
lambda: defaultdict(list)
)
for r in rules:
product_sets = r.apply(smiles)
for product_set in product_sets:
for product in product_set:
educt_rule_products[smiles][r.url].append(product)
return educt_rule_products
def find_missing_rules(self, rules: List["Rule"]):
print(f"Processing {self.pathway.name}")
# compute products for each node / rule combination in the pathway
educt_rule_products = defaultdict(lambda: defaultdict(list))
for node in self.pathway.nodes:
educt_rule_products.update(**self._get_products(node.default_node_label.smiles, rules))
# loop through edges and determine reactions that can't be constructed by
# any of the rules or a combination of two rules in a chained fashion
res: Dict[str, List["Rule"]] = dict()
for edge in self.pathway.edges:
found = False
reaction = edge.edge_label
educts = [cs for cs in reaction.educts.all()]
products = [cs.smiles for cs in reaction.products.all()]
rule_chain = []
for educt in educts:
educt = educt.smiles
triggered_rules = list(educt_rule_products.get(educt, {}).keys())
for triggered_rule in triggered_rules:
if rule_products := educt_rule_products[educt][triggered_rule]:
# check if this rule covers the reaction
if FormatConverter.smiles_covered_by(
products, rule_products, standardize=True, canonicalize_tautomers=True
):
found = True
else:
# Check if another prediction step would cover the reaction
for product in rule_products:
prod_rule_products = self._get_products(product, rules)
prod_triggered_rules = list(
prod_rule_products.get(product, {}).keys()
)
for prod_triggered_rule in prod_triggered_rules:
if second_step_products := prod_rule_products[product][
prod_triggered_rule
]:
if FormatConverter.smiles_covered_by(
products,
second_step_products,
standardize=True,
canonicalize_tautomers=True,
):
rule_chain.append(
(
triggered_rule,
Rule.objects.get(url=triggered_rule).name,
)
)
rule_chain.append(
(
prod_triggered_rule,
Rule.objects.get(url=prod_triggered_rule).name,
)
)
res[edge.url] = rule_chain
if not found:
res[edge.url] = rule_chain
return res

View File

@ -5,11 +5,14 @@ import logging
from collections import defaultdict
from datetime import datetime
from pathlib import Path
from typing import List, Dict, Set, Tuple, TYPE_CHECKING
from typing import List, Dict, Set, Tuple, TYPE_CHECKING, Callable
from abc import ABC, abstractmethod
import networkx as nx
import numpy as np
from envipy_plugins import Descriptor
from numpy.random import default_rng
import polars as pl
from sklearn.base import BaseEstimator, ClassifierMixin
from sklearn.decomposition import PCA
from sklearn.dummy import DummyClassifier
@ -26,70 +29,281 @@ if TYPE_CHECKING:
from epdb.models import Rule, CompoundStructure, Reaction
class Dataset:
def __init__(
self, columns: List[str], num_labels: int, data: List[List[str | int | float]] = None
):
self.columns: List[str] = columns
self.num_labels: int = num_labels
if data is None:
self.data: List[List[str | int | float]] = list()
class Dataset(ABC):
def __init__(self, columns: List[str] = None, data: List[List[str | int | float]] | pl.DataFrame = None):
if isinstance(data, pl.DataFrame): # Allows for re-creation of self in cases like indexing with __getitem__
self.df = data
else:
self.data = data
# Build either an empty dataframe with columns or fill it with list of list data
if data is not None and len(columns) != len(data[0]):
raise ValueError(f"Header and Data are not aligned {len(columns)} columns vs. {len(data[0])} columns")
if columns is None:
raise ValueError("Columns can't be None if data is not already a DataFrame")
self.df = pl.DataFrame(data=data, schema=columns, orient="row", infer_schema_length=None)
self.num_features: int = len(columns) - self.num_labels
self._struct_features: Tuple[int, int] = self._block_indices("feature_")
self._triggered: Tuple[int, int] = self._block_indices("trig_")
self._observed: Tuple[int, int] = self._block_indices("obs_")
def add_rows(self, rows: List[List[str | int | float]]):
"""Add rows to the dataset. Extends the polars dataframe stored in self"""
if len(self.columns) != len(rows[0]):
raise ValueError(f"Header and Data are not aligned {len(self.columns)} columns vs. {len(rows[0])} columns")
new_rows = pl.DataFrame(data=rows, schema=self.columns, orient="row", infer_schema_length=None)
self.df.extend(new_rows)
def _block_indices(self, prefix) -> Tuple[int, int]:
def add_row(self, row: List[str | int | float]):
"""See add_rows"""
self.add_rows([row])
def block_indices(self, prefix) -> List[int]:
"""Find the indexes in column labels that has the prefix"""
indices: List[int] = []
for i, feature in enumerate(self.columns):
if feature.startswith(prefix):
indices.append(i)
return indices
return min(indices), max(indices)
@property
def columns(self) -> List[str]:
"""Use the polars dataframe columns"""
return self.df.columns
def structure_id(self):
return self.data[0][0]
@property
def shape(self):
return self.df.shape
def add_row(self, row: List[str | int | float]):
if len(self.columns) != len(row):
raise ValueError(f"Header and Data are not aligned {len(self.columns)} vs. {len(row)}")
self.data.append(row)
@abstractmethod
def X(self, **kwargs):
pass
def times_triggered(self, rule_uuid) -> int:
idx = self.columns.index(f"trig_{rule_uuid}")
@abstractmethod
def y(self, **kwargs):
pass
times_triggered = 0
for row in self.data:
if row[idx] == 1:
times_triggered += 1
return times_triggered
def struct_features(self) -> Tuple[int, int]:
return self._struct_features
def triggered(self) -> Tuple[int, int]:
return self._triggered
def observed(self) -> Tuple[int, int]:
return self._observed
def at(self, position: int) -> Dataset:
return Dataset(self.columns, self.num_labels, [self.data[position]])
def limit(self, limit: int) -> Dataset:
return Dataset(self.columns, self.num_labels, self.data[:limit])
@staticmethod
@abstractmethod
def generate_dataset(reactions, *args, **kwargs):
pass
def __iter__(self):
return (self.at(i) for i, _ in enumerate(self.data))
"""Use polars iter_rows for iterating over the dataset"""
return self.df.iter_rows()
def __getitem__(self, item):
"""Item is passed to polars allowing for advanced indexing.
See https://docs.pola.rs/api/python/stable/reference/dataframe/api/polars.DataFrame.__getitem__.html#polars.DataFrame.__getitem__"""
res = self.df[item]
if isinstance(res, pl.DataFrame): # If we get a dataframe back from indexing make new self with res dataframe
return self.__class__(data=res)
else: # If we don't get a dataframe back (likely base type, int, str, float etc.) return the item
return res
def save(self, path: "Path | str"):
import pickle
with open(path, "wb") as fh:
pickle.dump(self, fh)
@staticmethod
def load(path: "str | Path") -> "Dataset":
import pickle
return pickle.load(open(path, "rb"))
def to_numpy(self):
return self.df.to_numpy()
def __repr__(self):
return (
f"<{self.__class__.__name__} #rows={len(self.df)} #cols={len(self.columns)}>"
)
def __len__(self):
return len(self.df)
def iter_rows(self, named=False):
return self.df.iter_rows(named=named)
def filter(self, *predicates, **constraints):
return self.__class__(data=self.df.filter(*predicates, **constraints))
def select(self, *exprs, **named_exprs):
return self.__class__(data=self.df.select(*exprs, **named_exprs))
def with_columns(self, *exprs, **name_exprs):
return self.__class__(data=self.df.with_columns(*exprs, **name_exprs))
def sort(self, by, *more_by, descending=False, nulls_last=False, multithreaded=True, maintain_order=False):
return self.__class__(data=self.df.sort(by, *more_by, descending=descending, nulls_last=nulls_last,
multithreaded=multithreaded, maintain_order=maintain_order))
def item(self, row=None, column=None):
return self.df.item(row, column)
def fill_nan(self, value):
return self.__class__(data=self.df.fill_nan(value))
@property
def height(self):
return self.df.height
class RuleBasedDataset(Dataset):
def __init__(self, num_labels=None, columns=None, data=None):
super().__init__(columns, data)
# Calculating num_labels allows functions like getitem to be in the base Dataset as it unifies the init.
self.num_labels: int = num_labels if num_labels else sum([1 for c in self.columns if "obs_" in c])
# Pre-calculate the ids of columns for features/labels, useful later in X and y
self._struct_features: List[int] = self.block_indices("feature_")
self._triggered: List[int] = self.block_indices("trig_")
self._observed: List[int] = self.block_indices("obs_")
self.feature_cols: List[int] = self._struct_features + self._triggered
self.num_features: int = len(self.feature_cols)
self.has_probs = False
def times_triggered(self, rule_uuid) -> int:
"""Count how many times a rule is triggered by the number of rows with one in the rules trig column"""
return self.df.filter(pl.col(f"trig_{rule_uuid}") == 1).height
def struct_features(self) -> List[int]:
return self._struct_features
def triggered(self) -> List[int]:
return self._triggered
def observed(self) -> List[int]:
return self._observed
def structure_id(self, index: int):
"""Get the UUID of a compound"""
return self.item(index, "structure_id")
def X(self, exclude_id_col=True, na_replacement=0):
"""Get all the feature and trig columns"""
_col_ids = self.feature_cols
if not exclude_id_col:
_col_ids = [0] + _col_ids
res = self[:, _col_ids]
if na_replacement is not None:
res.df = res.df.fill_null(na_replacement)
return res
def trig(self, na_replacement=0):
"""Get all the trig columns"""
res = self[:, self._triggered]
if na_replacement is not None:
res.df = res.df.fill_null(na_replacement)
return res
def y(self, na_replacement=0):
"""Get all the obs columns"""
res = self[:, self._observed]
if na_replacement is not None:
res.df = res.df.fill_null(na_replacement)
return res
@staticmethod
def generate_dataset(reactions, applicable_rules, educts_only=True, feat_funcs: List["Callable | Descriptor"]=None):
if feat_funcs is None:
feat_funcs = [FormatConverter.maccs]
_structures = set() # Get all the structures
for r in reactions:
_structures.update(r.educts.all())
if not educts_only:
_structures.update(r.products.all())
compounds = sorted(_structures, key=lambda x: x.url)
triggered: Dict[str, Set[str]] = defaultdict(set)
observed: Set[str] = set()
# Apply rules on collected compounds and store tps
for i, comp in enumerate(compounds):
logger.debug(f"{i + 1}/{len(compounds)}...")
for rule in applicable_rules:
product_sets = rule.apply(comp.smiles)
if len(product_sets) == 0:
continue
key = f"{rule.uuid} + {comp.uuid}"
if key in triggered:
logger.info(f"{key} already present. Duplicate reaction?")
for prod_set in product_sets:
for smi in prod_set:
try:
smi = FormatConverter.standardize(smi, remove_stereo=True)
except Exception:
logger.debug(f"Standardizing SMILES failed for {smi}")
triggered[key].add(smi)
for i, r in enumerate(reactions):
logger.debug(f"{i + 1}/{len(reactions)}...")
if len(r.educts.all()) != 1:
logger.debug(f"Skipping {r.url} as it has {len(r.educts.all())} substrates!")
continue
for comp in r.educts.all():
for rule in applicable_rules:
key = f"{rule.uuid} + {comp.uuid}"
if key not in triggered:
continue
# standardize products from reactions for comparison
standardized_products = []
for cs in r.products.all():
smi = cs.smiles
try:
smi = FormatConverter.standardize(smi, remove_stereo=True)
except Exception as e:
logger.debug(f"Standardizing SMILES failed for {smi}")
standardized_products.append(smi)
if len(set(standardized_products).difference(triggered[key])) == 0:
observed.add(key)
feat_columns = []
for feat_func in feat_funcs:
if isinstance(feat_func, Descriptor):
feats = feat_func.get_molecule_descriptors(compounds[0].smiles)
else:
feats = feat_func(compounds[0].smiles)
start_i = len(feat_columns)
feat_columns.extend([f"feature_{start_i + i}" for i, _ in enumerate(feats)])
ds_columns = (["structure_id"] +
feat_columns +
[f"trig_{r.uuid}" for r in applicable_rules] +
[f"obs_{r.uuid}" for r in applicable_rules])
rows = []
for i, comp in enumerate(compounds):
# Features
feats = []
for feat_func in feat_funcs:
if isinstance(feat_func, Descriptor):
feat = feat_func.get_molecule_descriptors(comp.smiles)
else:
feat = feat_func(comp.smiles)
feats.extend(feat)
trig = []
obs = []
for rule in applicable_rules:
key = f"{rule.uuid} + {comp.uuid}"
# Check triggered
if key in triggered:
trig.append(1)
else:
trig.append(0)
# Check obs
if key in observed:
obs.append(1)
elif key not in triggered:
obs.append(None)
else:
obs.append(0)
rows.append([str(comp.uuid)] + feats + trig + obs)
ds = RuleBasedDataset(len(applicable_rules), ds_columns, data=rows)
return ds
def classification_dataset(
self, structures: List[str | "CompoundStructure"], applicable_rules: List["Rule"]
) -> Tuple[Dataset, List[List[PredictionResult]]]:
) -> Tuple[RuleBasedDataset, List[List[PredictionResult]]]:
classify_data = []
classify_products = []
for struct in structures:
@ -113,186 +327,18 @@ class Dataset:
else:
trig.append(0)
prods.append([])
classify_data.append([struct_id] + features + trig + ([-1] * len(trig)))
new_row = [struct_id] + features + trig + ([-1] * len(trig))
if self.has_probs:
new_row += [-1] * len(trig)
classify_data.append(new_row)
classify_products.append(prods)
ds = RuleBasedDataset(len(applicable_rules), self.columns, data=classify_data)
return ds, classify_products
return Dataset(
columns=self.columns, num_labels=self.num_labels, data=classify_data
), classify_products
@staticmethod
def generate_dataset(
reactions: List["Reaction"], applicable_rules: List["Rule"], educts_only: bool = True
) -> Dataset:
_structures = set()
for r in reactions:
for e in r.educts.all():
_structures.add(e)
if not educts_only:
for e in r.products:
_structures.add(e)
compounds = sorted(_structures, key=lambda x: x.url)
triggered: Dict[str, Set[str]] = defaultdict(set)
observed: Set[str] = set()
# Apply rules on collected compounds and store tps
for i, comp in enumerate(compounds):
logger.debug(f"{i + 1}/{len(compounds)}...")
for rule in applicable_rules:
product_sets = rule.apply(comp.smiles)
if len(product_sets) == 0:
continue
key = f"{rule.uuid} + {comp.uuid}"
if key in triggered:
logger.info(f"{key} already present. Duplicate reaction?")
for prod_set in product_sets:
for smi in prod_set:
try:
smi = FormatConverter.standardize(smi, remove_stereo=True)
except Exception:
# :shrug:
logger.debug(f"Standardizing SMILES failed for {smi}")
pass
triggered[key].add(smi)
for i, r in enumerate(reactions):
logger.debug(f"{i + 1}/{len(reactions)}...")
if len(r.educts.all()) != 1:
logger.debug(f"Skipping {r.url} as it has {len(r.educts.all())} substrates!")
continue
for comp in r.educts.all():
for rule in applicable_rules:
key = f"{rule.uuid} + {comp.uuid}"
if key not in triggered:
continue
# standardize products from reactions for comparison
standardized_products = []
for cs in r.products.all():
smi = cs.smiles
try:
smi = FormatConverter.standardize(smi, remove_stereo=True)
except Exception as e:
# :shrug:
logger.debug(f"Standardizing SMILES failed for {smi}")
pass
standardized_products.append(smi)
if len(set(standardized_products).difference(triggered[key])) == 0:
observed.add(key)
else:
pass
ds = None
for i, comp in enumerate(compounds):
# Features
feat = FormatConverter.maccs(comp.smiles)
trig = []
obs = []
for rule in applicable_rules:
key = f"{rule.uuid} + {comp.uuid}"
# Check triggered
if key in triggered:
trig.append(1)
else:
trig.append(0)
# Check obs
if key in observed:
obs.append(1)
elif key not in triggered:
obs.append(None)
else:
obs.append(0)
if ds is None:
header = (
["structure_id"]
+ [f"feature_{i}" for i, _ in enumerate(feat)]
+ [f"trig_{r.uuid}" for r in applicable_rules]
+ [f"obs_{r.uuid}" for r in applicable_rules]
)
ds = Dataset(header, len(applicable_rules))
ds.add_row([str(comp.uuid)] + feat + trig + obs)
return ds
def X(self, exclude_id_col=True, na_replacement=0):
res = self.__getitem__(
(slice(None), slice(1 if exclude_id_col else 0, len(self.columns) - self.num_labels))
)
if na_replacement is not None:
res = [[x if x is not None else na_replacement for x in row] for row in res]
return res
def trig(self, na_replacement=0):
res = self.__getitem__((slice(None), slice(self._triggered[0], self._triggered[1])))
if na_replacement is not None:
res = [[x if x is not None else na_replacement for x in row] for row in res]
return res
def y(self, na_replacement=0):
res = self.__getitem__((slice(None), slice(len(self.columns) - self.num_labels, None)))
if na_replacement is not None:
res = [[x if x is not None else na_replacement for x in row] for row in res]
return res
def __getitem__(self, key):
if not isinstance(key, tuple):
raise TypeError("Dataset must be indexed with dataset[rows, columns]")
row_key, col_key = key
# Normalize rows
if isinstance(row_key, int):
rows = [self.data[row_key]]
else:
rows = self.data[row_key]
# Normalize columns
if isinstance(col_key, int):
res = [row[col_key] for row in rows]
else:
res = [
[row[i] for i in range(*col_key.indices(len(row)))]
if isinstance(col_key, slice)
else [row[i] for i in col_key]
for row in rows
]
return res
def save(self, path: "Path"):
import pickle
with open(path, "wb") as fh:
pickle.dump(self, fh)
@staticmethod
def load(path: "Path") -> "Dataset":
import pickle
return pickle.load(open(path, "rb"))
def add_probs(self, probs):
col_names = [f"prob_{self.columns[r_id].split('_')[-1]}" for r_id in self._observed]
self.df = self.df.with_columns(*[pl.Series(name, probs[:, j]) for j, name in enumerate(col_names)])
self.has_probs = True
def to_arff(self, path: "Path"):
arff = f"@relation 'enviPy-dataset: -C {self.num_labels}'\n"
@ -304,7 +350,7 @@ class Dataset:
arff += f"@attribute {c} {{0,1}}\n"
arff += "\n@data\n"
for d in self.data:
for d in self:
ys = ",".join([str(v if v is not None else "?") for v in d[-self.num_labels :]])
xs = ",".join([str(v if v is not None else "?") for v in d[: self.num_features]])
arff += f"{ys},{xs}\n"
@ -313,10 +359,40 @@ class Dataset:
fh.write(arff)
fh.flush()
def __repr__(self):
return (
f"<Dataset #rows={len(self.data)} #cols={len(self.columns)} #labels={self.num_labels}>"
class EnviFormerDataset(Dataset):
def __init__(self, columns=None, data=None):
super().__init__(columns, data)
def X(self):
"""Return the educts"""
return self["educts"]
def y(self):
"""Return the products"""
return self["products"]
@staticmethod
def generate_dataset(reactions, *args, **kwargs):
# Standardise reactions for the training data
stereo = kwargs.get("stereo", False)
rows = []
for reaction in reactions:
e = ".".join(
[
FormatConverter.standardize(smile.smiles, remove_stereo=not stereo)
for smile in reaction.educts.all()
]
)
p = ".".join(
[
FormatConverter.standardize(smile.smiles, remove_stereo=not stereo)
for smile in reaction.products.all()
]
)
rows.append([e, p])
ds = EnviFormerDataset(["educts", "products"], rows)
return ds
class SparseLabelECC(BaseEstimator, ClassifierMixin):
@ -498,7 +574,7 @@ class EnsembleClassifierChain:
self.classifiers = []
if self.num_labels is None:
self.num_labels = len(Y[0])
self.num_labels = Y.shape[1]
for p in range(self.num_chains):
logger.debug(f"{datetime.now()} fitting {p + 1}/{self.num_chains}")
@ -529,7 +605,7 @@ class RelativeReasoning:
def fit(self, X, Y):
n_instances = len(Y)
n_attributes = len(Y[0])
n_attributes = Y.shape[1]
for i in range(n_attributes):
for j in range(n_attributes):
@ -541,8 +617,8 @@ class RelativeReasoning:
countboth = 0
for k in range(n_instances):
vi = Y[k][i]
vj = Y[k][j]
vi = Y[k, i]
vj = Y[k, j]
if vi is None or vj is None:
continue
@ -598,7 +674,7 @@ class ApplicabilityDomainPCA(PCA):
self.min_vals = None
self.max_vals = None
def build(self, train_dataset: "Dataset"):
def build(self, train_dataset: "RuleBasedDataset"):
# transform
X_scaled = self.scaler.fit_transform(train_dataset.X())
# fit pca
@ -612,7 +688,7 @@ class ApplicabilityDomainPCA(PCA):
instances_pca = self.transform(instances_scaled)
return instances_pca
def is_applicable(self, classify_instances: "Dataset"):
def is_applicable(self, classify_instances: "RuleBasedDataset"):
instances_pca = self.__transform(classify_instances.X())
is_applicable = []

184
uv.lock generated
View File

@ -1,6 +1,10 @@
version = 1
revision = 3
revision = 2
requires-python = ">=3.12"
resolution-markers = [
"sys_platform == 'linux' or sys_platform == 'win32'",
"sys_platform != 'linux' and sys_platform != 'win32'",
]
[[package]]
name = "aiohappyeyeballs"
@ -176,6 +180,19 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/c9/af/0dcccc7fdcdf170f9a1585e5e96b6fb0ba1749ef6be8c89a6202284759bd/celery-5.5.3-py3-none-any.whl", hash = "sha256:0b5761a07057acee94694464ca482416b959568904c9dfa41ce8413a7d65d525", size = 438775, upload-time = "2025-06-01T11:08:09.94Z" },
]
[[package]]
name = "celery-stubs"
version = "0.1.3"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "mypy" },
{ name = "typing-extensions" },
]
sdist = { url = "https://files.pythonhosted.org/packages/98/14/b853ada8706a3a301396566b6dd405d1cbb24bff756236a12a01dbe766a4/celery-stubs-0.1.3.tar.gz", hash = "sha256:0fb5345820f8a2bd14e6ffcbef2d10181e12e40f8369f551d7acc99d8d514919", size = 46583, upload-time = "2023-02-10T02:20:11.837Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/1c/7a/4ab2347d13f1f59d10a7337feb9beb002664119f286036785284c6bec150/celery_stubs-0.1.3-py3-none-any.whl", hash = "sha256:dfb9ad27614a8af028b2055bb4a4ae99ca5e9a8d871428a506646d62153218d7", size = 89085, upload-time = "2023-02-10T02:20:09.409Z" },
]
[[package]]
name = "certifi"
version = "2025.10.5"
@ -525,13 +542,14 @@ wheels = [
[[package]]
name = "enviformer"
version = "0.1.0"
source = { git = "ssh://git@git.envipath.com/enviPath/enviformer.git?rev=v0.1.2#3f28f60cfa1df814cf7559303b5130933efa40ae" }
source = { git = "ssh://git@git.envipath.com/enviPath/enviformer.git?rev=v0.1.4#7094be5767748fd63d4a84a5d71f06cf02ba07f3" }
dependencies = [
{ name = "joblib" },
{ name = "lightning" },
{ name = "pytorch-lightning" },
{ name = "scikit-learn" },
{ name = "torch" },
{ name = "torch", version = "2.8.0", source = { registry = "https://pypi.org/simple" }, marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "torch", version = "2.8.0+cu128", source = { registry = "https://download.pytorch.org/whl/cu128" }, marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
]
[[package]]
@ -546,7 +564,6 @@ dependencies = [
{ name = "django-ninja" },
{ name = "django-oauth-toolkit" },
{ name = "django-polymorphic" },
{ name = "django-stubs" },
{ name = "enviformer" },
{ name = "envipy-additional-information" },
{ name = "envipy-ambit" },
@ -554,6 +571,7 @@ dependencies = [
{ name = "epam-indigo" },
{ name = "gunicorn" },
{ name = "networkx" },
{ name = "polars" },
{ name = "psycopg2-binary" },
{ name = "python-dotenv" },
{ name = "rdkit" },
@ -566,6 +584,8 @@ dependencies = [
[package.optional-dependencies]
dev = [
{ name = "celery-stubs" },
{ name = "django-stubs" },
{ name = "poethepoet" },
{ name = "pre-commit" },
{ name = "ruff" },
@ -577,15 +597,16 @@ ms-login = [
[package.metadata]
requires-dist = [
{ name = "celery", specifier = ">=5.5.2" },
{ name = "celery-stubs", marker = "extra == 'dev'", specifier = "==0.1.3" },
{ name = "django", specifier = ">=5.2.1" },
{ name = "django-extensions", specifier = ">=4.1" },
{ name = "django-model-utils", specifier = ">=5.0.0" },
{ name = "django-ninja", specifier = ">=1.4.1" },
{ name = "django-oauth-toolkit", specifier = ">=3.0.1" },
{ name = "django-polymorphic", specifier = ">=4.1.0" },
{ name = "django-stubs", specifier = ">=5.2.4" },
{ name = "enviformer", git = "ssh://git@git.envipath.com/enviPath/enviformer.git?rev=v0.1.2" },
{ name = "envipy-additional-information", git = "ssh://git@git.envipath.com/enviPath/enviPy-additional-information.git?rev=v0.1.4" },
{ name = "django-stubs", marker = "extra == 'dev'", specifier = ">=5.2.4" },
{ name = "enviformer", git = "ssh://git@git.envipath.com/enviPath/enviformer.git?rev=v0.1.4" },
{ name = "envipy-additional-information", git = "ssh://git@git.envipath.com/enviPath/enviPy-additional-information.git?rev=v0.1.7" },
{ name = "envipy-ambit", git = "ssh://git@git.envipath.com/enviPath/enviPy-ambit.git" },
{ name = "envipy-plugins", git = "ssh://git@git.envipath.com/enviPath/enviPy-plugins.git?rev=v0.1.0" },
{ name = "epam-indigo", specifier = ">=1.30.1" },
@ -593,6 +614,7 @@ requires-dist = [
{ name = "msal", marker = "extra == 'ms-login'", specifier = ">=1.33.0" },
{ name = "networkx", specifier = ">=3.4.2" },
{ name = "poethepoet", marker = "extra == 'dev'", specifier = ">=0.37.0" },
{ name = "polars", specifier = "==1.35.1" },
{ name = "pre-commit", marker = "extra == 'dev'", specifier = ">=4.3.0" },
{ name = "psycopg2-binary", specifier = ">=2.9.10" },
{ name = "python-dotenv", specifier = ">=1.1.0" },
@ -608,8 +630,8 @@ provides-extras = ["ms-login", "dev"]
[[package]]
name = "envipy-additional-information"
version = "0.1.0"
source = { git = "ssh://git@git.envipath.com/enviPath/enviPy-additional-information.git?rev=v0.1.4#4da604090bf7cf1f3f552d69485472dbc623030a" }
version = "0.1.7"
source = { git = "ssh://git@git.envipath.com/enviPath/enviPy-additional-information.git?rev=v0.1.7#d02a5d5e6a931e6565ea86127813acf7e4b33a30" }
dependencies = [
{ name = "pydantic" },
]
@ -865,7 +887,8 @@ dependencies = [
{ name = "packaging" },
{ name = "pytorch-lightning" },
{ name = "pyyaml" },
{ name = "torch" },
{ name = "torch", version = "2.8.0", source = { registry = "https://pypi.org/simple" }, marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "torch", version = "2.8.0+cu128", source = { registry = "https://download.pytorch.org/whl/cu128" }, marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "torchmetrics" },
{ name = "tqdm" },
{ name = "typing-extensions" },
@ -1074,6 +1097,47 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/b7/da/7d22601b625e241d4f23ef1ebff8acfc60da633c9e7e7922e24d10f592b3/multidict-6.7.0-py3-none-any.whl", hash = "sha256:394fc5c42a333c9ffc3e421a4c85e08580d990e08b99f6bf35b4132114c5dcb3", size = 12317, upload-time = "2025-10-06T14:52:29.272Z" },
]
[[package]]
name = "mypy"
version = "1.18.2"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "mypy-extensions" },
{ name = "pathspec" },
{ name = "typing-extensions" },
]
sdist = { url = "https://files.pythonhosted.org/packages/c0/77/8f0d0001ffad290cef2f7f216f96c814866248a0b92a722365ed54648e7e/mypy-1.18.2.tar.gz", hash = "sha256:06a398102a5f203d7477b2923dda3634c36727fa5c237d8f859ef90c42a9924b", size = 3448846, upload-time = "2025-09-19T00:11:10.519Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/07/06/dfdd2bc60c66611dd8335f463818514733bc763e4760dee289dcc33df709/mypy-1.18.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:33eca32dd124b29400c31d7cf784e795b050ace0e1f91b8dc035672725617e34", size = 12908273, upload-time = "2025-09-19T00:10:58.321Z" },
{ url = "https://files.pythonhosted.org/packages/81/14/6a9de6d13a122d5608e1a04130724caf9170333ac5a924e10f670687d3eb/mypy-1.18.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:a3c47adf30d65e89b2dcd2fa32f3aeb5e94ca970d2c15fcb25e297871c8e4764", size = 11920910, upload-time = "2025-09-19T00:10:20.043Z" },
{ url = "https://files.pythonhosted.org/packages/5f/a9/b29de53e42f18e8cc547e38daa9dfa132ffdc64f7250e353f5c8cdd44bee/mypy-1.18.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5d6c838e831a062f5f29d11c9057c6009f60cb294fea33a98422688181fe2893", size = 12465585, upload-time = "2025-09-19T00:10:33.005Z" },
{ url = "https://files.pythonhosted.org/packages/77/ae/6c3d2c7c61ff21f2bee938c917616c92ebf852f015fb55917fd6e2811db2/mypy-1.18.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:01199871b6110a2ce984bde85acd481232d17413868c9807e95c1b0739a58914", size = 13348562, upload-time = "2025-09-19T00:10:11.51Z" },
{ url = "https://files.pythonhosted.org/packages/4d/31/aec68ab3b4aebdf8f36d191b0685d99faa899ab990753ca0fee60fb99511/mypy-1.18.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:a2afc0fa0b0e91b4599ddfe0f91e2c26c2b5a5ab263737e998d6817874c5f7c8", size = 13533296, upload-time = "2025-09-19T00:10:06.568Z" },
{ url = "https://files.pythonhosted.org/packages/9f/83/abcb3ad9478fca3ebeb6a5358bb0b22c95ea42b43b7789c7fb1297ca44f4/mypy-1.18.2-cp312-cp312-win_amd64.whl", hash = "sha256:d8068d0afe682c7c4897c0f7ce84ea77f6de953262b12d07038f4d296d547074", size = 9828828, upload-time = "2025-09-19T00:10:28.203Z" },
{ url = "https://files.pythonhosted.org/packages/5f/04/7f462e6fbba87a72bc8097b93f6842499c428a6ff0c81dd46948d175afe8/mypy-1.18.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:07b8b0f580ca6d289e69209ec9d3911b4a26e5abfde32228a288eb79df129fcc", size = 12898728, upload-time = "2025-09-19T00:10:01.33Z" },
{ url = "https://files.pythonhosted.org/packages/99/5b/61ed4efb64f1871b41fd0b82d29a64640f3516078f6c7905b68ab1ad8b13/mypy-1.18.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:ed4482847168439651d3feee5833ccedbf6657e964572706a2adb1f7fa4dfe2e", size = 11910758, upload-time = "2025-09-19T00:10:42.607Z" },
{ url = "https://files.pythonhosted.org/packages/3c/46/d297d4b683cc89a6e4108c4250a6a6b717f5fa96e1a30a7944a6da44da35/mypy-1.18.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c3ad2afadd1e9fea5cf99a45a822346971ede8685cc581ed9cd4d42eaf940986", size = 12475342, upload-time = "2025-09-19T00:11:00.371Z" },
{ url = "https://files.pythonhosted.org/packages/83/45/4798f4d00df13eae3bfdf726c9244bcb495ab5bd588c0eed93a2f2dd67f3/mypy-1.18.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a431a6f1ef14cf8c144c6b14793a23ec4eae3db28277c358136e79d7d062f62d", size = 13338709, upload-time = "2025-09-19T00:11:03.358Z" },
{ url = "https://files.pythonhosted.org/packages/d7/09/479f7358d9625172521a87a9271ddd2441e1dab16a09708f056e97007207/mypy-1.18.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7ab28cc197f1dd77a67e1c6f35cd1f8e8b73ed2217e4fc005f9e6a504e46e7ba", size = 13529806, upload-time = "2025-09-19T00:10:26.073Z" },
{ url = "https://files.pythonhosted.org/packages/71/cf/ac0f2c7e9d0ea3c75cd99dff7aec1c9df4a1376537cb90e4c882267ee7e9/mypy-1.18.2-cp313-cp313-win_amd64.whl", hash = "sha256:0e2785a84b34a72ba55fb5daf079a1003a34c05b22238da94fcae2bbe46f3544", size = 9833262, upload-time = "2025-09-19T00:10:40.035Z" },
{ url = "https://files.pythonhosted.org/packages/5a/0c/7d5300883da16f0063ae53996358758b2a2df2a09c72a5061fa79a1f5006/mypy-1.18.2-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:62f0e1e988ad41c2a110edde6c398383a889d95b36b3e60bcf155f5164c4fdce", size = 12893775, upload-time = "2025-09-19T00:10:03.814Z" },
{ url = "https://files.pythonhosted.org/packages/50/df/2cffbf25737bdb236f60c973edf62e3e7b4ee1c25b6878629e88e2cde967/mypy-1.18.2-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:8795a039bab805ff0c1dfdb8cd3344642c2b99b8e439d057aba30850b8d3423d", size = 11936852, upload-time = "2025-09-19T00:10:51.631Z" },
{ url = "https://files.pythonhosted.org/packages/be/50/34059de13dd269227fb4a03be1faee6e2a4b04a2051c82ac0a0b5a773c9a/mypy-1.18.2-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6ca1e64b24a700ab5ce10133f7ccd956a04715463d30498e64ea8715236f9c9c", size = 12480242, upload-time = "2025-09-19T00:11:07.955Z" },
{ url = "https://files.pythonhosted.org/packages/5b/11/040983fad5132d85914c874a2836252bbc57832065548885b5bb5b0d4359/mypy-1.18.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d924eef3795cc89fecf6bedc6ed32b33ac13e8321344f6ddbf8ee89f706c05cb", size = 13326683, upload-time = "2025-09-19T00:09:55.572Z" },
{ url = "https://files.pythonhosted.org/packages/e9/ba/89b2901dd77414dd7a8c8729985832a5735053be15b744c18e4586e506ef/mypy-1.18.2-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:20c02215a080e3a2be3aa50506c67242df1c151eaba0dcbc1e4e557922a26075", size = 13514749, upload-time = "2025-09-19T00:10:44.827Z" },
{ url = "https://files.pythonhosted.org/packages/25/bc/cc98767cffd6b2928ba680f3e5bc969c4152bf7c2d83f92f5a504b92b0eb/mypy-1.18.2-cp314-cp314-win_amd64.whl", hash = "sha256:749b5f83198f1ca64345603118a6f01a4e99ad4bf9d103ddc5a3200cc4614adf", size = 9982959, upload-time = "2025-09-19T00:10:37.344Z" },
{ url = "https://files.pythonhosted.org/packages/87/e3/be76d87158ebafa0309946c4a73831974d4d6ab4f4ef40c3b53a385a66fd/mypy-1.18.2-py3-none-any.whl", hash = "sha256:22a1748707dd62b58d2ae53562ffc4d7f8bcc727e8ac7cbc69c053ddc874d47e", size = 2352367, upload-time = "2025-09-19T00:10:15.489Z" },
]
[[package]]
name = "mypy-extensions"
version = "1.1.0"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/a2/6e/371856a3fb9d31ca8dac321cda606860fa4548858c0cc45d9d1d4ca2628b/mypy_extensions-1.1.0.tar.gz", hash = "sha256:52e68efc3284861e772bbcd66823fde5ae21fd2fdb51c62a211403730b916558", size = 6343, upload-time = "2025-04-22T14:54:24.164Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/79/7b/2c79738432f5c924bef5071f933bcc9efd0473bac3b4aa584a6f7c1c8df8/mypy_extensions-1.1.0-py3-none-any.whl", hash = "sha256:1be4cccdb0f2482337c4743e60421de3a356cd97508abadd57d47403e94f5505", size = 4963, upload-time = "2025-04-22T14:54:22.983Z" },
]
[[package]]
name = "networkx"
version = "3.5"
@ -1192,7 +1256,7 @@ name = "nvidia-cudnn-cu12"
version = "9.10.2.21"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "nvidia-cublas-cu12" },
{ name = "nvidia-cublas-cu12", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
]
wheels = [
{ url = "https://files.pythonhosted.org/packages/ba/51/e123d997aa098c61d029f76663dedbfb9bc8dcf8c60cbd6adbe42f76d049/nvidia_cudnn_cu12-9.10.2.21-py3-none-manylinux_2_27_x86_64.whl", hash = "sha256:949452be657fa16687d0930933f032835951ef0892b37d2d53824d1a84dc97a8", size = 706758467, upload-time = "2025-06-06T21:54:08.597Z" },
@ -1203,7 +1267,7 @@ name = "nvidia-cufft-cu12"
version = "11.3.3.83"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "nvidia-nvjitlink-cu12" },
{ name = "nvidia-nvjitlink-cu12", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
]
wheels = [
{ url = "https://files.pythonhosted.org/packages/1f/13/ee4e00f30e676b66ae65b4f08cb5bcbb8392c03f54f2d5413ea99a5d1c80/nvidia_cufft_cu12-11.3.3.83-py3-none-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:4d2dd21ec0b88cf61b62e6b43564355e5222e4a3fb394cac0db101f2dd0d4f74", size = 193118695, upload-time = "2025-03-07T01:45:27.821Z" },
@ -1230,9 +1294,9 @@ name = "nvidia-cusolver-cu12"
version = "11.7.3.90"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "nvidia-cublas-cu12" },
{ name = "nvidia-cusparse-cu12" },
{ name = "nvidia-nvjitlink-cu12" },
{ name = "nvidia-cublas-cu12", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "nvidia-cusparse-cu12", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "nvidia-nvjitlink-cu12", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
]
wheels = [
{ url = "https://files.pythonhosted.org/packages/85/48/9a13d2975803e8cf2777d5ed57b87a0b6ca2cc795f9a4f59796a910bfb80/nvidia_cusolver_cu12-11.7.3.90-py3-none-manylinux_2_27_x86_64.whl", hash = "sha256:4376c11ad263152bd50ea295c05370360776f8c3427b30991df774f9fb26c450", size = 267506905, upload-time = "2025-03-07T01:47:16.273Z" },
@ -1243,7 +1307,7 @@ name = "nvidia-cusparse-cu12"
version = "12.5.8.93"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "nvidia-nvjitlink-cu12" },
{ name = "nvidia-nvjitlink-cu12", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
]
wheels = [
{ url = "https://files.pythonhosted.org/packages/c2/f5/e1854cb2f2bcd4280c44736c93550cc300ff4b8c95ebe370d0aa7d2b473d/nvidia_cusparse_cu12-12.5.8.93-py3-none-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:1ec05d76bbbd8b61b06a80e1eaf8cf4959c3d4ce8e711b65ebd0443bb0ebb13b", size = 288216466, upload-time = "2025-03-07T01:48:13.779Z" },
@ -1308,6 +1372,15 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/aa/18/a8444036c6dd65ba3624c63b734d3ba95ba63ace513078e1580590075d21/pastel-0.2.1-py2.py3-none-any.whl", hash = "sha256:4349225fcdf6c2bb34d483e523475de5bb04a5c10ef711263452cb37d7dd4364", size = 5955, upload-time = "2020-09-16T19:21:11.409Z" },
]
[[package]]
name = "pathspec"
version = "0.12.1"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/ca/bc/f35b8446f4531a7cb215605d100cd88b7ac6f44ab3fc94870c120ab3adbf/pathspec-0.12.1.tar.gz", hash = "sha256:a482d51503a1ab33b1c67a6c3813a26953dbdc71c31dacaef9a838c4e29f5712", size = 51043, upload-time = "2023-12-10T22:30:45Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/cc/20/ff623b09d963f88bfde16306a54e12ee5ea43e9b597108672ff3a408aad6/pathspec-0.12.1-py3-none-any.whl", hash = "sha256:a0d503e138a4c123b27490a4f7beda6a01c6f288df0e4a8b79c7eb0dc7b4cc08", size = 31191, upload-time = "2023-12-10T22:30:43.14Z" },
]
[[package]]
name = "pillow"
version = "11.3.0"
@ -1396,6 +1469,32 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/92/1b/5337af1a6a478d25a3e3c56b9b4b42b0a160314e02f4a0498d5322c8dac4/poethepoet-0.37.0-py3-none-any.whl", hash = "sha256:861790276315abcc8df1b4bd60e28c3d48a06db273edd3092f3c94e1a46e5e22", size = 90062, upload-time = "2025-08-11T18:00:27.595Z" },
]
[[package]]
name = "polars"
version = "1.35.1"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "polars-runtime-32" },
]
sdist = { url = "https://files.pythonhosted.org/packages/9b/5b/3caad788d93304026cbf0ab4c37f8402058b64a2f153b9c62f8b30f5d2ee/polars-1.35.1.tar.gz", hash = "sha256:06548e6d554580151d6ca7452d74bceeec4640b5b9261836889b8e68cfd7a62e", size = 694881, upload-time = "2025-10-30T12:12:52.294Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/9f/4c/21a227b722534404241c2a76beceb7463469d50c775a227fc5c209eb8adc/polars-1.35.1-py3-none-any.whl", hash = "sha256:c29a933f28aa330d96a633adbd79aa5e6a6247a802a720eead9933f4613bdbf4", size = 783598, upload-time = "2025-10-30T12:11:54.668Z" },
]
[[package]]
name = "polars-runtime-32"
version = "1.35.1"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/df/3e/19c252e8eb4096300c1a36ec3e50a27e5fa9a1ccaf32d3927793c16abaee/polars_runtime_32-1.35.1.tar.gz", hash = "sha256:f6b4ec9cd58b31c87af1b8c110c9c986d82345f1d50d7f7595b5d447a19dc365", size = 2696218, upload-time = "2025-10-30T12:12:53.479Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/08/2c/da339459805a26105e9d9c2f07e43ca5b8baeee55acd5457e6881487a79a/polars_runtime_32-1.35.1-cp39-abi3-macosx_10_12_x86_64.whl", hash = "sha256:6f051a42f6ae2f26e3bc2cf1f170f2120602976e2a3ffb6cfba742eecc7cc620", size = 40525100, upload-time = "2025-10-30T12:11:58.098Z" },
{ url = "https://files.pythonhosted.org/packages/27/70/a0733568b3533481924d2ce68b279ab3d7334e5fa6ed259f671f650b7c5e/polars_runtime_32-1.35.1-cp39-abi3-macosx_11_0_arm64.whl", hash = "sha256:c2232f9cf05ba59efc72d940b86c033d41fd2d70bf2742e8115ed7112a766aa9", size = 36701908, upload-time = "2025-10-30T12:12:02.166Z" },
{ url = "https://files.pythonhosted.org/packages/46/54/6c09137bef9da72fd891ba58c2962cc7c6c5cad4649c0e668d6b344a9d7b/polars_runtime_32-1.35.1-cp39-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:42f9837348557fd674477ea40a6ac8a7e839674f6dd0a199df24be91b026024c", size = 41317692, upload-time = "2025-10-30T12:12:04.928Z" },
{ url = "https://files.pythonhosted.org/packages/22/55/81c5b266a947c339edd7fbaa9e1d9614012d02418453f48b76cc177d3dd9/polars_runtime_32-1.35.1-cp39-abi3-manylinux_2_24_aarch64.whl", hash = "sha256:c873aeb36fed182d5ebc35ca17c7eb193fe83ae2ea551ee8523ec34776731390", size = 37853058, upload-time = "2025-10-30T12:12:08.342Z" },
{ url = "https://files.pythonhosted.org/packages/6c/58/be8b034d559eac515f52408fd6537be9bea095bc0388946a4e38910d3d50/polars_runtime_32-1.35.1-cp39-abi3-win_amd64.whl", hash = "sha256:35cde9453ca7032933f0e58e9ed4388f5a1e415dd0db2dd1e442c81d815e630c", size = 41289554, upload-time = "2025-10-30T12:12:11.104Z" },
{ url = "https://files.pythonhosted.org/packages/f4/7f/e0111b9e2a1169ea82cde3ded9c92683e93c26dfccd72aee727996a1ac5b/polars_runtime_32-1.35.1-cp39-abi3-win_arm64.whl", hash = "sha256:fd77757a6c9eb9865c4bfb7b07e22225207c6b7da382bd0b9bd47732f637105d", size = 36958878, upload-time = "2025-10-30T12:12:15.206Z" },
]
[[package]]
name = "pre-commit"
version = "4.3.0"
@ -1670,7 +1769,8 @@ dependencies = [
{ name = "lightning-utilities" },
{ name = "packaging" },
{ name = "pyyaml" },
{ name = "torch" },
{ name = "torch", version = "2.8.0", source = { registry = "https://pypi.org/simple" }, marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "torch", version = "2.8.0+cu128", source = { registry = "https://download.pytorch.org/whl/cu128" }, marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "torchmetrics" },
{ name = "tqdm" },
{ name = "typing-extensions" },
@ -1754,11 +1854,11 @@ wheels = [
[[package]]
name = "redis"
version = "6.4.0"
version = "7.0.1"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/0d/d6/e8b92798a5bd67d659d51a18170e91c16ac3b59738d91894651ee255ed49/redis-6.4.0.tar.gz", hash = "sha256:b01bc7282b8444e28ec36b261df5375183bb47a07eb9c603f284e89cbc5ef010", size = 4647399, upload-time = "2025-08-07T08:10:11.441Z" }
sdist = { url = "https://files.pythonhosted.org/packages/57/8f/f125feec0b958e8d22c8f0b492b30b1991d9499a4315dfde466cf4289edc/redis-7.0.1.tar.gz", hash = "sha256:c949df947dca995dc68fdf5a7863950bf6df24f8d6022394585acc98e81624f1", size = 4755322, upload-time = "2025-10-27T14:34:00.33Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/e8/02/89e2ed7e85db6c93dfa9e8f691c5087df4e3551ab39081a4d7c6d1f90e05/redis-6.4.0-py3-none-any.whl", hash = "sha256:f0544fa9604264e9464cdf4814e7d4830f74b165d52f2a330a760a88dd248b7f", size = 279847, upload-time = "2025-08-07T08:10:09.84Z" },
{ url = "https://files.pythonhosted.org/packages/e9/97/9f22a33c475cda519f20aba6babb340fb2f2254a02fb947816960d1e669a/redis-7.0.1-py3-none-any.whl", hash = "sha256:4977af3c7d67f8f0eb8b6fec0dafc9605db9343142f634041fb0235f67c0588a", size = 339938, upload-time = "2025-10-27T14:33:58.553Z" },
]
[[package]]
@ -1963,15 +2063,40 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/32/d5/f9a850d79b0851d1d4ef6456097579a9005b31fea68726a4ae5f2d82ddd9/threadpoolctl-3.6.0-py3-none-any.whl", hash = "sha256:43a0b8fd5a2928500110039e43a5eed8480b918967083ea48dc3ab9f13c4a7fb", size = 18638, upload-time = "2025-03-13T13:49:21.846Z" },
]
[[package]]
name = "torch"
version = "2.8.0"
source = { registry = "https://pypi.org/simple" }
resolution-markers = [
"sys_platform != 'linux' and sys_platform != 'win32'",
]
dependencies = [
{ name = "filelock", marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "fsspec", marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "jinja2", marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "networkx", marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "setuptools", marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "sympy", marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "typing-extensions", marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
]
wheels = [
{ url = "https://files.pythonhosted.org/packages/be/66/5c9a321b325aaecb92d4d1855421e3a055abd77903b7dab6575ca07796db/torch-2.8.0-cp312-none-macosx_11_0_arm64.whl", hash = "sha256:619c2869db3ada2c0105487ba21b5008defcc472d23f8b80ed91ac4a380283b0", size = 73630478, upload-time = "2025-08-06T14:53:57.144Z" },
{ url = "https://files.pythonhosted.org/packages/de/69/8b7b13bba430f5e21d77708b616f767683629fc4f8037564a177d20f90ed/torch-2.8.0-cp313-cp313t-macosx_14_0_arm64.whl", hash = "sha256:1a62a1ec4b0498930e2543535cf70b1bef8c777713de7ceb84cd79115f553767", size = 73915128, upload-time = "2025-08-06T14:54:34.769Z" },
{ url = "https://files.pythonhosted.org/packages/04/6e/650bb7f28f771af0cb791b02348db8b7f5f64f40f6829ee82aa6ce99aabe/torch-2.8.0-cp313-none-macosx_11_0_arm64.whl", hash = "sha256:7b677e17f5a3e69fdef7eb3b9da72622f8d322692930297e4ccb52fefc6c8211", size = 73632395, upload-time = "2025-08-06T14:55:28.645Z" },
]
[[package]]
name = "torch"
version = "2.8.0+cu128"
source = { registry = "https://download.pytorch.org/whl/cu128" }
resolution-markers = [
"sys_platform == 'linux' or sys_platform == 'win32'",
]
dependencies = [
{ name = "filelock" },
{ name = "fsspec" },
{ name = "jinja2" },
{ name = "networkx" },
{ name = "filelock", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "fsspec", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "jinja2", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "networkx", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "nvidia-cublas-cu12", marker = "platform_machine == 'x86_64' and sys_platform == 'linux'" },
{ name = "nvidia-cuda-cupti-cu12", marker = "platform_machine == 'x86_64' and sys_platform == 'linux'" },
{ name = "nvidia-cuda-nvrtc-cu12", marker = "platform_machine == 'x86_64' and sys_platform == 'linux'" },
@ -1986,10 +2111,10 @@ dependencies = [
{ name = "nvidia-nccl-cu12", marker = "platform_machine == 'x86_64' and sys_platform == 'linux'" },
{ name = "nvidia-nvjitlink-cu12", marker = "platform_machine == 'x86_64' and sys_platform == 'linux'" },
{ name = "nvidia-nvtx-cu12", marker = "platform_machine == 'x86_64' and sys_platform == 'linux'" },
{ name = "setuptools" },
{ name = "sympy" },
{ name = "setuptools", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "sympy", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
{ name = "triton", marker = "platform_machine == 'x86_64' and sys_platform == 'linux'" },
{ name = "typing-extensions" },
{ name = "typing-extensions", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
]
wheels = [
{ url = "https://download.pytorch.org/whl/cu128/torch-2.8.0%2Bcu128-cp312-cp312-manylinux_2_28_x86_64.whl", hash = "sha256:4354fc05bb79b208d6995a04ca1ceef6a9547b1c4334435574353d381c55087c" },
@ -2008,7 +2133,8 @@ dependencies = [
{ name = "lightning-utilities" },
{ name = "numpy" },
{ name = "packaging" },
{ name = "torch" },
{ name = "torch", version = "2.8.0", source = { registry = "https://pypi.org/simple" }, marker = "sys_platform != 'linux' and sys_platform != 'win32'" },
{ name = "torch", version = "2.8.0+cu128", source = { registry = "https://download.pytorch.org/whl/cu128" }, marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
]
sdist = { url = "https://files.pythonhosted.org/packages/85/2e/48a887a59ecc4a10ce9e8b35b3e3c5cef29d902c4eac143378526e7485cb/torchmetrics-1.8.2.tar.gz", hash = "sha256:cf64a901036bf107f17a524009eea7781c9c5315d130713aeca5747a686fe7a5", size = 580679, upload-time = "2025-09-03T14:00:54.077Z" }
wheels = [
@ -2032,7 +2158,7 @@ name = "triton"
version = "3.4.0"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "setuptools" },
{ name = "setuptools", marker = "sys_platform == 'linux' or sys_platform == 'win32'" },
]
wheels = [
{ url = "https://files.pythonhosted.org/packages/d0/66/b1eb52839f563623d185f0927eb3530ee4d5ffe9d377cdaf5346b306689e/triton-3.4.0-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:31c1d84a5c0ec2c0f8e8a072d7fd150cab84a9c239eaddc6706c081bfae4eb04", size = 155560068, upload-time = "2025-07-30T19:58:37.081Z" },