[Feature] Prediction settings list on User page (#276)

I have added a list of other prediction settings to the User page and a way to change a setting to the default.
<img width="500" alt="{4EFA1273-E53A-4333-948B-8AE3597821A8}.png" src="attachments/048fdc83-1c3e-41d2-a59b-44b0337a05bf">

Co-authored-by: Tim Lorsbach <tim@lorsba.ch>
Reviewed-on: enviPath/enviPy#276
Reviewed-by: jebus <lorsbach@envipath.com>
Co-authored-by: Liam Brydon <lbry121@aucklanduni.ac.nz>
Co-committed-by: Liam Brydon <lbry121@aucklanduni.ac.nz>

.env.local.example

@@ -20,3 +20,16 @@ LOG_LEVEL='INFO'
 SERVER_URL='http://localhost:8000'
 PLUGINS_ENABLED=True
 EP_DATA_DIR='data'
+EMAIL_HOST_USER='admin@envipath.com'
+EMAIL_HOST_PASSWORD='dummy-password'
+
+DEFAULT_FROM_EMAIL="test@test.com"
+SERVER_EMAIL='test@test.com'
+
+# Testing settings VScode
+DJANGO_SETTINGS_MODULE='envipath.settings'
+MANAGE_PY_PATH='./manage.py'
+
+APPLICABILITY_DOMAIN_ENABLED=True
+ENVIFORMER_PRESENT=True
+MODEL_BUILDING_ENABLED=True

.gitea/actions/setup-envipy/action.yaml

@@ -0,0 +1,72 @@
+name: 'Setup enviPy Environment'
+description: 'Shared setup for enviPy CI - installs dependencies and prepares environment'
+
+inputs:
+  skip-frontend:
+    description: 'Skip frontend build steps (pnpm, tailwind)'
+    required: false
+    default: 'false'
+  skip-playwright:
+    description: 'Skip Playwright installation'
+    required: false
+    default: 'false'
+  ssh-private-key:
+    description: 'SSH private key for git access'
+    required: true
+  run-migrations:
+    description: 'Run Django migrations after setup'
+    required: false
+    default: 'true'
+
+runs:
+  using: "composite"
+  steps:
+    - name: Setup ssh
+      shell: bash
+      run: |
+        mkdir -p ~/.ssh
+        echo "${{ inputs.ssh-private-key }}" > ~/.ssh/id_ed25519
+        chmod 600 ~/.ssh/id_ed25519
+        ssh-keyscan git.envipath.com >> ~/.ssh/known_hosts
+        eval $(ssh-agent -s)
+        ssh-add ~/.ssh/id_ed25519
+
+    - name: Setup Python venv
+      shell: bash
+      run: |
+        uv sync --locked --all-extras --dev
+
+    - name: Install Playwright
+      if: inputs.skip-playwright == 'false'
+      shell: bash
+      run: |
+        source .venv/bin/activate
+        playwright install --with-deps
+
+    - name: Build Frontend
+      if: inputs.skip-frontend == 'false'
+      shell: bash
+      run: |
+        uv run python scripts/pnpm_wrapper.py install
+        cat << 'EOF' > pnpm-workspace.yaml
+        onlyBuiltDependencies:
+          - '@parcel/watcher'
+          - '@tailwindcss/oxide'
+        EOF
+        uv run python scripts/pnpm_wrapper.py run build
+
+    - name: Wait for Postgres
+      shell: bash
+      run: |
+        until pg_isready -h postgres -U ${{ env.POSTGRES_USER }}; do
+          echo "Waiting for postgres..."
+          sleep 2
+        done
+        echo "Postgres is ready!"
+
+    - name: Run Django Migrations
+      if: inputs.run-migrations == 'true'
+      shell: bash
+      run: |
+        source .venv/bin/activate
+        python manage.py migrate --noinput

.gitea/docker/Dockerfile.ci

@@ -0,0 +1,53 @@
+# Custom CI Docker image for Gitea runners
+# Pre-installs Node.js 24, pnpm 10, uv, and system dependencies
+# to eliminate setup time in CI workflows
+
+FROM ubuntu:24.04
+
+# Prevent interactive prompts during package installation
+ENV DEBIAN_FRONTEND=noninteractive
+
+# Install system dependencies
+RUN apt-get update && \
+    apt-get install -y \
+      postgresql-client \
+      redis-tools \
+      openjdk-11-jre-headless \
+      curl \
+      ca-certificates \
+      gnupg \
+      lsb-release \
+      git \
+      ssh \
+      libxrender1 \
+      libxext6 \
+      libfontconfig1 \
+      libfreetype6 \
+      libcairo2 \
+      libglib2.0-0t64 \
+      && rm -rf /var/lib/apt/lists/*
+
+# Install Node.js 24 via NodeSource
+RUN curl -fsSL https://deb.nodesource.com/setup_24.x | bash - && \
+    apt-get install -y nodejs && \
+    rm -rf /var/lib/apt/lists/*
+
+# Enable corepack and install pnpm 10
+RUN corepack enable && \
+    corepack prepare pnpm@10 --activate
+
+# Install uv https://docs.astral.sh/uv/guides/integration/docker/#available-images
+COPY --from=ghcr.io/astral-sh/uv:latest /uv /uvx /bin/
+ENV PATH="/root/.cargo/bin:${PATH}"
+
+# Verify installations
+RUN node --version && \
+    npm --version && \
+    pnpm --version && \
+    uv --version && \
+    pg_isready --version && \
+    redis-cli --version && \
+    java -version
+
+# Set working directory
+WORKDIR /workspace

.gitea/workflows/api-ci.yaml

@@ -0,0 +1,86 @@
+name: API CI
+
+on:
+  pull_request:
+    branches:
+      - develop
+    paths:
+      - 'epapi/**'
+      - 'epdb/models.py'  # API depends on models
+      - 'epdb/logic.py'   # API depends on business logic
+      - 'tests/fixtures/**'  # API tests use fixtures
+  workflow_dispatch:
+
+jobs:
+  api-tests:
+    if: ${{ !contains(gitea.event.pull_request.title, 'WIP') }}
+    runs-on: ubuntu-latest
+    container:
+      image: git.envipath.com/envipath/envipy-ci:latest
+
+    services:
+      postgres:
+        image: postgres:16
+        env:
+          POSTGRES_USER: ${{ vars.POSTGRES_USER }}
+          POSTGRES_PASSWORD: ${{ secrets.POSTGRES_PASSWORD }}
+          POSTGRES_DB: ${{ vars.POSTGRES_DB }}
+        ports:
+          - ${{ vars.POSTGRES_PORT}}:5432
+        options: >-
+          --health-cmd="pg_isready -U postgres"
+          --health-interval=10s
+          --health-timeout=5s
+          --health-retries=5
+
+    env:
+      RUNNER_TOOL_CACHE: /toolcache
+      EP_DATA_DIR: /opt/enviPy/
+      ALLOWED_HOSTS: 127.0.0.1,localhost
+      DEBUG: True
+      LOG_LEVEL: INFO
+      MODEL_BUILDING_ENABLED: True
+      APPLICABILITY_DOMAIN_ENABLED: True
+      ENVIFORMER_PRESENT: True
+      ENVIFORMER_DEVICE: cpu
+      FLAG_CELERY_PRESENT: False
+      PLUGINS_ENABLED: True
+      SERVER_URL: http://localhost:8000
+      ADMIN_APPROVAL_REQUIRED: True
+      REGISTRATION_MANDATORY: True
+      LOG_DIR: ''
+      # DB
+      POSTGRES_SERVICE_NAME: postgres
+      POSTGRES_DB: ${{ vars.POSTGRES_DB }}
+      POSTGRES_USER: ${{ vars.POSTGRES_USER }}
+      POSTGRES_PASSWORD: ${{ secrets.POSTGRES_PASSWORD }}
+      POSTGRES_PORT: 5432
+      # SENTRY
+      SENTRY_ENABLED: False
+      # MS ENTRA
+      MS_ENTRA_ENABLED: False
+
+    steps:
+      - name: Checkout repository
+        uses: actions/checkout@v4
+
+      # Use shared setup action - skips frontend builds for API-only tests
+      - name: Setup enviPy Environment
+        uses: ./.gitea/actions/setup-envipy
+        with:
+          skip-frontend: 'true'
+          skip-playwright: 'false'
+          ssh-private-key: ${{ secrets.ENVIPY_CI_PRIVATE_KEY }}
+          run-migrations: 'true'
+
+      - name: Run API tests
+        run: |
+          .venv/bin/python manage.py test epapi -v 2
+
+      - name: Test API endpoints availability
+        run: |
+          .venv/bin/python manage.py runserver 0.0.0.0:8000 &
+          SERVER_PID=$!
+          sleep 5
+          curl -f http://localhost:8000/api/v1/docs || echo "API docs not available"
+          kill $SERVER_PID

.gitea/workflows/build-ci-image.yaml

@@ -0,0 +1,48 @@
+name: Build CI Docker Image
+
+on:
+  workflow_dispatch:
+  push:
+    branches:
+      - develop
+      - main
+    paths:
+      - '.gitea/docker/Dockerfile.ci'
+      - '.gitea/workflows/build-ci-image.yaml'
+
+jobs:
+  build-and-push:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout repository
+        uses: actions/checkout@v4
+
+      - name: Set up Docker Buildx
+        uses: docker/setup-buildx-action@v3
+
+      - name: Log in to container registry
+        uses: docker/login-action@v3
+        with:
+          registry: git.envipath.com
+          username: ${{ secrets.CI_REGISTRY_USER }}
+          password: ${{ secrets.CI_REGISTRY_PASSWORD }}
+
+      - name: Extract metadata
+        id: meta
+        uses: docker/metadata-action@v5
+        with:
+          images: git.envipath.com/envipath/envipy-ci
+          tags: |
+            type=raw,value=latest
+            type=sha,prefix={{branch}}-
+
+      - name: Build and push Docker image
+        uses: docker/build-push-action@v5
+        with:
+          context: .
+          file: .gitea/docker/Dockerfile.ci
+          push: true
+          tags: ${{ steps.meta.outputs.tags }}
+          labels: ${{ steps.meta.outputs.labels }}
+          cache-from: type=registry,ref=git.envipath.com/envipath/envipy-ci:latest
+          cache-to: type=inline

.gitea/workflows/ci.yaml

@@ -8,7 +8,10 @@ on:
 
 jobs:
   test:
+    if: ${{ !contains(gitea.event.pull_request.title, 'WIP') }}
     runs-on: ubuntu-latest
+    container:
+      image: git.envipath.com/envipath/envipy-ci:latest
 
     services:
       postgres:
@@ -40,7 +43,7 @@ jobs:
       EP_DATA_DIR: /opt/enviPy/
       ALLOWED_HOSTS: 127.0.0.1,localhost
       DEBUG: True
-      LOG_LEVEL: DEBUG
+      LOG_LEVEL: INFO
       MODEL_BUILDING_ENABLED: True
       APPLICABILITY_DOMAIN_ENABLED: True
       ENVIFORMER_PRESENT: True
@@ -63,54 +66,22 @@ jobs:
       MS_ENTRA_ENABLED: False
 
     steps:
-
       - name: Checkout repository
         uses: actions/checkout@v4
 
-      - name: Install system tools via apt
+      # Use shared setup action - includes all dependencies and migrations
-        run: |
+      - name: Setup enviPy Environment
-          sudo apt-get update
+        uses: ./.gitea/actions/setup-envipy
-          sudo apt-get install -y postgresql-client redis-tools openjdk-11-jre-headless
-
-      - name: Setup ssh
-        run: |
-          echo "${{ secrets.ENVIPY_CI_PRIVATE_KEY }}" > ~/.ssh/id_ed25519
-          chmod 600 ~/.ssh/id_ed25519
-          ssh-keyscan git.envipath.com >> ~/.ssh/known_hosts
-          eval $(ssh-agent -s)
-          ssh-add ~/.ssh/id_ed25519
-
-      - name: Install pnpm
-        uses: pnpm/action-setup@v4
         with:
-          version: 10
+          skip-frontend: 'false'
+          skip-playwright: 'false'
+          ssh-private-key: ${{ secrets.ENVIPY_CI_PRIVATE_KEY }}
+          run-migrations: 'true'
 
-      - name: Use Node.js
+      - name: Run frontend tests
-        uses: actions/setup-node@v4
-        with:
-          node-version: 20
-          cache: "pnpm"
-
-      - name: Install uv
-        uses: astral-sh/setup-uv@v6
-        with:
-          enable-cache: true
-
-      - name: Setup venv
         run: |
-          uv sync --locked --all-extras --dev
+          .venv/bin/python manage.py test --tag frontend
-
-      - name: Wait for services
-        run: |
-          until pg_isready -h postgres -U postgres; do sleep 2; done
-          # until redis-cli -h redis ping; do sleep 2; done
-
-      - name: Run Django Migrations
-        run: |
-          source .venv/bin/activate
-          python manage.py migrate --noinput
 
       - name: Run Django tests
         run: |
-          source .venv/bin/activate
+          .venv/bin/python manage.py test tests --exclude-tag slow --exclude-tag frontend
-          python manage.py test tests --exclude-tag slow

.gitignore

@@ -1,17 +1,375 @@
-*.pyc
+
+
+
+### Python ###
+
+# Byte-compiled / optimized / DLL files
+__pycache__/
+*.py[codz]
+*$py.class
+
+# C extensions
+*.so
+
+# Distribution / packaging
+.Python
+build/
+develop-eggs/
+dist/
+downloads/
+eggs/
+.eggs/
+lib/
+lib64/
+parts/
+sdist/
+var/
+wheels/
+share/python-wheels/
+*.egg-info/
+.installed.cfg
+*.egg
+MANIFEST
+
+# PyInstaller
+#   Usually these files are written by a python script from a template
+#   before PyInstaller builds the exe, so as to inject date/other infos into it.
+*.manifest
+*.spec
+
+# Installer logs
+pip-log.txt
+pip-delete-this-directory.txt
+
+# Unit test / coverage reports
+htmlcov/
+.tox/
+.nox/
+.coverage
+.coverage.*
+.cache
+nosetests.xml
+coverage.xml
+*.cover
+*.py.cover
+.hypothesis/
+.pytest_cache/
+cover/
+
+# Translations
+*.mo
+*.pot
+
+# Django stuff:
+*.log
+local_settings.py
 db.sqlite3
-.idea/
+db.sqlite3-journal
 static/admin/
 static/django_extensions/
+
+# Flask stuff:
+instance/
+.webassets-cache
+
+# Scrapy stuff:
+.scrapy
+
+# Sphinx documentation
+docs/_build/
+
+# PyBuilder
+.pybuilder/
+target/
+
+# Jupyter Notebook
+.ipynb_checkpoints
+
+# IPython
+profile_default/
+ipython_config.py
+
+
+# pdm
+#   Similar to Pipfile.lock, it is generally recommended to include pdm.lock in version control.
+#   pdm recommends including project-wide configuration in pdm.toml, but excluding .pdm-python.
+#   https://pdm-project.org/en/latest/usage/project/#working-with-version-control
+# pdm.lock
+# pdm.toml
+.pdm-python
+.pdm-build/
+
+# pixi
+#   Similar to Pipfile.lock, it is generally recommended to include pixi.lock in version control.
+# pixi.lock
+#   Pixi creates a virtual environment in the .pixi directory, just like venv module creates one
+#   in the .venv directory. It is recommended not to include this directory in version control.
+.pixi
+
+# PEP 582; used by e.g. github.com/David-OConnor/pyflow and github.com/pdm-project/pdm
+__pypackages__/
+
+# Celery stuff
+celerybeat-schedule
+celerybeat.pid
+
+# Redis
+*.rdb
+*.aof
+*.pid
+
+# RabbitMQ
+mnesia/
+rabbitmq/
+rabbitmq-data/
+
+# ActiveMQ
+activemq-data/
+
+# SageMath parsed files
+*.sage.py
+
+# Environments
 .env
+.envrc
+.venv
+env/
+venv/
+ENV/
+env.bak/
+venv.bak/
+
+# Spyder project settings
+.spyderproject
+.spyproject
+
+# Rope project settings
+.ropeproject
+
+# mkdocs documentation
+/site
+
+# mypy
+.mypy_cache/
+.dmypy.json
+dmypy.json
+
+# Pyre type checker
+.pyre/
+
+# pytype static type analyzer
+.pytype/
+
+# Cython debug symbols
+cython_debug/
+
+# PyCharm
+#   JetBrains specific template is maintained in a separate JetBrains.gitignore that can
+#   be found at https://github.com/github/gitignore/blob/main/Global/JetBrains.gitignore
+#   and can be added to the global gitignore or merged into this file.  For a more nuclear
+#   option (not recommended) you can uncomment the following to ignore the entire idea folder.
+.idea/
+
+# Abstra
+#   Abstra is an AI-powered process automation framework.
+#   Ignore directories containing user credentials, local state, and settings.
+#   Learn more at https://abstra.io/docs
+.abstra/
+
+# Visual Studio Code
+#   Visual Studio Code specific template is maintained in a separate VisualStudioCode.gitignore
+#   that can be found at https://github.com/github/gitignore/blob/main/Global/VisualStudioCode.gitignore
+#   and can be added to the global gitignore or merged into this file. However, if you prefer,
+#   you could uncomment the following to ignore the entire vscode folder
+.vscode/
+*.code-workspace
+
+# Ruff stuff:
+.ruff_cache/
+
+# UV cache
+.uv-cache/
+
+# PyPI configuration file
+.pypirc
+
+# Marimo
+marimo/_static/
+marimo/_lsp/
+__marimo__/
+
+# Streamlit
+.streamlit/secrets.toml
+
+### Agents ###
+.claude/
+.codex/
+.cursor/
+.github/prompts/
+.junie/
+.windsurf/
+
+AGENTS.md
+CLAUDE.md
+GEMINI.md
+.aider.*
+
+### Node.js ###
+
+# Logs
+logs
+*.log
+npm-debug.log*
+yarn-debug.log*
+yarn-error.log*
+lerna-debug.log*
+
+# Diagnostic reports (https://nodejs.org/api/report.html)
+report.[0-9]*.[0-9]*.[0-9]*.[0-9]*.json
+
+# Runtime data
+pids
+*.pid
+*.seed
+*.pid.lock
+
+# Directory for instrumented libs generated by jscoverage/JSCover
+lib-cov
+
+# Coverage directory used by tools like istanbul
+coverage
+*.lcov
+
+# nyc test coverage
+.nyc_output
+
+# Grunt intermediate storage (https://gruntjs.com/creating-plugins#storing-task-files)
+.grunt
+
+# Bower dependency directory (https://bower.io/)
+bower_components
+
+# node-waf configuration
+.lock-wscript
+
+# Compiled binary addons (https://nodejs.org/api/addons.html)
+build/Release
+
+# Dependency directories
+node_modules/
+jspm_packages/
+
+# Snowpack dependency directory (https://snowpack.dev/)
+web_modules/
+
+# TypeScript cache
+*.tsbuildinfo
+
+# Optional npm cache directory
+.npm
+
+# Optional eslint cache
+.eslintcache
+
+# Optional stylelint cache
+.stylelintcache
+
+# Optional REPL history
+.node_repl_history
+
+# Output of 'npm pack'
+*.tgz
+
+# Yarn Integrity file
+.yarn-integrity
+
+# dotenv environment variable files
+.env
+.env.*
+!.env.example
+
+# parcel-bundler cache (https://parceljs.org/)
+.cache
+.parcel-cache
+
+# Next.js build output
+.next
+out
+
+# Nuxt.js build / generate output
+.nuxt
+dist
+.output
+
+# Gatsby files
+.cache/
+# Comment in the public line in if your project uses Gatsby and not Next.js
+# https://nextjs.org/blog/next-9-1#public-directory-support
+# public
+
+# vuepress build output
+.vuepress/dist
+
+# vuepress v2.x temp and cache directory
+.temp
+.cache
+
+# Sveltekit cache directory
+.svelte-kit/
+
+# vitepress build output
+**/.vitepress/dist
+
+# vitepress cache directory
+**/.vitepress/cache
+
+# Docusaurus cache and generated files
+.docusaurus
+
+# Serverless directories
+.serverless/
+
+# FuseBox cache
+.fusebox/
+
+# DynamoDB Local files
+.dynamodb/
+
+# Firebase cache directory
+.firebase/
+
+# TernJS port file
+.tern-port
+
+# Stores VSCode versions used for testing VSCode extensions
+.vscode-test
+
+# yarn v3
+.pnp.*
+.yarn/*
+!.yarn/patches
+!.yarn/plugins
+!.yarn/releases
+!.yarn/sdks
+!.yarn/versions
+
+# Vite files
+vite.config.js.timestamp-*
+vite.config.ts.timestamp-*
+.vite/
+
+### Custom ###
+
 debug.log
 scratches/
-
+test-results/
 data/
+*.arff
 
-.DS_Store
+# Auto generated
-
-node_modules/
 static/css/output.css
 
-*.code-workspace
+# macOS system files
+.DS_Store
+.Trashes
+._*

envipath/api.py

@@ -1,4 +1,4 @@
-from epdb.api import router as epdb_app_router
+from epapi.v1.router import router as v1_router  # Refactored API from epdb.api_v2
 from epdb.legacy_api import router as epdb_legacy_app_router
 from ninja import NinjaAPI
 
@@ -8,5 +8,5 @@ api_v1 = NinjaAPI(title="API V1 Docs", urls_namespace="api-v1")
 api_legacy = NinjaAPI(title="Legacy API Docs", urls_namespace="api-legacy")
 
 # Add routers
-api_v1.add_router("/", epdb_app_router)
+api_v1.add_router("/", v1_router)
 api_legacy.add_router("/", epdb_legacy_app_router)

envipath/settings.py

@@ -48,10 +48,25 @@ INSTALLED_APPS = [
     "django_extensions",
     "oauth2_provider",
     # Custom
+    "epapi",  # API endpoints (v1, etc.)
     "epdb",
-    "migration",
+    # "migration",
 ]
 
+TENANT = os.environ.get("TENANT", "public")
+
+if TENANT != "public":
+    INSTALLED_APPS.append(TENANT)
+
+EPDB_PACKAGE_MODEL = os.environ.get("EPDB_PACKAGE_MODEL", "epdb.Package")
+
+
+def GET_PACKAGE_MODEL():
+    from django.apps import apps
+
+    return apps.get_model(EPDB_PACKAGE_MODEL)
+
+
 AUTHENTICATION_BACKENDS = [
     "django.contrib.auth.backends.ModelBackend",
 ]
@@ -184,6 +199,12 @@ if not os.path.exists(LOG_DIR):
     os.mkdir(LOG_DIR)
 
 PLUGIN_DIR = os.path.join(EP_DATA_DIR, "plugins")
+
+API_PAGINATION_DEFAULT_PAGE_SIZE = int(os.environ.get("API_PAGINATION_DEFAULT_PAGE_SIZE", 50))
+PAGINATION_MAX_PER_PAGE_SIZE = int(
+    os.environ.get("API_PAGINATION_MAX_PAGE_SIZE", 100)
+)  # Ninja override
+
 if not os.path.exists(PLUGIN_DIR):
     os.mkdir(PLUGIN_DIR)
 
@@ -341,6 +362,7 @@ FLAGS = {
 # -> /password_reset/done is covered as well
 LOGIN_EXEMPT_URLS = [
     "/register",
+    "/api/v1/",  # Let API handle its own authentication
     "/api/legacy/",
     "/o/token/",
     "/o/userinfo/",
@@ -352,7 +374,7 @@ LOGIN_EXEMPT_URLS = [
     "/cookie-policy",
     "/about",
     "/contact",
-    "/jobs",
+    "/careers",
     "/cite",
     "/legal",
 ]

envipath/urls.py

@@ -23,12 +23,20 @@ from .api import api_v1, api_legacy
 
 urlpatterns = [
     path("", include("epdb.urls")),
-    path("", include("migration.urls")),
     path("admin/", admin.site.urls),
     path("api/v1/", api_v1.urls),
     path("api/legacy/", api_legacy.urls),
     path("o/", include("oauth2_provider.urls", namespace="oauth2_provider")),
 ]
 
+if "migration" in s.INSTALLED_APPS:
+    urlpatterns.append(path("", include("migration.urls")))
+
 if s.MS_ENTRA_ENABLED:
     urlpatterns.append(path("", include("epauth.urls")))
+
+# Custom error handlers
+handler400 = "epdb.views.handler400"
+handler403 = "epdb.views.handler403"
+handler404 = "epdb.views.handler404"
+handler500 = "epdb.views.handler500"

epapi/apps.py

@@ -0,0 +1,6 @@
+from django.apps import AppConfig
+
+
+class EpapiConfig(AppConfig):
+    default_auto_field = "django.db.models.BigAutoField"
+    name = "epapi"

epapi/tests/__init__.py

@@ -0,0 +1 @@
+# Tests for epapi app

epapi/tests/v1/__init__.py

@@ -0,0 +1 @@
+# Tests for epapi v1 API

epapi/tests/v1/test_api_permissions.py

@@ -0,0 +1,532 @@
+from django.test import TestCase, tag
+
+from epdb.logic import GroupManager, PackageManager, UserManager
+from epdb.models import (
+    Compound,
+    GroupPackagePermission,
+    Permission,
+    UserPackagePermission,
+)
+
+
+@tag("api", "end2end")
+class APIPermissionTestBase(TestCase):
+    """
+    Base class for API permission tests.
+
+    Sets up common test data:
+    - user1: Owner of packages
+    - user2: User with various permissions
+    - user3: User with no permissions
+    - reviewed_package: Public package (reviewed=True)
+    - unreviewed_package_owned: Unreviewed package owned by user1
+    - unreviewed_package_read: Unreviewed package with READ permission for user2
+    - unreviewed_package_write: Unreviewed package with WRITE permission for user2
+    - unreviewed_package_all: Unreviewed package with ALL permission for user2
+    - unreviewed_package_no_access: Unreviewed package with no permissions for user2/user3
+    - group_package: Unreviewed package accessible via group permission
+    - test_group: Group containing user2
+    """
+
+    @classmethod
+    def setUpTestData(cls):
+        # Create users
+        cls.user1 = UserManager.create_user(
+            "permission-user1",
+            "permission-user1@envipath.com",
+            "SuperSafe",
+            set_setting=False,
+            add_to_group=False,
+            is_active=True,
+        )
+        cls.user2 = UserManager.create_user(
+            "permission-user2",
+            "permission-user2@envipath.com",
+            "SuperSafe",
+            set_setting=False,
+            add_to_group=False,
+            is_active=True,
+        )
+        cls.user3 = UserManager.create_user(
+            "permission-user3",
+            "permission-user3@envipath.com",
+            "SuperSafe",
+            set_setting=False,
+            add_to_group=False,
+            is_active=True,
+        )
+
+        # Delete default packages to ensure clean test data
+        for user in [cls.user1, cls.user2, cls.user3]:
+            default_pkg = user.default_package
+            user.default_package = None
+            user.save()
+            if default_pkg:
+                default_pkg.delete()
+
+        # Create reviewed package (public)
+        cls.reviewed_package = PackageManager.create_package(
+            cls.user1, "Reviewed Package", "Public package"
+        )
+        cls.reviewed_package.reviewed = True
+        cls.reviewed_package.save()
+
+        # Create unreviewed packages with various permissions
+        cls.unreviewed_package_owned = PackageManager.create_package(
+            cls.user1, "User1 Owned Package", "Owned by user1"
+        )
+
+        cls.unreviewed_package_read = PackageManager.create_package(
+            cls.user1, "User2 Read Package", "User2 has READ permission"
+        )
+        UserPackagePermission.objects.create(
+            user=cls.user2, package=cls.unreviewed_package_read, permission=Permission.READ[0]
+        )
+
+        cls.unreviewed_package_write = PackageManager.create_package(
+            cls.user1, "User2 Write Package", "User2 has WRITE permission"
+        )
+        UserPackagePermission.objects.create(
+            user=cls.user2, package=cls.unreviewed_package_write, permission=Permission.WRITE[0]
+        )
+
+        cls.unreviewed_package_all = PackageManager.create_package(
+            cls.user1, "User2 All Package", "User2 has ALL permission"
+        )
+        UserPackagePermission.objects.create(
+            user=cls.user2, package=cls.unreviewed_package_all, permission=Permission.ALL[0]
+        )
+
+        cls.unreviewed_package_no_access = PackageManager.create_package(
+            cls.user1, "No Access Package", "No permissions for user2/user3"
+        )
+
+        # Create group and group package
+        cls.test_group = GroupManager.create_group(
+            cls.user1, "Test Group", "Group for permission testing"
+        )
+        cls.test_group.user_member.add(cls.user2)
+        cls.test_group.save()
+
+        cls.group_package = PackageManager.create_package(
+            cls.user1, "Group Package", "Accessible via group permission"
+        )
+        GroupPackagePermission.objects.create(
+            group=cls.test_group, package=cls.group_package, permission=Permission.READ[0]
+        )
+
+        # Create test compounds in each package
+        cls.reviewed_compound = Compound.create(
+            cls.reviewed_package, "C", "Reviewed Compound", "Test compound"
+        )
+        cls.owned_compound = Compound.create(
+            cls.unreviewed_package_owned, "CC", "Owned Compound", "Test compound"
+        )
+        cls.read_compound = Compound.create(
+            cls.unreviewed_package_read, "CCC", "Read Compound", "Test compound"
+        )
+        cls.write_compound = Compound.create(
+            cls.unreviewed_package_write, "CCCC", "Write Compound", "Test compound"
+        )
+        cls.all_compound = Compound.create(
+            cls.unreviewed_package_all, "CCCCC", "All Compound", "Test compound"
+        )
+        cls.no_access_compound = Compound.create(
+            cls.unreviewed_package_no_access, "CCCCCC", "No Access Compound", "Test compound"
+        )
+        cls.group_compound = Compound.create(
+            cls.group_package, "CCCCCCC", "Group Compound", "Test compound"
+        )
+
+
+@tag("api", "end2end")
+class PackageListPermissionTest(APIPermissionTestBase):
+    """
+    Test permissions for /api/v1/packages/ endpoint.
+
+    Special case: This endpoint allows anonymous access (auth=None)
+    """
+
+    ENDPOINT = "/api/v1/packages/"
+
+    def test_anonymous_user_sees_only_reviewed_packages(self):
+        """Anonymous users should only see reviewed packages."""
+        self.client.logout()
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # Should only see reviewed package
+        self.assertEqual(payload["total_items"], 1)
+        self.assertEqual(payload["items"][0]["uuid"], str(self.reviewed_package.uuid))
+        self.assertEqual(payload["items"][0]["review_status"], "reviewed")
+
+    def test_authenticated_user_sees_all_readable_packages(self):
+        """Authenticated users see reviewed + packages they have access to."""
+        self.client.force_login(self.user2)
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # user2 should see:
+        # - reviewed_package (public)
+        # - unreviewed_package_read (READ permission)
+        # - unreviewed_package_write (WRITE permission)
+        # - unreviewed_package_all (ALL permission)
+        # - group_package (via group membership)
+        # Total: 5 packages
+        self.assertEqual(payload["total_items"], 5)
+
+        visible_uuids = {item["uuid"] for item in payload["items"]}
+        expected_uuids = {
+            str(self.reviewed_package.uuid),
+            str(self.unreviewed_package_read.uuid),
+            str(self.unreviewed_package_write.uuid),
+            str(self.unreviewed_package_all.uuid),
+            str(self.group_package.uuid),
+        }
+        self.assertEqual(visible_uuids, expected_uuids)
+
+    def test_owner_sees_all_owned_packages(self):
+        """Package owner sees all packages they created."""
+        self.client.force_login(self.user1)
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # user1 owns all packages
+        # Total: 7 packages (all packages created in setUpTestData)
+        self.assertEqual(payload["total_items"], 7)
+
+    def test_filter_by_review_status_true(self):
+        """Filter to show only reviewed packages."""
+        self.client.force_login(self.user2)
+        response = self.client.get(self.ENDPOINT, {"review_status": True})
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # Only reviewed_package
+        self.assertEqual(payload["total_items"], 1)
+        self.assertTrue(all(item["review_status"] == "reviewed" for item in payload["items"]))
+
+    def test_filter_by_review_status_false(self):
+        """Filter to show only unreviewed packages."""
+        self.client.force_login(self.user2)
+        response = self.client.get(self.ENDPOINT, {"review_status": False})
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # user2's accessible unreviewed packages: 4
+        self.assertEqual(payload["total_items"], 4)
+        self.assertTrue(all(item["review_status"] == "unreviewed" for item in payload["items"]))
+
+    def test_anonymous_filter_unreviewed_returns_empty(self):
+        """Anonymous users get no results when filtering for unreviewed."""
+        self.client.logout()
+        response = self.client.get(self.ENDPOINT, {"review_status": False})
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        self.assertEqual(payload["total_items"], 0)
+
+
+@tag("api", "end2end")
+class GlobalCompoundListPermissionTest(APIPermissionTestBase):
+    """
+    Test permissions for /api/v1/compounds/ endpoint.
+
+    This endpoint requires authentication.
+    """
+
+    ENDPOINT = "/api/v1/compounds/"
+
+    def test_anonymous_user_cannot_access(self):
+        """Anonymous users should get 401 Unauthorized."""
+        self.client.logout()
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 401)
+
+    def test_authenticated_user_sees_compounds_from_readable_packages(self):
+        """Authenticated users see compounds from packages they can read."""
+        self.client.force_login(self.user2)
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # user2 should see compounds from:
+        # - reviewed_package (public)
+        # - unreviewed_package_read (READ permission)
+        # - unreviewed_package_write (WRITE permission)
+        # - unreviewed_package_all (ALL permission)
+        # - group_package (via group membership)
+        # Total: 5 compounds
+        self.assertEqual(payload["total_items"], 5)
+
+        visible_uuids = {item["uuid"] for item in payload["items"]}
+        expected_uuids = {
+            str(self.reviewed_compound.uuid),
+            str(self.read_compound.uuid),
+            str(self.write_compound.uuid),
+            str(self.all_compound.uuid),
+            str(self.group_compound.uuid),
+        }
+        self.assertEqual(visible_uuids, expected_uuids)
+
+    def test_user_without_permission_cannot_see_compound(self):
+        """User without permission to package cannot see its compounds."""
+        self.client.force_login(self.user3)
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # user3 should only see compounds from reviewed_package
+        self.assertEqual(payload["total_items"], 1)
+        self.assertEqual(payload["items"][0]["uuid"], str(self.reviewed_compound.uuid))
+
+    def test_owner_sees_all_compounds(self):
+        """Package owner sees all compounds they created."""
+        self.client.force_login(self.user1)
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # user1 owns all packages, so sees all compounds
+        self.assertEqual(payload["total_items"], 7)
+
+    def test_read_permission_allows_viewing(self):
+        """READ permission allows viewing compounds."""
+        self.client.force_login(self.user2)
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # Check that read_compound is included
+        uuids = [item["uuid"] for item in payload["items"]]
+        self.assertIn(str(self.read_compound.uuid), uuids)
+
+    def test_write_permission_allows_viewing(self):
+        """WRITE permission also allows viewing compounds."""
+        self.client.force_login(self.user2)
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # Check that write_compound is included
+        uuids = [item["uuid"] for item in payload["items"]]
+        self.assertIn(str(self.write_compound.uuid), uuids)
+
+    def test_all_permission_allows_viewing(self):
+        """ALL permission allows viewing compounds."""
+        self.client.force_login(self.user2)
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # Check that all_compound is included
+        uuids = [item["uuid"] for item in payload["items"]]
+        self.assertIn(str(self.all_compound.uuid), uuids)
+
+    def test_group_permission_allows_viewing(self):
+        """Group membership grants access to group-permitted packages."""
+        self.client.force_login(self.user2)
+        response = self.client.get(self.ENDPOINT)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # Check that group_compound is included
+        uuids = [item["uuid"] for item in payload["items"]]
+        self.assertIn(str(self.group_compound.uuid), uuids)
+
+
+@tag("api", "end2end")
+class PackageScopedCompoundListPermissionTest(APIPermissionTestBase):
+    """
+    Test permissions for /api/v1/package/{uuid}/compound/ endpoint.
+
+    This endpoint requires authentication AND package access.
+    """
+
+    def test_anonymous_user_cannot_access_reviewed_package(self):
+        """Anonymous users should get 401 even for reviewed packages."""
+        self.client.logout()
+        endpoint = f"/api/v1/package/{self.reviewed_package.uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 401)
+
+    def test_authenticated_user_can_access_reviewed_package(self):
+        """Authenticated users can access reviewed packages."""
+        self.client.force_login(self.user3)
+        endpoint = f"/api/v1/package/{self.reviewed_package.uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        self.assertEqual(payload["total_items"], 1)
+        self.assertEqual(payload["items"][0]["uuid"], str(self.reviewed_compound.uuid))
+
+    def test_user_can_access_package_with_read_permission(self):
+        """User with READ permission can access package-scoped endpoint."""
+        self.client.force_login(self.user2)
+        endpoint = f"/api/v1/package/{self.unreviewed_package_read.uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        self.assertEqual(payload["total_items"], 1)
+        self.assertEqual(payload["items"][0]["uuid"], str(self.read_compound.uuid))
+
+    def test_user_can_access_package_with_write_permission(self):
+        """User with WRITE permission can access package-scoped endpoint."""
+        self.client.force_login(self.user2)
+        endpoint = f"/api/v1/package/{self.unreviewed_package_write.uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        self.assertEqual(payload["total_items"], 1)
+        self.assertEqual(payload["items"][0]["uuid"], str(self.write_compound.uuid))
+
+    def test_user_can_access_package_with_all_permission(self):
+        """User with ALL permission can access package-scoped endpoint."""
+        self.client.force_login(self.user2)
+        endpoint = f"/api/v1/package/{self.unreviewed_package_all.uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        self.assertEqual(payload["total_items"], 1)
+        self.assertEqual(payload["items"][0]["uuid"], str(self.all_compound.uuid))
+
+    def test_user_cannot_access_package_without_permission(self):
+        """User without permission gets 403 Forbidden."""
+        self.client.force_login(self.user2)
+        endpoint = f"/api/v1/package/{self.unreviewed_package_no_access.uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 403)
+
+    def test_nonexistent_package_returns_404(self):
+        """Request for non-existent package returns 404."""
+        self.client.force_login(self.user2)
+        fake_uuid = "00000000-0000-0000-0000-000000000000"
+        endpoint = f"/api/v1/package/{fake_uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 404)
+
+    def test_owner_can_access_owned_package(self):
+        """Package owner can access their package."""
+        self.client.force_login(self.user1)
+        endpoint = f"/api/v1/package/{self.unreviewed_package_owned.uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        self.assertEqual(payload["total_items"], 1)
+        self.assertEqual(payload["items"][0]["uuid"], str(self.owned_compound.uuid))
+
+    def test_group_member_can_access_group_package(self):
+        """Group member can access package via group permission."""
+        self.client.force_login(self.user2)
+        endpoint = f"/api/v1/package/{self.group_package.uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        self.assertEqual(payload["total_items"], 1)
+        self.assertEqual(payload["items"][0]["uuid"], str(self.group_compound.uuid))
+
+    def test_non_group_member_cannot_access_group_package(self):
+        """Non-group member cannot access package with only group permission."""
+        self.client.force_login(self.user3)
+        endpoint = f"/api/v1/package/{self.group_package.uuid}/compound/"
+        response = self.client.get(endpoint)
+
+        self.assertEqual(response.status_code, 403)
+
+
+@tag("api", "end2end")
+class MultiResourcePermissionTest(APIPermissionTestBase):
+    """
+    Test that permission system works consistently across all resource types.
+
+    Tests a sample of other endpoints to ensure permission logic is consistent.
+    """
+
+    def test_rules_endpoint_respects_permissions(self):
+        """Rules endpoint uses same permission logic."""
+        from epdb.models import SimpleAmbitRule
+
+        # Create rule in no-access package
+        rule = SimpleAmbitRule.create(
+            self.unreviewed_package_no_access, "Test Rule", "Test", "[C:1]>>[C:1]O"
+        )
+
+        self.client.force_login(self.user2)
+        response = self.client.get("/api/v1/rules/")
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # user2 should not see the rule from no_access_package
+        rule_uuids = [item["uuid"] for item in payload["items"]]
+        self.assertNotIn(str(rule.uuid), rule_uuids)
+
+    def test_reactions_endpoint_respects_permissions(self):
+        """Reactions endpoint uses same permission logic."""
+        from epdb.models import Reaction
+
+        # Create reaction in no-access package
+        reaction = Reaction.create(
+            self.unreviewed_package_no_access, "Test Reaction", "Test", ["C"], ["CO"]
+        )
+
+        self.client.force_login(self.user2)
+        response = self.client.get("/api/v1/reactions/")
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # user2 should not see the reaction from no_access_package
+        reaction_uuids = [item["uuid"] for item in payload["items"]]
+        self.assertNotIn(str(reaction.uuid), reaction_uuids)
+
+    def test_pathways_endpoint_respects_permissions(self):
+        """Pathways endpoint uses same permission logic."""
+        from epdb.models import Pathway
+
+        # Create pathway in no-access package
+        pathway = Pathway.objects.create(
+            package=self.unreviewed_package_no_access, name="Test Pathway", description="Test"
+        )
+
+        self.client.force_login(self.user2)
+        response = self.client.get("/api/v1/pathways/")
+
+        self.assertEqual(response.status_code, 200)
+        payload = response.json()
+
+        # user2 should not see the pathway from no_access_package
+        pathway_uuids = [item["uuid"] for item in payload["items"]]
+        self.assertNotIn(str(pathway.uuid), pathway_uuids)

epapi/tests/v1/test_contract_get_entities.py

@@ -0,0 +1,477 @@
+from django.test import TestCase, tag
+
+from epdb.logic import PackageManager, UserManager
+from epdb.models import Compound, Reaction, Pathway, EPModel, SimpleAmbitRule, Scenario
+
+
+class BaseTestAPIGetPaginated:
+    """
+    Mixin class for API pagination tests.
+
+    Subclasses must inherit from both this class and TestCase, e.g.:
+        class MyTest(BaseTestAPIGetPaginated, TestCase):
+            ...
+
+    Subclasses must define:
+    - resource_name: Singular name (e.g., "compound")
+    - resource_name_plural: Plural name (e.g., "compounds")
+    - global_endpoint: Global listing endpoint (e.g., "/api/v1/compounds/")
+    - package_endpoint_template: Template for package-scoped endpoint or None
+    - total_reviewed: Number of reviewed items to create
+    - total_unreviewed: Number of unreviewed items to create
+    - create_reviewed_resource(cls, package, idx): Factory method
+    - create_unreviewed_resource(cls, package, idx): Factory method
+    """
+
+    # Configuration to be overridden by subclasses
+    resource_name = None
+    resource_name_plural = None
+    global_endpoint = None
+    package_endpoint_template = None
+    total_reviewed = 50
+    total_unreviewed = 20
+    default_page_size = 50
+    max_page_size = 100
+
+    @classmethod
+    def setUpTestData(cls):
+        # Create test user
+        cls.user = UserManager.create_user(
+            f"{cls.resource_name}-user",
+            f"{cls.resource_name}-user@envipath.com",
+            "SuperSafe",
+            set_setting=False,
+            add_to_group=False,
+            is_active=True,
+        )
+
+        # Delete the auto-created default package to ensure clean test data
+        default_pkg = cls.user.default_package
+        cls.user.default_package = None
+        cls.user.save()
+        default_pkg.delete()
+
+        # Create reviewed package
+        cls.reviewed_package = PackageManager.create_package(
+            cls.user, "Reviewed Package", f"Reviewed package for {cls.resource_name} tests"
+        )
+        cls.reviewed_package.reviewed = True
+        cls.reviewed_package.save()
+
+        # Create unreviewed package
+        cls.unreviewed_package = PackageManager.create_package(
+            cls.user, "Draft Package", f"Unreviewed package for {cls.resource_name} tests"
+        )
+
+        # Create reviewed resources
+        for idx in range(cls.total_reviewed):
+            cls.create_reviewed_resource(cls.reviewed_package, idx)
+
+        # Create unreviewed resources
+        for idx in range(cls.total_unreviewed):
+            cls.create_unreviewed_resource(cls.unreviewed_package, idx)
+
+        # Set up package-scoped endpoints if applicable
+        if cls.package_endpoint_template:
+            cls.reviewed_package_endpoint = cls.package_endpoint_template.format(
+                uuid=cls.reviewed_package.uuid
+            )
+            cls.unreviewed_package_endpoint = cls.package_endpoint_template.format(
+                uuid=cls.unreviewed_package.uuid
+            )
+
+    @classmethod
+    def create_reviewed_resource(cls, package, idx):
+        """
+        Create a single reviewed resource.
+        Must be implemented by subclass.
+
+        Args:
+            package: The package to create the resource in
+            idx: Index of the resource (0-based)
+        """
+        raise NotImplementedError(f"{cls.__name__} must implement create_reviewed_resource()")
+
+    @classmethod
+    def create_unreviewed_resource(cls, package, idx):
+        """
+        Create a single unreviewed resource.
+        Must be implemented by subclass.
+
+        Args:
+            package: The package to create the resource in
+            idx: Index of the resource (0-based)
+        """
+        raise NotImplementedError(f"{cls.__name__} must implement create_unreviewed_resource()")
+
+    def setUp(self):
+        self.client.force_login(self.user)
+
+    def test_requires_session_authentication(self):
+        """Test that the global endpoint requires authentication."""
+        self.client.logout()
+        response = self.client.get(self.global_endpoint)
+        self.assertEqual(response.status_code, 401)
+
+    def test_global_listing_uses_default_page_size(self):
+        """Test that the global endpoint uses default pagination settings."""
+        response = self.client.get(self.global_endpoint, {"review_status": True})
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        self.assertEqual(payload["page"], 1)
+        self.assertEqual(payload["page_size"], self.default_page_size)
+        self.assertEqual(payload["total_items"], self.total_reviewed)
+
+        # Verify only reviewed items are returned
+        self.assertTrue(all(item["review_status"] == "reviewed" for item in payload["items"]))
+
+    def test_can_request_later_page(self):
+        """Test that pagination works for later pages."""
+        if self.total_reviewed <= self.default_page_size:
+            self.skipTest(
+                f"Not enough items to test pagination "
+                f"({self.total_reviewed} <= {self.default_page_size})"
+            )
+
+        response = self.client.get(self.global_endpoint, {"page": 2})
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        self.assertEqual(payload["page"], 2)
+
+        # Calculate expected items on page 2
+        expected_items = min(self.default_page_size, self.total_reviewed - self.default_page_size)
+        self.assertEqual(len(payload["items"]), expected_items)
+
+        # Verify only reviewed items are returned
+        self.assertTrue(all(item["review_status"] == "reviewed" for item in payload["items"]))
+
+    def test_page_size_is_capped(self):
+        """Test that page size is capped at the maximum."""
+        if self.total_reviewed <= self.max_page_size:
+            self.skipTest(
+                f"Not enough items to test page size cap "
+                f"({self.total_reviewed} <= {self.max_page_size})"
+            )
+
+        response = self.client.get(self.global_endpoint, {"page_size": 150})
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        self.assertEqual(payload["page_size"], self.max_page_size)
+        self.assertEqual(len(payload["items"]), self.max_page_size)
+
+    def test_package_endpoint_for_reviewed_package(self):
+        """Test the package-scoped endpoint for reviewed packages."""
+        if not self.package_endpoint_template:
+            self.skipTest("No package endpoint for this resource")
+
+        response = self.client.get(self.reviewed_package_endpoint)
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        self.assertEqual(payload["total_items"], self.total_reviewed)
+
+        # Verify only reviewed items are returned
+        self.assertTrue(all(item["review_status"] == "reviewed" for item in payload["items"]))
+
+    def test_package_endpoint_for_unreviewed_package(self):
+        """Test the package-scoped endpoint for unreviewed packages."""
+        if not self.package_endpoint_template:
+            self.skipTest("No package endpoint for this resource")
+
+        response = self.client.get(self.unreviewed_package_endpoint)
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        self.assertEqual(payload["total_items"], self.total_unreviewed)
+
+        # Verify only unreviewed items are returned
+        self.assertTrue(all(item["review_status"] == "unreviewed" for item in payload["items"]))
+
+
+@tag("api", "end2end")
+class PackagePaginationAPITest(TestCase):
+    ENDPOINT = "/api/v1/packages/"
+
+    @classmethod
+    def setUpTestData(cls):
+        cls.user = UserManager.create_user(
+            "package-user",
+            "package-user@envipath.com",
+            "SuperSafe",
+            set_setting=False,
+            add_to_group=False,
+            is_active=True,
+        )
+
+        # Delete the auto-created default package to ensure clean test data
+        default_pkg = cls.user.default_package
+        cls.user.default_package = None
+        cls.user.save()
+        default_pkg.delete()
+
+        # Create reviewed packages
+        cls.total_reviewed = 25
+        for idx in range(cls.total_reviewed):
+            package = PackageManager.create_package(
+                cls.user, f"Reviewed Package {idx:03d}", "Reviewed package for tests"
+            )
+            package.reviewed = True
+            package.save()
+
+        # Create unreviewed packages
+        cls.total_unreviewed = 15
+        for idx in range(cls.total_unreviewed):
+            PackageManager.create_package(
+                cls.user, f"Draft Package {idx:03d}", "Unreviewed package for tests"
+            )
+
+    def setUp(self):
+        self.client.force_login(self.user)
+
+    def test_anonymous_can_access_reviewed_packages(self):
+        self.client.logout()
+        response = self.client.get(self.ENDPOINT)
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        # Anonymous users can only see reviewed packages
+        self.assertEqual(payload["total_items"], self.total_reviewed)
+        self.assertTrue(all(item["review_status"] == "reviewed" for item in payload["items"]))
+
+    def test_listing_uses_default_page_size(self):
+        response = self.client.get(self.ENDPOINT)
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        self.assertEqual(payload["page"], 1)
+        self.assertEqual(payload["page_size"], 50)
+        self.assertEqual(payload["total_items"], self.total_reviewed + self.total_unreviewed)
+
+    def test_reviewed_filter_true(self):
+        response = self.client.get(self.ENDPOINT, {"review_status": True})
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        self.assertEqual(payload["total_items"], self.total_reviewed)
+        self.assertTrue(all(item["review_status"] == "reviewed" for item in payload["items"]))
+
+    def test_reviewed_filter_false(self):
+        response = self.client.get(self.ENDPOINT, {"review_status": False})
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        self.assertEqual(payload["total_items"], self.total_unreviewed)
+        self.assertTrue(all(item["review_status"] == "unreviewed" for item in payload["items"]))
+
+    def test_reviewed_filter_false_anonymous(self):
+        self.client.logout()
+        response = self.client.get(self.ENDPOINT, {"review_status": False})
+        self.assertEqual(response.status_code, 200)
+
+        payload = response.json()
+        # Anonymous users cannot access unreviewed packages
+        self.assertEqual(payload["total_items"], 0)
+
+
+@tag("api", "end2end")
+class CompoundPaginationAPITest(BaseTestAPIGetPaginated, TestCase):
+    """Compound pagination tests using base class."""
+
+    resource_name = "compound"
+    resource_name_plural = "compounds"
+    global_endpoint = "/api/v1/compounds/"
+    package_endpoint_template = "/api/v1/package/{uuid}/compound/"
+    total_reviewed = 125
+    total_unreviewed = 35
+
+    @classmethod
+    def create_reviewed_resource(cls, package, idx):
+        simple_smiles = ["C", "CC", "CCC", "CCCC", "CCCCC"]
+        smiles = simple_smiles[idx % len(simple_smiles)] + ("O" * (idx // len(simple_smiles)))
+        return Compound.create(
+            package,
+            smiles,
+            f"Reviewed Compound {idx:03d}",
+            "Compound for pagination tests",
+        )
+
+    @classmethod
+    def create_unreviewed_resource(cls, package, idx):
+        simple_smiles = ["C", "CC", "CCC", "CCCC", "CCCCC"]
+        smiles = simple_smiles[idx % len(simple_smiles)] + ("N" * (idx // len(simple_smiles)))
+        return Compound.create(
+            package,
+            smiles,
+            f"Draft Compound {idx:03d}",
+            "Compound for pagination tests",
+        )
+
+
+@tag("api", "end2end")
+class RulePaginationAPITest(BaseTestAPIGetPaginated, TestCase):
+    """Rule pagination tests using base class."""
+
+    resource_name = "rule"
+    resource_name_plural = "rules"
+    global_endpoint = "/api/v1/rules/"
+    package_endpoint_template = "/api/v1/package/{uuid}/rule/"
+    total_reviewed = 125
+    total_unreviewed = 35
+
+    @classmethod
+    def create_reviewed_resource(cls, package, idx):
+        # Create unique SMIRKS by combining chain length and functional group variations
+        # This ensures each idx gets a truly unique SMIRKS pattern
+        carbon_chain = "C" * (idx + 1)  # C, CC, CCC, ... (grows with idx)
+        smirks = f"[{carbon_chain}:1]>>[{carbon_chain}:1]O"
+        return SimpleAmbitRule.create(
+            package,
+            f"Reviewed Rule {idx:03d}",
+            f"Rule {idx} for pagination tests",
+            smirks,
+        )
+
+    @classmethod
+    def create_unreviewed_resource(cls, package, idx):
+        # Create unique SMIRKS by varying the carbon chain length
+        carbon_chain = "C" * (idx + 1)  # C, CC, CCC, ... (grows with idx)
+        smirks = f"[{carbon_chain}:1]>>[{carbon_chain}:1]N"
+        return SimpleAmbitRule.create(
+            package,
+            f"Draft Rule {idx:03d}",
+            f"Rule {idx} for pagination tests",
+            smirks,
+        )
+
+
+@tag("api", "end2end")
+class ReactionPaginationAPITest(BaseTestAPIGetPaginated, TestCase):
+    """Reaction pagination tests using base class."""
+
+    resource_name = "reaction"
+    resource_name_plural = "reactions"
+    global_endpoint = "/api/v1/reactions/"
+    package_endpoint_template = "/api/v1/package/{uuid}/reaction/"
+    total_reviewed = 125
+    total_unreviewed = 35
+
+    @classmethod
+    def create_reviewed_resource(cls, package, idx):
+        # Generate unique SMILES with growing chain lengths to avoid duplicates
+        # Each idx gets a unique chain length
+        educt_smiles = "C" * (idx + 1)  # C, CC, CCC, ... (grows with idx)
+        product_smiles = educt_smiles + "O"
+        return Reaction.create(
+            package=package,
+            name=f"Reviewed Reaction {idx:03d}",
+            description="Reaction for pagination tests",
+            educts=[educt_smiles],
+            products=[product_smiles],
+        )
+
+    @classmethod
+    def create_unreviewed_resource(cls, package, idx):
+        # Generate unique SMILES with growing chain lengths to avoid duplicates
+        # Each idx gets a unique chain length
+        educt_smiles = "C" * (idx + 1)  # C, CC, CCC, ... (grows with idx)
+        product_smiles = educt_smiles + "N"
+        return Reaction.create(
+            package=package,
+            name=f"Draft Reaction {idx:03d}",
+            description="Reaction for pagination tests",
+            educts=[educt_smiles],
+            products=[product_smiles],
+        )
+
+
+@tag("api", "end2end")
+class PathwayPaginationAPITest(BaseTestAPIGetPaginated, TestCase):
+    """Pathway pagination tests using base class."""
+
+    resource_name = "pathway"
+    resource_name_plural = "pathways"
+    global_endpoint = "/api/v1/pathways/"
+    package_endpoint_template = "/api/v1/package/{uuid}/pathway/"
+    total_reviewed = 125
+    total_unreviewed = 35
+
+    @classmethod
+    def create_reviewed_resource(cls, package, idx):
+        return Pathway.objects.create(
+            package=package,
+            name=f"Reviewed Pathway {idx:03d}",
+            description="Pathway for pagination tests",
+        )
+
+    @classmethod
+    def create_unreviewed_resource(cls, package, idx):
+        return Pathway.objects.create(
+            package=package,
+            name=f"Draft Pathway {idx:03d}",
+            description="Pathway for pagination tests",
+        )
+
+
+@tag("api", "end2end")
+class ModelPaginationAPITest(BaseTestAPIGetPaginated, TestCase):
+    """Model pagination tests using base class."""
+
+    resource_name = "model"
+    resource_name_plural = "models"
+    global_endpoint = "/api/v1/models/"
+    package_endpoint_template = "/api/v1/package/{uuid}/model/"
+    total_reviewed = 125
+    total_unreviewed = 35
+
+    @classmethod
+    def create_reviewed_resource(cls, package, idx):
+        return EPModel.objects.create(
+            package=package,
+            name=f"Reviewed Model {idx:03d}",
+            description="Model for pagination tests",
+        )
+
+    @classmethod
+    def create_unreviewed_resource(cls, package, idx):
+        return EPModel.objects.create(
+            package=package,
+            name=f"Draft Model {idx:03d}",
+            description="Model for pagination tests",
+        )
+
+
+@tag("api", "end2end")
+class ScenarioPaginationAPITest(BaseTestAPIGetPaginated, TestCase):
+    """Scenario pagination tests using base class."""
+
+    resource_name = "scenario"
+    resource_name_plural = "scenarios"
+    global_endpoint = "/api/v1/scenarios/"
+    package_endpoint_template = "/api/v1/package/{uuid}/scenario/"
+    total_reviewed = 125
+    total_unreviewed = 35
+
+    @classmethod
+    def create_reviewed_resource(cls, package, idx):
+        return Scenario.create(
+            package,
+            f"Reviewed Scenario {idx:03d}",
+            "Scenario for pagination tests",
+            "2025-01-01",
+            "lab",
+            [],
+        )
+
+    @classmethod
+    def create_unreviewed_resource(cls, package, idx):
+        return Scenario.create(
+            package,
+            f"Draft Scenario {idx:03d}",
+            "Scenario for pagination tests",
+            "2025-01-01",
+            "field",
+            [],
+        )

epapi/v1/auth.py

@@ -0,0 +1,8 @@
+from ninja.security import HttpBearer
+from ninja.errors import HttpError
+
+
+class BearerTokenAuth(HttpBearer):
+    def authenticate(self, request, token):
+        # FIXME: placeholder; implement it in O(1) time
+        raise HttpError(401, "Invalid or expired token")

epapi/v1/dal.py

@@ -0,0 +1,95 @@
+from django.db.models import Model
+from epdb.logic import PackageManager
+from epdb.models import CompoundStructure, User, Package, Compound
+from uuid import UUID
+
+from .errors import EPAPINotFoundError, EPAPIPermissionDeniedError
+
+
+def get_compound_or_error(user, compound_uuid: UUID):
+    """
+    Get compound by UUID with permission check.
+    """
+    try:
+        compound = Compound.objects.get(uuid=compound_uuid)
+        package = compound.package
+    except Compound.DoesNotExist:
+        raise EPAPINotFoundError(f"Compound with UUID {compound_uuid} not found")
+
+    # FIXME: optimize package manager to exclusively work with UUIDs
+    if not user or user.is_anonymous or not PackageManager.readable(user, package):
+        raise EPAPIPermissionDeniedError("Insufficient permissions to access this compound.")
+
+    return compound
+
+
+def get_package_or_error(user, package_uuid: UUID):
+    """
+    Get package by UUID with permission check.
+    """
+
+    # FIXME: update package manager with custom exceptions to avoid manual checks here
+    try:
+        package = Package.objects.get(uuid=package_uuid)
+    except Package.DoesNotExist:
+        raise EPAPINotFoundError(f"Package with UUID {package_uuid} not found")
+
+    # FIXME: optimize package manager to exclusively work with UUIDs
+    if not user or user.is_anonymous or not PackageManager.readable(user, package):
+        raise EPAPIPermissionDeniedError("Insufficient permissions to access this package.")
+
+    return package
+
+
+def get_user_packages_qs(user: User | None):
+    """Get all packages readable by the user."""
+    if not user or user.is_anonymous:
+        return PackageManager.get_reviewed_packages()
+    return PackageManager.get_all_readable_packages(user, include_reviewed=True)
+
+
+def get_user_entities_qs(model_class: Model, user: User | None):
+    """Build queryset for reviewed package entities."""
+
+    if not user or user.is_anonymous:
+        return model_class.objects.filter(package__reviewed=True).select_related("package")
+
+    qs = model_class.objects.filter(
+        package__in=PackageManager.get_all_readable_packages(user, include_reviewed=True)
+    ).select_related("package")
+    return qs
+
+
+def get_package_scoped_entities_qs(
+    model_class: Model, package_uuid: UUID, user: User | None = None
+):
+    """Build queryset for specific package entities."""
+    package = get_package_or_error(user, package_uuid)
+    qs = model_class.objects.filter(package=package).select_related("package")
+    return qs
+
+
+def get_user_structures_qs(user: User | None):
+    """Build queryset for structures accessible to the user (via compound->package)."""
+
+    if not user or user.is_anonymous:
+        return CompoundStructure.objects.filter(compound__package__reviewed=True).select_related(
+            "compound__package"
+        )
+
+    qs = CompoundStructure.objects.filter(
+        compound__package__in=PackageManager.get_all_readable_packages(user, include_reviewed=True)
+    ).select_related("compound__package")
+    return qs
+
+
+def get_package_compound_scoped_structure_qs(
+    package_uuid: UUID, compound_uuid: UUID, user: User | None = None
+):
+    """Build queryset for specific package compound structures."""
+
+    get_package_or_error(user, package_uuid)
+    compound = get_compound_or_error(user, compound_uuid)
+
+    qs = CompoundStructure.objects.filter(compound=compound).select_related("compound__package")
+    return qs

epapi/v1/endpoints/compounds.py

@@ -0,0 +1,41 @@
+from django.conf import settings as s
+from ninja import Router
+from ninja_extra.pagination import paginate
+from uuid import UUID
+
+from epdb.models import Compound
+from ..pagination import EnhancedPageNumberPagination
+from ..schemas import CompoundOutSchema, ReviewStatusFilter
+from ..dal import get_user_entities_qs, get_package_scoped_entities_qs
+
+router = Router()
+
+
+@router.get("/compounds/", response=EnhancedPageNumberPagination.Output[CompoundOutSchema])
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_all_compounds(request):
+    """
+    List all compounds from reviewed packages.
+    """
+    return get_user_entities_qs(Compound, request.user).order_by("name").all()
+
+
+@router.get(
+    "/package/{uuid:package_uuid}/compound/",
+    response=EnhancedPageNumberPagination.Output[CompoundOutSchema],
+)
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_package_compounds(request, package_uuid: UUID):
+    """
+    List all compounds for a specific package.
+    """
+    user = request.user
+    return get_package_scoped_entities_qs(Compound, package_uuid, user).order_by("name").all()

epapi/v1/endpoints/models.py

@@ -0,0 +1,41 @@
+from django.conf import settings as s
+from ninja import Router
+from ninja_extra.pagination import paginate
+from uuid import UUID
+
+from epdb.models import EPModel
+from ..pagination import EnhancedPageNumberPagination
+from ..schemas import ModelOutSchema, ReviewStatusFilter
+from ..dal import get_user_entities_qs, get_package_scoped_entities_qs
+
+router = Router()
+
+
+@router.get("/models/", response=EnhancedPageNumberPagination.Output[ModelOutSchema])
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_all_models(request):
+    """
+    List all models from reviewed packages.
+    """
+    return get_user_entities_qs(EPModel, request.user).order_by("name").all()
+
+
+@router.get(
+    "/package/{uuid:package_uuid}/model/",
+    response=EnhancedPageNumberPagination.Output[ModelOutSchema],
+)
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_package_models(request, package_uuid: UUID):
+    """
+    List all models for a specific package.
+    """
+    user = request.user
+    return get_package_scoped_entities_qs(EPModel, package_uuid, user).order_by("name").all()

epapi/v1/endpoints/packages.py

@@ -0,0 +1,27 @@
+from django.conf import settings as s
+from ninja import Router
+from ninja_extra.pagination import paginate
+import logging
+
+from ..dal import get_user_packages_qs
+from ..pagination import EnhancedPageNumberPagination
+from ..schemas import PackageOutSchema, SelfReviewStatusFilter
+
+router = Router()
+logger = logging.getLogger(__name__)
+
+
+@router.get("/packages/", response=EnhancedPageNumberPagination.Output[PackageOutSchema], auth=None)
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=SelfReviewStatusFilter,
+)
+def list_all_packages(request):
+    """
+    List packages accessible to the user.
+
+    """
+    user = request.user
+    qs = get_user_packages_qs(user)
+    return qs.order_by("name").all()

epapi/v1/endpoints/pathways.py

@@ -0,0 +1,42 @@
+from django.conf import settings as s
+from ninja import Router
+from ninja_extra.pagination import paginate
+from uuid import UUID
+
+from epdb.models import Pathway
+from ..pagination import EnhancedPageNumberPagination
+from ..schemas import PathwayOutSchema, ReviewStatusFilter
+from ..dal import get_user_entities_qs, get_package_scoped_entities_qs
+
+router = Router()
+
+
+@router.get("/pathways/", response=EnhancedPageNumberPagination.Output[PathwayOutSchema])
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_all_pathways(request):
+    """
+    List all pathways from reviewed packages.
+    """
+    user = request.user
+    return get_user_entities_qs(Pathway, user).order_by("name").all()
+
+
+@router.get(
+    "/package/{uuid:package_uuid}/pathway/",
+    response=EnhancedPageNumberPagination.Output[PathwayOutSchema],
+)
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_package_pathways(request, package_uuid: UUID):
+    """
+    List all pathways for a specific package.
+    """
+    user = request.user
+    return get_package_scoped_entities_qs(Pathway, package_uuid, user).order_by("name").all()

epapi/v1/endpoints/reactions.py

@@ -0,0 +1,42 @@
+from django.conf import settings as s
+from ninja import Router
+from ninja_extra.pagination import paginate
+from uuid import UUID
+
+from epdb.models import Reaction
+from ..pagination import EnhancedPageNumberPagination
+from ..schemas import ReactionOutSchema, ReviewStatusFilter
+from ..dal import get_user_entities_qs, get_package_scoped_entities_qs
+
+router = Router()
+
+
+@router.get("/reactions/", response=EnhancedPageNumberPagination.Output[ReactionOutSchema])
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_all_reactions(request):
+    """
+    List all reactions from reviewed packages.
+    """
+    user = request.user
+    return get_user_entities_qs(Reaction, user).order_by("name").all()
+
+
+@router.get(
+    "/package/{uuid:package_uuid}/reaction/",
+    response=EnhancedPageNumberPagination.Output[ReactionOutSchema],
+)
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_package_reactions(request, package_uuid: UUID):
+    """
+    List all reactions for a specific package.
+    """
+    user = request.user
+    return get_package_scoped_entities_qs(Reaction, package_uuid, user).order_by("name").all()

epapi/v1/endpoints/rules.py

@@ -0,0 +1,42 @@
+from django.conf import settings as s
+from ninja import Router
+from ninja_extra.pagination import paginate
+from uuid import UUID
+
+from epdb.models import Rule
+from ..pagination import EnhancedPageNumberPagination
+from ..schemas import ReviewStatusFilter, RuleOutSchema
+from ..dal import get_user_entities_qs, get_package_scoped_entities_qs
+
+router = Router()
+
+
+@router.get("/rules/", response=EnhancedPageNumberPagination.Output[RuleOutSchema])
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_all_rules(request):
+    """
+    List all rules from reviewed packages.
+    """
+    user = request.user
+    return get_user_entities_qs(Rule, user).order_by("name").all()
+
+
+@router.get(
+    "/package/{uuid:package_uuid}/rule/",
+    response=EnhancedPageNumberPagination.Output[RuleOutSchema],
+)
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_package_rules(request, package_uuid: UUID):
+    """
+    List all rules for a specific package.
+    """
+    user = request.user
+    return get_package_scoped_entities_qs(Rule, package_uuid, user).order_by("name").all()

epapi/v1/endpoints/scenarios.py

@@ -0,0 +1,36 @@
+from django.conf import settings as s
+from ninja import Router
+from ninja_extra.pagination import paginate
+from uuid import UUID
+
+from epdb.models import Scenario
+from ..pagination import EnhancedPageNumberPagination
+from ..schemas import ReviewStatusFilter, ScenarioOutSchema
+from ..dal import get_user_entities_qs, get_package_scoped_entities_qs
+
+router = Router()
+
+
+@router.get("/scenarios/", response=EnhancedPageNumberPagination.Output[ScenarioOutSchema])
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_all_scenarios(request):
+    user = request.user
+    return get_user_entities_qs(Scenario, user).order_by("name").all()
+
+
+@router.get(
+    "/package/{uuid:package_uuid}/scenario/",
+    response=EnhancedPageNumberPagination.Output[ScenarioOutSchema],
+)
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=ReviewStatusFilter,
+)
+def list_package_scenarios(request, package_uuid: UUID):
+    user = request.user
+    return get_package_scoped_entities_qs(Scenario, package_uuid, user).order_by("name").all()

epapi/v1/endpoints/structure.py

@@ -0,0 +1,50 @@
+from django.conf import settings as s
+from ninja import Router
+from ninja_extra.pagination import paginate
+from uuid import UUID
+
+from ..pagination import EnhancedPageNumberPagination
+from ..schemas import CompoundStructureOutSchema, StructureReviewStatusFilter
+from ..dal import (
+    get_user_structures_qs,
+    get_package_compound_scoped_structure_qs,
+)
+
+router = Router()
+
+
+@router.get(
+    "/structures/", response=EnhancedPageNumberPagination.Output[CompoundStructureOutSchema]
+)
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=StructureReviewStatusFilter,
+)
+def list_all_structures(request):
+    """
+    List all structures from all packages.
+    """
+    user = request.user
+    return get_user_structures_qs(user).order_by("name").all()
+
+
+@router.get(
+    "/package/{uuid:package_uuid}/compound/{uuid:compound_uuid}/structure/",
+    response=EnhancedPageNumberPagination.Output[CompoundStructureOutSchema],
+)
+@paginate(
+    EnhancedPageNumberPagination,
+    page_size=s.API_PAGINATION_DEFAULT_PAGE_SIZE,
+    filter_schema=StructureReviewStatusFilter,
+)
+def list_package_structures(request, package_uuid: UUID, compound_uuid: UUID):
+    """
+    List all structures for a specific package and compound.
+    """
+    user = request.user
+    return (
+        get_package_compound_scoped_structure_qs(package_uuid, compound_uuid, user)
+        .order_by("name")
+        .all()
+    )

epapi/v1/errors.py

@@ -0,0 +1,28 @@
+from ninja.errors import HttpError
+
+
+class EPAPIError(HttpError):
+    status_code: int = 500
+
+    def __init__(self, message: str) -> None:
+        super().__init__(status_code=self.status_code, message=message)
+
+    @classmethod
+    def from_exception(cls, exc: Exception):
+        return cls(message=str(exc))
+
+
+class EPAPIUnauthorizedError(EPAPIError):
+    status_code = 401
+
+
+class EPAPIPermissionDeniedError(EPAPIError):
+    status_code = 403
+
+
+class EPAPINotFoundError(EPAPIError):
+    status_code = 404
+
+
+class EPAPIValidationError(EPAPIError):
+    status_code = 422

epapi/v1/pagination.py

@@ -0,0 +1,60 @@
+import math
+from typing import Any, Generic, List, TypeVar
+
+from django.db.models import QuerySet
+from ninja import Schema
+from ninja.pagination import PageNumberPagination
+
+T = TypeVar("T")
+
+
+class EnhancedPageNumberPagination(PageNumberPagination):
+    class Output(Schema, Generic[T]):
+        items: List[T]
+        page: int
+        page_size: int
+        total_items: int
+        total_pages: int
+
+    def paginate_queryset(
+        self,
+        queryset: QuerySet,
+        pagination: PageNumberPagination.Input,
+        **params: Any,
+    ) -> Any:
+        page_size = self._get_page_size(pagination.page_size)
+        offset = (pagination.page - 1) * page_size
+        total_items = self._items_count(queryset)
+        total_pages = math.ceil(total_items / page_size) if page_size > 0 else 0
+
+        return {
+            "items": queryset[offset : offset + page_size],
+            "page": pagination.page,
+            "page_size": page_size,
+            "total_items": total_items,
+            "total_pages": total_pages,
+        }
+
+    async def apaginate_queryset(
+        self,
+        queryset: QuerySet,
+        pagination: PageNumberPagination.Input,
+        **params: Any,
+    ) -> Any:
+        page_size = self._get_page_size(pagination.page_size)
+        offset = (pagination.page - 1) * page_size
+        total_items = await self._aitems_count(queryset)
+        total_pages = math.ceil(total_items / page_size) if page_size > 0 else 0
+
+        if isinstance(queryset, QuerySet):
+            items = [obj async for obj in queryset[offset : offset + page_size]]
+        else:
+            items = queryset[offset : offset + page_size]
+
+        return {
+            "items": items,
+            "page": pagination.page,
+            "page_size": page_size,
+            "total_items": total_items,
+            "total_pages": total_pages,
+        }

epapi/v1/router.py

@@ -0,0 +1,22 @@
+from ninja import Router
+from ninja.security import SessionAuth
+from .auth import BearerTokenAuth
+from .endpoints import packages, scenarios, compounds, rules, reactions, pathways, models, structure
+
+# Main router with authentication
+router = Router(
+    auth=[
+        SessionAuth(),
+        BearerTokenAuth(),
+    ]
+)
+
+# Include all endpoint routers
+router.add_router("", packages.router)
+router.add_router("", scenarios.router)
+router.add_router("", compounds.router)
+router.add_router("", rules.router)
+router.add_router("", reactions.router)
+router.add_router("", pathways.router)
+router.add_router("", models.router)
+router.add_router("", structure.router)

epapi/v1/schemas.py

@@ -0,0 +1,104 @@
+from ninja import FilterSchema, FilterLookup, Schema
+from typing import Annotated, Optional
+from uuid import UUID
+
+
+# Filter schema for query parameters
+class ReviewStatusFilter(FilterSchema):
+    """Filter schema for review_status query parameter."""
+
+    review_status: Annotated[Optional[bool], FilterLookup("package__reviewed")] = None
+
+
+class SelfReviewStatusFilter(FilterSchema):
+    """Filter schema for review_status query parameter on self-reviewed entities."""
+
+    review_status: Annotated[Optional[bool], FilterLookup("reviewed")] = None
+
+
+class StructureReviewStatusFilter(FilterSchema):
+    """Filter schema for review_status on structures (via compound->package)."""
+
+    review_status: Annotated[Optional[bool], FilterLookup("compound__package__reviewed")] = None
+
+
+# Base schema for all package-scoped entities
+class PackageEntityOutSchema(Schema):
+    """Base schema for entities belonging to a package."""
+
+    uuid: UUID
+    url: str = ""
+    name: str
+    description: str
+    review_status: str = ""
+    package: str = ""
+
+    @staticmethod
+    def resolve_url(obj):
+        return obj.url
+
+    @staticmethod
+    def resolve_package(obj):
+        return obj.package.url
+
+    @staticmethod
+    def resolve_review_status(obj):
+        return "reviewed" if obj.package.reviewed else "unreviewed"
+
+
+# All package-scoped entities inherit from base
+class ScenarioOutSchema(PackageEntityOutSchema):
+    pass
+
+
+class CompoundOutSchema(PackageEntityOutSchema):
+    pass
+
+
+class RuleOutSchema(PackageEntityOutSchema):
+    pass
+
+
+class ReactionOutSchema(PackageEntityOutSchema):
+    pass
+
+
+class PathwayOutSchema(PackageEntityOutSchema):
+    pass
+
+
+class ModelOutSchema(PackageEntityOutSchema):
+    pass
+
+
+class CompoundStructureOutSchema(PackageEntityOutSchema):
+    compound: str = ""
+
+    @staticmethod
+    def resolve_compound(obj):
+        return obj.compound.url
+
+    @staticmethod
+    def resolve_package(obj):
+        return obj.compound.package.url
+
+    @staticmethod
+    def resolve_review_status(obj):
+        return "reviewed" if obj.compound.package.reviewed else "unreviewed"
+
+
+# Package is special (no package FK)
+class PackageOutSchema(Schema):
+    uuid: UUID
+    url: str = ""
+    name: str
+    description: str
+    review_status: str = ""
+
+    @staticmethod
+    def resolve_url(obj):
+        return obj.url
+
+    @staticmethod
+    def resolve_review_status(obj):
+        return "reviewed" if obj.reviewed else "unreviewed"

epdb/admin.py

@@ -1,29 +1,31 @@
+from django.conf import settings as s
 from django.contrib import admin
 
 from .models import (
-    User,
-    UserPackagePermission,
-    Group,
-    GroupPackagePermission,
-    Package,
-    MLRelativeReasoning,
-    EnviFormer,
     Compound,
     CompoundStructure,
-    SimpleAmbitRule,
-    ParallelRule,
-    Reaction,
-    Pathway,
-    Node,
     Edge,
-    Scenario,
+    EnviFormer,
-    Setting,
     ExternalDatabase,
     ExternalIdentifier,
+    Group,
+    GroupPackagePermission,
     JobLog,
     License,
+    MLRelativeReasoning,
+    Node,
+    ParallelRule,
+    Pathway,
+    Reaction,
+    Scenario,
+    Setting,
+    SimpleAmbitRule,
+    User,
+    UserPackagePermission,
 )
 
+Package = s.GET_PACKAGE_MODEL()
+
 
 class UserAdmin(admin.ModelAdmin):
     list_display = ["username", "email", "is_active"]

epdb/apps.py

@@ -1,4 +1,9 @@
+import logging
+
 from django.apps import AppConfig
+from django.conf import settings
+
+logger = logging.getLogger(__name__)
 
 
 class EPDBConfig(AppConfig):
@@ -7,3 +12,6 @@ class EPDBConfig(AppConfig):
 
     def ready(self):
         import epdb.signals  # noqa: F401
+
+        model_name = getattr(settings, "EPDB_PACKAGE_MODEL", "epdb.Package")
+        logger.info(f"Using Package model: {model_name}")

epdb/context_processors.py

@@ -5,7 +5,7 @@ Context processors automatically make variables available to all templates.
 """
 
 from .logic import PackageManager
-from .models import Package
+from django.conf import settings as s
 
 
 def package_context(request):
@@ -20,7 +20,7 @@ def package_context(request):
 
     reviewed_package_qs = PackageManager.get_reviewed_packages()
 
-    unreviewed_package_qs = Package.objects.none()
+    unreviewed_package_qs = s.GET_PACKAGE_MODEL().objects.none()
 
     # Only get user-specific packages if user is authenticated
     if current_user.is_authenticated:

epdb/legacy_api.py

@@ -1,27 +1,35 @@
-from typing import List, Dict, Optional, Any
+from typing import Any, Dict, List, Optional
 
+import nh3
+from django.conf import settings as s
 from django.contrib.auth import get_user_model
 from django.http import HttpResponse
 from django.shortcuts import redirect
-from ninja import Router, Schema, Field, Form
+from ninja import Field, Form, Router, Schema, Query
+from ninja.security import SessionAuth
 
 from utilities.chem import FormatConverter
-from .logic import PackageManager, UserManager, SettingManager
+from utilities.misc import PackageExporter
+
+from .logic import GroupManager, PackageManager, SettingManager, UserManager, SearchManager
 from .models import (
     Compound,
     CompoundStructure,
-    Package,
+    Edge,
+    EPModel,
+    Node,
+    Pathway,
+    Reaction,
+    Rule,
+    Scenario,
+    SimpleAmbitRule,
     User,
     UserPackagePermission,
-    Rule,
+    ParallelRule,
-    Reaction,
-    Scenario,
-    Pathway,
-    Node,
-    Edge,
-    SimpleAmbitRule,
 )
 
+Package = s.GET_PACKAGE_MODEL()
+
 
 def _anonymous_or_real(request):
     if request.user.is_authenticated and not request.user.is_anonymous:
@@ -29,8 +37,7 @@ def _anonymous_or_real(request):
     return get_user_model().objects.get(username="anonymous")
 
 
-# router = Router(auth=SessionAuth())
+router = Router(auth=SessionAuth(csrf=False))
-router = Router()
 
 
 class Error(Schema):
@@ -118,13 +125,16 @@ class SimpleEdge(SimpleObject):
     identifier: str = "edge"
 
 
+class SimpleModel(SimpleObject):
+    identifier: str = "relative-reasoning"
+
+
 ################
 # Login/Logout #
 ################
-@router.post("/", response={200: SimpleUser, 403: Error})
+@router.post("/", response={200: SimpleUser, 403: Error}, auth=None)
 def login(request, loginusername: Form[str], loginpassword: Form[str]):
-    from django.contrib.auth import authenticate
+    from django.contrib.auth import authenticate, login
-    from django.contrib.auth import login
 
     email = User.objects.get(username=loginusername).email
     user = authenticate(username=email, password=loginpassword)
@@ -167,9 +177,13 @@ class UserSchema(Schema):
         return SettingManager.get_all_settings(obj)
 
 
+class Me(Schema):
+    whoami: str | None = None
+
+
 @router.get("/user", response={200: UserWrapper, 403: Error})
-def get_users(request, whoami: str = None):
+def get_users(request, me: Query[Me]):
-    if whoami:
+    if me.whoami:
         return {"user": [request.user]}
     else:
         return {"user": User.objects.all()}
@@ -186,6 +200,61 @@ def get_user(request, user_uuid):
         }
 
 
+class Search(Schema):
+    packages: List[str] = Field(alias="packages[]")
+    search: str
+    method: str
+
+
+@router.get("/search", response={200: Any, 403: Error})
+def search(request, search: Query[Search]):
+    try:
+        packs = []
+        for package in search.packages:
+            packs.append(PackageManager.get_package_by_url(request.user, package))
+
+        method = None
+
+        if search.method == "text":
+            method = "text"
+        elif search.method == "inchikey":
+            method = "inchikey"
+        elif search.method == "defaultSmiles":
+            method = "default"
+        elif search.method == "canonicalSmiles":
+            method = "canonical"
+        elif search.method == "exactSmiles":
+            method = "exact"
+
+        if method is None:
+            raise ValueError(f"Search method {search.method} is not supported!")
+
+        search_res = SearchManager.search(packs, search.search, method)
+        res = {}
+        if "Compounds" in search_res:
+            res["compound"] = search_res["Compounds"]
+
+        if "Compound Structures" in search_res:
+            res["structure"] = search_res["Compound Structures"]
+
+        if "Reaction" in search_res:
+            res["reaction"] = search_res["Reaction"]
+
+        if "Pathway" in search_res:
+            res["pathway"] = search_res["Pathway"]
+
+        if "Rules" in search_res:
+            res["rule"] = search_res["Rules"]
+
+        for key in res:
+            for v in res[key]:
+                v["id"] = v["url"].replace("simple-ambit-rule", "simple-rule")
+
+        return res
+    except ValueError as e:
+        return 403, {"message": f"Search failed due to {e}"}
+
+
 ###########
 # Package #
 ###########
@@ -251,67 +320,110 @@ def get_packages(request):
     }
 
 
-@router.get("/package/{uuid:package_uuid}", response={200: PackageSchema, 403: Error})
+class GetPackage(Schema):
-def get_package(request, package_uuid):
+    exportAsJson: str | None = None
+
+
+@router.get("/package/{uuid:package_uuid}", response={200: PackageSchema | Any, 403: Error})
+def get_package(request, package_uuid, gp: Query[GetPackage]):
     try:
-        return PackageManager.get_package_by_id(request.user, package_uuid)
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if gp.exportAsJson and gp.exportAsJson.strip() == "true":
+            return PackageExporter(p).do_export()
+
+        return p
     except ValueError:
         return 403, {
             "message": f"Getting Package with id {package_uuid} failed due to insufficient rights!"
         }
 
 
+class CreatePackage(Schema):
+    packageName: str
+    packageDescription: str | None = None
+
+
 @router.post("/package")
 def create_packages(
-    request, packageName: Form[str], packageDescription: Optional[str] = Form(None)
+    request,
+    p: Form[CreatePackage],
 ):
     try:
-        if packageName.strip() == "":
+        if p.packageName.strip() == "":
             raise ValueError("Package name cannot be empty!")
 
-        new_pacakge = PackageManager.create_package(request.user, packageName, packageDescription)
+        new_pacakge = PackageManager.create_package(
+            request.user, p.packageName, p.packageDescription
+        )
         return redirect(new_pacakge.url)
     except ValueError as e:
         return 400, {"message": str(e)}
 
 
+class UpdatePackage(Schema):
+    packageDescription: str | None = None
+    hiddenMethod: str | None = None
+    permissions: str | None = None
+    ppsURI: str | None = None
+    read: str | None = None
+    write: str | None = None
+
+
 @router.post("/package/{uuid:package_uuid}", response={200: PackageSchema | Any, 400: Error})
-def update_package(
+def update_package(request, package_uuid, pack: Form[UpdatePackage]):
-    request,
-    package_uuid,
-    packageDescription: Optional[str] = Form(None),
-    hiddenMethod: Optional[str] = Form(None),
-    exportAsJson: Optional[str] = Form(None),
-    permissions: Optional[str] = Form(None),
-    ppsURI: Optional[str] = Form(None),
-    read: Optional[str] = Form(None),
-    write: Optional[str] = Form(None),
-):
     try:
         p = PackageManager.get_package_by_id(request.user, package_uuid)
 
-        if hiddenMethod:
+        if pack.hiddenMethod:
-            if hiddenMethod == "DELETE":
+            if pack.hiddenMethod == "DELETE":
                 p.delete()
 
-        elif packageDescription and packageDescription.strip() != "":
+        elif pack.packageDescription is not None:
-            p.description = packageDescription
+            description = nh3.clean(pack.packageDescription, tags=s.ALLOWED_HTML_TAGS).strip()
-            p.save()
-            return
-        elif exportAsJson == "true":
-            pack_json = PackageManager.export_package(
-                p, include_models=False, include_external_identifiers=False
-            )
-            return pack_json
-        elif all([permissions, ppsURI, read]):
-            PackageManager.update_permissions
-        elif all([permissions, ppsURI, write]):
-            pass
 
+            if description:
+                p.description = description
+                p.save()
+                return HttpResponse(status=200)
+            else:
+                raise ValueError("Package description cannot be empty!")
+        elif all([pack.permissions, pack.ppsURI, pack.read]):
+            if "group" in pack.ppsURI:
+                grantee = GroupManager.get_group_lp(pack.ppsURI)
+            else:
+                grantee = UserManager.get_user_lp(pack.ppsURI)
+
+            PackageManager.grant_read(request.user, p, grantee)
+            return HttpResponse(status=200)
+        elif all([pack.permissions, pack.ppsURI, pack.write]):
+            if "group" in pack.ppsURI:
+                grantee = GroupManager.get_group_lp(pack.ppsURI)
+            else:
+                grantee = UserManager.get_user_lp(pack.ppsURI)
+
+            PackageManager.grant_write(request.user, p, grantee)
+            return HttpResponse(status=200)
     except ValueError as e:
         return 400, {"message": str(e)}
 
 
+@router.delete("/package/{uuid:package_uuid}")
+def delete_package(request, package_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.administrable(request.user, p):
+            p.delete()
+            return redirect(f"{s.SERVER_URL}/package")
+        else:
+            raise ValueError("You do not have the rights to delete this Package!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting Package with id {package_uuid} failed due to insufficient rights!"
+        }
+
+
 ################################
 # Compound / CompoundStructure #
 ################################
@@ -509,6 +621,83 @@ def get_package_compound_structure(request, package_uuid, compound_uuid, structu
         }
 
 
+class CreateCompound(Schema):
+    compoundSmiles: str
+    compoundName: str | None = None
+    compoundDescription: str | None = None
+    inchi: str | None = None
+
+
+@router.post("/package/{uuid:package_uuid}/compound")
+def create_package_compound(
+    request,
+    package_uuid,
+    c: Form[CreateCompound],
+):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+        # inchi is not used atm
+        c = Compound.create(
+            p, c.compoundSmiles, c.compoundName, c.compoundDescription, inchi=c.inchi
+        )
+        return redirect(c.url)
+    except ValueError as e:
+        return 400, {"message": str(e)}
+
+
+@router.delete("/package/{uuid:package_uuid}/compound/{uuid:compound_uuid}")
+def delete_compound(request, package_uuid, compound_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            c = Compound.objects.get(package=p, uuid=compound_uuid)
+            c.delete()
+            return redirect(f"{p.url}/compound")
+        else:
+            raise ValueError("You do not have the rights to delete this Compound!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting Compound with id {compound_uuid} failed due to insufficient rights!"
+        }
+
+
+@router.delete(
+    "/package/{uuid:package_uuid}/compound/{uuid:compound_uuid}/structure/{uuid:structure_uuid}"
+)
+def delete_compound_structure(request, package_uuid, compound_uuid, structure_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            c = Compound.objects.get(package=p, uuid=compound_uuid)
+            cs = CompoundStructure.objects.get(compound=c, uuid=structure_uuid)
+
+            # Check if we have to delete the compound as no structure is left
+            if len(cs.compound.structures.all()) == 1:
+                # This will delete the structure as well
+                c.delete()
+                return redirect(p.url + "/compound")
+            else:
+                if cs.normalized_structure:
+                    c.delete()
+                    return redirect(p.url + "/compound")
+                else:
+                    if c.default_structure == cs:
+                        cs.delete()
+                        c.default_structure = c.structures.all().first()
+                        return redirect(c.url + "/structure")
+                    else:
+                        cs.delete()
+                        return redirect(c.url + "/structure")
+        else:
+            raise ValueError("You do not have the rights to delete this CompoundStructure!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting CompoundStructure with id {compound_uuid} failed due to insufficient rights!"
+        }
+
+
 #########
 # Rules #
 #########
@@ -672,6 +861,73 @@ def _get_package_rule(request, package_uuid, rule_uuid):
 
 
 # POST
+class CreateSimpleRule(Schema):
+    smirks: str
+    name: str | None = None
+    description: str | None = None
+    reactantFilterSmarts: str | None = None
+    productFilterSmarts: str | None = None
+    immediate: str | None = None
+    rdkitrule: str | None = None
+
+
+@router.post("/package/{uuid:package_uuid}/simple-rule")
+def create_package_simple_rule(
+    request,
+    package_uuid,
+    r: Form[CreateSimpleRule],
+):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if r.rdkitrule and r.rdkitrule.strip() == "true":
+            raise ValueError("Not yet implemented!")
+        else:
+            sr = SimpleAmbitRule.create(
+                p, r.name, r.description, r.smirks, r.reactantFilterSmarts, r.productFilterSmarts
+            )
+
+        return redirect(sr.url)
+
+    except ValueError as e:
+        return 400, {"message": str(e)}
+
+
+class CreateParallelRule(Schema):
+    simpleRules: str
+    name: str | None = None
+    description: str | None = None
+    reactantFilterSmarts: str | None = None
+    productFilterSmarts: str | None = None
+    immediate: str | None = None
+
+
+@router.post("/package/{uuid:package_uuid}/parallel-rule")
+def create_package_parallel_rule(
+    request,
+    package_uuid,
+    r: Form[CreateParallelRule],
+):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        srs = SimpleRule.objects.filter(package=p, url__in=r.simpleRules)
+
+        if srs.count() != len(r.simpleRules):
+            raise ValueError(
+                f"Not all SimpleRules could be found in Package with id {package_uuid}!"
+            )
+
+        sr = ParallelRule.create(
+            p, list(srs), r.name, r.description, r.reactantFilterSmarts, r.productFilterSmarts
+        )
+
+        return redirect(sr.url)
+
+    except ValueError as e:
+        return 400, {"message": str(e)}
+
+
 @router.post(
     "/package/{uuid:package_uuid}/rule/{uuid:rule_uuid}", response={200: str | Any, 403: Error}
 )
@@ -721,6 +977,41 @@ def _post_package_rule(request, package_uuid, rule_uuid, compound: Form[str]):
         }
 
 
+@router.delete("/package/{uuid:package_uuid}/rule/{uuid:rule_uuid}")
+def delete_rule(request, package_uuid, rule_uuid):
+    return _delete_rule(request, package_uuid, rule_uuid)
+
+
+@router.delete(
+    "/package/{uuid:package_uuid}/simple-rule/{uuid:rule_uuid}",
+)
+def delete_simple_rule(request, package_uuid, rule_uuid):
+    return _delete_rule(request, package_uuid, rule_uuid)
+
+
+@router.delete(
+    "/package/{uuid:package_uuid}/parallel-rule/{uuid:rule_uuid}",
+)
+def delete_parallel_rule(request, package_uuid, rule_uuid):
+    return _delete_rule(request, package_uuid, rule_uuid)
+
+
+def _delete_rule(request, package_uuid, rule_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            r = Rule.objects.get(package=p, uuid=rule_uuid)
+            r.delete()
+            return redirect(f"{p.url}/rule")
+        else:
+            raise ValueError("You do not have the rights to delete this Rule!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting Rule with id {rule_uuid} failed due to insufficient rights!"
+        }
+
+
 ############
 # Reaction #
 ############
@@ -809,6 +1100,82 @@ def get_package_reaction(request, package_uuid, reaction_uuid):
         }
 
 
+class CreateReaction(Schema):
+    reactionName: str | None = None
+    reactionDescription: str | None = None
+    smirks: str | None = None
+    educt: str | None = None
+    product: str | None = None
+    rule: str | None = None
+
+
+@router.post("/package/{uuid:package_uuid}/reaction")
+def create_package_reaction(
+    request,
+    package_uuid,
+    r: Form[CreateReaction],
+):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if r.smirks is None and (r.educt is None or r.product is None):
+            raise ValueError("Either SMIRKS or educt/product must be provided")
+
+        if r.smirks is not None and (r.educt is not None and r.product is not None):
+            raise ValueError("SMIRKS and educt/product provided!")
+
+        rule = None
+        if r.rule:
+            try:
+                rule = Rule.objects.get(package=p, url=r.rule)
+            except Rule.DoesNotExist:
+                raise ValueError(f"Rule with id {r.rule} does not exist!")
+
+        if r.educt is not None:
+            try:
+                educt_cs = CompoundStructure.objects.get(compound__package=p, url=r.educt)
+            except CompoundStructure.DoesNotExist:
+                raise ValueError(f"Compound with id {r.educt} does not exist!")
+
+            try:
+                product_cs = CompoundStructure.objects.get(compound__package=p, url=r.product)
+            except CompoundStructure.DoesNotExist:
+                raise ValueError(f"Compound with id {r.product} does not exist!")
+
+            new_r = Reaction.create(
+                p, r.reactionName, r.reactionDescription, [educt_cs], [product_cs], rule
+            )
+        else:
+            educts = r.smirks.split(">>")[0].split("\\.")
+            products = r.smirks.split(">>")[1].split("\\.")
+
+            new_r = Reaction.create(
+                p, r.reactionName, r.reactionDescription, educts, products, rule
+            )
+
+        return redirect(new_r.url)
+
+    except ValueError as e:
+        return 400, {"message": str(e)}
+
+
+@router.delete("/package/{uuid:package_uuid}/reaction/{uuid:reaction_uuid}")
+def delete_reaction(request, package_uuid, reaction_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            r = Reaction.objects.get(package=p, uuid=reaction_uuid)
+            r.delete()
+            return redirect(f"{p.url}/reaction")
+        else:
+            raise ValueError("You do not have the rights to delete this Reaction!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting Reaction with id {reaction_uuid} failed due to insufficient rights!"
+        }
+
+
 ############
 # Scenario #
 ############
@@ -823,7 +1190,7 @@ class ScenarioSchema(Schema):
     description: str = Field(None, alias="description")
     id: str = Field(None, alias="url")
     identifier: str = "scenario"
-    linkedTo: List[Dict[str, str]] = Field({}, alias="linked_to")
+    linkedTo: List[Dict[str, str]] = Field([], alias="linked_to")
     name: str = Field(None, alias="name")
     pathways: List["SimplePathway"] = Field([], alias="related_pathways")
     relatedScenarios: List[Dict[str, str]] = Field([], alias="related_scenarios")
@@ -874,6 +1241,38 @@ def get_package_scenario(request, package_uuid, scenario_uuid):
         }
 
 
+@router.delete("/package/{uuid:package_uuid}/scenario")
+def delete_scenarios(request, package_uuid, scenario_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            scens = Scenario.objects.filter(package=p)
+            scens.delete()
+            return redirect(f"{p.url}/scenario")
+        else:
+            raise ValueError("You do not have the rights to delete Scenarios!")
+    except ValueError:
+        return 403, {"message": "Deleting Scenarios failed due to insufficient rights!"}
+
+
+@router.delete("/package/{uuid:package_uuid}/scenario/{uuid:scenario_uuid}")
+def delete_scenario(request, package_uuid, scenario_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            scen = Scenario.objects.get(package=p, uuid=scenario_uuid)
+            scen.delete()
+            return redirect(f"{p.url}/scenario")
+        else:
+            raise ValueError("You do not have the rights to delete this Scenario!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting Scenario with id {scenario_uuid} failed due to insufficient rights!"
+        }
+
+
 ###########
 # Pathway #
 ###########
@@ -1013,46 +1412,67 @@ def get_package_pathway(request, package_uuid, pathway_uuid):
         }
 
 
+class CreatePathway(Schema):
+    smilesinput: str
+    name: str | None = None
+    description: str | None = None
+    rootOnly: str | None = None
+    selectedSetting: str | None = None
+
+
 @router.post("/package/{uuid:package_uuid}/pathway")
 def create_pathway(
     request,
     package_uuid,
-    smilesinput: Form[str],
+    pw: Form[CreatePathway],
-    name: Optional[str] = Form(None),
-    description: Optional[str] = Form(None),
-    rootOnly: Optional[str] = Form(None),
-    selectedSetting: Optional[str] = Form(None),
 ):
     try:
         p = PackageManager.get_package_by_id(request.user, package_uuid)
 
-        stand_smiles = FormatConverter.standardize(smilesinput.strip())
+        stand_smiles = FormatConverter.standardize(pw.smilesinput.strip())
 
-        pw = Pathway.create(p, stand_smiles, name=name, description=description)
+        new_pw = Pathway.create(p, stand_smiles, name=pw.name, description=pw.description)
 
         pw_mode = "predict"
-        if rootOnly and rootOnly == "true":
+        if pw.rootOnly and pw.rootOnly.strip() == "true":
             pw_mode = "build"
 
-        pw.kv.update({"mode": pw_mode})
+        new_pw.kv.update({"mode": pw_mode})
-        pw.save()
+        new_pw.save()
 
         if pw_mode == "predict":
             setting = request.user.prediction_settings()
 
-            if selectedSetting:
+            if pw.selectedSetting:
-                setting = SettingManager.get_setting_by_url(request.user, selectedSetting)
+                setting = SettingManager.get_setting_by_url(request.user, pw.selectedSetting)
 
-            pw.setting = setting
+            new_pw.setting = setting
-            pw.save()
+            new_pw.save()
 
-            from .tasks import predict
+            from .tasks import dispatch, predict
 
-            predict.delay(pw.pk, setting.pk, limit=-1)
+            dispatch(request.user, predict, new_pw.pk, setting.pk, limit=None)
 
-        return redirect(pw.url)
+        return redirect(new_pw.url)
     except ValueError as e:
-        print(e)
+        return 400, {"message": str(e)}
+
+
+@router.delete("/package/{uuid:package_uuid}/pathway/{uuid:pathway_uuid}")
+def delete_pathway(request, package_uuid, pathway_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            pw = Pathway.objects.get(package=p, uuid=pathway_uuid)
+            pw.delete()
+            return redirect(f"{p.url}/pathway")
+        else:
+            raise ValueError("You do not have the rights to delete this pathway!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting Pathway with id {pathway_uuid} failed due to insufficient rights!"
+        }
 
 
 ########
@@ -1143,6 +1563,52 @@ def get_package_pathway_node(request, package_uuid, pathway_uuid, node_uuid):
         }
 
 
+class CreateNode(Schema):
+    nodeAsSmiles: str
+    nodeName: str | None = None
+    nodeReason: str | None = None
+    nodeDepth: str | None = None
+
+
+@router.post(
+    "/package/{uuid:package_uuid}/pathway/{uuid:pathway_uuid}/node",
+    response={200: str | Any, 403: Error},
+)
+def add_pathway_node(request, package_uuid, pathway_uuid, n: Form[CreateNode]):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+        pw = Pathway.objects.get(package=p, uuid=pathway_uuid)
+
+        if n.nodeDepth is not None and n.nodeDepth.strip() != "":
+            node_depth = int(n.nodeDepth)
+        else:
+            node_depth = -1
+
+        n = Node.create(pw, n.nodeAsSmiles, node_depth, n.nodeName, n.nodeReason)
+
+        return redirect(n.url)
+    except ValueError:
+        return 403, {"message": "Adding node failed!"}
+
+
+@router.delete("/package/{uuid:package_uuid}/pathway/{uuid:pathway_uuid}/node/{uuid:node_uuid}")
+def delete_node(request, package_uuid, pathway_uuid, node_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            pw = Pathway.objects.get(package=p, uuid=pathway_uuid)
+            n = Node.objects.get(pathway=pw, uuid=node_uuid)
+            n.delete()
+            return redirect(f"{pw.url}/node")
+        else:
+            raise ValueError("You do not have the rights to delete this Node!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting Node with id {node_uuid} failed due to insufficient rights!"
+        }
+
+
 ########
 # Edge #
 ########
@@ -1206,6 +1672,200 @@ def get_package_pathway_edge(request, package_uuid, pathway_uuid, edge_uuid):
         }
 
 
+class CreateEdge(Schema):
+    edgeAsSmirks: str | None = None
+    educts: str | None = None  # Node URIs comma sep
+    products: str | None = None  # Node URIs comma sep
+    multistep: str | None = None
+    edgeReason: str | None = None
+
+
+@router.post(
+    "/package/{uuid:package_uuid}/üathway/{uuid:pathway_uuid}/edge",
+    response={200: str | Any, 403: Error},
+)
+def add_pathway_edge(request, package_uuid, pathway_uuid, e: Form[CreateEdge]):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+        pw = Pathway.objects.get(package=p, uuid=pathway_uuid)
+
+        if e.edgeAsSmirks is None and (e.educts is None or e.products is None):
+            raise ValueError("Either SMIRKS or educt/product must be provided")
+
+        if e.edgeAsSmirks is not None and (e.educts is not None and e.products is not None):
+            raise ValueError("SMIRKS and educt/product provided!")
+
+        educts = []
+        products = []
+
+        if e.edgeAsSmirks:
+            for ed in e.edgeAsSmirks.split(">>")[0].split("\\."):
+                educts.append(Node.objects.get(pathway=pw, default_node_label__smiles=ed))
+
+            for pr in e.edgeAsSmirks.split(">>")[1].split("\\."):
+                products.append(Node.objects.get(pathway=pw, default_node_label__smiles=pr))
+        else:
+            for ed in e.educts.split(","):
+                educts.append(Node.objects.get(pathway=pw, url=ed.strip()))
+
+            for pr in e.products.split(","):
+                products.append(Node.objects.get(pathway=pw, url=pr.strip()))
+
+        new_e = Edge.create(
+            pathway=pw,
+            start_nodes=educts,
+            end_nodes=products,
+            rule=None,
+            name=e.name,
+            description=e.edgeReason,
+        )
+
+        return redirect(new_e.url)
+    except ValueError:
+        return 403, {"message": "Adding node failed!"}
+
+
+@router.delete("/package/{uuid:package_uuid}/pathway/{uuid:pathway_uuid}/edge/{uuid:edge_uuid}")
+def delete_edge(request, package_uuid, pathway_uuid, edge_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            pw = Pathway.objects.get(package=p, uuid=pathway_uuid)
+            e = Edge.objects.get(pathway=pw, uuid=edge_uuid)
+            e.delete()
+            return redirect(f"{pw.url}/edge")
+        else:
+            raise ValueError("You do not have the rights to delete this Edge!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting Edge with id {edge_uuid} failed due to insufficient rights!"
+        }
+
+
+#########
+# Model #
+#########
+class ModelWrapper(Schema):
+    relative_reasoning: List["SimpleModel"] = Field(..., alias="relative-reasoning")
+
+
+class ModelSchema(Schema):
+    aliases: List[str] = Field([], alias="aliases")
+    description: str = Field(None, alias="description")
+    evalPackages: List["SimplePackage"] = Field([])
+    id: str = Field(None, alias="url")
+    identifier: str = "relative-reasoning"
+    #   "info" : {
+    #       "Accuracy (Single-Gen)" : "0.5932962678936605" ,
+    #       "Area under PR-Curve (Single-Gen)" : "0.5654653182134282" ,
+    #       "Area under ROC-Curve (Single-Gen)" : "0.8178302405034772" ,
+    #       "Precision (Single-Gen)" : "0.6978730822873083" ,
+    #       "Probability Threshold" : "0.5" ,
+    #       "Recall/Sensitivity (Single-Gen)" : "0.4484149210261006"
+    #     } ,
+    name: str = Field(None, alias="name")
+    pathwayPackages: List["SimplePackage"] = Field([])
+    reviewStatus: str = Field(None, alias="review_status")
+    rulePackages: List["SimplePackage"] = Field([])
+    scenarios: List["SimpleScenario"] = Field([], alias="scenarios")
+    status: str
+    statusMessage: str
+    threshold: str
+    type: str
+
+
+@router.get("/model", response={200: ModelWrapper, 403: Error})
+def get_models(request):
+    pass
+
+
+@router.get("/package/{uuid:package_uuid}/model", response={200: ModelWrapper, 403: Error})
+def get_package_models(request, package_uuid, model_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+        return EPModel.objects.filter(package=p)
+    except ValueError:
+        return 403, {
+            "message": f"Getting Reaction with id {model_uuid} failed due to insufficient rights!"
+        }
+
+
+class Classify(Schema):
+    smiles: str | None = None
+
+
+@router.get(
+    "/package/{uuid:package_uuid}/model/{uuid:model_uuid}",
+    response={200: ModelSchema | Any, 403: Error, 400: Error},
+)
+def get_model(request, package_uuid, model_uuid, c: Query[Classify]):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+        mod = EPModel.objects.get(package=p, uuid=model_uuid)
+
+        if c.smiles:
+            if c.smiles == "":
+                return 400, {"message": "Received empty SMILES"}
+
+            try:
+                stand_smiles = FormatConverter.standardize(c.smiles)
+            except ValueError:
+                return 400, {"message": f'"{c.smiles}" is not a valid SMILES'}
+
+            from epdb.tasks import dispatch_eager, predict_simple
+
+            _, pred_res = dispatch_eager(request.user, predict_simple, mod.pk, stand_smiles)
+
+            result = []
+
+            for pr in pred_res:
+                if len(pr) > 0:
+                    products = []
+                    for prod_set in pr.product_sets:
+                        products.append(tuple([x for x in prod_set]))
+
+                    res = {
+                        "probability": pr.probability,
+                        "products": list(set(products)),
+                    }
+
+                    if pr.rule:
+                        res["id"] = pr.rule.url
+                        res["identifier"] = pr.rule.get_rule_identifier()
+                        res["name"] = pr.rule.name
+                        res["reviewStatus"] = (
+                            "reviewed" if pr.rule.package.reviewed else "unreviewed"
+                        )
+
+                    result.append(res)
+
+            return result
+
+        return mod
+    except ValueError:
+        return 403, {
+            "message": f"Getting Reaction with id {model_uuid} failed due to insufficient rights!"
+        }
+
+
+@router.delete("/package/{uuid:package_uuid}/model/{uuid:model_uuid}")
+def delete_model(request, package_uuid, model_uuid):
+    try:
+        p = PackageManager.get_package_by_id(request.user, package_uuid)
+
+        if PackageManager.writable(request.user, p):
+            m = EPModel.objects.get(package=p, uuid=model_uuid)
+            m.delete()
+            return redirect(f"{p.url}/model")
+        else:
+            raise ValueError("You do not have the rights to delete this Model!")
+    except ValueError:
+        return 403, {
+            "message": f"Deleting Model with id {model_uuid} failed due to insufficient rights!"
+        }
+
+
 ###########
 # Setting #
 ###########

epdb/logic.py

@@ -1,39 +1,41 @@
-import re
-import logging
 import json
-from typing import Union, List, Optional, Set, Dict, Any
+import logging
+import re
+from typing import Any, Dict, List, Optional, Set, Union, Tuple
 from uuid import UUID
 
 import nh3
+from django.conf import settings as s
 from django.contrib.auth import get_user_model
 from django.db import transaction
-from django.conf import settings as s
 from pydantic import ValidationError
 
 from epdb.models import (
-    User,
-    Package,
-    UserPackagePermission,
-    GroupPackagePermission,
-    Permission,
-    Group,
-    Setting,
-    EPModel,
-    UserSettingPermission,
-    Rule,
-    Pathway,
-    Node,
-    Edge,
     Compound,
-    Reaction,
     CompoundStructure,
+    Edge,
     EnzymeLink,
+    EPModel,
+    ExpansionSchemeChoice,
+    Group,
+    GroupPackagePermission,
+    Node,
+    Pathway,
+    Permission,
+    Reaction,
+    Rule,
+    Setting,
+    User,
+    UserPackagePermission,
+    UserSettingPermission,
 )
 from utilities.chem import FormatConverter
-from utilities.misc import PackageImporter, PackageExporter
+from utilities.misc import PackageExporter, PackageImporter
 
 logger = logging.getLogger(__name__)
 
+Package = s.GET_PACKAGE_MODEL()
+
 
 class EPDBURLParser:
     UUID_PATTERN = r"[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}"
@@ -442,6 +444,7 @@ class PackageManager(object):
             if PackageManager.readable(user, p):
                 return p
             else:
+                # FIXME: use custom exception to be translatable to 403 in API
                 raise ValueError(
                     "Insufficient permissions to access Package with ID {}".format(package_id)
                 )
@@ -578,30 +581,39 @@ class PackageManager(object):
         else:
             _ = perm_cls.objects.update_or_create(defaults={"permission": new_perm}, **data)
 
+    @staticmethod
+    def grant_read(caller: User, package: Package, grantee: Union[User, Group]):
+        PackageManager.update_permissions(caller, package, grantee, Permission.READ[0])
+
+    @staticmethod
+    def grant_write(caller: User, package: Package, grantee: Union[User, Group]):
+        PackageManager.update_permissions(caller, package, grantee, Permission.WRITE[0])
+
     @staticmethod
     @transaction.atomic
     def import_legacy_package(
         data: dict, owner: User, keep_ids=False, add_import_timestamp=True, trust_reviewed=False
     ):
-        from uuid import UUID, uuid4
-        from datetime import datetime
         from collections import defaultdict
+        from datetime import datetime
+        from uuid import UUID, uuid4
+
+        from envipy_additional_information import AdditionalInformationConverter
+
         from .models import (
-            Package,
             Compound,
             CompoundStructure,
-            SimpleRule,
+            Edge,
-            SimpleAmbitRule,
+            Node,
             ParallelRule,
+            Pathway,
+            Reaction,
+            Scenario,
             SequentialRule,
             SequentialRuleOrdering,
-            Reaction,
+            SimpleAmbitRule,
-            Pathway,
+            SimpleRule,
-            Node,
-            Edge,
-            Scenario,
         )
-        from envipy_additional_information import AdditionalInformationConverter
 
         pack = Package()
         pack.uuid = UUID(data["id"].split("/")[-1]) if keep_ids else uuid4()
@@ -1106,6 +1118,7 @@ class SettingManager(object):
         rule_packages: List[Package] = None,
         model: EPModel = None,
         model_threshold: float = None,
+        expansion_scheme: ExpansionSchemeChoice = ExpansionSchemeChoice.BFS,
     ):
         new_s = Setting()
         # Clean for potential XSS
@@ -1388,6 +1401,9 @@ class SEdge(object):
         self.rule = rule
         self.probability = probability
 
+    def product_smiles(self):
+        return [p.smiles for p in self.products]
+
     def __hash__(self):
         full_hash = 0
 
@@ -1473,6 +1489,7 @@ class SPathway(object):
         self.smiles_to_node: Dict[str, SNode] = dict(**{n.smiles: n for n in self.root_nodes})
         self.edges: Set["SEdge"] = set()
         self.done = False
+        self.empty_due_to_threshold = False
 
     @staticmethod
     def from_pathway(pw: "Pathway", persist: bool = True):
@@ -1537,22 +1554,32 @@ class SPathway(object):
 
         return sorted(res, key=lambda x: hash(x))
 
-    def predict_step(self, from_depth: int = None, from_node: "Node" = None):
+    def _expand(self, substrates: List[SNode]) -> Tuple[List[SNode], List[SEdge]]:
-        substrates: List[SNode] = []
+        """
+        Expands the given substrates by generating new nodes and edges based on prediction settings.
 
-        if from_depth is not None:
+        This method processes a list of substrates and expands them into new nodes and edges using defined
-            substrates = self._get_nodes_for_depth(from_depth)
+        rules and settings. It evaluates each substrate to determine its applicability domain, persists
-        elif from_node is not None:
+        domain assessments, and generates candidates for further processing. Newly created nodes and edges
-            for k, v in self.snode_persist_lookup.items():
+        are returned, and any applicable information is stored or updated internally during the process.
-                if from_node == v:
+
-                    substrates = [k]
+        Parameters:
-                    break
+            substrates (List[SNode]): A list of substrate nodes to be expanded.
-        else:
+
-            raise ValueError("Neither from_depth nor from_node_url specified")
+        Returns:
+            Tuple[List[SNode], List[SEdge]]:
+                A tuple containing:
+                - A list of new nodes generated during the expansion.
+                - A list of new edges representing connections between nodes based on candidate reactions.
+
+        Raises:
+            ValueError: If a node does not have an ID when it should have been saved already.
+        """
+        new_nodes: List[SNode] = []
+        new_edges: List[SEdge] = []
 
-        new_tp = False
-        if substrates:
         for sub in substrates:
+            # For App Domain we have to ensure that each Node is evaluated
             if sub.app_domain_assessment is None:
                 if self.prediction_setting.model:
                     if self.prediction_setting.model.app_domain:
@@ -1563,9 +1590,9 @@ class SPathway(object):
                         if self.persist is not None:
                             n = self.snode_persist_lookup[sub]
 
-                                assert n.id is not None, (
+                            if n.id is None:
-                                    "Node has no id! Should have been saved already... aborting!"
+                                raise ValueError(f"Node {n} has no ID... aborting!")
-                                )
+
                             node_data = n.simple_json()
                             node_data["image"] = f"{n.url}?image=svg"
                             app_domain_assessment["assessment"]["node"] = node_data
@@ -1575,11 +1602,25 @@ class SPathway(object):
 
                         sub.app_domain_assessment = app_domain_assessment
 
-                candidates = self.prediction_setting.expand(self, sub)
+            expansion_result = self.prediction_setting.expand(self, sub)
+
+            # We don't have any substrate, but technically we have at least one rule that triggered.
+            # If our substrate is a root node a.k.a. depth == 0 store that info in SPathway
+            if (
+                len(expansion_result["transformations"]) == 0
+                and expansion_result["rule_triggered"]
+                and sub.depth == 0
+            ):
+                self.empty_due_to_threshold = True
+
+                # Emit directly
+                if self.persist is not None:
+                    self.persist.kv["empty_due_to_threshold"] = True
+                    self.persist.save()
+
             # candidates is a List of PredictionResult. The length of the List is equal to the number of rules
-                for cand_set in candidates:
+            for cand_set in expansion_result["transformations"]:
                 if cand_set:
-                        new_tp = True
                     # cand_set is a PredictionResult object that can consist of multiple candidate reactions
                     for cand in cand_set:
                         cand_nodes = []
@@ -1593,10 +1634,9 @@ class SPathway(object):
                                         app_domain_assessment = (
                                             self.prediction_setting.model.app_domain.assess(c)
                                         )
-
+                                snode = SNode(c, sub.depth + 1, app_domain_assessment)
-                                    self.smiles_to_node[c] = SNode(
+                                self.smiles_to_node[c] = snode
-                                        c, sub.depth + 1, app_domain_assessment
+                                new_nodes.append(snode)
-                                    )
 
                             node = self.smiles_to_node[c]
                             cand_nodes.append(node)
@@ -1608,6 +1648,132 @@ class SPathway(object):
                             probability=cand_set.probability,
                         )
                         self.edges.add(edge)
+                        new_edges.append(edge)
+
+        return new_nodes, new_edges
+
+    def predict(self):
+        """
+        Predicts outcomes based on a graph traversal algorithm using the specified expansion schema.
+
+        This method iteratively explores the nodes of a graph starting from the root nodes, propagating
+        probabilities through edges, and updating the probabilities of the connected nodes. The traversal
+        can follow one of three predefined expansion schemas: Depth-First Search (DFS), Breadth-First Search
+        (BFS), or a Greedy approach based on node probabilities. The methodology ensures that all reachable
+        nodes are processed systematically according to the specified schema.
+
+        Errors will be raised if the expansion schema is undefined or invalid. Additionally, this method
+        supports persisting changes by writing back data to the database when configured to do so.
+
+        Attributes
+        ----------
+        done : bool
+            A flag indicating whether the prediction process is completed.
+        persist : Any
+            An optional object that manages persistence operations for saving modifications.
+        root_nodes : List[SNode]
+            A collection of initial nodes in the graph from which traversal begins.
+        prediction_setting : Any
+            Configuration object specifying settings for graph traversal, such as the choice of
+            expansion schema.
+
+        Raises
+        ------
+        ValueError
+            If an invalid or unknown expansion schema is provided in `prediction_setting`.
+        """
+        # populate initial queue
+        queue = list(self.root_nodes)
+        processed = set()
+
+        # initial nodes have prob 1.0
+        node_probs: Dict[SNode, float] = {}
+        node_probs.update({n: 1.0 for n in queue})
+
+        while queue:
+            current = queue.pop(0)
+
+            if current in processed:
+                continue
+
+            processed.add(current)
+
+            new_nodes, new_edges = self._expand([current])
+
+            if new_nodes or new_edges:
+                # Check if we need to write back data to the database
+                if self.persist:
+                    self._sync_to_pathway()
+                    # call save to update the internal modified field
+                    self.persist.save()
+
+                if new_nodes:
+                    for edge in new_edges:
+                        # All edge have `current` as educt
+                        # Use `current` and adjust probs
+                        current_prob = node_probs[current]
+
+                        for prod in edge.products:
+                            # Either is a new product or a product and we found a path with a higher prob
+                            if (
+                                prod not in node_probs
+                                or current_prob * edge.probability > node_probs[prod]
+                            ):
+                                node_probs[prod] = current_prob * edge.probability
+
+                    # Update Queue to proceed
+                    if self.prediction_setting.expansion_scheme == "DFS":
+                        for n in new_nodes:
+                            if n not in processed:
+                                # We want to follow this path -> prepend queue
+                                queue.insert(0, n)
+                    elif self.prediction_setting.expansion_scheme == "BFS":
+                        for n in new_nodes:
+                            if n not in processed:
+                                # Add at the end, everything queued before will be processed
+                                # before new_nodese
+                                queue.append(n)
+                    elif self.prediction_setting.expansion_scheme == "GREEDY":
+                        # Simply add them, as we will re-order the queue later
+                        for n in new_nodes:
+                            if n not in processed:
+                                queue.append(n)
+
+                        node_and_probs = []
+                        for queued_val in queue:
+                            node_and_probs.append((queued_val, node_probs[queued_val]))
+
+                        # re-order the queue and only pick smiles
+                        queue = [
+                            n[0] for n in sorted(node_and_probs, key=lambda x: x[1], reverse=True)
+                        ]
+                    else:
+                        raise ValueError(
+                            f"Unknown expansion schema: {self.prediction_setting.expansion_scheme}"
+                        )
+
+        # Queue exhausted, we're done
+        self.done = True
+
+    def predict_step(self, from_depth: int = None, from_node: "Node" = None):
+        substrates: List[SNode] = []
+
+        if from_depth is not None:
+            substrates = self._get_nodes_for_depth(from_depth)
+        elif from_node is not None:
+            for k, v in self.snode_persist_lookup.items():
+                if from_node == v:
+                    substrates = [k]
+                    break
+            else:
+                raise ValueError(f"Node {from_node} not found in SPathway!")
+        else:
+            raise ValueError("Neither from_depth nor from_node_url specified")
+
+        new_tp = False
+        if substrates:
+            new_nodes, _ = self._expand(substrates)
+            new_tp = len(new_nodes) > 0
 
         # In case no substrates are found, we're done.
         # For "predict from node" we're always done
@@ -1620,6 +1786,14 @@ class SPathway(object):
             # call save to update the internal modified field
             self.persist.save()
 
+    def get_edge_for_educt_smiles(self, smiles: str) -> List[SEdge]:
+        res = []
+        for e in self.edges:
+            for n in e.educts:
+                if n.smiles == smiles:
+                    res.append(e)
+        return res
+
     def _sync_to_pathway(self) -> None:
         logger.info("Updating Pathway with SPathway")
 
@@ -1683,11 +1857,6 @@ class SPathway(object):
                 "to": to_indices,
             }
 
-            # if edge.rule:
-            #     e['rule'] = {
-            #         'name': edge.rule.name,
-            #         'id': edge.rule.url,
-            #     }
             edges.append(e)
 
         return {

epdb/management/commands/create_ml_models.py

@@ -2,7 +2,9 @@ from django.conf import settings as s
 from django.core.management.base import BaseCommand
 from django.db import transaction
 
-from epdb.models import MLRelativeReasoning, EnviFormer, Package
+from epdb.models import EnviFormer, MLRelativeReasoning
+
+Package = s.GET_PACKAGE_MODEL()
 
 
 class Command(BaseCommand):
@@ -75,11 +77,13 @@ class Command(BaseCommand):
             return packages
 
         # Iteratively create models in options["model_names"]
-        print(f"Creating models: {options['model_names']}\n"
+        print(
+            f"Creating models: {options['model_names']}\n"
             f"Data packages: {options['data_packages']}\n"
             f"Rule Packages (only for MLRR): {options['rule_packages']}\n"
             f"Eval Packages: {options['eval_packages']}\n"
-              f"Threshold: {options['threshold']:.2f}")
+            f"Threshold: {options['threshold']:.2f}"
+        )
         data_packages = decode_packages(options["data_packages"])
         eval_packages = decode_packages(options["eval_packages"])
         rule_packages = decode_packages(options["rule_packages"])
@@ -89,8 +93,7 @@ class Command(BaseCommand):
                 model = EnviFormer.create(
                     pack,
                     data_packages=data_packages,
-                    eval_packages=eval_packages,
+                    threshold=options["threshold"],
-                    threshold=options['threshold'],
                     name=f"EnviFormer - {', '.join(options['data_packages'])} - T{options['threshold']:.2f}",
                     description=f"EnviFormer transformer trained on {options['data_packages']} "
                     f"evaluated on {options['eval_packages']}.",
@@ -100,8 +103,7 @@ class Command(BaseCommand):
                     package=pack,
                     rule_packages=rule_packages,
                     data_packages=data_packages,
-                    eval_packages=eval_packages,
+                    threshold=options["threshold"],
-                    threshold=options['threshold'],
                     name=f"ECC - {', '.join(options['data_packages'])} - T{options['threshold']:.2f}",
                     description=f"ML Relative Reasoning trained on {options['data_packages']} with rules from "
                     f"{options['rule_packages']} and evaluated on {options['eval_packages']}.",

epdb/management/commands/load_enviformer.py

@@ -8,7 +8,9 @@ from django.conf import settings as s
 from django.core.management.base import BaseCommand
 from django.db import transaction
 
-from epdb.models import EnviFormer, Package
+from epdb.models import EnviFormer
+
+Package = s.GET_PACKAGE_MODEL()
 
 
 class Command(BaseCommand):

epdb/management/commands/localize_urls.py

@@ -1,8 +1,8 @@
 from django.apps import apps
+from django.conf import settings as s
 from django.core.management.base import BaseCommand
-
+from django.db.models import F, JSONField, TextField, Value
-from django.db.models import F, Value, TextField, JSONField
+from django.db.models.functions import Cast, Replace
-from django.db.models.functions import Replace, Cast
 
 from epdb.models import EnviPathModel
 
@@ -23,10 +23,12 @@ class Command(BaseCommand):
         )
 
     def handle(self, *args, **options):
+        Package = s.GET_PACKAGE_MODEL()
+        Package.objects.update(url=Replace(F("url"), Value(options["old"]), Value(options["new"])))
+
         MODELS = [
             "User",
             "Group",
-            "Package",
             "Compound",
             "CompoundStructure",
             "Pathway",
@@ -47,7 +49,6 @@ class Command(BaseCommand):
         ]
         for model in MODELS:
             obj_cls = apps.get_model("epdb", model)
-            print(f"Localizing urls for {model}")
             obj_cls.objects.update(
                 url=Replace(F("url"), Value(options["old"]), Value(options["new"]))
             )

epdb/migrations/0012_node_stereo_removed_pathway_predicted.py

@@ -0,0 +1,22 @@
+# Generated by Django 5.2.7 on 2025-12-02 13:09
+
+from django.db import migrations, models
+
+
+class Migration(migrations.Migration):
+    dependencies = [
+        ("epdb", "0011_auto_20251111_1413"),
+    ]
+
+    operations = [
+        migrations.AddField(
+            model_name="node",
+            name="stereo_removed",
+            field=models.BooleanField(default=False),
+        ),
+        migrations.AddField(
+            model_name="pathway",
+            name="predicted",
+            field=models.BooleanField(default=False),
+        ),
+    ]

epdb/migrations/0013_setting_expansion_schema.py

@@ -0,0 +1,25 @@
+# Generated by Django 5.2.7 on 2025-12-14 11:30
+
+from django.db import migrations, models
+
+
+class Migration(migrations.Migration):
+    dependencies = [
+        ("epdb", "0012_node_stereo_removed_pathway_predicted"),
+    ]
+
+    operations = [
+        migrations.AddField(
+            model_name="setting",
+            name="expansion_schema",
+            field=models.CharField(
+                choices=[
+                    ("BFS", "Breadth First Search"),
+                    ("DFS", "Depth First Search"),
+                    ("GREEDY", "Greedy"),
+                ],
+                default="BFS",
+                max_length=20,
+            ),
+        ),
+    ]

epdb/migrations/0014_rename_expansion_schema_setting_expansion_scheme.py

@@ -0,0 +1,17 @@
+# Generated by Django 5.2.7 on 2025-12-14 16:02
+
+from django.db import migrations
+
+
+class Migration(migrations.Migration):
+    dependencies = [
+        ("epdb", "0013_setting_expansion_schema"),
+    ]
+
+    operations = [
+        migrations.RenameField(
+            model_name="setting",
+            old_name="expansion_schema",
+            new_name="expansion_scheme",
+        ),
+    ]

epdb/models.py

@@ -2,40 +2,41 @@ import abc
 import hashlib
 import json
 import logging
+import math
 import os
 import secrets
 from abc import abstractmethod
 from collections import defaultdict
 from datetime import datetime
-from typing import Union, List, Optional, Dict, Tuple, Set, Any
+from typing import Any, Dict, List, Optional, Set, Tuple, Union
 from uuid import uuid4
-import math
+
 import joblib
 import nh3
 import numpy as np
 from django.conf import settings as s
 from django.contrib.auth.models import AbstractUser
-from django.contrib.contenttypes.fields import GenericRelation, GenericForeignKey
+from django.contrib.contenttypes.fields import GenericForeignKey, GenericRelation
 from django.contrib.contenttypes.models import ContentType
 from django.contrib.postgres.fields import ArrayField
 from django.db import models, transaction
-from django.db.models import JSONField, Count, Q, QuerySet
+from django.db.models import Count, JSONField, Q, QuerySet
 from django.utils import timezone
 from django.utils.functional import cached_property
-from envipy_additional_information import EnviPyModel
+from envipy_additional_information import EnviPyModel, HalfLife
 from model_utils.models import TimeStampedModel
 from polymorphic.models import PolymorphicModel
-from sklearn.metrics import precision_score, recall_score, jaccard_score
+from sklearn.metrics import jaccard_score, precision_score, recall_score
 from sklearn.model_selection import ShuffleSplit
 
-from utilities.chem import FormatConverter, ProductSet, PredictionResult, IndigoUtils
+from utilities.chem import FormatConverter, IndigoUtils, PredictionResult, ProductSet
 from utilities.ml import (
-    RuleBasedDataset,
     ApplicabilityDomainPCA,
-    EnsembleClassifierChain,
-    RelativeReasoning,
-    EnviFormerDataset,
     Dataset,
+    EnsembleClassifierChain,
+    EnviFormerDataset,
+    RelativeReasoning,
+    RuleBasedDataset,
 )
 
 logger = logging.getLogger(__name__)
@@ -44,8 +45,6 @@ logger = logging.getLogger(__name__)
 ##########################
 # User/Groups/Permission #
 ##########################
-
-
 class User(AbstractUser):
     email = models.EmailField(unique=True)
     uuid = models.UUIDField(
@@ -53,7 +52,10 @@ class User(AbstractUser):
     )
     url = models.TextField(blank=False, null=True, verbose_name="URL", unique=True)
     default_package = models.ForeignKey(
-        "epdb.Package", verbose_name="Default Package", null=True, on_delete=models.SET_NULL
+        s.EPDB_PACKAGE_MODEL,
+        verbose_name="Default Package",
+        null=True,
+        on_delete=models.SET_NULL,
     )
     default_group = models.ForeignKey(
         "Group",
@@ -243,7 +245,7 @@ class UserPackagePermission(Permission):
     )
     user = models.ForeignKey("User", verbose_name="Permission to", on_delete=models.CASCADE)
     package = models.ForeignKey(
-        "epdb.Package", verbose_name="Permission on", on_delete=models.CASCADE
+        s.EPDB_PACKAGE_MODEL, verbose_name="Permission on", on_delete=models.CASCADE
     )
 
     class Meta:
@@ -259,7 +261,7 @@ class GroupPackagePermission(Permission):
     )
     group = models.ForeignKey("Group", verbose_name="Permission to", on_delete=models.CASCADE)
     package = models.ForeignKey(
-        "epdb.Package", verbose_name="Permission on", on_delete=models.CASCADE
+        s.EPDB_PACKAGE_MODEL, verbose_name="Permission on", on_delete=models.CASCADE
     )
 
     class Meta:
@@ -728,10 +730,13 @@ class Package(EnviPathModel):
         rules = sorted(rules, key=lambda x: x.url)
         return rules
 
+    class Meta:
+        swappable = "EPDB_PACKAGE_MODEL"
+
 
 class Compound(EnviPathModel, AliasMixin, ScenarioMixin, ChemicalIdentifierMixin):
     package = models.ForeignKey(
-        "epdb.Package", verbose_name="Package", on_delete=models.CASCADE, db_index=True
+        s.EPDB_PACKAGE_MODEL, verbose_name="Package", on_delete=models.CASCADE, db_index=True
     )
     default_structure = models.ForeignKey(
         "CompoundStructure",
@@ -749,6 +754,30 @@ class Compound(EnviPathModel, AliasMixin, ScenarioMixin, ChemicalIdentifierMixin
 
     @property
     def normalized_structure(self) -> "CompoundStructure":
+        if not CompoundStructure.objects.filter(compound=self, normalized_structure=True).exists():
+            num_structs = self.structures.count()
+            stand_smiles = set()
+            for structure in self.structures.all():
+                stand_smiles.add(FormatConverter.standardize(structure.smiles))
+
+            if len(stand_smiles) != 1:
+                logger.debug(
+                    f"#Structures: {num_structs} - #Standardized SMILES: {len(stand_smiles)}"
+                )
+                logger.debug(f"Couldn't infer normalized structure for {self.name} - {self.url}")
+                raise ValueError(
+                    f"Couldn't find nor infer normalized structure for {self.name} ({self.url})"
+                )
+            else:
+                cs = CompoundStructure.create(
+                    self,
+                    stand_smiles.pop(),
+                    name="Normalized structure of {}".format(self.name),
+                    description="{} (in its normalized form)".format(self.description),
+                    normalized_structure=True,
+                )
+                return cs
+
         return CompoundStructure.objects.get(compound=self, normalized_structure=True)
 
     def _url(self):
@@ -766,9 +795,7 @@ class Compound(EnviPathModel, AliasMixin, ScenarioMixin, ChemicalIdentifierMixin
 
     @property
     def related_pathways(self):
-        pathways = Node.objects.filter(node_labels__in=[self.default_structure]).values_list(
+        pathways = self.related_nodes.values_list("pathway", flat=True)
-            "pathway", flat=True
-        )
         return Pathway.objects.filter(package=self.package, id__in=set(pathways)).order_by("name")
 
     @property
@@ -778,10 +805,16 @@ class Compound(EnviPathModel, AliasMixin, ScenarioMixin, ChemicalIdentifierMixin
             | Reaction.objects.filter(package=self.package, products__in=[self.default_structure])
         ).order_by("name")
 
+    @property
+    def related_nodes(self):
+        return Node.objects.filter(
+            node_labels__in=[self.default_structure], pathway__package=self.package
+        )
+
     @staticmethod
     @transaction.atomic
     def create(
-        package: Package, smiles: str, name: str = None, description: str = None, *args, **kwargs
+        package: "Package", smiles: str, name: str = None, description: str = None, *args, **kwargs
     ) -> "Compound":
         if smiles is None or smiles.strip() == "":
             raise ValueError("SMILES is required")
@@ -896,15 +929,79 @@ class Compound(EnviPathModel, AliasMixin, ScenarioMixin, ChemicalIdentifierMixin
         if self in mapping:
             return mapping[self]
 
+        default_structure_smiles = self.default_structure.smiles
+        normalized_structure_smiles = self.normalized_structure.smiles
+
+        existing_compound = None
+        existing_normalized_compound = None
+
+        # Dedup check - Check if we find a direct match for a given SMILES
+        if CompoundStructure.objects.filter(
+            smiles=default_structure_smiles, compound__package=target
+        ).exists():
+            existing_compound = CompoundStructure.objects.get(
+                smiles=default_structure_smiles, compound__package=target
+            ).compound
+
+        # Check if we can find the standardized one
+        if CompoundStructure.objects.filter(
+            smiles=normalized_structure_smiles, compound__package=target
+        ).exists():
+            existing_normalized_compound = CompoundStructure.objects.get(
+                smiles=normalized_structure_smiles, compound__package=target
+            ).compound
+
+        if any([existing_compound, existing_normalized_compound]):
+            if existing_normalized_compound and existing_compound:
+                # We only have to set the mapping
+                mapping[self] = existing_compound
+                for structure in self.structures.all():
+                    if structure not in mapping:
+                        mapping[structure] = existing_compound.structures.get(
+                            smiles=structure.smiles
+                        )
+
+                return existing_compound
+
+            elif existing_normalized_compound:
+                mapping[self] = existing_normalized_compound
+
+                # Merge the structure into the existing compound
+                for structure in self.structures.all():
+                    if existing_normalized_compound.structures.filter(
+                        smiles=structure.smiles
+                    ).exists():
+                        continue
+
+                    # Create a new Structure
+                    cs = CompoundStructure.create(
+                        existing_normalized_compound,
+                        structure.smiles,
+                        name=structure.name,
+                        description=structure.description,
+                        normalized_structure=structure.normalized_structure,
+                    )
+
+                    mapping[structure] = cs
+
+                    return existing_normalized_compound
+
+            else:
+                raise ValueError(
+                    f"Found a CompoundStructure for {default_structure_smiles} but not for {normalized_structure_smiles} in target package {target.name}"
+                )
+        else:
+            # Here we can safely use Compound.objects.create as we won't end up in a duplicate
             new_compound = Compound.objects.create(
                 package=target,
                 name=self.name,
                 description=self.description,
                 kv=self.kv.copy() if self.kv else {},
             )
+
             mapping[self] = new_compound
 
-        # Copy compound structures
+            # Copy underlying structures
             for structure in self.structures.all():
                 if structure not in mapping:
                     new_structure = CompoundStructure.objects.create(
@@ -949,6 +1046,17 @@ class Compound(EnviPathModel, AliasMixin, ScenarioMixin, ChemicalIdentifierMixin
 
         return new_compound
 
+    def half_lifes(self):
+        hls: Dict[Scenario, List[HalfLife]] = defaultdict(list)
+
+        for n in self.related_nodes:
+            for scen in n.scenarios.all().order_by("name"):
+                for ai in scen.get_additional_information():
+                    if isinstance(ai, HalfLife):
+                        hls[scen].append(ai)
+
+        return dict(hls)
+
     class Meta:
         unique_together = [("uuid", "package")]
 
@@ -1061,7 +1169,7 @@ class EnzymeLink(EnviPathModel, KEGGIdentifierMixin):
 
 class Rule(PolymorphicModel, EnviPathModel, AliasMixin, ScenarioMixin):
     package = models.ForeignKey(
-        "epdb.Package", verbose_name="Package", on_delete=models.CASCADE, db_index=True
+        s.EPDB_PACKAGE_MODEL, verbose_name="Package", on_delete=models.CASCADE, db_index=True
     )
 
     # # https://github.com/django-polymorphic/django-polymorphic/issues/229
@@ -1074,6 +1182,10 @@ class Rule(PolymorphicModel, EnviPathModel, AliasMixin, ScenarioMixin):
     def apply(self, *args, **kwargs):
         pass
 
+    @abc.abstractmethod
+    def get_rule_identifier(self) -> str:
+        pass
+
     @staticmethod
     def cls_for_type(rule_type: str):
         if rule_type == "SimpleAmbitRule":
@@ -1103,34 +1215,44 @@ class Rule(PolymorphicModel, EnviPathModel, AliasMixin, ScenarioMixin):
         rule_type = type(self)
 
         if rule_type == SimpleAmbitRule:
-            new_rule = SimpleAmbitRule.objects.create(
+            new_rule = SimpleAmbitRule.create(
                 package=target,
                 name=self.name,
                 description=self.description,
                 smirks=self.smirks,
                 reactant_filter_smarts=self.reactant_filter_smarts,
                 product_filter_smarts=self.product_filter_smarts,
-                kv=self.kv.copy() if self.kv else {},
             )
+
+            if self.kv:
+                new_rule.kv.update(**self.kv)
+                new_rule.save()
+
         elif rule_type == SimpleRDKitRule:
-            new_rule = SimpleRDKitRule.objects.create(
+            new_rule = SimpleRDKitRule.create(
                 package=target,
                 name=self.name,
                 description=self.description,
                 reaction_smarts=self.reaction_smarts,
-                kv=self.kv.copy() if self.kv else {},
             )
+
+            if self.kv:
+                new_rule.kv.update(**self.kv)
+                new_rule.save()
+
         elif rule_type == ParallelRule:
-            new_rule = ParallelRule.objects.create(
+            new_srs = []
-                package=target,
-                name=self.name,
-                description=self.description,
-                kv=self.kv.copy() if self.kv else {},
-            )
-            # Copy simple rules relationships
             for simple_rule in self.simple_rules.all():
                 copied_simple_rule = simple_rule.copy(target, mapping)
-                new_rule.simple_rules.add(copied_simple_rule)
+                new_srs.append(copied_simple_rule)
+
+            new_rule = ParallelRule.create(
+                package=target,
+                simple_rules=new_srs,
+                name=self.name,
+                description=self.description,
+            )
+
         elif rule_type == SequentialRule:
             raise ValueError("SequentialRule copy not implemented!")
         else:
@@ -1167,7 +1289,7 @@ class SimpleAmbitRule(SimpleRule):
     @staticmethod
     @transaction.atomic
     def create(
-        package: Package,
+        package: "Package",
         name: str = None,
         description: str = None,
         smirks: str = None,
@@ -1228,8 +1350,16 @@ class SimpleAmbitRule(SimpleRule):
     def _url(self):
         return "{}/simple-ambit-rule/{}".format(self.package.url, self.uuid)
 
+    def get_rule_identifier(self) -> str:
+        return "simple-rule"
+
     def apply(self, smiles):
-        return FormatConverter.apply(smiles, self.smirks)
+        return FormatConverter.apply(
+            smiles,
+            self.smirks,
+            reactant_filter_smarts=self.reactant_filter_smarts,
+            product_filter_smarts=self.product_filter_smarts,
+        )
 
     @property
     def reactants_smarts(self):
@@ -1241,7 +1371,7 @@ class SimpleAmbitRule(SimpleRule):
 
     @property
     def related_reactions(self):
-        qs = Package.objects.filter(reviewed=True)
+        qs = s.GET_PACKAGE_MODEL().objects.filter(reviewed=True)
         return self.reaction_rule.filter(package__in=qs).order_by("name")
 
     @property
@@ -1273,6 +1403,9 @@ class ParallelRule(Rule):
     def _url(self):
         return "{}/parallel-rule/{}".format(self.package.url, self.uuid)
 
+    def get_rule_identifier(self) -> str:
+        return "parallel-rule"
+
     @cached_property
     def srs(self) -> QuerySet:
         return self.simple_rules.all()
@@ -1304,6 +1437,71 @@ class ParallelRule(Rule):
 
         return res
 
+    @staticmethod
+    @transaction.atomic
+    def create(
+        package: "Package",
+        simple_rules: List["SimpleRule"],
+        name: str = None,
+        description: str = None,
+        reactant_filter_smarts: str = None,
+        product_filter_smarts: str = None,
+    ):
+        if len(simple_rules) == 0:
+            raise ValueError("At least one simple rule is required!")
+
+        for sr in simple_rules:
+            if sr.package != package:
+                raise ValueError(
+                    f"Simple rule {sr.uuid} does not belong to package {package.uuid}!"
+                )
+
+        # Deduplication check
+        query = ParallelRule.objects.annotate(
+            srs_count=Count("simple_rules", filter=Q(simple_rules__in=simple_rules), distinct=True)
+        )
+
+        existing_rule_qs = query.filter(
+            srs_count=len(simple_rules),
+        )
+
+        if existing_rule_qs.exists():
+            if existing_rule_qs.count() > 1:
+                logger.error(f"Found more than one reaction for given input! {existing_rule_qs}")
+            return existing_rule_qs.first()
+
+        r = ParallelRule()
+        r.package = package
+
+        if name is not None:
+            name = nh3.clean(name, tags=s.ALLOWED_HTML_TAGS).strip()
+
+        if name is None or name == "":
+            name = f"Rule {Rule.objects.filter(package=package).count() + 1}"
+
+        r.name = name
+        if description is not None and description.strip() != "":
+            r.description = nh3.clean(description, tags=s.ALLOWED_HTML_TAGS).strip()
+
+        if reactant_filter_smarts is not None and reactant_filter_smarts.strip() != "":
+            if not FormatConverter.is_valid_smarts(reactant_filter_smarts.strip()):
+                raise ValueError(f'Reactant Filter SMARTS "{reactant_filter_smarts}" is invalid!')
+            else:
+                r.reactant_filter_smarts = reactant_filter_smarts.strip()
+
+        if product_filter_smarts is not None and product_filter_smarts.strip() != "":
+            if not FormatConverter.is_valid_smarts(product_filter_smarts.strip()):
+                raise ValueError(f'Product Filter SMARTS "{product_filter_smarts}" is invalid!')
+            else:
+                r.product_filter_smarts = product_filter_smarts.strip()
+
+        r.save()
+
+        for sr in simple_rules:
+            r.simple_rules.add(sr)
+
+        return r
+
 
 class SequentialRule(Rule):
     simple_rules = models.ManyToManyField(
@@ -1313,6 +1511,9 @@ class SequentialRule(Rule):
     def _url(self):
         return "{}/sequential-rule/{}".format(self.compound.url, self.uuid)
 
+    def get_rule_identifier(self) -> str:
+        return "sequential-rule"
+
     @property
     def srs(self):
         return self.simple_rules.all()
@@ -1333,7 +1534,7 @@ class SequentialRuleOrdering(models.Model):
 
 class Reaction(EnviPathModel, AliasMixin, ScenarioMixin, ReactionIdentifierMixin):
     package = models.ForeignKey(
-        "epdb.Package", verbose_name="Package", on_delete=models.CASCADE, db_index=True
+        s.EPDB_PACKAGE_MODEL, verbose_name="Package", on_delete=models.CASCADE, db_index=True
     )
     educts = models.ManyToManyField(
         "epdb.CompoundStructure", verbose_name="Educts", related_name="reaction_educts"
@@ -1355,7 +1556,7 @@ class Reaction(EnviPathModel, AliasMixin, ScenarioMixin, ReactionIdentifierMixin
     @staticmethod
     @transaction.atomic
     def create(
-        package: Package,
+        package: "Package",
         name: str = None,
         description: str = None,
         educts: Union[List[str], List[CompoundStructure]] = None,
@@ -1450,31 +1651,44 @@ class Reaction(EnviPathModel, AliasMixin, ScenarioMixin, ReactionIdentifierMixin
         if self in mapping:
             return mapping[self]
 
-        # Create new reaction
+        copied_reaction_educts = []
-        new_reaction = Reaction.objects.create(
+        copied_reaction_products = []
-            package=target,
+        copied_reaction_rules = []
-            name=self.name,
-            description=self.description,
-            multi_step=self.multi_step,
-            medline_references=self.medline_references,
-            kv=self.kv.copy() if self.kv else {},
-        )
-        mapping[self] = new_reaction
 
         # Copy educts (reactant compounds)
         for educt in self.educts.all():
             copied_educt = educt.copy(target, mapping)
-            new_reaction.educts.add(copied_educt)
+            copied_reaction_educts.append(copied_educt)
 
         # Copy products
         for product in self.products.all():
             copied_product = product.copy(target, mapping)
-            new_reaction.products.add(copied_product)
+            copied_reaction_products.append(copied_product)
 
         # Copy rules
         for rule in self.rules.all():
             copied_rule = rule.copy(target, mapping)
-            new_reaction.rules.add(copied_rule)
+            copied_reaction_rules.append(copied_rule)
+
+        new_reaction = Reaction.create(
+            package=target,
+            name=self.name,
+            description=self.description,
+            educts=copied_reaction_educts,
+            products=copied_reaction_products,
+            rules=copied_reaction_rules,
+            multi_step=self.multi_step,
+        )
+
+        if self.medline_references:
+            new_reaction.medline_references = self.medline_references
+            new_reaction.save()
+
+        if self.kv:
+            new_reaction.kv = self.kv
+            new_reaction.save()
+
+        mapping[self] = new_reaction
 
         # Copy external identifiers
         for ext_id in self.external_identifiers.all():
@@ -1514,11 +1728,12 @@ class Reaction(EnviPathModel, AliasMixin, ScenarioMixin, ReactionIdentifierMixin
 
 class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
     package = models.ForeignKey(
-        "epdb.Package", verbose_name="Package", on_delete=models.CASCADE, db_index=True
+        s.EPDB_PACKAGE_MODEL, verbose_name="Package", on_delete=models.CASCADE, db_index=True
     )
     setting = models.ForeignKey(
         "epdb.Setting", verbose_name="Setting", on_delete=models.CASCADE, null=True, blank=True
     )
+    predicted = models.BooleanField(default=False, null=False)
 
     @property
     def root_nodes(self):
@@ -1544,6 +1759,16 @@ class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
         # potentially prefetched edge_set
         return self.edge_set.all()
 
+    @property
+    def setting_with_overrides(self):
+        mem_copy = Setting.objects.get(pk=self.setting.pk)
+
+        if "setting_overrides" in self.kv:
+            for k, v in self.kv["setting_overrides"].items():
+                setattr(mem_copy, k, f"{v} (this is an override for this particular pathway)")
+
+        return mem_copy
+
     def _url(self):
         return "{}/pathway/{}".format(self.package.url, self.uuid)
 
@@ -1570,6 +1795,9 @@ class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
     def failed(self):
         return self.status() == "failed"
 
+    def empty_due_to_threshold(self):
+        return self.kv.get("empty_due_to_threshold", False)
+
     def d3_json(self):
         # Ideally it would be something like this but
         # to reduce crossing in edges do a DFS
@@ -1591,11 +1819,9 @@ class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
         while len(queue):
             current = queue.pop()
             processed.add(current)
-
             nodes.append(current.d3_json())
 
-            for e in self.edges:
+            for e in self.edges.filter(start_nodes=current).distinct():
-                if current in e.start_nodes.all():
                 for prod in e.end_nodes.all():
                     if prod not in queue and prod not in processed:
                         queue.append(prod)
@@ -1679,15 +1905,18 @@ class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
             "status": self.status(),
         }
 
-        return json.dumps(res)
+        return res
 
-    def to_csv(self) -> str:
+    def to_csv(self, include_header=True, include_pathway_url=False) -> str:
         import csv
         import io
 
-        rows = []
+        header = []
-        rows.append(
+
-            [
+        if include_pathway_url:
+            header += ["Pathway URL"]
+
+        header += [
             "SMILES",
             "name",
             "depth",
@@ -1696,10 +1925,20 @@ class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
             "rule_ids",
             "parent_smiles",
         ]
-        )
+
+        rows = []
+
+        if include_header:
+            rows.append(header)
+
         for n in self.nodes.order_by("depth"):
             cs = n.default_node_label
-            row = [cs.smiles, cs.name, n.depth]
+            row = []
+
+            if include_pathway_url:
+                row.append(n.pathway.url)
+
+            row += [cs.smiles, cs.name, n.depth]
 
             edges = self.edges.filter(end_nodes__in=[n])
             if len(edges):
@@ -1730,6 +1969,7 @@ class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
         smiles: str,
         name: Optional[str] = None,
         description: Optional[str] = None,
+        predicted: bool = False,
     ):
         pw = Pathway()
         pw.package = package
@@ -1742,6 +1982,7 @@ class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
         pw.name = name
         if description is not None and description.strip() != "":
             pw.description = nh3.clean(description, tags=s.ALLOWED_HTML_TAGS).strip()
+        pw.predicted = predicted
 
         pw.save()
         try:
@@ -1761,6 +2002,8 @@ class Pathway(EnviPathModel, AliasMixin, ScenarioMixin):
             return mapping[self]
 
         # Start copying the pathway
+        # Its safe to use .objects.create here as Pathways itself aren't
+        # deduplicated
         new_pathway = Pathway.objects.create(
             package=target,
             name=self.name,
@@ -1872,6 +2115,7 @@ class Node(EnviPathModel, AliasMixin, ScenarioMixin):
     )
     out_edges = models.ManyToManyField("epdb.Edge", verbose_name="Outgoing Edges")
     depth = models.IntegerField(verbose_name="Node depth", null=False, blank=False)
+    stereo_removed = models.BooleanField(default=False, null=False)
 
     def _url(self):
         return "{}/node/{}".format(self.pathway.url, self.uuid)
@@ -1881,6 +2125,7 @@ class Node(EnviPathModel, AliasMixin, ScenarioMixin):
 
         return {
             "depth": self.depth,
+            "stereo_removed": self.stereo_removed,
             "url": self.url,
             "node_label_id": self.default_node_label.url,
             "image": f"{self.url}?image=svg",
@@ -1896,6 +2141,7 @@ class Node(EnviPathModel, AliasMixin, ScenarioMixin):
                 else None,
                 "uncovered_functional_groups": False,
             },
+            "is_engineered_intermediate": self.kv.get("is_engineered_intermediate", False),
         }
 
     @staticmethod
@@ -1906,12 +2152,17 @@ class Node(EnviPathModel, AliasMixin, ScenarioMixin):
         name: Optional[str] = None,
         description: Optional[str] = None,
     ):
+        stereo_removed = False
+        if pathway.predicted and FormatConverter.has_stereo(smiles):
+            smiles = FormatConverter.standardize(smiles, remove_stereo=True)
+            stereo_removed = True
         c = Compound.create(pathway.package, smiles, name=name, description=description)
 
         if Node.objects.filter(pathway=pathway, default_node_label=c.default_structure).exists():
             return Node.objects.get(pathway=pathway, default_node_label=c.default_structure)
 
         n = Node()
+        n.stereo_removed = stereo_removed
         n.pathway = pathway
         n.depth = depth
 
@@ -2076,7 +2327,7 @@ class Edge(EnviPathModel, AliasMixin, ScenarioMixin):
 
 class EPModel(PolymorphicModel, EnviPathModel):
     package = models.ForeignKey(
-        "epdb.Package", verbose_name="Package", on_delete=models.CASCADE, db_index=True
+        s.EPDB_PACKAGE_MODEL, verbose_name="Package", on_delete=models.CASCADE, db_index=True
     )
 
     def _url(self):
@@ -2085,17 +2336,17 @@ class EPModel(PolymorphicModel, EnviPathModel):
 
 class PackageBasedModel(EPModel):
     rule_packages = models.ManyToManyField(
-        "Package",
+        s.EPDB_PACKAGE_MODEL,
         verbose_name="Rule Packages",
         related_name="%(app_label)s_%(class)s_rule_packages",
     )
     data_packages = models.ManyToManyField(
-        "Package",
+        s.EPDB_PACKAGE_MODEL,
         verbose_name="Data Packages",
         related_name="%(app_label)s_%(class)s_data_packages",
     )
     eval_packages = models.ManyToManyField(
-        "Package",
+        s.EPDB_PACKAGE_MODEL,
         verbose_name="Evaluation Packages",
         related_name="%(app_label)s_%(class)s_eval_packages",
     )
@@ -2152,6 +2403,29 @@ class PackageBasedModel(EPModel):
 
         return res
 
+    @property
+    def mg_pr_curve(self):
+        if self.model_status != self.FINISHED:
+            raise ValueError(f"Expected {self.FINISHED} but model is in status {self.model_status}")
+
+        if not self.multigen_eval:
+            raise ValueError("MG PR Curve is only available for multigen models")
+
+        res = []
+
+        thresholds = self.eval_results["multigen_average_precision_per_threshold"].keys()
+
+        for t in thresholds:
+            res.append(
+                {
+                    "precision": self.eval_results["multigen_average_precision_per_threshold"][t],
+                    "recall": self.eval_results["multigen_average_recall_per_threshold"][t],
+                    "threshold": float(t),
+                }
+            )
+
+        return res
+
     @cached_property
     def applicable_rules(self) -> List["Rule"]:
         """
@@ -2213,6 +2487,13 @@ class PackageBasedModel(EPModel):
         return Dataset.load(ds_path)
 
     def retrain(self):
+        # Reset eval fields
+        self.eval_results = {}
+        self.eval_packages.clear()
+        self.model_status = False
+        self.save()
+
+        # Do actual retrain
         self.build_dataset()
         self.build_model()
 
@@ -2250,7 +2531,7 @@ class PackageBasedModel(EPModel):
         self.save()
 
     def evaluate_model(self, multigen: bool, eval_packages: List["Package"] = None, **kwargs):
-        if self.model_status != self.BUILT_NOT_EVALUATED:
+        if self.model_status not in [self.BUILT_NOT_EVALUATED, self.FINISHED]:
             raise ValueError(f"Can't evaluate a model in state {self.model_status}!")
 
         if multigen:
@@ -2258,9 +2539,12 @@ class PackageBasedModel(EPModel):
             self.save()
 
         if eval_packages is not None:
+            self.eval_packages.clear()
             for p in eval_packages:
                 self.eval_packages.add(p)
 
+        self.eval_results = {}
+
         self.model_status = self.EVALUATING
         self.save()
 
@@ -2314,9 +2598,14 @@ class PackageBasedModel(EPModel):
             recall = {f"{t:.2f}": [] for t in thresholds}
 
             # Note: only one root compound supported at this time
-            root_compounds = [
+            root_compounds = []
-                [p.default_node_label.smiles for p in p.root_nodes][0] for p in pathways
+            for pw in pathways:
-            ]
+                if pw.root_nodes:
+                    root_compounds.append(pw.root_nodes[0].default_node_label)
+                else:
+                    logger.info(
+                        f"Skipping MG Eval of Pathway {pw.name} ({pw.uuid}) as it has no root compounds!"
+                    )
 
             # As we need a Model Instance in our setting, get a fresh copy from db, overwrite the serialized mode and
             # pass it to the setting used in prediction
@@ -2340,7 +2629,7 @@ class PackageBasedModel(EPModel):
             for i, root in enumerate(root_compounds):
                 logger.debug(f"Evaluating pathway {i + 1} of {len(root_compounds)}...")
 
-                spw = SPathway(root_nodes=root, prediction_setting=s)
+                spw = SPathway(root_nodes=root.smiles, prediction_setting=s)
                 level = 0
 
                 while not spw.done:
@@ -3123,7 +3412,7 @@ class EnviFormer(PackageBasedModel):
         return args
 
     def evaluate_model(self, multigen: bool, eval_packages: List["Package"] = None, **kwargs):
-        if self.model_status != self.BUILT_NOT_EVALUATED:
+        if self.model_status not in [self.BUILT_NOT_EVALUATED, self.FINISHED]:
             raise ValueError(f"Can't evaluate a model in state {self.model_status}!")
 
         if multigen:
@@ -3131,9 +3420,12 @@ class EnviFormer(PackageBasedModel):
             self.save()
 
         if eval_packages is not None:
+            self.eval_packages.clear()
             for p in eval_packages:
                 self.eval_packages.add(p)
 
+        self.eval_results = {}
+
         self.model_status = self.EVALUATING
         self.save()
 
@@ -3400,7 +3692,7 @@ class PluginModel(EPModel):
 
 class Scenario(EnviPathModel):
     package = models.ForeignKey(
-        "epdb.Package", verbose_name="Package", on_delete=models.CASCADE, db_index=True
+        s.EPDB_PACKAGE_MODEL, verbose_name="Package", on_delete=models.CASCADE, db_index=True
     )
     scenario_date = models.CharField(max_length=256, null=False, blank=False, default="No date")
     scenario_type = models.CharField(
@@ -3543,6 +3835,12 @@ class UserSettingPermission(Permission):
         return f"User: {self.user} has Permission: {self.permission} on Setting: {self.setting}"
 
 
+class ExpansionSchemeChoice(models.TextChoices):
+    BFS = "BFS", "Breadth First Search"
+    DFS = "DFS", "Depth First Search"
+    GREEDY = "GREEDY", "Greedy"
+
+
 class Setting(EnviPathModel):
     public = models.BooleanField(null=False, blank=False, default=False)
     global_default = models.BooleanField(null=False, blank=False, default=False)
@@ -3555,7 +3853,7 @@ class Setting(EnviPathModel):
     )
 
     rule_packages = models.ManyToManyField(
-        "Package",
+        s.EPDB_PACKAGE_MODEL,
         verbose_name="Setting Rule Packages",
         related_name="setting_rule_packages",
         blank=True,
@@ -3567,6 +3865,12 @@ class Setting(EnviPathModel):
         null=True, blank=True, verbose_name="Setting Model Threshold", default=0.25
     )
 
+    expansion_scheme = models.CharField(
+        max_length=20,
+        choices=ExpansionSchemeChoice.choices,
+        default=ExpansionSchemeChoice.BFS,
+    )
+
     def _url(self):
         return "{}/setting/{}".format(s.SERVER_URL, self.uuid)
 
@@ -3601,33 +3905,48 @@ class Setting(EnviPathModel):
         rules = sorted(rules, key=lambda x: x.url)
         return rules
 
-    def expand(self, pathway, current_node):
+    def expand(self, pathway, current_node) -> Dict[str, Any]:
+        res: Dict[str, Any] = defaultdict(list)
+
         """Decision Method whether to expand on a certain Node or not"""
         if pathway.num_nodes() >= self.max_nodes:
             logger.info(
-                f"Pathway has {pathway.num_nodes()} which exceeds the limit of {self.max_nodes}"
+                f"Pathway has {pathway.num_nodes()} Nodes which exceeds the limit of {self.max_nodes}"
             )
-            return []
+            res["expansion_skipped"] = True
+            return res
 
         if pathway.depth() >= self.max_depth:
             logger.info(
                 f"Pathway has reached depth {pathway.depth()} which exceeds the limit of {self.max_depth}"
             )
-            return []
+            res["expansion_skipped"] = True
+            return res
 
-        transformations = []
         if self.model is not None:
             pred_results = self.model.predict(current_node.smiles)
+
+            # Store whether there are results that may be removed as they are below
+            # the given threshold
+            if len(pred_results):
+                res["rule_triggered"] = True
+
             for pred_result in pred_results:
-                if pred_result.probability >= self.model_threshold:
+                if (
-                    transformations.append(pred_result)
+                    len(pred_result.product_sets)
+                    and pred_result.probability >= self.model_threshold
+                ):
+                    res["transformations"].append(pred_result)
         else:
             for rule in self.applicable_rules:
                 tmp_products = rule.apply(current_node.smiles)
                 if tmp_products:
-                    transformations.append(PredictionResult(tmp_products, 1.0, rule))
+                    res["transformations"].append(PredictionResult(tmp_products, 1.0, rule))
 
-        return transformations
+            if len(res["transformations"]):
+                res["rule_triggered"] = True
+
+        return res
 
     @transaction.atomic
     def make_global_default(self):
@@ -3660,10 +3979,6 @@ class JobLog(TimeStampedModel):
     done_at = models.DateTimeField(null=True, blank=True, default=None)
     task_result = models.TextField(null=True, blank=True, default=None)
 
-    def check_for_update(self):
-        async_res = self.get_result()
-        new_status = async_res.state
-
     TERMINAL_STATES = [
         "SUCCESS",
         "FAILURE",
@@ -3671,12 +3986,22 @@ class JobLog(TimeStampedModel):
         "IGNORED",
     ]
 
-        if new_status != self.status and new_status in TERMINAL_STATES:
+    def is_in_terminal_state(self):
+        return self.status in self.TERMINAL_STATES
+
+    def check_for_update(self):
+        if self.is_in_terminal_state():
+            return
+
+        async_res = self.get_result()
+        new_status = async_res.state
+
+        if new_status != self.status and new_status in self.TERMINAL_STATES:
             self.status = new_status
             self.done_at = async_res.date_done
 
             if new_status == "SUCCESS":
-                self.task_result = async_res.result
+                self.task_result = str(async_res.result) if async_res.result else None
 
             self.save()
 
@@ -3687,3 +4012,18 @@ class JobLog(TimeStampedModel):
         from celery.result import AsyncResult
 
         return AsyncResult(str(self.task_id))
+
+    def parsed_result(self):
+        if not self.is_in_terminal_state() or self.task_result is None:
+            return None
+
+        import ast
+
+        if self.job_name == "engineer_pathways":
+            return ast.literal_eval(self.task_result)
+        return self.task_result
+
+    def is_result_downloadable(self):
+        downloadable = ["batch_predict"]
+
+        return self.job_name in downloadable

epdb/tasks.py

@@ -6,14 +6,18 @@ from uuid import uuid4
 
 from celery import shared_task
 from celery.utils.functional import LRUCache
+from django.conf import settings as s
 from django.utils import timezone
 
 from epdb.logic import SPathway
-from epdb.models import Edge, EPModel, JobLog, Node, Package, Pathway, Rule, Setting, User
+from epdb.models import Edge, EPModel, JobLog, Node, Pathway, Rule, Setting, User
+from utilities.chem import FormatConverter
 
 logger = logging.getLogger(__name__)
 ML_CACHE = LRUCache(3)  # Cache the three most recent ML models to reduce load times.
 
+Package = s.GET_PACKAGE_MODEL()
+
 
 def get_ml_model(model_pk: int):
     if model_pk not in ML_CACHE:
@@ -33,7 +37,7 @@ def dispatch_eager(user: "User", job: Callable, *args, **kwargs):
         log.task_result = str(x) if x else None
         log.save()
 
-        return x
+        return log, x
     except Exception as e:
         logger.exception(e)
         raise e
@@ -49,7 +53,7 @@ def dispatch(user: "User", job: Callable, *args, **kwargs):
         log.status = "INITIAL"
         log.save()
 
-        return x.result
+        return log
     except Exception as e:
         logger.exception(e)
         raise e
@@ -136,14 +140,25 @@ def predict(
     pred_setting_pk: int,
     limit: Optional[int] = None,
     node_pk: Optional[int] = None,
+    setting_overrides: Optional[dict] = None,
 ) -> Pathway:
     pw = Pathway.objects.get(id=pw_pk)
     setting = Setting.objects.get(id=pred_setting_pk)
+
+    if setting_overrides:
+        for k, v in setting_overrides.items():
+            setattr(setting, k, v)
+
     # If the setting has a model add/restore it from the cache
     if setting.model is not None:
         setting.model = get_ml_model(setting.model.pk)
 
-    pw.kv.update(**{"status": "running"})
+    kv = {"status": "running"}
+
+    if setting_overrides:
+        kv["setting_overrides"] = setting_overrides
+
+    pw.kv.update(**kv)
     pw.save()
 
     if JobLog.objects.filter(task_id=self.request.id).exists():
@@ -168,10 +183,12 @@ def predict(
             spw = SPathway.from_pathway(pw)
             spw.predict_step(from_node=n)
         else:
-            raise ValueError("Neither limit nor node_pk given!")
+            spw = SPathway(prediction_setting=setting, persist=pw)
+            spw.predict()
 
     except Exception as e:
         pw.kv.update({"status": "failed"})
+        pw.kv.update(**{"error": str(e)})
         pw.save()
 
         if JobLog.objects.filter(task_id=self.request.id).exists():
@@ -281,3 +298,144 @@ def identify_missing_rules(
     buffer.seek(0)
 
     return buffer.getvalue()
+
+
+@shared_task(bind=True, queue="background")
+def engineer_pathways(self, pw_pks: List[int], setting_pk: int, target_package_pk: int):
+    from utilities.misc import PathwayUtils
+
+    setting = Setting.objects.get(pk=setting_pk)
+    # Temporarily set model_threshold to 0.0 to keep all tps
+    setting.model_threshold = 0.0
+
+    target = Package.objects.get(pk=target_package_pk)
+
+    intermediate_pathways = []
+    predicted_pathways = []
+
+    for pw in Pathway.objects.filter(pk__in=pw_pks):
+        pu = PathwayUtils(pw)
+
+        eng_pw, node_to_snode_mapping, intermediates = pu.engineer(setting)
+
+        # If we've found intermediates, do the following
+        # - Get a copy of the original pathway and add intermediates
+        # - Store the predicted pathway for further investigation
+        if len(intermediates):
+            copy_mapping = {}
+            copied_pw = pw.copy(target, copy_mapping)
+            copied_pw.name = f"{copied_pw.name} (Engineered)"
+            copied_pw.description = f"The original Pathway can be found here: {pw.url}"
+            copied_pw.save()
+
+            for inter in intermediates:
+                start = copy_mapping[inter[0]]
+                end = copy_mapping[inter[1]]
+                start_snode = inter[2]
+                end_snode = inter[3]
+                for idx, intermediate_edge in enumerate(inter[4]):
+                    smiles_to_node = {}
+
+                    snodes_to_create = list(
+                        set(intermediate_edge.educts + intermediate_edge.products)
+                    )
+
+                    for snode in snodes_to_create:
+                        if snode == start_snode or snode == end_snode:
+                            smiles_to_node[snode.smiles] = start if snode == start_snode else end
+                            continue
+
+                        if snode.smiles not in smiles_to_node:
+                            n = Node.create(copied_pw, smiles=snode.smiles, depth=snode.depth)
+                            # Used in viz to highlight intermediates
+                            n.kv.update({"is_engineered_intermediate": True})
+                            n.save()
+                            smiles_to_node[snode.smiles] = n
+
+                    Edge.create(
+                        copied_pw,
+                        [smiles_to_node[educt.smiles] for educt in intermediate_edge.educts],
+                        [smiles_to_node[product.smiles] for product in intermediate_edge.products],
+                        rule=intermediate_edge.rule,
+                    )
+
+            # Persist the predicted pathway
+            pred_pw = pu.spathway_to_pathway(target, eng_pw, name=f"{pw.name} (Predicted)")
+
+            intermediate_pathways.append(copied_pw.url)
+            predicted_pathways.append(pred_pw.url)
+
+    return intermediate_pathways, predicted_pathways
+
+
+@shared_task(bind=True, queue="background")
+def batch_predict(
+    self,
+    substrates: List[str] | List[List[str]],
+    prediction_setting_pk: int,
+    target_package_pk: int,
+    num_tps: int = 50,
+):
+    target_package = Package.objects.get(pk=target_package_pk)
+    prediction_setting = Setting.objects.get(pk=prediction_setting_pk)
+
+    if len(substrates) == 0:
+        raise ValueError("No substrates given!")
+
+    is_pair = isinstance(substrates[0], list)
+
+    substrate_and_names = []
+    if not is_pair:
+        for sub in substrates:
+            substrate_and_names.append([sub, None])
+    else:
+        substrate_and_names = substrates
+
+    # Check prerequisite that we can standardize all substrates
+    standardized_substrates_and_smiles = []
+    for substrate in substrate_and_names:
+        try:
+            stand_smiles = FormatConverter.standardize(substrate[0])
+            standardized_substrates_and_smiles.append([stand_smiles, substrate[1]])
+        except ValueError:
+            raise ValueError(
+                f'Pathway prediction failed as standardization of SMILES "{substrate}" failed!'
+            )
+
+    pathways = []
+
+    for pair in standardized_substrates_and_smiles:
+        pw = Pathway.create(
+            target_package,
+            pair[0],
+            name=pair[1],
+            predicted=True,
+        )
+
+        # set mode and setting
+        pw.setting = prediction_setting
+        pw.kv.update({"mode": "predict"})
+        pw.save()
+
+        predict(
+            pw.pk,
+            prediction_setting.pk,
+            limit=None,
+            setting_overrides={
+                "max_nodes": num_tps,
+                "max_depth": num_tps,
+                "model_threshold": 0.001,
+            },
+        )
+
+        pathways.append(pw)
+
+    buffer = io.StringIO()
+
+    for idx, pw in enumerate(pathways):
+        # Carry out header only for the first pathway
+        buffer.write(pw.to_csv(include_header=idx == 0, include_pathway_url=True))
+
+    buffer.seek(0)
+
+    return buffer.getvalue()

epdb/urls.py

@@ -49,6 +49,7 @@ urlpatterns = [
     re_path(r"^group$", v.groups, name="groups"),
     re_path(r"^search$", v.search, name="search"),
     re_path(r"^predict$", v.predict_pathway, name="predict_pathway"),
+    re_path(r"^batch-predict$", v.batch_predict_pathway, name="batch_predict_pathway"),
     # User Detail
     re_path(rf"^user/(?P<user_uuid>{UUID})", v.user, name="user"),
     # Group Detail
@@ -142,6 +143,11 @@ urlpatterns = [
         v.package_pathway,
         name="package pathway detail",
     ),
+    re_path(
+        rf"^package/(?P<package_uuid>{UUID})/predict$",
+        v.package_predict_pathway,
+        name="package predict pathway",
+    ),
     # Pathway Nodes
     re_path(
         rf"^package/(?P<package_uuid>{UUID})/pathway/(?P<pathway_uuid>{UUID})/node$",
@@ -191,7 +197,8 @@ urlpatterns = [
     re_path(r"^indigo/dearomatize$", v.dearomatize, name="indigo_dearomatize"),
     re_path(r"^indigo/layout$", v.layout, name="indigo_layout"),
     re_path(r"^depict$", v.depict, name="depict"),
-    re_path(r"^jobs", v.jobs, name="jobs"),
+    path("jobs", v.jobs, name="jobs"),
+    path("jobs/<uuid:job_uuid>", v.job, name="job detail"),
     # OAuth Stuff
     path("o/userinfo/", v.userinfo, name="oauth_userinfo"),
     # Static Pages

epdb/views.py

@@ -1,58 +1,63 @@
 import json
 import logging
-from typing import List, Dict, Any
+from typing import Any, Dict, List
+from datetime import datetime
 
+import nh3
 from django.conf import settings as s
 from django.contrib.auth import get_user_model
-from django.http import JsonResponse, HttpResponse, HttpResponseNotAllowed, HttpResponseBadRequest
+from django.core.exceptions import BadRequest, PermissionDenied
-from django.shortcuts import render, redirect
+from django.http import HttpResponse, HttpResponseBadRequest, HttpResponseNotAllowed, JsonResponse
+from django.shortcuts import redirect, render
 from django.urls import reverse
 from django.views.decorators.csrf import csrf_exempt
 from envipy_additional_information import NAME_MAPPING
 from oauth2_provider.decorators import protected_resource
-import nh3
 
 from utilities.chem import FormatConverter, IndigoUtils
 from utilities.decorators import package_permission_required
 from utilities.misc import HTMLGenerator
+
 from .logic import (
+    EPDBURLParser,
     GroupManager,
     PackageManager,
-    UserManager,
-    SettingManager,
     SearchManager,
-    EPDBURLParser,
+    SettingManager,
+    UserManager,
 )
 from .models import (
-    Package,
+    APIToken,
-    GroupPackagePermission,
-    Group,
-    CompoundStructure,
     Compound,
+    CompoundStructure,
+    Edge,
+    EnviFormer,
+    EnzymeLink,
+    EPModel,
+    ExternalDatabase,
+    ExternalIdentifier,
+    Group,
+    GroupPackagePermission,
+    JobLog,
+    License,
+    MLRelativeReasoning,
+    Node,
+    Pathway,
+    Permission,
     Reaction,
     Rule,
-    Pathway,
-    Node,
-    EPModel,
-    EnviFormer,
-    MLRelativeReasoning,
     RuleBasedRelativeReasoning,
     Scenario,
     SimpleAmbitRule,
-    APIToken,
-    UserPackagePermission,
-    Permission,
-    License,
     User,
-    Edge,
+    UserPackagePermission,
-    ExternalDatabase,
+    ExpansionSchemeChoice,
-    ExternalIdentifier,
-    EnzymeLink,
-    JobLog,
 )
 
 logger = logging.getLogger(__name__)
 
+Package = s.GET_PACKAGE_MODEL()
+
 
 def log_post_params(request):
     if s.DEBUG:
@@ -60,6 +65,26 @@ def log_post_params(request):
             logger.debug(f"{k}\t{v}")
 
 
+def get_error_handler_context(request, for_user=None) -> Dict[str, Any]:
+    current_user = _anonymous_or_real(request)
+
+    if for_user:
+        current_user = for_user
+
+    ctx = {
+        "title": "enviPath",
+        "meta": {
+            "site_id": s.MATOMO_SITE_ID,
+            "version": "0.0.1",
+            "server_url": s.SERVER_URL,
+            "user": current_user,
+            "enabled_features": s.FLAGS,
+            "debug": s.DEBUG,
+        },
+    }
+    return ctx
+
+
 def error(request, message: str, detail: str, code: int = 400):
     context = get_base_context(request)
     error_context = {
@@ -74,6 +99,48 @@ def error(request, message: str, detail: str, code: int = 400):
     return render(request, "errors/error.html", context, status=code)
 
 
+def handler400(request, exception):
+    """Custom 400 Bad Request error handler"""
+    context = get_error_handler_context(request)
+    context["public_mode"] = True
+    return render(request, "errors/400_bad_request.html", context, status=400)
+
+
+def handler403(request, exception):
+    """Custom 403 Forbidden error handler"""
+    context = get_error_handler_context(request)
+    context["public_mode"] = True
+    return render(request, "errors/403_access_denied.html", context, status=403)
+
+
+def handler404(request, exception):
+    """Custom 404 Not Found error handler"""
+    context = get_error_handler_context(request)
+    context["public_mode"] = True
+    return render(request, "errors/404_not_found.html", context, status=404)
+
+
+def handler500(request):
+    """Custom 500 Internal Server Error handler"""
+    context = get_error_handler_context(request)
+
+    error_context = {}
+    error_context["error_message"] = "Internal Server Error"
+    error_context["error_detail"] = "An unexpected error occurred. Please try again later."
+
+    if request.headers.get("Accept") == "application/json":
+        return JsonResponse(error_context, status=500)
+
+    context["public_mode"] = True
+    context["error_code"] = 500
+    context["error_description"] = (
+        "We encountered an unexpected error while processing your request. Our team has been notified and is working to resolve the issue."
+    )
+    context.update(**error_context)
+
+    return render(request, "errors/error.html", context, status=500)
+
+
 def login(request):
     context = get_base_context(request)
 
@@ -83,8 +150,7 @@ def login(request):
         return render(request, "static/login.html", context)
 
     elif request.method == "POST":
-        from django.contrib.auth import authenticate
+        from django.contrib.auth import authenticate, login
-        from django.contrib.auth import login
 
         username = request.POST.get("username").strip()
         if username != request.POST.get("username"):
@@ -191,8 +257,8 @@ def register(request):
 
 
 def editable(request, user):
-    if user.is_superuser:
+    # if user.is_superuser:
-        return True
+    #     return True
 
     url = request.build_absolute_uri(request.path)
     if PackageManager.is_package_url(url):
@@ -256,7 +322,7 @@ def get_base_context(request, for_user=None) -> Dict[str, Any]:
 
 
 def _anonymous_or_real(request):
-    if request.user.is_authenticated and not request.user.is_anonymous:
+    if request.user and (request.user.is_authenticated and not request.user.is_anonymous):
         return request.user
     return get_user_model().objects.get(username="anonymous")
 
@@ -374,26 +440,49 @@ def predict_pathway(request):
     return render(request, "predict_pathway.html", context)
 
 
+def batch_predict_pathway(request):
+    """Top-level predict pathway view using user's default package."""
+    if request.method != "GET":
+        return HttpResponseNotAllowed(["GET"])
+
+    context = get_base_context(request)
+    context["title"] = "enviPath - Batch Predict Pathway"
+    context["meta"]["current_package"] = context["meta"]["user"].default_package
+
+    return render(request, "batch_predict_pathway.html", context)
+
+
+@package_permission_required()
+def package_predict_pathway(request, package_uuid):
+    """Package-specific predict pathway view."""
+    if request.method != "GET":
+        return HttpResponseNotAllowed(["GET"])
+
+    current_user = _anonymous_or_real(request)
+    current_package = PackageManager.get_package_by_id(current_user, package_uuid)
+
+    context = get_base_context(request)
+    context["title"] = f"enviPath - {current_package.name} - Predict Pathway"
+    context["meta"]["current_package"] = current_package
+
+    return render(request, "predict_pathway.html", context)
+
+
 def packages(request):
     current_user = _anonymous_or_real(request)
 
     if request.method == "GET":
         context = get_base_context(request)
         context["title"] = "enviPath - Packages"
-
-        context["object_type"] = "package"
         context["meta"]["current_package"] = context["meta"]["user"].default_package
-        context["meta"]["can_edit"] = True
 
-        reviewed_package_qs = Package.objects.filter(reviewed=True).order_by("created")
+        # Context for paginated template
-        unreviewed_package_qs = PackageManager.get_all_readable_packages(current_user).order_by(
+        context["entity_type"] = "package"
-            "name"
+        context["api_endpoint"] = "/api/v1/packages/"
-        )
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "packages"
 
-        context["reviewed_objects"] = reviewed_package_qs
+        return render(request, "collections/packages_paginated.html", context)
-        context["unreviewed_objects"] = unreviewed_package_qs
-
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         if hidden := request.POST.get("hidden", None):
@@ -439,29 +528,16 @@ def compounds(request):
     if request.method == "GET":
         context = get_base_context(request)
         context["title"] = "enviPath - Compounds"
-
-        context["object_type"] = "compound"
         context["meta"]["current_package"] = context["meta"]["user"].default_package
 
-        reviewed_compound_qs = Compound.objects.none()
+        # Context for paginated template
+        context["entity_type"] = "compound"
+        context["api_endpoint"] = "/api/v1/compounds/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_mode"] = "tabbed"
+        context["list_title"] = "compounds"
 
-        for p in PackageManager.get_reviewed_packages():
+        return render(request, "collections/compounds_paginated.html", context)
-            reviewed_compound_qs |= Compound.objects.filter(package=p)
-
-        reviewed_compound_qs = reviewed_compound_qs.order_by("name")
-
-        if request.GET.get("all"):
-            return JsonResponse(
-                {
-                    "objects": [
-                        {"name": pw.name, "url": pw.url, "reviewed": True}
-                        for pw in reviewed_compound_qs
-                    ]
-                }
-            )
-
-        context["reviewed_objects"] = reviewed_compound_qs
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         # delegate to default package
@@ -477,32 +553,19 @@ def rules(request):
     if request.method == "GET":
         context = get_base_context(request)
         context["title"] = "enviPath - Rules"
-
-        context["object_type"] = "rule"
         context["meta"]["current_package"] = context["meta"]["user"].default_package
         context["breadcrumbs"] = [
             {"Home": s.SERVER_URL},
             {"Rule": s.SERVER_URL + "/rule"},
         ]
-        reviewed_rule_qs = Rule.objects.none()
 
-        for p in PackageManager.get_reviewed_packages():
+        # Context for paginated template
-            reviewed_rule_qs |= Rule.objects.filter(package=p)
+        context["entity_type"] = "rule"
+        context["api_endpoint"] = "/api/v1/rules/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "rules"
 
-        reviewed_rule_qs = reviewed_rule_qs.order_by("name")
+        return render(request, "collections/rules_paginated.html", context)
-
-        if request.GET.get("all"):
-            return JsonResponse(
-                {
-                    "objects": [
-                        {"name": pw.name, "url": pw.url, "reviewed": True}
-                        for pw in reviewed_rule_qs
-                    ]
-                }
-            )
-
-        context["reviewed_objects"] = reviewed_rule_qs
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         # delegate to default package
@@ -518,32 +581,19 @@ def reactions(request):
     if request.method == "GET":
         context = get_base_context(request)
         context["title"] = "enviPath - Reactions"
-
-        context["object_type"] = "reaction"
         context["meta"]["current_package"] = context["meta"]["user"].default_package
         context["breadcrumbs"] = [
             {"Home": s.SERVER_URL},
             {"Reaction": s.SERVER_URL + "/reaction"},
         ]
-        reviewed_reaction_qs = Reaction.objects.none()
 
-        for p in PackageManager.get_reviewed_packages():
+        # Context for paginated template
-            reviewed_reaction_qs |= Reaction.objects.filter(package=p).order_by("name")
+        context["entity_type"] = "reaction"
+        context["api_endpoint"] = "/api/v1/reactions/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "reactions"
 
-        reviewed_reaction_qs = reviewed_reaction_qs.order_by("name")
+        return render(request, "collections/reactions_paginated.html", context)
-
-        if request.GET.get("all"):
-            return JsonResponse(
-                {
-                    "objects": [
-                        {"name": pw.name, "url": pw.url, "reviewed": True}
-                        for pw in reviewed_reaction_qs
-                    ]
-                }
-            )
-
-        context["reviewed_objects"] = reviewed_reaction_qs
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         # delegate to default package
@@ -559,33 +609,19 @@ def pathways(request):
     if request.method == "GET":
         context = get_base_context(request)
         context["title"] = "enviPath - Pathways"
-
-        context["object_type"] = "pathway"
         context["meta"]["current_package"] = context["meta"]["user"].default_package
         context["breadcrumbs"] = [
             {"Home": s.SERVER_URL},
             {"Pathway": s.SERVER_URL + "/pathway"},
         ]
 
-        reviewed_pathway_qs = Pathway.objects.none()
+        # Context for paginated template
+        context["entity_type"] = "pathway"
+        context["api_endpoint"] = "/api/v1/pathways/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "pathways"
 
-        for p in PackageManager.get_reviewed_packages():
+        return render(request, "collections/pathways_paginated.html", context)
-            reviewed_pathway_qs |= Pathway.objects.filter(package=p).order_by("name")
-
-        reviewed_pathway_qs = reviewed_pathway_qs.order_by("name")
-
-        if request.GET.get("all"):
-            return JsonResponse(
-                {
-                    "objects": [
-                        {"name": pw.name, "url": pw.url, "reviewed": True}
-                        for pw in reviewed_pathway_qs
-                    ]
-                }
-            )
-
-        context["reviewed_objects"] = reviewed_pathway_qs
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         # delegate to default package
@@ -609,25 +645,13 @@ def scenarios(request):
             {"Scenario": s.SERVER_URL + "/scenario"},
         ]
 
-        reviewed_scenario_qs = Scenario.objects.none()
+        # Context for paginated template
+        context["entity_type"] = "scenario"
+        context["api_endpoint"] = "/api/v1/scenarios/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "scenarios"
 
-        for p in PackageManager.get_reviewed_packages():
+        return render(request, "collections/scenarios_paginated.html", context)
-            reviewed_scenario_qs |= Scenario.objects.filter(package=p).order_by("name")
-
-        reviewed_scenario_qs = reviewed_scenario_qs.order_by("name")
-
-        if request.GET.get("all"):
-            return JsonResponse(
-                {
-                    "objects": [
-                        {"name": s.name, "url": s.url, "reviewed": True}
-                        for s in reviewed_scenario_qs
-                    ]
-                }
-            )
-
-        context["reviewed_objects"] = reviewed_scenario_qs
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         # delegate to default package
@@ -642,42 +666,28 @@ def models(request):
     if request.method == "GET":
         context = get_base_context(request)
         context["title"] = "enviPath - Models"
-
-        context["object_type"] = "model"
         context["meta"]["current_package"] = context["meta"]["user"].default_package
         context["breadcrumbs"] = [
             {"Home": s.SERVER_URL},
             {"Model": s.SERVER_URL + "/model"},
         ]
 
+        # Keep model_types for potential modal/action use
         context["model_types"] = {
             "ML Relative Reasoning": "ml-relative-reasoning",
             "Rule Based Relative Reasoning": "rule-based-relative-reasoning",
             "EnviFormer": "enviformer",
         }
-
         for k, v in s.CLASSIFIER_PLUGINS.items():
             context["model_types"][v.display()] = k
 
-        reviewed_model_qs = EPModel.objects.none()
+        # Context for paginated template
+        context["entity_type"] = "model"
+        context["api_endpoint"] = "/api/v1/models/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "models"
 
-        for p in PackageManager.get_reviewed_packages():
+        return render(request, "collections/models_paginated.html", context)
-            reviewed_model_qs |= EPModel.objects.filter(package=p).order_by("name")
-
-        reviewed_model_qs = reviewed_model_qs.order_by("name")
-
-        if request.GET.get("all"):
-            return JsonResponse(
-                {
-                    "objects": [
-                        {"name": pw.name, "url": pw.url, "reviewed": True}
-                        for pw in reviewed_model_qs
-                    ]
-                }
-            )
-
-        context["reviewed_objects"] = reviewed_model_qs
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         current_user = _anonymous_or_real(request)
@@ -754,6 +764,10 @@ def package_models(request, package_uuid):
         context["meta"]["current_package"] = current_package
         context["object_type"] = "model"
         context["breadcrumbs"] = breadcrumbs(current_package, "model")
+        context["entity_type"] = "model"
+        context["api_endpoint"] = f"/api/v1/package/{current_package.uuid}/model/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "models"
 
         reviewed_model_qs = EPModel.objects.none()
         unreviewed_model_qs = EPModel.objects.none()
@@ -775,9 +789,6 @@ def package_models(request, package_uuid):
                 }
             )
 
-        context["reviewed_objects"] = reviewed_model_qs
-        context["unreviewed_objects"] = unreviewed_model_qs
-
         context["model_types"] = {
             "ML Relative Reasoning": "mlrr",
             "Rule Based Relative Reasoning": "rbrr",
@@ -790,7 +801,7 @@ def package_models(request, package_uuid):
             for k, v in s.CLASSIFIER_PLUGINS.items():
                 context["model_types"][v.display()] = k
 
-        return render(request, "collections/objects_list.html", context)
+        return render(request, "collections/models_paginated.html", context)
 
     elif request.method == "POST":
         log_post_params(request)
@@ -856,7 +867,7 @@ def package_models(request, package_uuid):
                 request, "Invalid model type.", f'Model type "{model_type}" is not supported."'
             )
 
-        from .tasks import dispatch, build_model
+        from .tasks import build_model, dispatch
 
         dispatch(current_user, build_model, mod.pk)
 
@@ -881,19 +892,20 @@ def package_model(request, package_uuid, model_uuid):
             # Check if smiles is non empty and valid
             if smiles == "":
                 return JsonResponse({"error": "Received empty SMILES"}, status=400)
-
+            stereo = FormatConverter.has_stereo(smiles)
             try:
-                stand_smiles = FormatConverter.standardize(smiles)
+                stand_smiles = FormatConverter.standardize(smiles, remove_stereo=True)
             except ValueError:
                 return JsonResponse({"error": f'"{smiles}" is not a valid SMILES'}, status=400)
 
             if classify:
                 from epdb.tasks import dispatch_eager, predict_simple
 
-                res = dispatch_eager(current_user, predict_simple, current_model.pk, stand_smiles)
+                _, pred_res = dispatch_eager(
+                    current_user, predict_simple, current_model.pk, stand_smiles
+                )
 
-                pred_res = current_model.predict(stand_smiles)
+                res = {"pred": [], "stereo": stereo}
-                res = []
 
                 for pr in pred_res:
                     if len(pr) > 0:
@@ -902,7 +914,7 @@ def package_model(request, package_uuid, model_uuid):
                             logger.debug(f"Checking {prod_set}")
                             products.append(tuple([x for x in prod_set]))
 
-                        res.append(
+                        res["pred"].append(
                             {
                                 "products": list(set(products)),
                                 "probability": pr.probability,
@@ -1052,9 +1064,7 @@ def package(request, package_uuid):
                 return redirect(s.SERVER_URL + "/package")
             elif hidden == "publish-package":
                 for g in Group.objects.filter(public=True):
-                    PackageManager.update_permissions(
+                    PackageManager.grant_read(current_user, current_package, g)
-                        current_user, current_package, g, Permission.READ[0]
-                    )
                 return redirect(current_package.url)
             elif hidden == "copy":
                 object_to_copy = request.POST.get("object_to_copy")
@@ -1149,6 +1159,11 @@ def package_compounds(request, package_uuid):
         context["meta"]["current_package"] = current_package
         context["object_type"] = "compound"
         context["breadcrumbs"] = breadcrumbs(current_package, "compound")
+        context["entity_type"] = "compound"
+        context["api_endpoint"] = f"/api/v1/package/{current_package.uuid}/compound/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_mode"] = "tabbed"
+        context["list_title"] = "compounds"
 
         reviewed_compound_qs = Compound.objects.none()
         unreviewed_compound_qs = Compound.objects.none()
@@ -1174,17 +1189,18 @@ def package_compounds(request, package_uuid):
                 }
             )
 
-        context["reviewed_objects"] = reviewed_compound_qs
+        return render(request, "collections/compounds_paginated.html", context)
-        context["unreviewed_objects"] = unreviewed_compound_qs
-
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         compound_name = request.POST.get("compound-name")
         compound_smiles = request.POST.get("compound-smiles")
         compound_description = request.POST.get("compound-description")
-
+        try:
-        c = Compound.create(current_package, compound_smiles, compound_name, compound_description)
+            c = Compound.create(
+                current_package, compound_smiles, compound_name, compound_description
+            )
+        except ValueError as e:
+            raise BadRequest(str(e))
 
         return redirect(c.url)
 
@@ -1292,19 +1308,17 @@ def package_compound_structures(request, package_uuid, compound_uuid):
         context["breadcrumbs"] = breadcrumbs(
             current_package, "compound", current_compound, "structure"
         )
+        context["entity_type"] = "structure"
+        context["page_title"] = f"{current_compound.name} - Structures"
+        context["api_endpoint"] = (
+            f"/api/v1/package/{current_package.uuid}/compound/{current_compound.uuid}/structure/"
+        )
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["compound"] = current_compound
+        context["list_mode"] = "combined"
+        context["list_title"] = "structures"
 
-        reviewed_compound_structure_qs = CompoundStructure.objects.none()
+        return render(request, "collections/structures_paginated.html", context)
-        unreviewed_compound_structure_qs = CompoundStructure.objects.none()
-
-        if current_package.reviewed:
-            reviewed_compound_structure_qs = current_compound.structures.order_by("name")
-        else:
-            unreviewed_compound_structure_qs = current_compound.structures.order_by("name")
-
-        context["reviewed_objects"] = reviewed_compound_structure_qs
-        context["unreviewed_objects"] = unreviewed_compound_structure_qs
-
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         structure_name = request.POST.get("structure-name")
@@ -1451,6 +1465,10 @@ def package_rules(request, package_uuid):
         context["meta"]["current_package"] = current_package
         context["object_type"] = "rule"
         context["breadcrumbs"] = breadcrumbs(current_package, "rule")
+        context["entity_type"] = "rule"
+        context["api_endpoint"] = f"/api/v1/package/{current_package.uuid}/rule/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "rules"
 
         reviewed_rule_qs = Rule.objects.none()
         unreviewed_rule_qs = Rule.objects.none()
@@ -1472,10 +1490,7 @@ def package_rules(request, package_uuid):
                 }
             )
 
-        context["reviewed_objects"] = reviewed_rule_qs
+        return render(request, "collections/rules_paginated.html", context)
-        context["unreviewed_objects"] = unreviewed_rule_qs
-
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         log_post_params(request)
@@ -1653,11 +1668,15 @@ def package_reactions(request, package_uuid):
 
     if request.method == "GET":
         context = get_base_context(request)
-        context["title"] = f"enviPath - {current_package.name} - {current_package.name} - Reactions"
+        context["title"] = f"enviPath - {current_package.name} - Reactions"
 
         context["meta"]["current_package"] = current_package
         context["object_type"] = "reaction"
         context["breadcrumbs"] = breadcrumbs(current_package, "reaction")
+        context["entity_type"] = "reaction"
+        context["api_endpoint"] = f"/api/v1/package/{current_package.uuid}/reaction/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "reactions"
 
         reviewed_reaction_qs = Reaction.objects.none()
         unreviewed_reaction_qs = Reaction.objects.none()
@@ -1683,10 +1702,7 @@ def package_reactions(request, package_uuid):
                 }
             )
 
-        context["reviewed_objects"] = reviewed_reaction_qs
+        return render(request, "collections/reactions_paginated.html", context)
-        context["unreviewed_objects"] = unreviewed_reaction_qs
-
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         reaction_name = request.POST.get("reaction-name")
@@ -1805,6 +1821,10 @@ def package_pathways(request, package_uuid):
         context["meta"]["current_package"] = current_package
         context["object_type"] = "pathway"
         context["breadcrumbs"] = breadcrumbs(current_package, "pathway")
+        context["entity_type"] = "pathway"
+        context["api_endpoint"] = f"/api/v1/package/{current_package.uuid}/pathway/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "pathways"
 
         reviewed_pathway_qs = Pathway.objects.none()
         unreviewed_pathway_qs = Pathway.objects.none()
@@ -1828,10 +1848,7 @@ def package_pathways(request, package_uuid):
                 }
             )
 
-        context["reviewed_objects"] = reviewed_pathway_qs
+        return render(request, "collections/pathways_paginated.html", context)
-        context["unreviewed_objects"] = unreviewed_pathway_qs
-
-        return render(request, "collections/objects_list.html", context)
 
     elif request.method == "POST":
         log_post_params(request)
@@ -1848,7 +1865,6 @@ def package_pathways(request, package_uuid):
                 "Pathway prediction failed!",
                 "Pathway prediction failed due to missing or empty SMILES",
             )
-
         try:
             stand_smiles = FormatConverter.standardize(smiles)
         except ValueError:
@@ -1871,8 +1887,13 @@ def package_pathways(request, package_uuid):
             prediction_setting = SettingManager.get_setting_by_url(current_user, prediction_setting)
         else:
             prediction_setting = current_user.prediction_settings()
-
+        pw = Pathway.create(
-        pw = Pathway.create(current_package, stand_smiles, name=name, description=description)
+            current_package,
+            stand_smiles,
+            name=name,
+            description=description,
+            predicted=pw_mode in {"predict", "incremental"},
+        )
 
         # set mode
         pw.kv.update({"mode": pw_mode})
@@ -1880,7 +1901,7 @@ def package_pathways(request, package_uuid):
 
         if pw_mode == "predict" or pw_mode == "incremental":
             # unlimited pred (will be handled by setting)
-            limit = -1
+            limit = None
 
             # For incremental predict first level and return
             if pw_mode == "incremental":
@@ -1916,6 +1937,7 @@ def package_pathway(request, package_uuid, pathway_uuid):
                 {
                     "status": current_pathway.status(),
                     "modified": current_pathway.modified.strftime("%Y-%m-%d %H:%M:%S"),
+                    "emptyDueToThreshold": current_pathway.empty_due_to_threshold(),
                 }
             )
 
@@ -1936,7 +1958,7 @@ def package_pathway(request, package_uuid, pathway_uuid):
             rule_package = PackageManager.get_package_by_url(
                 current_user, request.GET.get("rule-package")
             )
-            res = dispatch_eager(
+            _, res = dispatch_eager(
                 current_user, identify_missing_rules, [current_pathway.pk], rule_package.pk
             )
 
@@ -2364,6 +2386,10 @@ def package_scenarios(request, package_uuid):
         context["meta"]["current_package"] = current_package
         context["object_type"] = "scenario"
         context["breadcrumbs"] = breadcrumbs(current_package, "scenario")
+        context["entity_type"] = "scenario"
+        context["api_endpoint"] = f"/api/v1/package/{current_package.uuid}/scenario/"
+        context["per_page"] = s.API_PAGINATION_DEFAULT_PAGE_SIZE
+        context["list_title"] = "scenarios"
 
         reviewed_scenario_qs = Scenario.objects.none()
         unreviewed_scenario_qs = Scenario.objects.none()
@@ -2389,13 +2415,10 @@ def package_scenarios(request, package_uuid):
                 }
             )
 
-        context["reviewed_objects"] = reviewed_scenario_qs
-        context["unreviewed_objects"] = unreviewed_scenario_qs
-
         from envipy_additional_information import (
+            SEDIMENT_ADDITIONAL_INFORMATION,
             SLUDGE_ADDITIONAL_INFORMATION,
             SOIL_ADDITIONAL_INFORMATION,
-            SEDIMENT_ADDITIONAL_INFORMATION,
         )
 
         context["scenario_types"] = {
@@ -2426,7 +2449,7 @@ def package_scenarios(request, package_uuid):
         context["soil_additional_information"] = SOIL_ADDITIONAL_INFORMATION
         context["sediment_additional_information"] = SEDIMENT_ADDITIONAL_INFORMATION
 
-        return render(request, "collections/objects_list.html", context)
+        return render(request, "collections/scenarios_paginated.html", context)
     elif request.method == "POST":
         log_post_params(request)
 
@@ -2641,6 +2664,14 @@ def user(request, user_uuid):
 
             return redirect(current_user.url)
 
+        if "change_default" in request.POST:
+            new_default_uuid = request.POST["change_default"]
+            current_user.default_setting = SettingManager.get_setting_by_id(
+                current_user, new_default_uuid
+            )
+            current_user.save()
+            return redirect(current_user.url)
+
         return HttpResponseBadRequest()
 
     else:
@@ -2741,14 +2772,18 @@ def settings(request):
     context = get_base_context(request)
 
     if request.method == "GET":
+        context = get_base_context(request)
+        context["title"] = "enviPath - Settings"
+
         context["object_type"] = "setting"
-        # Even if settings are aready in "meta", for consistency add it on root level
-        context["settings"] = SettingManager.get_all_settings(current_user)
         context["breadcrumbs"] = [
             {"Home": s.SERVER_URL},
             {"Group": s.SERVER_URL + "/setting"},
         ]
-        return
+
+        context["objects"] = SettingManager.get_all_settings(current_user)
+
+        return render(request, "collections/objects_list.html", context)
     elif request.method == "POST":
         if s.DEBUG:
             for k, v in request.POST.items():
@@ -2786,15 +2821,25 @@ def settings(request):
             )
 
             if not PackageManager.readable(current_user, params["model"].package):
-                raise ValueError("")
+                raise PermissionDenied("You're not allowed to access this model!")
+
+            expansion_scheme = request.POST.get(
+                "model-based-prediction-setting-expansion-scheme", "BFS"
+            )
+
+            if expansion_scheme not in ExpansionSchemeChoice.values:
+                raise BadRequest(f"Unknown expansion scheme: {expansion_scheme}")
+
+            params["expansion_scheme"] = ExpansionSchemeChoice(expansion_scheme)
 
         elif tp_gen_method == "rule-based-prediction-setting":
             rule_packages = request.POST.getlist("rule-based-prediction-setting-packages")
             params["rule_packages"] = [
                 PackageManager.get_package_by_url(current_user, p) for p in rule_packages
             ]
+
         else:
-            raise ValueError("")
+            raise BadRequest("Neither Model-Based nor Rule-Based as Method selected!")
 
         created_setting = SettingManager.create_setting(
             current_user,
@@ -2836,6 +2881,143 @@ def jobs(request):
 
         return render(request, "collections/joblog.html", context)
 
+    elif request.method == "POST":
+        job_name = request.POST.get("job-name")
+
+        if job_name == "engineer-pathway":
+            pathway_to_engineer = request.POST.get("pathway-to-engineer")
+            engineer_setting = request.POST.get("engineer-setting")
+
+            if not all([pathway_to_engineer, engineer_setting]):
+                raise BadRequest(
+                    f"Unable to run {job_name} as it requires 'pathway-to-engineer' and 'engineer-setting' parameters."
+                )
+
+            pathway_package = PackageManager.get_package_by_url(current_user, pathway_to_engineer)
+            pathway_to_engineer = Pathway.objects.get(
+                url=pathway_to_engineer, package=pathway_package
+            )
+
+            engineer_setting = SettingManager.get_setting_by_url(current_user, engineer_setting)
+
+            target_package = PackageManager.create_package(
+                current_user,
+                f"Autogenerated Package for Pathway Engineering of {pathway_to_engineer.name}",
+                f"This Package was generated automatically for the engineering Task of {pathway_to_engineer.name}.",
+            )
+
+            from .tasks import dispatch, engineer_pathways
+
+            res = dispatch(
+                current_user,
+                engineer_pathways,
+                [pathway_to_engineer.pk],
+                engineer_setting.pk,
+                target_package.pk,
+            )
+
+            return redirect(f"{s.SERVER_URL}/jobs/{res.task_id}")
+
+        elif job_name == "batch-predict":
+            substrates = request.POST.get("substrates")
+            prediction_setting_url = request.POST.get("prediction-setting")
+            num_tps = request.POST.get("num-tps")
+
+            if substrates is None or substrates.strip() == "":
+                raise BadRequest("No substrates provided.")
+
+            pred_data = []
+            for pair in substrates.split("\n"):
+                parts = pair.split(",")
+
+                try:
+                    smiles = FormatConverter.standardize(parts[0])
+                except ValueError:
+                    raise BadRequest(f"Couldn't standardize SMILES {parts[0]}!")
+
+                # name is optional
+                name = parts[1] if len(parts) > 1 else None
+                pred_data.append([smiles, name])
+
+            max_tps = 50
+            if num_tps is not None and num_tps.strip() != "":
+                try:
+                    num_tps = int(num_tps)
+                    max_tps = max(min(num_tps, 50), 1)
+                except ValueError:
+                    raise BadRequest(f"Parameter for num-tps {num_tps} is not a valid integer.")
+
+            batch_predict_setting = SettingManager.get_setting_by_url(
+                current_user, prediction_setting_url
+            )
+
+            target_package = PackageManager.create_package(
+                current_user,
+                f"Autogenerated Package for Batch Prediction {datetime.now()}",
+                "This Package was generated automatically for the batch prediction task.",
+            )
+
+            from .tasks import dispatch, batch_predict
+
+            res = dispatch(
+                current_user,
+                batch_predict,
+                pred_data,
+                batch_predict_setting.pk,
+                target_package.pk,
+                num_tps=max_tps,
+            )
+
+            return redirect(f"{s.SERVER_URL}/jobs/{res.task_id}")
+
+        else:
+            raise BadRequest(f"Job {job_name} is not supported!")
+    else:
+        return HttpResponseNotAllowed(["GET", "POST"])
+
+
+def job(request, job_uuid):
+    current_user = _anonymous_or_real(request)
+    context = get_base_context(request)
+
+    if request.method == "GET":
+        if current_user.is_superuser:
+            job = JobLog.objects.get(task_id=job_uuid)
+        else:
+            job = JobLog.objects.get(task_id=job_uuid, user=current_user)
+
+        # No op if status is already in a terminal state
+        job.check_for_update()
+
+        if request.GET.get("download", False) == "true":
+            if not job.is_result_downloadable():
+                raise BadRequest("Result is not downloadable!")
+
+            if job.job_name == "batch_predict":
+                filename = f"{job.job_name.replace(' ', '_')}_{job.task_id}.csv"
+            else:
+                raise BadRequest("Result is not downloadable!")
+
+            res_str = job.task_result
+            response = HttpResponse(res_str, content_type="text/csv")
+            response["Content-Disposition"] = f'attachment; filename="{filename}"'
+
+            return response
+
+        context["object_type"] = "joblog"
+        context["breadcrumbs"] = [
+            {"Home": s.SERVER_URL},
+            {"Jobs": s.SERVER_URL + "/jobs"},
+            {job.job_name: f"{s.SERVER_URL}/jobs/{job.task_id}"},
+        ]
+
+        context["job"] = job
+
+        return render(request, "objects/joblog.html", context)
+
+    else:
+        return HttpResponseNotAllowed(["GET"])
+
 
 ###########
 # KETCHER #

migration/views.py

@@ -1,24 +1,21 @@
-import gzip
 import json
 import logging
 import os.path
-from datetime import datetime
 
 from django.conf import settings as s
 from django.http import HttpResponseNotAllowed
 from django.shortcuts import render
-
-from epdb.logic import PackageManager
-from epdb.models import Rule, SimpleAmbitRule, Package, CompoundStructure
-from epdb.views import get_base_context, _anonymous_or_real
-from utilities.chem import FormatConverter
-
-
 from rdkit import Chem
 from rdkit.Chem.MolStandardize import rdMolStandardize
 
+from epdb.models import CompoundStructure, Rule, SimpleAmbitRule
+from epdb.views import get_base_context
+from utilities.chem import FormatConverter
+
 logger = logging.getLogger(__name__)
 
+Package = s.GET_PACKAGE_MODEL()
+
 
 def normalize_smiles(smiles):
     m1 = Chem.MolFromSmiles(smiles)
@@ -59,9 +56,7 @@ def run_both_engines(SMILES, SMIRKS):
         set(
             [
                 normalize_smiles(str(x))
-                for x in FormatConverter.sanitize_smiles(
+                for x in FormatConverter.sanitize_smiles([str(s) for s in all_rdkit_prods])[0]
-                    [str(s) for s in all_rdkit_prods]
-                )[0]
             ]
         )
     )
@@ -85,8 +80,7 @@ def migration(request):
                 url="http://localhost:8000/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1"
             )
             ALL_SMILES = [
-                cs.smiles
+                cs.smiles for cs in CompoundStructure.objects.filter(compound__package=BBD)
-                for cs in CompoundStructure.objects.filter(compound__package=BBD)
             ]
             RULES = SimpleAmbitRule.objects.filter(package=BBD)
 
@@ -142,9 +136,7 @@ def migration(request):
             )
 
         for r in migration_status["results"]:
-            r["detail_url"] = r["detail_url"].replace(
+            r["detail_url"] = r["detail_url"].replace("http://localhost:8000", s.SERVER_URL)
-                "http://localhost:8000", s.SERVER_URL
-            )
 
         context.update(**migration_status)
 
@@ -152,8 +144,6 @@ def migration(request):
 
 
 def migration_detail(request, package_uuid, rule_uuid):
-    current_user = _anonymous_or_real(request)
-
     if request.method == "GET":
         context = get_base_context(request)
 
@@ -235,9 +225,7 @@ def compare(request):
         context["smirks"] = (
             "[#1,#6:6][#7;X3;!$(NC1CC1)!$([N][C]=O)!$([!#8]CNC=O):1]([#1,#6:7])[#6;A;X4:2][H:3]>>[#1,#6:6][#7;X3:1]([#1,#6:7])[H:3].[#6;A:2]=O"
         )
-        context["smiles"] = (
+        context["smiles"] = "C(CC(=O)N[C@@H](CS[Se-])C(=O)NCC(=O)[O-])[C@@H](C(=O)[O-])N"
-            "C(CC(=O)N[C@@H](CS[Se-])C(=O)NCC(=O)[O-])[C@@H](C(=O)[O-])N"
-        )
         return render(request, "compare.html", context)
 
     elif request.method == "POST":

pyproject.toml

@@ -9,7 +9,8 @@ dependencies = [
     "django>=5.2.1",
     "django-extensions>=4.1",
     "django-model-utils>=5.0.0",
-    "django-ninja>=1.4.1",
+    "django-ninja>=1.4.5",
+    "django-ninja-extra>=0.30.6",
     "django-oauth-toolkit>=3.0.1",
     "django-polymorphic>=4.1.0",
     "enviformer",
@@ -45,6 +46,9 @@ dev = [
     "poethepoet>=0.37.0",
     "pre-commit>=4.3.0",
     "ruff>=0.13.3",
+    "pytest-playwright>=0.7.1",
+    "pytest-django>=4.11.1",
+    "pytest-cov>=7.0.0",
 ]
 
 [tool.ruff]
@@ -66,47 +70,31 @@ docstring-code-format = true
 
 [tool.poe.tasks]
 # Main tasks
-setup = { sequence = ["db-up", "migrate", "bootstrap"], help = "Complete setup: start database, run migrations, and bootstrap data" }
+setup = { sequence = [
-dev = { shell = """
+    "db-up",
-# Start pnpm CSS watcher in background
+    "migrate",
-pnpm run dev &
+    "bootstrap",
-PNPM_PID=$!
+], help = "Complete setup: start database, run migrations, and bootstrap data" }
-echo "Started CSS watcher (PID: $PNPM_PID)"
+dev = { cmd = "uv run python scripts/dev_server.py", help = "Start the development server with CSS watcher", deps = [
-
+    "db-up",
-# Cleanup function
+    "js-deps",
-cleanup() {
+] }
-    echo "\nShutting down..."
+build = { sequence = [
-    if kill -0 $PNPM_PID 2>/dev/null; then
+    "build-frontend",
-        kill $PNPM_PID
+    "collectstatic",
-        echo "✓ CSS watcher stopped"
+], help = "Build frontend assets and collect static files" }
-    fi
-    if [ ! -z "${DJ_PID:-}" ] && kill -0 $DJ_PID 2>/dev/null; then
-        kill $DJ_PID
-        echo "✓ Django server stopped"
-    fi
-}
-
-# Set trap for cleanup
-trap cleanup EXIT INT TERM
-
-# Start Django dev server in background
-uv run python manage.py runserver &
-DJ_PID=$!
-
-# Wait for Django to finish
-wait $DJ_PID
-""", help = "Start the development server with CSS watcher", deps = ["db-up", "js-deps"] }
-build = { sequence = ["build-frontend", "collectstatic"], help = "Build frontend assets and collect static files" }
 
 # Database tasks
 db-up = { cmd = "docker compose -f docker-compose.dev.yml up -d", help = "Start PostgreSQL database using Docker Compose" }
 db-down = { cmd = "docker compose -f docker-compose.dev.yml down", help = "Stop PostgreSQL database" }
 
 # Frontend tasks
-js-deps = { cmd = "pnpm install", help = "Install frontend dependencies" }
+js-deps = { cmd = "uv run python scripts/pnpm_wrapper.py install", help = "Install frontend dependencies" }
 
 # Full cleanup tasks
-clean = { sequence = ["clean-db"], help = "Remove model files and database volumes (WARNING: destroys all data!)" }
+clean = { sequence = [
+    "clean-db",
+], help = "Remove model files and database volumes (WARNING: destroys all data!)" }
 clean-db = { cmd = "docker compose -f docker-compose.dev.yml down -v", help = "Removes the database container and volume." }
 
 # Django tasks
@@ -124,6 +112,33 @@ echo "  Password: SuperSafe"
 """, help = "Bootstrap initial data (anonymous user, packages, models)" }
 shell = { cmd = "uv run python manage.py shell", help = "Open Django shell" }
 
-# Build tasks
+
-build-frontend = { cmd = "pnpm run build", help = "Build frontend assets using pnpm", deps = ["js-deps"] }
+build-frontend = { cmd = "uv run python scripts/pnpm_wrapper.py run build", help = "Build frontend assets using pnpm", deps = [
-collectstatic = { cmd = "uv run python manage.py collectstatic --noinput", help = "Collect static files for production", deps = ["build-frontend"] }
+    "js-deps",
+] } # Build tasks
+
+
+collectstatic = { cmd = "uv run python manage.py collectstatic --noinput", help = "Collect static files for production", deps = [
+    "build-frontend",
+] }
+
+frontend-test-setup = { cmd = "playwright install", help = "Install the browsers required for frontend testing" }
+
+[tool.pytest.ini_options]
+addopts = "--verbose --capture=no --durations=10"
+testpaths = ["tests", "*/tests"]
+pythonpath = ["."]
+norecursedirs = [
+    "env",
+    "venv",
+    "envipy-plugins",
+    "envipy-additional-information",
+    "envipy-ambit",
+    "enviformer",
+]
+markers = [
+    "api: API tests",
+    "frontend: Frontend tests",
+    "end2end: End-to-end tests",
+    "slow: Slow tests",
+]

scripts/dev_server.py

@@ -0,0 +1,201 @@
+#!/usr/bin/env python3
+"""
+Cross-platform development server script.
+Starts pnpm CSS watcher and Django dev server, handling cleanup on exit.
+Works on both Windows and Unix systems.
+"""
+
+import atexit
+import shutil
+import signal
+import subprocess
+import sys
+import time
+
+
+def find_pnpm():
+    """
+    Find pnpm executable on the system.
+    Returns the path to pnpm or None if not found.
+    """
+    # Try to find pnpm using shutil.which
+    # On Windows, this will find pnpm.cmd if it's in PATH
+    pnpm_path = shutil.which("pnpm")
+
+    if pnpm_path:
+        return pnpm_path
+
+    # On Windows, also try pnpm.cmd explicitly
+    if sys.platform == "win32":
+        pnpm_cmd = shutil.which("pnpm.cmd")
+        if pnpm_cmd:
+            return pnpm_cmd
+
+    return None
+
+
+class DevServerManager:
+    """Manages background processes for development server."""
+
+    def __init__(self):
+        self.processes = []
+        self._cleanup_registered = False
+
+    def start_process(self, command, description, shell=False):
+        """Start a background process and return the process object."""
+        print(f"Starting {description}...")
+        try:
+            if shell:
+                # Use shell=True for commands that need shell interpretation
+                process = subprocess.Popen(
+                    command,
+                    shell=True,
+                    stdout=subprocess.PIPE,
+                    stderr=subprocess.STDOUT,
+                    text=True,
+                    bufsize=1,
+                )
+            else:
+                # Split command into list for subprocess
+                process = subprocess.Popen(
+                    command,
+                    stdout=subprocess.PIPE,
+                    stderr=subprocess.STDOUT,
+                    text=True,
+                    bufsize=1,
+                )
+            self.processes.append((process, description))
+            print(f"✓ Started {description} (PID: {process.pid})")
+            return process
+        except Exception as e:
+            print(f"✗ Failed to start {description}: {e}", file=sys.stderr)
+            self.cleanup()
+            sys.exit(1)
+
+    def cleanup(self):
+        """Terminate all running processes."""
+        if not self.processes:
+            return
+
+        print("\nShutting down...")
+        for process, description in self.processes:
+            if process.poll() is None:  # Process is still running
+                try:
+                    # Try graceful termination first
+                    if sys.platform == "win32":
+                        process.terminate()
+                    else:
+                        process.send_signal(signal.SIGTERM)
+
+                    # Wait up to 5 seconds for graceful shutdown
+                    try:
+                        process.wait(timeout=5)
+                    except subprocess.TimeoutExpired:
+                        # Force kill if graceful shutdown failed
+                        if sys.platform == "win32":
+                            process.kill()
+                        else:
+                            process.send_signal(signal.SIGKILL)
+                        process.wait()
+
+                    print(f"✓ {description} stopped")
+                except Exception as e:
+                    print(f"✗ Error stopping {description}: {e}", file=sys.stderr)
+
+        self.processes.clear()
+
+    def register_cleanup(self):
+        """Register cleanup handlers for various exit scenarios."""
+        if self._cleanup_registered:
+            return
+
+        self._cleanup_registered = True
+
+        # Register atexit handler (works on all platforms)
+        atexit.register(self.cleanup)
+
+        # Register signal handlers (Unix only)
+        if sys.platform != "win32":
+            signal.signal(signal.SIGINT, self._signal_handler)
+            signal.signal(signal.SIGTERM, self._signal_handler)
+
+    def _signal_handler(self, signum, frame):
+        """Handle Unix signals."""
+        self.cleanup()
+        sys.exit(0)
+
+    def wait_for_process(self, process, description):
+        """Wait for a process to finish and handle its output."""
+        try:
+            # Stream output from the process
+            for line in iter(process.stdout.readline, ""):
+                if line:
+                    print(f"[{description}] {line.rstrip()}")
+
+            process.wait()
+            return process.returncode
+        except KeyboardInterrupt:
+            # Handle Ctrl+C
+            self.cleanup()
+            sys.exit(0)
+        except Exception as e:
+            print(f"Error waiting for {description}: {e}", file=sys.stderr)
+            self.cleanup()
+            sys.exit(1)
+
+
+def main():
+    """Main entry point."""
+    manager = DevServerManager()
+    manager.register_cleanup()
+
+    # Find pnpm executable
+    pnpm_path = find_pnpm()
+    if not pnpm_path:
+        print("Error: pnpm not found in PATH.", file=sys.stderr)
+        print("\nPlease install pnpm:", file=sys.stderr)
+        print("  Windows: https://pnpm.io/installation#on-windows", file=sys.stderr)
+        print("  Unix: https://pnpm.io/installation#on-posix-systems", file=sys.stderr)
+        sys.exit(1)
+
+    # Determine shell usage based on platform
+    use_shell = sys.platform == "win32"
+
+    # Start pnpm CSS watcher
+    # Use the found pnpm path to ensure it works on Windows
+    pnpm_command = f'"{pnpm_path}" run dev' if use_shell else [pnpm_path, "run", "dev"]
+    manager.start_process(
+        pnpm_command,
+        "CSS watcher",
+        shell=use_shell,
+    )
+
+    # Give pnpm a moment to start
+    time.sleep(1)
+
+    # Start Django dev server
+    django_process = manager.start_process(
+        ["uv", "run", "python", "manage.py", "runserver"],
+        "Django server",
+        shell=False,
+    )
+
+    print("\nDevelopment servers are running. Press Ctrl+C to stop.\n")
+
+    try:
+        # Wait for Django server (main process)
+        # If Django exits, we should clean up everything
+        return_code = manager.wait_for_process(django_process, "Django")
+
+        # If Django exited unexpectedly, clean up and exit
+        if return_code != 0:
+            manager.cleanup()
+            sys.exit(return_code)
+    except KeyboardInterrupt:
+        # Ctrl+C was pressed
+        manager.cleanup()
+        sys.exit(0)
+
+
+if __name__ == "__main__":
+    main()

scripts/pnpm_wrapper.py

@@ -0,0 +1,59 @@
+#!/usr/bin/env python3
+"""
+Cross-platform pnpm command wrapper.
+Finds pnpm correctly on Windows (handles pnpm.cmd) and Unix systems.
+"""
+
+import shutil
+import subprocess
+import sys
+
+
+def find_pnpm():
+    """
+    Find pnpm executable on the system.
+    Returns the path to pnpm or None if not found.
+    """
+    # Try to find pnpm using shutil.which
+    # On Windows, this will find pnpm.cmd if it's in PATH
+    pnpm_path = shutil.which("pnpm")
+
+    if pnpm_path:
+        return pnpm_path
+
+    # On Windows, also try pnpm.cmd explicitly
+    if sys.platform == "win32":
+        pnpm_cmd = shutil.which("pnpm.cmd")
+        if pnpm_cmd:
+            return pnpm_cmd
+
+    return None
+
+
+def main():
+    """Main entry point - execute pnpm with provided arguments."""
+    pnpm_path = find_pnpm()
+
+    if not pnpm_path:
+        print("Error: pnpm not found in PATH.", file=sys.stderr)
+        print("\nPlease install pnpm:", file=sys.stderr)
+        print("  Windows: https://pnpm.io/installation#on-windows", file=sys.stderr)
+        print("  Unix: https://pnpm.io/installation#on-posix-systems", file=sys.stderr)
+        sys.exit(1)
+
+    # Get all arguments passed to this script
+    args = sys.argv[1:]
+
+    # Execute pnpm with the provided arguments
+    try:
+        sys.exit(subprocess.call([pnpm_path] + args))
+    except KeyboardInterrupt:
+        # Handle Ctrl+C gracefully
+        sys.exit(130)
+    except Exception as e:
+        print(f"Error executing pnpm: {e}", file=sys.stderr)
+        sys.exit(1)
+
+
+if __name__ == "__main__":
+    main()

static/js/alpine/index.js

@@ -0,0 +1,265 @@
+/**
+ * Alpine.js Components for enviPath
+ *
+ * This module provides reusable Alpine.js data components for modals,
+ * form validation, and form submission.
+ */
+
+document.addEventListener('alpine:init', () => {
+  /**
+   * Modal Form Component
+   *
+   * Provides form validation using HTML5 Constraint Validation API,
+   * loading states for submission, and error message management.
+   *
+   * Basic Usage:
+   * <dialog x-data="modalForm()" @close="reset()">
+   *   <form id="my-form">
+   *     <input name="field" required>
+   *   </form>
+   *   <button @click="submit('my-form')" :disabled="isSubmitting">Submit</button>
+   * </dialog>
+   *
+   * With Custom State:
+   * <dialog x-data="modalForm({ state: { selectedItem: '', imageUrl: '' } })" @close="reset()">
+   *   <select x-model="selectedItem" @change="updateImagePreview(selectedItem + '?image=svg')">
+   *   <img :src="imageUrl" x-show="imageUrl">
+   * </dialog>
+   *
+   * With AJAX:
+   * <button @click="submitAsync('my-form', { onSuccess: (data) => console.log(data) })">
+   */
+  Alpine.data('modalForm', (options = {}) => ({
+    isSubmitting: false,
+    errors: {},
+    // Spread custom initial state from options
+    ...(options.state || {}),
+
+    /**
+     * Validate a single field using HTML5 Constraint Validation API
+     * @param {HTMLElement} field - The input/select/textarea element
+     */
+    validateField(field) {
+      const name = field.name || field.id;
+      if (!name) return;
+
+      if (!field.validity.valid) {
+        this.errors[name] = field.validationMessage;
+      } else {
+        delete this.errors[name];
+      }
+    },
+
+    /**
+     * Clear error for a field (call on input)
+     * @param {HTMLElement} field - The input element
+     */
+    clearError(field) {
+      const name = field.name || field.id;
+      if (name && this.errors[name]) {
+        delete this.errors[name];
+      }
+    },
+
+    /**
+     * Get error message for a field
+     * @param {string} name - Field name
+     * @returns {string|undefined} Error message or undefined
+     */
+    getError(name) {
+      return this.errors[name];
+    },
+
+    /**
+     * Check if form has any errors
+     * @returns {boolean} True if there are errors
+     */
+    hasErrors() {
+      return Object.keys(this.errors).length > 0;
+    },
+
+    /**
+     * Validate all fields in a form
+     * @param {string} formId - The form element ID
+     * @returns {boolean} True if form is valid
+     */
+    validateAll(formId) {
+      const form = document.getElementById(formId);
+      if (!form) return false;
+
+      this.errors = {};
+      const fields = form.querySelectorAll('input, select, textarea');
+
+      fields.forEach(field => {
+        if (field.name && !field.validity.valid) {
+          this.errors[field.name] = field.validationMessage;
+        }
+      });
+
+      return !this.hasErrors();
+    },
+
+    /**
+     * Validate that two password fields match
+     * @param {string} password1Id - ID of first password field
+     * @param {string} password2Id - ID of second password field
+     * @returns {boolean} True if passwords match
+     */
+    validatePasswordMatch(password1Id, password2Id) {
+      const pw1 = document.getElementById(password1Id);
+      const pw2 = document.getElementById(password2Id);
+
+      if (!pw1 || !pw2) return false;
+
+      if (pw1.value !== pw2.value) {
+        this.errors[pw2.name || password2Id] = 'Passwords do not match';
+        pw2.setCustomValidity('Passwords do not match');
+        return false;
+      }
+
+      delete this.errors[pw2.name || password2Id];
+      pw2.setCustomValidity('');
+      return true;
+    },
+
+    /**
+     * Submit a form with loading state
+     * @param {string} formId - The form element ID
+     */
+    submit(formId) {
+      const form = document.getElementById(formId);
+      if (!form) return;
+
+      // Validate before submit
+      if (!form.checkValidity()) {
+        form.reportValidity();
+        return;
+      }
+
+      // Set action to current URL if empty
+      if (!form.action || form.action === window.location.href + '#') {
+        form.action = window.location.href;
+      }
+
+      // Set loading state and submit
+      this.isSubmitting = true;
+      form.submit();
+    },
+
+    /**
+     * Submit form via AJAX (fetch)
+     * @param {string} formId - The form element ID
+     * @param {Object} options - Options { onSuccess, onError, closeOnSuccess }
+     */
+    async submitAsync(formId, options = {}) {
+      const form = document.getElementById(formId);
+      if (!form) return;
+
+      // Validate before submit
+      if (!form.checkValidity()) {
+        form.reportValidity();
+        return;
+      }
+
+      this.isSubmitting = true;
+
+      try {
+        const formData = new FormData(form);
+        const response = await fetch(form.action || window.location.href, {
+          method: form.method || 'POST',
+          body: formData,
+          headers: {
+            'X-Requested-With': 'XMLHttpRequest',
+          },
+        });
+
+        const data = await response.json().catch(() => ({}));
+
+        if (response.ok) {
+          if (options.onSuccess) {
+            options.onSuccess(data);
+          }
+
+          if (data.redirect || data.success) {
+            window.location.href = data.redirect || data.success;
+          } else if (options.closeOnSuccess) {
+            this.$el.closest('dialog')?.close();
+          }
+        } else {
+          const errorMsg = data.error || data.message || `Error: ${response.status}`;
+          this.errors['_form'] = errorMsg;
+
+          if (options.onError) {
+            options.onError(errorMsg, data);
+          }
+        }
+      } catch (error) {
+        this.errors['_form'] = error.message;
+
+        if (options.onError) {
+          options.onError(error.message);
+        }
+      } finally {
+        this.isSubmitting = false;
+      }
+    },
+
+    /**
+     * Set form action URL dynamically
+     * @param {string} formId - The form element ID
+     * @param {string} url - The URL to set as action
+     */
+    setFormAction(formId, url) {
+      const form = document.getElementById(formId);
+      if (form) {
+        form.action = url;
+      }
+    },
+
+    /**
+     * Update image preview
+     * @param {string} url - Image URL (with query params)
+     * @param {string} targetId - Target element ID for the image
+     */
+    updateImagePreview(url) {
+      // Store URL for reactive binding with :src
+      this.imageUrl = url;
+    },
+
+    /**
+     * Reset form state (call on modal close)
+     * Resets to initial state from options
+     */
+    reset() {
+      this.isSubmitting = false;
+      this.errors = {};
+      this.imageUrl = '';
+
+      // Reset custom state to initial values
+      if (options.state) {
+        Object.keys(options.state).forEach(key => {
+          this[key] = options.state[key];
+        });
+      }
+
+      // Call custom reset handler if provided
+      if (options.onReset) {
+        options.onReset.call(this);
+      }
+    }
+  }));
+
+  /**
+   * Simple Modal Component (no form)
+   *
+   * For modals that don't need form validation.
+   *
+   * Usage:
+   * <dialog x-data="modal()">
+   *   <button @click="$el.closest('dialog').close()">Close</button>
+   * </dialog>
+   */
+  Alpine.data('modal', () => ({
+    // Placeholder for simple modals that may need state later
+  }));
+});

static/js/alpine/pagination.js

@@ -0,0 +1,148 @@
+/**
+ * Alpine.js Pagination Component
+ *
+ * Provides client-side pagination for large lists.
+ */
+
+document.addEventListener('alpine:init', () => {
+  Alpine.data('remotePaginatedList', (options = {}) => ({
+    items: [],
+    currentPage: 1,
+    totalPages: 0,
+    totalItems: 0,
+    perPage: options.perPage || 50,
+    endpoint: options.endpoint || '',
+    isReviewed: options.isReviewed || false,
+    instanceId: options.instanceId || Math.random().toString(36).substring(2, 9),
+    isLoading: false,
+    error: null,
+
+    init() {
+      if (this.endpoint) {
+        this.fetchPage(1);
+      }
+    },
+
+    get paginatedItems() {
+      return this.items;
+    },
+
+    get showingStart() {
+      if (this.totalItems === 0) return 0;
+      return (this.currentPage - 1) * this.perPage + 1;
+    },
+
+    get showingEnd() {
+      if (this.totalItems === 0) return 0;
+      return Math.min((this.currentPage - 1) * this.perPage + this.items.length, this.totalItems);
+    },
+
+    async fetchPage(page) {
+      if (!this.endpoint) {
+        return;
+      }
+
+      this.isLoading = true;
+      this.error = null;
+      this.$dispatch('loading-start');
+
+      try {
+        const url = new URL(this.endpoint, window.location.origin);
+        // Preserve existing query parameters and add pagination params
+        url.searchParams.set('page', page.toString());
+        url.searchParams.set('page_size', this.perPage.toString());
+
+        const response = await fetch(url.toString(), {
+          headers: { Accept: 'application/json' },
+          credentials: 'same-origin'
+        });
+
+        if (!response.ok) {
+          throw new Error(`Failed to load ${this.endpoint} (status ${response.status})`);
+        }
+
+        const data = await response.json();
+        this.items = data.items || [];
+        this.totalItems = data.total_items || 0;
+        this.totalPages = data.total_pages || 0;
+        this.currentPage = data.page || page;
+        this.perPage = data.page_size || this.perPage;
+
+        // Dispatch event for parent components (e.g., tab count updates)
+        this.$dispatch('items-loaded', { totalItems: this.totalItems });
+      } catch (err) {
+        console.error(err);
+        this.error = `Unable to load ${this.endpoint}. Please try again.`;
+      } finally {
+        this.isLoading = false;
+        this.$dispatch('loading-end');
+      }
+    },
+
+    nextPage() {
+      if (this.currentPage < this.totalPages) {
+        this.fetchPage(this.currentPage + 1);
+      }
+    },
+
+    prevPage() {
+      if (this.currentPage > 1) {
+        this.fetchPage(this.currentPage - 1);
+      }
+    },
+
+    goToPage(page) {
+      if (page >= 1 && page <= this.totalPages) {
+        this.fetchPage(page);
+      }
+    },
+
+    get pageNumbers() {
+      const pages = [];
+      const total = this.totalPages;
+      const current = this.currentPage;
+
+      if (total === 0) {
+        return pages;
+      }
+
+      if (total <= 7) {
+        for (let i = 1; i <= total; i++) {
+          pages.push({ page: i, isEllipsis: false, key: `${this.instanceId}-page-${i}` });
+        }
+      } else {
+        pages.push({ page: 1, isEllipsis: false, key: `${this.instanceId}-page-1` });
+
+        let rangeStart;
+        let rangeEnd;
+
+        if (current <= 4) {
+          rangeStart = 2;
+          rangeEnd = 5;
+        } else if (current >= total - 3) {
+          rangeStart = total - 4;
+          rangeEnd = total - 1;
+        } else {
+          rangeStart = current - 1;
+          rangeEnd = current + 1;
+        }
+
+        if (rangeStart > 2) {
+          pages.push({ page: '...', isEllipsis: true, key: `${this.instanceId}-ellipsis-start` });
+        }
+
+        for (let i = rangeStart; i <= rangeEnd; i++) {
+          pages.push({ page: i, isEllipsis: false, key: `${this.instanceId}-page-${i}` });
+        }
+
+        if (rangeEnd < total - 1) {
+          pages.push({ page: '...', isEllipsis: true, key: `${this.instanceId}-ellipsis-end` });
+        }
+
+        pages.push({ page: total, isEllipsis: false, key: `${this.instanceId}-page-${total}` });
+      }
+
+      return pages;
+    }
+  }));
+});

static/js/alpine/pathway.js

@@ -0,0 +1,106 @@
+/**
+ * Pathway Viewer Alpine.js Component
+ *
+ * Provides reactive status management and polling for pathway predictions.
+ * Handles status updates, change detection, and update notices.
+ */
+
+document.addEventListener('alpine:init', () => {
+  /**
+   * Pathway Viewer Component
+   *
+   * Usage:
+   * <div x-data="pathwayViewer({
+   *   status: 'running',
+   *   modified: '2024-01-01T00:00:00Z',
+   *   statusUrl: '/pathway/123?status=true'
+   * })" x-init="init()">
+   *   ...
+   * </div>
+   */
+  Alpine.data('pathwayViewer', (config) => ({
+    status: config.status,
+    modified: config.modified,
+    statusUrl: config.statusUrl,
+    emptyDueToThreshold: config.emptyDueToThreshold === "True",
+    showUpdateNotice: false,
+    showEmptyDueToThresholdNotice: false,
+    emptyDueToThresholdMessage: 'The Pathway is empty due to the selected threshold. Please try a different threshold.',
+    updateMessage: '',
+    pollInterval: null,
+
+    get statusTooltip() {
+      const tooltips = {
+        'completed': 'Pathway prediction completed.',
+        'failed': 'Pathway prediction failed.',
+        'running': 'Pathway prediction running.'
+      };
+      return tooltips[this.status] || '';
+    },
+
+    init() {
+      if (this.status === 'running') {
+        this.startPolling();
+      }
+
+      if (this.emptyDueToThreshold) {
+          this.showEmptyDueToThresholdNotice = true;
+      }
+
+    },
+
+    startPolling() {
+      if (this.pollInterval) {
+        return;
+      }
+      this.pollInterval = setInterval(() => this.checkStatus(), 5000);
+    },
+
+    async checkStatus() {
+      try {
+        const response = await fetch(this.statusUrl);
+        const data = await response.json();
+
+        if (data.emptyDueToThreshold) {
+          this.emptyDueToThreshold = true;
+          this.showEmptyDueToThresholdNotice = true;
+        }
+
+        if (data.modified > this.modified) {
+          if (!this.emptyDueToThreshold) {
+            this.showUpdateNotice = true;
+            this.updateMessage = this.getUpdateMessage(data.status);
+          }
+        }
+
+        if (data.status !== 'running') {
+          this.status = data.status;
+          if (this.pollInterval) {
+            clearInterval(this.pollInterval);
+            this.pollInterval = null;
+          }
+        }
+      } catch (err) {
+        console.error('Polling error:', err);
+      }
+    },
+
+    getUpdateMessage(status) {
+      let msg = 'Prediction ';
+
+      if (status === 'running') {
+        msg += 'is still running. But the Pathway was updated.';
+      } else if (status === 'completed') {
+        msg += 'is completed. Reload the page to see the updated Pathway.';
+      } else if (status === 'failed') {
+        msg += 'failed. Reload the page to see the current shape.';
+      }
+
+      return msg;
+    },
+
+    reloadPage() {
+      location.reload();
+    }
+  }));
+});

static/js/alpine/search.js

@@ -0,0 +1,145 @@
+/**
+ * Search Modal Alpine.js Component
+ *
+ * Provides package selection, search mode switching, and results display
+ * for the search modal.
+ */
+
+document.addEventListener('alpine:init', () => {
+  /**
+   * Search Modal Component
+   *
+   * Usage:
+   * <dialog x-data="searchModal()" @close="reset()">
+   *   ...
+   * </dialog>
+   */
+  Alpine.data('searchModal', () => ({
+    // Package selector state
+    selectedPackages: [],
+
+    // Search state
+    searchMode: 'text',
+    searchModeLabel: 'Text',
+    query: '',
+
+    // Results state
+    results: null,
+    isSearching: false,
+    error: null,
+
+    // Initialize on modal open
+    init() {
+      // Load reviewed packages by default
+      this.loadInitialSelection();
+
+      // Watch for modal open to focus searchbar
+      this.$watch('$el.open', (open) => {
+        if (open) {
+          setTimeout(() => {
+            this.$refs.searchbar.focus();
+          }, 320);
+        }
+      });
+    },
+
+    loadInitialSelection() {
+      // Select all reviewed packages by default
+      const menuItems = this.$refs.packageDropdown.querySelectorAll('li');
+
+      for (const item of menuItems) {
+        // Stop at 'Unreviewed Packages' section
+        if (item.classList.contains('menu-title') &&
+            item.textContent.trim() === 'Unreviewed Packages') {
+          break;
+        }
+
+        const packageOption = item.querySelector('.package-option');
+        if (packageOption) {
+          this.selectedPackages.push({
+            url: packageOption.dataset.packageUrl,
+            name: packageOption.dataset.packageName
+          });
+        }
+      }
+    },
+
+    togglePackage(url, name) {
+      const index = this.selectedPackages.findIndex(pkg => pkg.url === url);
+
+      if (index !== -1) {
+        this.selectedPackages.splice(index, 1);
+      } else {
+        this.selectedPackages.push({ url, name });
+      }
+    },
+
+    removePackage(url) {
+      const index = this.selectedPackages.findIndex(pkg => pkg.url === url);
+      if (index !== -1) {
+        this.selectedPackages.splice(index, 1);
+      }
+    },
+
+    isPackageSelected(url) {
+      return this.selectedPackages.some(pkg => pkg.url === url);
+    },
+
+    setSearchMode(mode, label) {
+      this.searchMode = mode;
+      this.searchModeLabel = label;
+      this.$refs.modeDropdown.hidePopover();
+    },
+
+    async performSearch(serverBase) {
+      if (!this.query.trim()) {
+        return;
+      }
+
+      if (this.selectedPackages.length < 1) {
+        this.results = { error: 'no_packages' };
+        return;
+      }
+
+      const params = new URLSearchParams();
+      this.selectedPackages.forEach(pkg => params.append('packages', pkg.url));
+      params.append('search', this.query.trim());
+      params.append('mode', this.searchModeLabel.toLowerCase());
+
+      this.isSearching = true;
+      this.results = null;
+      this.error = null;
+
+      try {
+        const response = await fetch(`${serverBase}/search?${params.toString()}`, {
+          method: 'GET',
+          headers: { 'Accept': 'application/json' }
+        });
+
+        if (!response.ok) {
+          throw new Error('Search request failed');
+        }
+
+        this.results = await response.json();
+      } catch (err) {
+        console.error('Search error:', err);
+        this.error = 'Search failed. Please try again.';
+      } finally {
+        this.isSearching = false;
+      }
+    },
+
+    hasResults() {
+      if (!this.results || this.results.error) return false;
+      const categories = ['Compounds', 'Compound Structures', 'Rules', 'Reactions', 'Pathways'];
+      return categories.some(cat => this.results[cat] && this.results[cat].length > 0);
+    },
+
+    reset() {
+      this.query = '';
+      this.results = null;
+      this.error = null;
+      this.isSearching = false;
+    }
+  }));
+});

static/js/discourse-api.js

@@ -63,17 +63,20 @@ class DiscourseAPI {
      * @returns {string} Cleaned excerpt
      */
     extractExcerpt(excerpt) {
-        if (!excerpt) return 'Click to read more';
+        if (!excerpt) return 'No preview available yet';
 
         // Remove HTML tags and clean up; collapse whitespace; do not add manual ellipsis
-        return excerpt
+        const cleaned = excerpt
             .replace(/<[^>]*>/g, '') // Remove HTML tags
             .replace(/&nbsp;/g, ' ') // Replace &nbsp; with spaces
             .replace(/&amp;/g, '&') // Replace &amp; with &
             .replace(/&lt;/g, '<') // Replace &lt; with <
             .replace(/&gt;/g, '>') // Replace &gt; with >
             .replace(/\s+/g, ' ') // Collapse all whitespace/newlines
-            .trim()
+            .trim();
+
+        // Check if excerpt is empty after cleaning
+        return cleaned || 'No preview available yet';
     }
 
     /**

static/js/pw.js

@@ -1,14 +1,21 @@
 console.log("loaded pw.js")
 
 function predictFromNode(url) {
-    $.post("", {node: url})
+    fetch("", {
-        .done(function (data) {
+        method: "POST",
+        headers: {
+            "Content-Type": "application/x-www-form-urlencoded",
+            "X-CSRFToken": document.querySelector('[name=csrfmiddlewaretoken]')?.value || ''
+        },
+        body: new URLSearchParams({node: url})
+    })
+    .then(response => response.json())
+    .then(data => {
         console.log("Success:", data);
         window.location.href = data.success;
     })
-        .fail(function (xhr, status, error) {
+    .catch(error => {
-            console.error("Error:", xhr.status, xhr.responseText);
+        console.error("Error:", error);
-            // show user-friendly message or log error
     });
 }
 
@@ -103,6 +110,9 @@ function draw(pathway, elem) {
     }
 
     function dragstarted(event, d) {
+        // Prevent zoom pan when dragging nodes
+        event.sourceEvent.stopPropagation();
+
         if (!event.active) simulation.alphaTarget(0.3).restart();
         d.fx = d.x;
         d.fy = d.y;
@@ -117,6 +127,9 @@ function draw(pathway, elem) {
     }
 
     function dragged(event, d) {
+        // Prevent zoom pan when dragging nodes
+        event.sourceEvent.stopPropagation();
+
         d.fx = event.x;
         d.fy = event.y;
 
@@ -127,6 +140,9 @@ function draw(pathway, elem) {
     }
 
     function dragended(event, d) {
+        // Prevent zoom pan when dragging nodes
+        event.sourceEvent.stopPropagation();
+
         if (!event.active) simulation.alphaTarget(0);
 
         // Mark that dragging has ended
@@ -192,58 +208,163 @@ function draw(pathway, elem) {
         d3.select(t).select("circle").classed("highlighted", !d3.select(t).select("circle").classed("highlighted"));
     }
 
-    // Wait one second before showing popup
+    // Wait before showing popup (ms)
     var popupWaitBeforeShow = 1000;
-    // Keep Popup at least for one second
-    var popushowAtLeast = 1000;
 
-    function pop_show_e(element) {
+    // Custom popover element
-        var e = element;
+    let popoverTimeout = null;
-        setTimeout(function () {
-            if ($(e).is(':hover')) { // if element is still hovered
-                $(e).popover("show");
 
-                // workaround to set fixed positions
+    function createPopover() {
-                pop = $(e).attr("aria-describedby")
+        const popover = document.createElement('div');
-                h = $('#' + pop).height();
+        popover.id = 'custom-popover';
-                $('#' + pop).attr("style", `position: fixed; top: ${clientY - (h / 2.0)}px; left: ${clientX + 10}px; margin: 0px; max-width: 1000px; display: block;`)
+        popover.className = 'fixed z-50';
-                setTimeout(function () {
+        popover.style.cssText = `
-                    var close = setInterval(function () {
+            background: #ffffff;
-                        if (!$(".popover:hover").length // mouse outside popover
+            border: 1px solid #d1d5db;
-                            && !$(e).is(':hover')) { // mouse outside element
+            box-shadow: 0 10px 15px -3px rgb(0 0 0 / 0.1), 0 4px 6px -4px rgb(0 0 0 / 0.1);
-                            $(e).popover('hide');
+            max-width: 320px;
-                            clearInterval(close);
+            padding: 0.75rem;
+            border-radius: 0.5rem;
+            opacity: 0;
+            visibility: hidden;
+            transition: opacity 150ms ease-in-out, visibility 150ms ease-in-out;
+            pointer-events: auto;
+        `;
+        popover.setAttribute('role', 'tooltip');
+        popover.innerHTML = `
+            <div class="font-semibold mb-2 popover-title" style="font-weight: 600; margin-bottom: 0.5rem;"></div>
+            <div class="text-sm popover-content" style="font-size: 0.875rem;"></div>
+        `;
+
+        // Add styles for content images
+        const style = document.createElement('style');
+        style.textContent = `
+            #custom-popover img {
+                max-width: 100%;
+                height: auto;
+                display: block;
+                margin: 0.5rem 0;
             }
-                    }, 100);
+            #custom-popover a {
-                }, popushowAtLeast);
+                color: #2563eb;
+                text-decoration: none;
             }
-        }, popupWaitBeforeShow);
+            #custom-popover a:hover {
+                text-decoration: underline;
+            }
+        `;
+        if (!document.getElementById('popover-styles')) {
+            style.id = 'popover-styles';
+            document.head.appendChild(style);
+        }
+
+        // Keep popover open when hovering over it
+        popover.addEventListener('mouseenter', () => {
+            if (popoverTimeout) {
+                clearTimeout(popoverTimeout);
+                popoverTimeout = null;
+            }
+        });
+
+        popover.addEventListener('mouseleave', () => {
+            hidePopover();
+        });
+
+        document.body.appendChild(popover);
+        return popover;
+    }
+
+    function getPopover() {
+        return document.getElementById('custom-popover') || createPopover();
+    }
+
+    function showPopover(element, title, content) {
+        const popover = getPopover();
+        popover.querySelector('.popover-title').textContent = title;
+        popover.querySelector('.popover-content').innerHTML = content;
+
+        // Make visible to measure
+        popover.style.visibility = 'hidden';
+        popover.style.opacity = '0';
+        popover.style.display = 'block';
+
+        // Smart positioning - avoid viewport overflow
+        const padding = 10;
+        const popoverRect = popover.getBoundingClientRect();
+        const viewportWidth = window.innerWidth;
+        const viewportHeight = window.innerHeight;
+
+        let left = clientX + 15;
+        let top = clientY - (popoverRect.height / 2);
+
+        // Prevent right overflow
+        if (left + popoverRect.width > viewportWidth - padding) {
+            left = clientX - popoverRect.width - 15;
+        }
+
+        // Prevent bottom overflow
+        if (top + popoverRect.height > viewportHeight - padding) {
+            top = viewportHeight - popoverRect.height - padding;
+        }
+
+        // Prevent top overflow
+        if (top < padding) {
+            top = padding;
+        }
+
+        popover.style.top = `${top}px`;
+        popover.style.left = `${left}px`;
+        popover.style.visibility = 'visible';
+        popover.style.opacity = '1';
+
+        currentElement = element;
+    }
+
+    function hidePopover() {
+        const popover = getPopover();
+        popover.style.opacity = '0';
+        popover.style.visibility = 'hidden';
+        currentElement = null;
     }
 
     function pop_add(objects, title, contentFunction) {
-        objects.attr("id", "pop")
+        objects.each(function (d) {
-            .attr("data-container", "body")
+            const element = this;
-            .attr("data-toggle", "popover")
-            .attr("data-placement", "right")
-            .attr("title", title);
 
-        objects.each(function (d, i) {
+            element.addEventListener('mouseenter', () => {
-            options = {trigger: "manual", html: true, animation: false};
+                if (popoverTimeout) clearTimeout(popoverTimeout);
-            this_ = this;
+
-            var p = $(this).popover(options).on("mouseenter", function () {
+                popoverTimeout = setTimeout(() => {
-                pop_show_e(this);
+                    if (element.matches(':hover')) {
+                        const content = contentFunction(d);
+                        showPopover(element, title, content);
+                    }
+                }, popupWaitBeforeShow);
             });
-            p.on("show.bs.popover", function (e) {
+
-                // this is to dynamically ajdust the content and bounds of the popup
+            element.addEventListener('mouseleave', () => {
-                p.attr('data-content', contentFunction(d));
+                if (popoverTimeout) {
-                p.data("bs.popover").setContent();
+                    clearTimeout(popoverTimeout);
-                p.data("bs.popover").tip().css({"max-width": "1000px"});
+                    popoverTimeout = null;
+                }
+
+                // Delay hide to allow moving to popover
+                setTimeout(() => {
+                    const popover = getPopover();
+                    if (!popover.matches(':hover') && !element.matches(':hover')) {
+                        hidePopover();
+                    }
+                }, 100);
             });
         });
     }
 
     function node_popup(n) {
-        popupContent = "<a href='" + n.url + "'>" + n.name + "</a><br>";
+        popupContent = "";
+        if (n.stereo_removed) {
+            popupContent += "<span class='alert alert-warning alert-soft'>Removed stereochemistry for prediction</span>";
+        }
+        popupContent += "<a href='" + n.url + "'>" + n.name + "</a><br>";
         popupContent += "Depth " + n.depth + "<br>"
 
         if (appDomainViewEnabled) {
@@ -255,7 +376,7 @@ function draw(pathway, elem) {
             }
         }
 
-        popupContent += "<img src='" + n.image + "' width='" + 20 * nodeRadius + "'><br>"
+        popupContent += "<img src='" + n.image + "'><br>"
         if (n.scenarios.length > 0) {
             popupContent += '<b>Half-lives and related scenarios:</b><br>'
             for (var s of n.scenarios) {
@@ -265,7 +386,7 @@ function draw(pathway, elem) {
 
         var isLeaf = pathway.links.filter(obj => obj.source.id === n.id).length === 0;
         if (pathway.isIncremental && isLeaf) {
-            popupContent += '<br><a class="btn btn-primary" onclick="predictFromNode(\'' + n.url + '\')" href="#">Predict from here</a><br>';
+            popupContent += '<br><a class="btn btn-primary btn-sm mt-2" onclick="predictFromNode(\'' + n.url + '\')" href="#">Predict from here</a><br>';
         }
 
         return popupContent;
@@ -285,7 +406,7 @@ function draw(pathway, elem) {
             popupContent += adcontent;
         }
 
-        popupContent += "<img src='" + e.image + "' width='" + 20 * nodeRadius + "'><br>"
+        popupContent += "<img src='" + e.image + "'><br>"
         if (e.reaction_probability) {
             popupContent += '<b>Probability:</b><br>' + e.reaction_probability.toFixed(3) + '<br>';
         }
@@ -308,6 +429,23 @@ function draw(pathway, elem) {
     });
 
     const zoomable = d3.select("#zoomable");
+    const svg = d3.select("#pwsvg");
+    const container = d3.select("#vizdiv");
+
+    // Set explicit SVG dimensions for proper zoom behavior
+    svg.attr("width", width)
+       .attr("height", height);
+
+    // Add background rectangle FIRST to enable pan/zoom on empty space
+    // This must be inserted before zoomable group so it's behind everything
+    svg.insert("rect", "#zoomable")
+        .attr("x", 0)
+        .attr("y", 0)
+        .attr("width", width)
+        .attr("height", height)
+        .attr("fill", "transparent")
+        .attr("pointer-events", "all")
+        .style("cursor", "grab");
 
     // Zoom Funktion aktivieren
     const zoom = d3.zoom()
@@ -316,7 +454,12 @@ function draw(pathway, elem) {
             zoomable.attr("transform", event.transform);
         });
 
-    d3.select("svg").call(zoom);
+    // Apply zoom to the SVG element - this enables wheel zoom
+    svg.call(zoom);
+
+    // Also apply zoom to container to catch events that might not reach SVG
+    // This ensures drag-to-pan works even when clicking on empty space
+    container.call(zoom);
 
     nodes = pathway['nodes'];
     links = pathway['links'];
@@ -381,7 +524,7 @@ function draw(pathway, elem) {
     node.append("circle")
         // make radius "invisible" for pseudo nodes
         .attr("r", d => d.pseudo ? 0.01 : nodeRadius)
-        .style("fill", "#e8e8e8");
+        .style("fill", d => d.is_engineered_intermediate ? "#42eff5" : "#e8e8e8");
 
     // Add image only for non pseudo nodes
     node.filter(d => !d.pseudo).each(function (d, i) {

templates/actions/collections/compound.html

@@ -1,6 +0,0 @@
-{% if meta.can_edit %}
-    <li>
-        <a role="button" data-toggle="modal" data-target="#new_compound_modal">
-            <span class="glyphicon glyphicon-plus"></span> New Compound</a>
-    </li>
-{% endif %}

templates/actions/collections/compound_structure.html

@@ -1,6 +0,0 @@
-{% if meta.can_edit %}
-    <li>
-        <a role="button" data-toggle="modal" data-target="#new_compound_structure_modal">
-            <span class="glyphicon glyphicon-plus"></span> New Compound Structure</a>
-    </li>
-{% endif %}

templates/actions/collections/edge.html

@@ -1,6 +1,10 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#new_edge_modal">
+    <a
-            <span class="glyphicon glyphicon-plus"></span> New Edge</a>
+      role="button"
+      onclick="document.getElementById('new_edge_modal').showModal(); return false;"
+    >
+      <span class="glyphicon glyphicon-plus"></span> New Edge</a
+    >
   </li>
 {% endif %}

templates/actions/collections/group.html

@@ -1,4 +1,8 @@
 <li>
-    <a role="button" data-toggle="modal" data-target="#new_group_modal">
+  <a
-        <span class="glyphicon glyphicon-plus"></span> New Group</a>
+    role="button"
+    onclick="document.getElementById('new_group_modal').showModal(); return false;"
+  >
+    <span class="glyphicon glyphicon-plus"></span> New Group</a
+  >
 </li>

templates/actions/collections/model.html

@@ -1,6 +0,0 @@
-{% if meta.can_edit and meta.enabled_features.MODEL_BUILDING %}
-    <li>
-        <a role="button" data-toggle="modal" data-target="#new_model_modal">
-            <span class="glyphicon glyphicon-plus"></span> New Model</a>
-    </li>
-{% endif %}

templates/actions/collections/node.html

@@ -1,6 +1,10 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#new_node_modal">
+    <a
-            <span class="glyphicon glyphicon-plus"></span> New Node</a>
+      role="button"
+      onclick="document.getElementById('new_node_modal').showModal(); return false;"
+    >
+      <span class="glyphicon glyphicon-plus"></span> New Node</a
+    >
   </li>
 {% endif %}

templates/actions/collections/package.html

@@ -1,12 +0,0 @@
-<li>
-    <a role="button" data-toggle="modal" data-target="#new_package_modal">
-        <span class="glyphicon glyphicon-plus"></span> New Package</a>
-</li>
-<li>
-    <a role="button" data-toggle="modal" data-target="#import_package_modal">
-        <span class="glyphicon glyphicon-import"></span> Import Package from JSON</a>
-</li>
-<li>
-    <a role="button" data-toggle="modal" data-target="#import_legacy_package_modal">
-        <span class="glyphicon glyphicon-import"></span> Import Package from legacy JSON</a>
-</li>

templates/actions/collections/pathway.html

@@ -1,6 +0,0 @@
-{% if meta.can_edit %}
-    <li>
-        <a href="{{ meta.server_url }}/predict">
-            <span class="glyphicon glyphicon-plus"></span> New Pathway</a>
-    </li>
-{% endif %}

templates/actions/collections/reaction.html

@@ -1,6 +0,0 @@
-{% if meta.can_edit %}
-    <li>
-        <a role="button" data-toggle="modal" data-target="#new_reaction_modal">
-            <span class="glyphicon glyphicon-plus"></span> New Reaction</a>
-    </li>
-{% endif %}

templates/actions/collections/rule.html

@@ -1,6 +0,0 @@
-{% if meta.can_edit %}
-    <li>
-        <a role="button" data-toggle="modal" data-target="#new_rule_modal">
-            <span class="glyphicon glyphicon-plus"></span> New Rule</a>
-    </li>
-{% endif %}

templates/actions/collections/scenario.html

@@ -1,6 +0,0 @@
-{% if meta.can_edit %}
-    <li>
-        <a role="button" data-toggle="modal" data-target="#new_scenario_modal">
-            <span class="glyphicon glyphicon-plus"></span> New Scenario</a>
-    </li>
-{% endif %}

templates/actions/collections/setting.html

@@ -1,6 +1,10 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#new_setting_modal">
+    <a
-            <span class="glyphicon glyphicon-plus"></span>New Setting</a>
+      role="button"
+      onclick="document.getElementById('new_setting_modal').showModal(); return false;"
+    >
+      <span class="glyphicon glyphicon-plus"></span>New Setting</a
+    >
   </li>
 {% endif %}

templates/actions/objects/compound.html

@@ -1,32 +1,60 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_compound_modal">
+    <a
-            <i class="glyphicon glyphicon-edit"></i> Edit Compound</a>
+      role="button"
+      onclick="document.getElementById('edit_compound_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-edit"></i> Edit Compound</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Aliases</a>
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#add_structure_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Add Structure</a>
+      role="button"
+      onclick="document.getElementById('add_structure_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Add Structure</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a>
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#generic_set_external_reference_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set External Reference</a>
+      role="button"
+      onclick="document.getElementById('generic_set_external_reference_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set External Reference</a
+    >
   </li>
 {% endif %}
 <li>
-        <a role="button" data-toggle="modal" data-target="#generic_copy_object_modal">
+  <a
-            <i class="glyphicon glyphicon-duplicate"></i> Copy</a>
+    role="button"
+    onclick="document.getElementById('generic_copy_object_modal').showModal(); return false;"
+  >
+    <i class="glyphicon glyphicon-duplicate"></i> Copy</a
+  >
 </li>
 {% if meta.can_edit %}
   <li>
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Compound</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Compound</a
+    >
   </li>
 {% endif %}

templates/actions/objects/compound_structure.html

@@ -1,22 +1,42 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_compound_structure_modal">
+    <a
-            <i class="glyphicon glyphicon-edit"></i> Edit Compound Structure</a>
+      role="button"
+      onclick="document.getElementById('edit_compound_structure_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-edit"></i> Edit Compound Structure</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Aliases</a>
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a>
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#generic_set_external_reference_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set External Reference</a>
+      role="button"
+      onclick="document.getElementById('generic_set_external_reference_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set External Reference</a
+    >
   </li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Compound Structure</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Compound Structure</a
+    >
   </li>
 {% endif %}

templates/actions/objects/edge.html

@@ -1,14 +1,26 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Aliases</a>
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a>
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
+    >
   </li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Edge</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Edge</a
+    >
   </li>
 {% endif %}

templates/actions/objects/group.html

@@ -1,10 +1,18 @@
 {% if meta.can_edit %}
   <li>
-    <a role="button" data-toggle="modal" data-target="#edit_group_member_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Add/Remove Member</a>
+      role="button"
+      onclick="document.getElementById('edit_group_member_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Add/Remove Member</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Group</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Group</a
+    >
   </li>
 {% endif %}

templates/actions/objects/joblog.html

@@ -0,0 +1,10 @@
+{% if job.is_result_downloadable %}
+  <li>
+    <a
+      class="button"
+      onclick="document.getElementById('download_job_result_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-floppy-save"></i> Download Result</a
+    >
+  </li>
+{% endif %}

templates/actions/objects/model.html

@@ -1,18 +1,38 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_model_modal">
+    <a
-            <i class="glyphicon glyphicon-edit"></i> Edit Model</a>
+      role="button"
+      onclick="document.getElementById('edit_model_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-edit"></i> Edit Model</a
+    >
   </li>
+  {% if model.model_status == 'BUILT_NOT_EVALUATED' or model.model_status == 'FINISHED' %}
     <li>
-        <a role="button" data-toggle="modal" data-target="#evaluate_model_modal">
+      <a
-            <i class="glyphicon glyphicon-ok"></i> Evaluate Model</a>
+        role="button"
-    </li>
+        onclick="document.getElementById('evaluate_model_modal').showModal(); return false;"
-    <li>
+      >
-        <a role="button" data-toggle="modal" data-target="#retrain_model_modal">
+        <i class="glyphicon glyphicon-ok"></i> Evaluate Model</a
-            <i class="glyphicon glyphicon-repeat"></i> Retrain Model</a>
+      >
-    </li>
+    </li>
-    <li>
+  {% endif %}
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+  {% if model.model_status == 'BUILT_NOT_EVALUATED' or model.model_status == 'FINISHED' %}
-            <i class="glyphicon glyphicon-trash"></i> Delete Model</a>
+    <li>
+      <a
+        role="button"
+        onclick="document.getElementById('retrain_model_modal').showModal(); return false;"
+      >
+        <i class="glyphicon glyphicon-repeat"></i> Retrain Model</a
+      >
+    </li>
+  {% endif %}
+  <li>
+    <a
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Model</a
+    >
   </li>
 {% endif %}

templates/actions/objects/node.html

@@ -1,18 +1,34 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_node_modal">
+    <a
-            <i class="glyphicon glyphicon-edit"></i> Edit Node</a>
+      role="button"
+      onclick="document.getElementById('edit_node_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-edit"></i> Edit Node</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Aliases</a>
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a>
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
+    >
   </li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Node</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Node</a
+    >
   </li>
 {% endif %}

templates/actions/objects/package.html

@@ -1,26 +1,50 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_package_modal">
+    <a
-            <i class="glyphicon glyphicon-edit"></i> Edit Package</a>
+      role="button"
+      onclick="document.getElementById('edit_package_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-edit"></i> Edit Package</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_package_permissions_modal">
+    <a
-            <i class="glyphicon glyphicon-user"></i> Edit Permissions</a>
+      role="button"
+      onclick="document.getElementById('edit_package_permissions_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-user"></i> Edit Permissions</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#publish_package_modal">
+    <a
-            <i class="glyphicon glyphicon-bullhorn"></i> Publish Package</a>
+      role="button"
+      onclick="document.getElementById('publish_package_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-bullhorn"></i> Publish Package</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#export_package_modal">
+    <a
-            <i class="glyphicon glyphicon-bullhorn"></i> Export Package as JSON</a>
+      role="button"
+      onclick="document.getElementById('export_package_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-bullhorn"></i> Export Package as JSON</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_license_modal">
+    <a
-            <i class="glyphicon glyphicon-duplicate"></i> License</a>
+      role="button"
+      onclick="document.getElementById('set_license_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-duplicate"></i> License</a
+    >
   </li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Package</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Package</a
+    >
   </li>
 {% endif %}

templates/actions/objects/pathway.html

@@ -1,59 +1,112 @@
 {% if meta.can_edit %}
   <li>
-        <a class="button" data-toggle="modal" data-target="#add_pathway_node_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Add Compound</a>
+      class="button"
+      onclick="document.getElementById('add_pathway_node_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Add Compound</a
+    >
   </li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#add_pathway_edge_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Add Reaction</a>
+      class="button"
+      onclick="document.getElementById('add_pathway_edge_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Add Reaction</a
+    >
   </li>
   <li role="separator" class="divider"></li>
 {% endif %}
 <li>
-        <a role="button" data-toggle="modal" data-target="#generic_copy_object_modal">
+  <a
-            <i class="glyphicon glyphicon-duplicate"></i> Copy</a>
+    role="button"
+    onclick="document.getElementById('generic_copy_object_modal').showModal(); return false;"
+  >
+    <i class="glyphicon glyphicon-duplicate"></i> Copy</a
+  >
 </li>
 <li>
-        <a class="button" data-toggle="modal" data-target="#download_pathway_csv_modal">
+  <a
-            <i class="glyphicon glyphicon-floppy-save"></i> Download Pathway as CSV</a>
+    class="button"
+    onclick="document.getElementById('download_pathway_csv_modal').showModal(); return false;"
+  >
+    <i class="glyphicon glyphicon-floppy-save"></i> Download Pathway as CSV</a
+  >
 </li>
 <li>
-        <a class="button" data-toggle="modal" data-target="#download_pathway_image_modal">
+  <a
-            <i class="glyphicon glyphicon-floppy-save"></i> Download Pathway as Image</a>
+    class="button"
+    onclick="document.getElementById('download_pathway_image_modal').showModal(); return false;"
+  >
+    <i class="glyphicon glyphicon-floppy-save"></i> Download Pathway as Image</a
+  >
+</li>
+<li>
+  <a
+    role="button"
+    onclick="document.getElementById('engineer_pathway_modal').showModal(); return false;"
+  >
+    <i class="glyphicon glyphicon-cog"></i> Engineer Pathway</a
+  >
 </li>
 {% if meta.can_edit %}
   <li>
-        <a class="button" data-toggle="modal" data-target="#identify_missing_rules_modal">
+    <a
-            <i class="glyphicon glyphicon-question-sign"></i> Identify Missing Rules</a>
+      class="button"
+      onclick="document.getElementById('identify_missing_rules_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-question-sign"></i> Identify Missing
+      Rules</a
+    >
   </li>
   <li role="separator" class="divider"></li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#edit_pathway_modal">
+    <a
-            <i class="glyphicon glyphicon-edit"></i> Edit Pathway</a>
+      class="button"
+      onclick="document.getElementById('edit_pathway_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-edit"></i> Edit Pathway</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a>
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Aliases</a>
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
+    >
   </li>
-    {#    <li>#}
-    {#        <a class="button" data-toggle="modal" data-target="#add_pathway_edge_modal">#}
-    {#            <i class="glyphicon glyphicon-plus"></i> Calculate Compound Properties</a>#}
-    {#    </li>#}
   <li role="separator" class="divider"></li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#delete_pathway_node_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Compound</a>
+      class="button"
+      onclick="document.getElementById('delete_pathway_node_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Compound</a
+    >
   </li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#delete_pathway_edge_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Reaction</a>
+      class="button"
+      onclick="document.getElementById('delete_pathway_edge_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Reaction</a
+    >
   </li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Pathway</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Pathway</a
+    >
   </li>
 {% endif %}

templates/actions/objects/reaction.html

@@ -1,28 +1,52 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_reaction_modal">
+    <a
-            <i class="glyphicon glyphicon-edit"></i> Edit Reaction</a>
+      role="button"
+      onclick="document.getElementById('edit_reaction_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-edit"></i> Edit Reaction</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Aliases</a>
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a>
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#generic_set_external_reference_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set External Reference</a>
+      role="button"
+      onclick="document.getElementById('generic_set_external_reference_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set External Reference</a
+    >
   </li>
 {% endif %}
 <li>
-        <a role="button" data-toggle="modal" data-target="#generic_copy_object_modal">
+  <a
-            <i class="glyphicon glyphicon-duplicate"></i> Copy</a>
+    role="button"
+    onclick="document.getElementById('generic_copy_object_modal').showModal(); return false;"
+  >
+    <i class="glyphicon glyphicon-duplicate"></i> Copy</a
+  >
 </li>
 {% if meta.can_edit %}
   <li>
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Reaction</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Reaction</a
+    >
   </li>
 {% endif %}

templates/actions/objects/rule.html

@@ -1,24 +1,44 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_rule_modal">
+    <a
-            <i class="glyphicon glyphicon-edit"></i> Edit Rule</a>
+      role="button"
+      onclick="document.getElementById('edit_rule_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-edit"></i> Edit Rule</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_aliases_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Aliases</a>
+      role="button"
+      onclick="document.getElementById('set_aliases_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Aliases</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#set_scenario_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a>
+      role="button"
+      onclick="document.getElementById('set_scenario_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> Set Scenarios</a
+    >
   </li>
 {% endif %}
 <li>
-        <a role="button" data-toggle="modal" data-target="#generic_copy_object_modal">
+  <a
-            <i class="glyphicon glyphicon-duplicate"></i> Copy</a>
+    role="button"
+    onclick="document.getElementById('generic_copy_object_modal').showModal(); return false;"
+  >
+    <i class="glyphicon glyphicon-duplicate"></i> Copy</a
+  >
 </li>
 {% if meta.can_edit %}
   <li>
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Rule</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Rule</a
+    >
   </li>
 {% endif %}

templates/actions/objects/scenario.html

@@ -1,14 +1,26 @@
 {% if meta.can_edit %}
   <li>
-        <a class="button" data-toggle="modal" data-target="#add_additional_information_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Add Additional Information</a>
+      class="button"
+      onclick="document.getElementById('add_additional_information_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Add Additional Information</a
+    >
   </li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#update_scenario_additional_information_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Set Additional Information</a>
+      class="button"
+      onclick="document.getElementById('update_scenario_additional_information_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Set Additional Information</a
+    >
   </li>
   <li>
-        <a class="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Scenario</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Scenario</a
+    >
   </li>
 {% endif %}

templates/actions/objects/user.html

@@ -1,22 +1,38 @@
 {% if meta.can_edit %}
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_user_modal">
+    <a
-            <i class="glyphicon glyphicon-edit"></i> Update</a>
+      role="button"
+      onclick="document.getElementById('edit_user_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-edit"></i> Update</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#edit_password_modal">
+    <a
-            <i class="glyphicon glyphicon-lock"></i> Update Password</a>
+      role="button"
+      onclick="document.getElementById('edit_password_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-lock"></i> Update Password</a
+    >
   </li>
   <li>
-        <a role="button" data-toggle="modal" data-target="#new_prediction_setting_modal">
+    <a
-            <i class="glyphicon glyphicon-plus"></i> New Prediction Setting</a>
+      role="button"
+      onclick="document.getElementById('new_prediction_setting_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-plus"></i> New Prediction Setting</a
+    >
   </li>
   {#    <li>#}
   {#        <a role="button" data-toggle="modal" data-target="#manage_api_token_modal">#}
   {#            <i class="glyphicon glyphicon-console"></i> Manage API Token</a>#}
   {#    </li>#}
   <li>
-        <a role="button" data-toggle="modal" data-target="#generic_delete_modal">
+    <a
-            <i class="glyphicon glyphicon-trash"></i> Delete Account</a>
+      class="button"
+      onclick="document.getElementById('generic_delete_modal').showModal(); return false;"
+    >
+      <i class="glyphicon glyphicon-trash"></i> Delete Account</a
+    >
   </li>
 {% endif %}

templates/admin.html

@@ -1,12 +1,17 @@
 {% extends "framework.html" %}
 {% load static %}
 {% block content %}
-
+  <div id="searchContent">
-<div id=searchContent>
     <form id="admin-form" action="{{ SERVER_BASE }}/admin" method="post">
       <div class="form-group">
         <label for="textarea">Query</label>
-            <textarea id="textarea" class="form-control" rows="10" placeholder="Paste query here" required>
+        <textarea
+          id="textarea"
+          class="form-control"
+          rows="10"
+          placeholder="Paste query here"
+          required
+        >
 PREFIX pps: <http://localhost:8080/vocabulary#>
 SELECT ?name (count(?objId) as ?xcnt)
 WHERE {
@@ -15,32 +20,29 @@ WHERE {
     ?packageId pps:reviewStatus 'reviewed' .
     ?packageId pps:pathway ?objId .
 } GROUP BY ?name
-            </textarea>
+            </textarea
+        >
       </div>
       <button id="submit" type="button" class="btn btn-primary">Submit</button>
     </form>
     <p></p>
   </div>
-<div id="results">
+  <div id="results"></div>
-</div>
   <div id="loading"></div>
-</div>
   <script>
     $(function () {
-    $('#submit').on('click', function() {
+      $("#submit").on("click", function () {
-
         makeLoadingGif("#loading", "{% static '/images/wait.gif' %}");
 
         data = {
-            "query": $("#textarea").val()
+          query: $("#textarea").val(),
-        }
+        };
 
         $.post("{{ SERVER_BASE }}/expire", data, function (result) {
           $("#loading").empty();
           queryResultToTable("results", result);
-        })
         });
-})
+      });
+    });
   </script>
-
 {% endblock content %}

templates/batch_predict_pathway.html

@@ -0,0 +1,168 @@
+{% extends "framework_modern.html" %}
+{% load static %}
+{% block content %}
+  <div class="mx-auto w-full p-8">
+    <h1 class="h1 mb-4 text-3xl font-bold">Batch Predict Pathways</h1>
+    <form id="smiles-form" method="POST" action="{% url "jobs" %}">
+      {% csrf_token %}
+      <input type="hidden" name="substrates" id="substrates" />
+      <input type="hidden" name="job-name" value="batch-predict" />
+
+      <fieldset class="flex flex-col gap-4 md:flex-3/4">
+        <table class="table table-zebra w-full">
+          <thead>
+            <tr>
+              <th>SMILES</th>
+              <th>Name</th>
+            </tr>
+          </thead>
+          <tbody id="smiles-table-body">
+            <tr>
+              <td>
+                <label>
+                  <input
+                    type="text"
+                    class="input input-bordered w-full smiles-input"
+                    placeholder="CN1C=NC2=C1C(=O)N(C(=O)N2C)C"
+                    {% if meta.debug %}
+                      value="CN1C=NC2=C1C(=O)N(C(=O)N2C)C"
+                    {% endif %}
+                  />
+                </label>
+              </td>
+              <td>
+                <label>
+                  <input
+                    type="text"
+                    class="input input-bordered w-full name-input"
+                    placeholder="Caffeine"
+                    {% if meta.debug %}
+                      value="Caffeine"
+                    {% endif %}
+                  />
+                </label>
+              </td>
+            </tr>
+            <tr>
+              <td>
+                <label>
+                  <input
+                    type="text"
+                    class="input input-bordered w-full smiles-input"
+                    placeholder="CC(C)CC1=CC=C(C=C1)C(C)C(=O)O"
+                    {% if meta.debug %}
+                      value="CC(C)CC1=CC=C(C=C1)C(C)C(=O)O"
+                    {% endif %}
+                  />
+                </label>
+              </td>
+              <td>
+                <label>
+                  <input
+                    type="text"
+                    class="input input-bordered w-full name-input"
+                    placeholder="Ibuprofen"
+                    {% if meta.debug %}
+                      value="Ibuprofen"
+                    {% endif %}
+                  />
+                </label>
+              </td>
+            </tr>
+          </tbody>
+        </table>
+        <label class="select mb-2 w-full">
+          <span class="label">Predictor</span>
+          <select id="prediction-setting" name="prediction-setting">
+            <option disabled>Select a Setting</option>
+            {% for s in meta.available_settings %}
+              <option
+                value="{{ s.url }}"
+                {% if s.id == meta.user.default_setting.id %}selected{% endif %}
+              >
+                {{ s.name }}{% if s.id == meta.user.default_setting.id %}
+                  (User default)
+                {% endif %}
+              </option>
+            {% endfor %}
+          </select>
+        </label>
+        <label class="floating-label" for="num-tps">
+          <input
+            type="number"
+            name="num-tps"
+            value="50"
+            step="1"
+            min="1"
+            max="100"
+            id="num-tps"
+            class="input input-md w-full"
+          />
+          <span>Max Transformation Products</span>
+        </label>
+        <div class="flex justify-end gap-2">
+          <button type="button" id="add-row-btn" class="btn btn-outline">
+            Add row
+          </button>
+          <button type="submit" class="btn btn-primary">Submit</button>
+        </div>
+      </fieldset>
+    </form>
+  </div>
+
+  <script>
+    const tableBody = document.getElementById("smiles-table-body");
+    const addRowBtn = document.getElementById("add-row-btn");
+    const form = document.getElementById("smiles-form");
+    const hiddenField = document.getElementById("substrates");
+
+    addRowBtn.addEventListener("click", () => {
+      const row = document.createElement("tr");
+
+      const tdSmiles = document.createElement("td");
+      const tdName = document.createElement("td");
+
+      const smilesInput = document.createElement("input");
+      smilesInput.type = "text";
+      smilesInput.className = "input input-bordered w-full smiles-input";
+      smilesInput.placeholder = "SMILES";
+
+      const nameInput = document.createElement("input");
+      nameInput.type = "text";
+      nameInput.className = "input input-bordered w-full name-input";
+      nameInput.placeholder = "Name";
+
+      tdSmiles.appendChild(smilesInput);
+      tdName.appendChild(nameInput);
+
+      row.appendChild(tdSmiles);
+      row.appendChild(tdName);
+
+      tableBody.appendChild(row);
+    });
+
+    // Before submit, gather table data into the hidden field
+    form.addEventListener("submit", (e) => {
+      const smilesInputs = Array.from(
+        document.querySelectorAll(".smiles-input"),
+      );
+      const nameInputs = Array.from(document.querySelectorAll(".name-input"));
+
+      const lines = [];
+
+      for (let i = 0; i < smilesInputs.length; i++) {
+        const smiles = smilesInputs[i].value.trim();
+        const name = nameInputs[i]?.value.trim() ?? "";
+
+        // Skip emtpy rows
+        if (!smiles && !name) {
+          continue;
+        }
+        lines.push(`${smiles},${name}`);
+      }
+      // Value looks like:
+      // "CN1C=NC2=C1C(=O)N(C(=O)N2C)C,Caffeine\nCC(C)CC1=CC=C(C=C1)C(C)C(=O)O,Ibuprofen"
+      hiddenField.value = lines.join("\n");
+    });
+  </script>
+{% endblock content %}

templates/collections/_paginated_list_partial.html

@@ -0,0 +1,103 @@
+{# Partial for paginated list content - expects to be inside a remotePaginatedList Alpine.js context #}
+{# Variables: empty_text (string), show_review_badge (bool), always_show_badge (bool) #}
+
+{# Loading state #}
+<div
+  x-show="isLoading"
+  class="mx-auto flex h-32 w-32 items-center justify-center"
+>
+  {% include "components/loading-spinner.html" %}
+</div>
+
+{# Error state #}
+<div
+  x-show="!isLoading && error"
+  class="alert alert-error/50 text-sm"
+  x-text="error"
+></div>
+
+{# Content #}
+<template x-if="!isLoading && !error">
+  <div>
+    {# Empty state #}
+    <div
+      x-show="totalItems === 0"
+      class="text-base-content/70 py-8 text-center"
+    >
+      <p>No {{ empty_text|default:"items" }} found.</p>
+    </div>
+
+    {# Items list #}
+    <ul class="menu bg-base-100 rounded-box w-full" x-show="totalItems > 0">
+      <template x-for="obj in paginatedItems" :key="obj.url">
+        <li>
+          <a :href="obj.url" class="hover:bg-base-200">
+            <span x-text="obj.name"></span>
+            {% if show_review_badge %}
+              <span
+                class="tooltip tooltip-left ml-auto"
+                data-tip="Reviewed"
+                {% if not always_show_badge %}
+                  x-show="obj.review_status === 'reviewed'"
+                {% endif %}
+              >
+                <svg
+                  xmlns="http://www.w3.org/2000/svg"
+                  width="24"
+                  height="24"
+                  viewBox="0 0 24 24"
+                  fill="none"
+                  stroke="currentColor"
+                  stroke-width="2"
+                  stroke-linecap="round"
+                  stroke-linejoin="round"
+                  class="lucide lucide-check-icon lucide-check"
+                >
+                  <path d="M20 6 9 17l-5-5" />
+                </svg>
+              </span>
+            {% endif %}
+          </a>
+        </li>
+      </template>
+    </ul>
+
+    {# Pagination controls #}
+    <div
+      x-show="totalPages > 1"
+      class="mt-4 flex items-center justify-between px-2"
+    >
+      <span class="text-base-content/70 text-sm">
+        Showing <span x-text="showingStart"></span>-<span
+          x-text="showingEnd"
+        ></span>
+        of <span x-text="totalItems"></span>
+      </span>
+      <div class="join">
+        <button
+          class="join-item btn btn-sm"
+          :disabled="currentPage === 1"
+          @click="prevPage()"
+        >
+          «
+        </button>
+        <template x-for="item in pageNumbers" :key="item.key">
+          <button
+            class="join-item btn btn-sm"
+            :class="{ 'btn-active': item.page === currentPage }"
+            :disabled="item.isEllipsis"
+            @click="!item.isEllipsis && goToPage(item.page)"
+            x-text="item.page"
+          ></button>
+        </template>
+        <button
+          class="join-item btn btn-sm"
+          :disabled="currentPage === totalPages"
+          @click="nextPage()"
+        >
+          »
+        </button>
+      </div>
+    </div>
+  </div>
+</template>

templates/collections/compounds_paginated.html

@@ -0,0 +1,33 @@
+{% extends "collections/paginated_base.html" %}
+
+{% block page_title %}Compounds{% endblock %}
+
+{% block action_button %}
+  {% if meta.can_edit %}
+    <button
+      type="button"
+      class="btn btn-primary btn-sm"
+      onclick="document.getElementById('new_compound_modal').showModal(); return false;"
+    >
+      New Compound
+    </button>
+  {% endif %}
+{% endblock action_button %}
+
+{% block action_modals %}
+  {% include "modals/collections/new_compound_modal.html" %}
+{% endblock action_modals %}
+
+{% block description %}
+  <p>
+    A compound stores the structure of a molecule and can include
+    meta-information.
+  </p>
+  <a
+    target="_blank"
+    href="https://wiki.envipath.org/index.php/compounds"
+    class="link link-primary"
+  >
+    Learn more &gt;&gt;
+  </a>
+{% endblock description %}

templates/collections/joblog.html

@@ -1,48 +1,59 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 {% load static %}
+{% load envipytags %}
 {% block content %}
-
+  <div class="space-y-2 p-4">
-    <div class="panel-group" id="reviewListAccordion">
+    <!-- Header Section -->
-        <div class="panel panel-default">
+    <div class="card bg-base-100">
-            <div class="panel-heading" id="headingPanel" style="font-size:2rem;height: 46px">
+      <div class="card-body">
-                Jobs
+        <h2 class="card-title text-2xl">User Prediction Jobs</h2>
+        <p class="mt-2">Job Logs Desc</p>
       </div>
-            <div class="panel-body">
-                <p>
-                    Job Logs Desc
-                </p>
-
     </div>
 
-            <div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
+    <!-- Jobs -->
-                <h4 class="panel-title">
+    <div class="collapse-arrow bg-base-200 collapse">
-                    <a id="job-accordion-link" data-toggle="collapse" data-parent="#job-accordion" href="#jobs">
+      <input type="checkbox" checked />
-                        Jobs
+      <div class="collapse-title text-xl font-medium">Recent Jobs</div>
-                    </a>
+      <div class="collapse-content" id="job-content">
-                </h4>
+        <div class="overflow-x-auto">
-            </div>
+          <table class="table-zebra table">
-            <div id="jobs"
+            <thead>
-                 class="panel-collapse collapse in">
+              <tr>
-                <div class="panel-body list-group-item" id="job-content">
+                {% if meta.user.is_superuser %}
-                    <table class="table table-bordered table-hover">
+                  <th>User</th>
-                        <tr style="background-color: rgba(0, 0, 0, 0.08);">
+                {% endif %}
-                            <th scope="col">ID</th>
+                <th>ID</th>
-                            <th scope="col">Name</th>
+                <th>Name</th>
-                            <th scope="col">Status</th>
+                <th>Status</th>
-                            <th scope="col">Queued</th>
+                <th>Queued</th>
-                            <th scope="col">Done</th>
+                <th>Done</th>
-                            <th scope="col">Result</th>
+                <th>Result</th>
               </tr>
+            </thead>
             <tbody>
               {% for job in jobs %}
                 <tr>
-                                <td>{{ job.task_id }}</td>
+                  {% if meta.user.is_superuser %}
+                    <td>
+                      <a href="{{ job.user.url }}">{{ job.user.username }}</a>
+                    </td>
+                  {% endif %}
+                  <td>
+                    <a href="{% url 'job detail' job.task_id %}"
+                      >{{ job.task_id }}</a
+                    >
+                  </td>
                   <td>{{ job.job_name }}</td>
                   <td>{{ job.status }}</td>
                   <td>{{ job.created }}</td>
                   <td>{{ job.done_at }}</td>
                   {% if job.task_result and job.task_result|is_url == True %}
-                                    <td><a href="{{ job.task_result }}">Result</a></td>
+                    <td>
+                      <a href="{{ job.task_result }}" class="link link-primary"
+                        >Result</a
+                      >
+                    </td>
                   {% elif job.task_result %}
                     <td>{{ job.task_result|slice:"40" }}...</td>
                   {% else %}
@@ -54,17 +65,31 @@
           </table>
         </div>
       </div>
+    </div>
 
+    {% if objects %}
       <!-- Unreviewable objects such as User / Group / Setting -->
-            <ul class='list-group'>
+      <div class="card bg-base-100 shadow-xl">
+        <div class="card-body">
+          <ul class="menu bg-base-200 rounded-box">
             {% for obj in objects %}
               {% if object_type == 'user' %}
-                        <a class="list-group-item" href="{{ obj.url }}">{{ obj.username }}</a>
+                <li>
+                  <a href="{{ obj.url }}" class="hover:bg-base-300"
+                    >{{ obj.username }}</a
+                  >
+                </li>
               {% else %}
-                        <a class="list-group-item" href="{{ obj.url }}">{{ obj.name }}</a>
+                <li>
+                  <a href="{{ obj.url }}" class="hover:bg-base-300"
+                    >{{ obj.name }}</a
+                  >
+                </li>
               {% endif %}
             {% endfor %}
           </ul>
         </div>
       </div>
+    {% endif %}
+  </div>
 {% endblock content %}

templates/collections/models_paginated.html

@@ -0,0 +1,32 @@
+{% extends "collections/paginated_base.html" %}
+
+{% block page_title %}Models{% endblock %}
+
+{% block action_button %}
+  {% if meta.can_edit and meta.enabled_features.MODEL_BUILDING %}
+    <button
+      type="button"
+      class="btn btn-primary btn-sm"
+      onclick="document.getElementById('new_model_modal').showModal(); return false;"
+    >
+      New Model
+    </button>
+  {% endif %}
+{% endblock action_button %}
+
+{% block action_modals %}
+  {% if meta.enabled_features.MODEL_BUILDING %}
+    {% include "modals/collections/new_model_modal.html" %}
+  {% endif %}
+{% endblock action_modals %}
+
+{% block description %}
+  <p>A model applies machine learning to limit the combinatorial explosion.</p>
+  <a
+    target="_blank"
+    href="https://wiki.envipath.org/index.php/relative_reasoning"
+    class="link link-primary"
+  >
+    Learn more &gt;&gt;
+  </a>
+{% endblock description %}

templates/collections/objects_list.html

@@ -1,319 +1,323 @@
-{% extends "framework.html" %}
+{% extends "framework_modern.html" %}
 {% load static %}
 {% block content %}
 
-    {% if object_type != 'package' %}
+  {# Serialize objects data for Alpine pagination #}
-        <div>
+  {# prettier-ignore-start #}
-            <div id="load-all-error" style="display: none;">
+{# FIXME: This is a hack to get the objects data into the JavaScript code. #}
-                <div class="alert alert-danger" role="alert">
+{% if object_type != 'scenario' %}
-                    <span class="glyphicon glyphicon-exclamation-sign" aria-hidden="true"></span>
+  <script>
-                    <span class="sr-only">Error:</span>
+    window.reviewedObjects = [
-                    Getting objects failed!
+      {% for obj in reviewed_objects %}
-                </div>
+        { "name": "{{ obj.name|escapejs }}", "url": "{{ obj.url }}" }{% if not forloop.last %},{% endif %}
-            </div>
+      {% endfor %}
-
+    ];
-            <input type="text" id="object-search" class="form-control" placeholder="Search by name"
+    window.unreviewedObjects = [
-                   style="display: none;">
+      {% for obj in unreviewed_objects %}
-            <p></p>
+        { "name": "{{ obj.name|escapejs }}", "url": "{{ obj.url }}" }{% if not forloop.last %},{% endif %}
-        </div>
+      {% endfor %}
+    ];
+  </script>
 {% endif %}
+{# prettier-ignore-end #}
+
+  <div class="px-8 py-4">
+    <input
+      type="text"
+      id="object-search"
+      class="input input-bordered hidden w-full max-w-xs"
+      placeholder="Search by name"
+    />
+  </div>
 
   {% block action_modals %}
-        {% if object_type == 'package' %}
+    {% if object_type == 'node' %}
-            {% include "modals/collections/new_package_modal.html" %}
-            {% include "modals/collections/import_package_modal.html" %}
-            {% include "modals/collections/import_legacy_package_modal.html" %}
-        {% elif object_type == 'compound' %}
-            {% include "modals/collections/new_compound_modal.html" %}
-        {% elif object_type == 'rule' %}
-            {% include "modals/collections/new_rule_modal.html" %}
-        {% elif object_type == 'reaction' %}
-            {% include "modals/collections/new_reaction_modal.html" %}
-        {% elif object_type == 'pathway' %}
-            {# {% include "modals/collections/new_pathway_modal.html" %} #}
-        {% elif object_type == 'node' %}
       {% include "modals/collections/new_node_modal.html" %}
     {% elif object_type == 'edge' %}
       {% include "modals/collections/new_edge_modal.html" %}
-        {% elif object_type == 'scenario' %}
-            {% include "modals/collections/new_scenario_modal.html" %}
-        {% elif object_type == 'model' %}
-            {% include "modals/collections/new_model_modal.html" %}
-        {% elif object_type == 'setting' %}
-            {#{% include "modals/collections/new_setting_modal.html" %}#}
-        {% elif object_type == 'user' %}
-            <div></div>
-        {% elif object_type == 'group' %}
-            {% include "modals/collections/new_group_modal.html" %}
     {% endif %}
   {% endblock action_modals %}
 
-<div class="panel-group" id="reviewListAccordion">
+  <div class="px-8 py-4">
-    <div class="panel panel-default">
+    <!-- Header Section -->
-        <div class="panel-heading" id="headingPanel" style="font-size:2rem;height: 46px">
+    <div class="card bg-base-100">
-            {% if object_type == 'package' %}
+      <div class="card-body px-0 py-4">
-            Packages
+        <div class="flex items-center justify-between">
-            {% elif object_type == 'compound' %}
+          <h2 class="card-title text-2xl">
-            Compounds
+            {% if object_type == 'node' %}
-            {% elif object_type == 'structure' %}
-            Compound structures
-            {% elif object_type == 'rule' %}
-            Rules
-            {% elif object_type == 'reaction' %}
-            Reactions
-            {% elif object_type == 'pathway' %}
-            Pathways
-            {% elif object_type == 'node' %}
               Nodes
             {% elif object_type == 'edge' %}
               Edges
-            {% elif object_type == 'scenario' %}
-            Scenarios
-            {% elif object_type == 'model' %}
-            Model
-            {% elif object_type == 'setting' %}
-            Settings
-            {% elif object_type == 'user' %}
-            Users
-            {% elif object_type == 'group' %}
-            Groups
             {% endif %}
-            <div id="actionsButton"
+          </h2>
-                 style="float: right;font-weight: normal;font-size: medium;position: relative; top: 50%; transform: translateY(-50%);z-index:100;display: none;"
+          <div id="actionsButton" class="dropdown dropdown-end hidden">
-                 class="dropdown"><a href="#" class="dropdown-toggle" data-toggle="dropdown" role="button"
+            <div tabindex="0" role="button" class="btn btn-ghost btn-sm">
-                                     aria-haspopup="true" aria-expanded="false"><span
+              <svg
-                    class="glyphicon glyphicon-wrench"></span> Actions <span class="caret"></span><span
+                xmlns="http://www.w3.org/2000/svg"
-                    style="padding-right:1em"></span></a>
+                width="16"
-                <ul id="actionsList" class="dropdown-menu">
+                height="16"
+                viewBox="0 0 24 24"
+                fill="none"
+                stroke="currentColor"
+                stroke-width="2"
+                stroke-linecap="round"
+                stroke-linejoin="round"
+                class="lucide lucide-wrench"
+              >
+                <path
+                  d="M14.7 6.3a1 1 0 0 0 0 1.4l1.6 1.6a1 1 0 0 0 1.4 0l3.77-3.77a6 6 0 0 1-7.94 7.94l-6.91 6.91a2.12 2.12 0 0 1-3-3l6.91-6.91a6 6 0 0 1 7.94-7.94l-3.76 3.76z"
+                />
+              </svg>
+              Actions
+            </div>
+            <ul
+              tabindex="-1"
+              class="dropdown-content menu bg-base-100 rounded-box z-50 w-52 p-2"
+            >
               {% block actions %}
-                        {% if object_type == 'package' %}
+                {% if object_type == 'node' %}
-                            {% include "actions/collections/package.html" %}
-                        {% elif object_type == 'compound' %}
-                            {% include "actions/collections/compound.html" %}
-                        {% elif object_type == 'structure' %}
-                            {% include "actions/collections/compound_structure.html" %}
-                        {% elif object_type == 'rule' %}
-                            {% include "actions/collections/rule.html" %}
-                        {% elif object_type == 'reaction' %}
-                            {% include "actions/collections/reaction.html" %}
-                        {% elif object_type == 'setting' %}
-                            {% include "actions/collections/setting.html" %}
-                        {% elif object_type == 'scenario' %}
-                            {% include "actions/collections/scenario.html" %}
-                        {% elif object_type == 'model' %}
-                            {% include "actions/collections/model.html" %}
-                        {% elif object_type == 'pathway' %}
-                            {% include "actions/collections/pathway.html" %}
-                        {% elif object_type == 'node' %}
                   {% include "actions/collections/node.html" %}
                 {% elif object_type == 'edge' %}
                   {% include "actions/collections/edge.html" %}
-                        {% elif object_type == 'group' %}
-                            {% include "actions/collections/group.html" %}
                 {% endif %}
               {% endblock %}
             </ul>
           </div>
         </div>
-        <div class="panel-body">
+        <div class="mt-2">
-            <!-- Set Text above links -->
+          {% if object_type == 'node' %}
-            {% if object_type == 'package' %}
+            <p>
-            <p>A package contains pathways, rules, etc. and can reflect specific experimental
+              Nodes represent the (predicted) compounds in a graph.
-                conditions. <a target="_blank" href="https://wiki.envipath.org/index.php/packages" role="button">Learn
+              <a
-                    more &gt;&gt;</a></p>
+                target="_blank"
-            {% elif object_type == 'compound' %}
+                href="https://wiki.envipath.org/index.php/nodes"
-            <p>A compound stores the structure of a molecule and can include meta-information.
+                class="link link-primary"
-                <a target="_blank" href="https://wiki.envipath.org/index.php/compounds" role="button">Learn more
+                >Learn more &gt;&gt;</a
-                    &gt;&gt;</a></p>
+              >
-            {% elif object_type == 'structure' %}
+            </p>
-            <p>The structures stored in this compound
-                <a target="_blank" href="https://wiki.envipath.org/index.php/compounds" role="button">Learn more
-                    &gt;&gt;</a></p>
-            {% elif object_type == 'rule' %}
-            <p>A rule describes a biotransformation reaction template that is defined as SMIRKS.
-                <a target="_blank" href="https://wiki.envipath.org/index.php/Rules" role="button">Learn more
-                    &gt;&gt;</a></p>
-            {% elif object_type == 'reaction' %}
-            <p>A reaction is a specific biotransformation from educt compounds to product compounds.
-                <a target="_blank" href="https://wiki.envipath.org/index.php/reactions" role="button">Learn more
-                    &gt;&gt;</a></p>
-            {% elif object_type == 'pathway' %}
-            <p>A pathway displays the (predicted) biodegradation of a compound as graph.
-                <a target="_blank" href="https://wiki.envipath.org/index.php/pathways" role="button">Learn more
-                    &gt;&gt;</a></p>
-            {% elif object_type == 'node' %}
-            <p>Nodes represent the (predicted) compounds in a graph.
-                <a target="_blank" href="https://wiki.envipath.org/index.php/nodes" role="button">Learn more
-                    &gt;&gt;</a></p>
           {% elif object_type == 'edge' %}
-            <p>Edges represent the links between Nodes in a graph
+            <p>
-                <a target="_blank" href="https://wiki.envipath.org/index.php/edges" role="button">Learn more
+              Edges represent the links between nodes in a graph.
-                    &gt;&gt;</a></p>
+              <a
-            {% elif object_type == 'scenario' %}
+                target="_blank"
-            <p>A scenario contains meta-information that can be attached to other data (compounds, rules, ..).
+                href="https://wiki.envipath.org/index.php/edges"
-                <a target="_blank" href="https://wiki.envipath.org/index.php/scenarios" role="button">Learn more
+                class="link link-primary"
-                    &gt;&gt;</a></p>
+                >Learn more &gt;&gt;</a
-            {% elif object_type == 'model' %}
+              >
-            <p>A model applies machine learning to limit the combinatorial explosion.
+            </p>
-                <a target="_blank" href="https://wiki.envipath.org/index.php/relative_reasoning" role="button">Learn
-                    more
-                    &gt;&gt;</a></p>
-            {% elif object_type == 'setting' %}
-            <p>A setting includes configuration parameters for pathway predictions.
-                <a target="_blank" href="https://wiki.envipath.org/index.php/settings" role="button">Learn more
-                    &gt;&gt;</a></p>
-            {% elif object_type == 'user' %}
-            <p>Register now to create own packages and to submit and manage your data.
-                <a target="_blank" href="https://wiki.envipath.org/index.php/users" role="button">Learn more
-                    &gt;&gt;</a></p>
-            {% elif object_type == 'group' %}
-            <p>Users can team up in groups to share packages.
-                <a target="_blank" href="https://wiki.envipath.org/index.php/groups" role="button">Learn more
-                    &gt;&gt;</a></p>
           {% endif %}
 
-            <!-- If theres nothing to show extend the text above -->
           {% if reviewed_objects and unreviewed_objects %}
             {% if reviewed_objects|length == 0 and unreviewed_objects|length == 0 %}
-            <p>Nothing found. There are two possible reasons: <br><br>1. There is no content yet.<br>2. You have no
+              <p class="mt-4">
-                reading permissions.<br><br>Please be sure you have at least reading permissions.</p>
+                Nothing found. There are two possible reasons:<br /><br />
+                1. There is no content yet.<br />
+                2. You have no reading permissions.<br /><br />
+                Please ensure you have at least reading permissions.
+              </p>
             {% endif %}
           {% endif %}
         </div>
+      </div>
+    </div>
+
+    <!-- Lists Container -->
+    <div class="w-full">
       {% if reviewed_objects %}
         {% if reviewed_objects|length > 0 %}
-        <div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
+          <!-- Reviewed -->
-            <h4 class="panel-title">
+          <div
-                <a id="ReviewedLink" data-toggle="collapse" data-parent="#reviewListAccordion"
+            class="collapse-arrow bg-base-200 collapse order-2 w-full"
-                   href="#Reviewed">Reviewed</a>
+            x-data="paginatedList(window.reviewedObjects || [], { isReviewed: true, instanceId: 'reviewed' })"
-            </h4>
+          >
+            <input type="checkbox" checked />
+            <div class="collapse-title text-xl font-medium">
+              Reviewed
+              <span
+                class="badge badge-sm badge-neutral ml-2"
+                x-text="totalItems"
+              ></span>
             </div>
-        <div id="Reviewed" class="panel-collapse collapse in">
+            <div class="collapse-content w-full">
-            <div class="panel-body list-group-item" id="ReviewedContent">
+              <ul class="menu bg-base-100 rounded-box w-full">
-                {% if object_type == 'package' %}
+                <template x-for="obj in paginatedItems" :key="obj.url">
-                {% for obj in reviewed_objects %}
+                  <li>
-                <a class="list-group-item" href="{{ obj.url }}">{{ obj.name|safe }}
+                    <a :href="obj.url" class="hover:bg-base-200">
-                    <span class="glyphicon glyphicon-star" aria-hidden="true"
+                      <span x-text="obj.name"></span>
-                          style="float:right" data-toggle="tooltip"
+                      <span
-                          data-placement="top" title="" data-original-title="Reviewed">
+                        class="tooltip tooltip-left ml-auto"
+                        data-tip="Reviewed"
+                      >
+                        <svg
+                          xmlns="http://www.w3.org/2000/svg"
+                          width="16"
+                          height="16"
+                          viewBox="0 0 24 24"
+                          fill="none"
+                          stroke="currentColor"
+                          stroke-width="2"
+                          stroke-linecap="round"
+                          stroke-linejoin="round"
+                          class="lucide lucide-star"
+                        >
+                          <polygon
+                            points="12 2 15.09 8.26 22 9.27 17 14.14 18.18 21.02 12 17.77 5.82 21.02 7 14.14 2 9.27 8.91 8.26 12 2"
+                          />
+                        </svg>
                       </span>
                     </a>
-                {% endfor %}
+                  </li>
-                {% else %}
+                </template>
-                {% for obj in reviewed_objects|slice:":50" %}
-                <a class="list-group-item" href="{{ obj.url }}">{{ obj.name|safe }}{# <i>({{ obj.package.name }})</i> #}
-                    <span class="glyphicon glyphicon-star" aria-hidden="true"
-                          style="float:right" data-toggle="tooltip"
-                          data-placement="top" title="" data-original-title="Reviewed">
-                        </span>
-                </a>
-                {% endfor %}
-                {% endif %}
-            </div>
-        </div>
-        {% endif %}
-        {% endif %}
-        {% if unreviewed_objects %}
-        <div class="panel panel-default panel-heading list-group-item" style="background-color:silver"><h4
-                class="panel-title"><a id="UnreviewedLink" data-toggle="collapse" data-parent="#unReviewListAccordion"
-                                       href="#Unreviewed">Unreviewed</a></h4></div>
-        <div id="Unreviewed" class="panel-collapse collapse {% if reviewed_objects|length == 0 or object_type == 'package' %}in{% endif %}">
-            <div class="panel-body list-group-item" id="UnreviewedContent">
-                {% if object_type == 'package' %}
-                {% for obj in unreviewed_objects %}
-                <a class="list-group-item" href="{{ obj.url }}">{{ obj.name|safe }}</a>
-                {% endfor %}
-                {% else %}
-                {% for obj in unreviewed_objects|slice:":50" %}
-                <a class="list-group-item" href="{{ obj.url }}">{{ obj.name|safe }}</a>
-                {% endfor %}
-                {% endif %}
-            </div>
-        </div>
-        {% endif %}
-        {% if objects %}
-        <!-- Unreviewable objects such as User / Group / Setting -->
-        <ul class='list-group'>
-            {% for obj in objects %}
-            {% if object_type == 'user' %}
-            <a class="list-group-item" href="{{ obj.url }}">{{ obj.username|safe }}</a>
-            {% else %}
-            <a class="list-group-item" href="{{ obj.url }}">{{ obj.name|safe }}</a>
-            {% endif %}
-            {% endfor %}
               </ul>
+              <!-- Pagination Controls -->
+              <div
+                x-show="totalPages > 1"
+                class="mt-4 flex items-center justify-between px-2"
+              >
+                <span class="text-base-content/70 text-sm">
+                  Showing <span x-text="showingStart"></span>-<span
+                    x-text="showingEnd"
+                  ></span>
+                  of <span x-text="totalItems"></span>
+                </span>
+                <div class="join">
+                  <button
+                    class="join-item btn btn-sm"
+                    :disabled="currentPage === 1"
+                    @click="prevPage()"
+                  >
+                    «
+                  </button>
+                  <template x-for="item in pageNumbers" :key="item.key">
+                    <button
+                      class="join-item btn btn-sm"
+                      :class="{ 'btn-active': item.page === currentPage }"
+                      :disabled="item.isEllipsis"
+                      @click="!item.isEllipsis && goToPage(item.page)"
+                      x-text="item.page"
+                    ></button>
+                  </template>
+                  <button
+                    class="join-item btn btn-sm"
+                    :disabled="currentPage === totalPages"
+                    @click="nextPage()"
+                  >
+                    »
+                  </button>
+                </div>
+              </div>
+            </div>
+          </div>
+        {% endif %}
+      {% endif %}
+
+      {% if unreviewed_objects %}
+        <!-- Unreviewed -->
+        <div
+          class="collapse-arrow bg-base-200 collapse order-1 w-full"
+          x-data="paginatedList(window.unreviewedObjects || [], { isReviewed: false, instanceId: 'unreviewed' })"
+        >
+          <input
+            type="checkbox"
+            {% if reviewed_objects|length == 0 %}checked{% endif %}
+          />
+          <div class="collapse-title text-xl font-medium">
+            Unreviewed
+            <span
+              class="badge badge-sm badge-neutral ml-2"
+              x-text="totalItems"
+            ></span>
+          </div>
+          <div class="collapse-content w-full">
+            <ul class="menu bg-base-100 rounded-box w-full">
+              <template x-for="obj in paginatedItems" :key="obj.url">
+                <li>
+                  <a
+                    :href="obj.url"
+                    class="hover:bg-base-200"
+                    x-text="obj.name"
+                  ></a>
+                </li>
+              </template>
+            </ul>
+            <!-- Pagination Controls -->
+            <div
+              x-show="totalPages > 1"
+              class="mt-4 flex items-center justify-between px-2"
+            >
+              <span class="text-base-content/70 text-sm">
+                Showing <span x-text="showingStart"></span>-<span
+                  x-text="showingEnd"
+                ></span>
+                of <span x-text="totalItems"></span>
+              </span>
+              <div class="join">
+                <button
+                  class="join-item btn btn-sm"
+                  :disabled="currentPage === 1"
+                  @click="prevPage()"
+                >
+                  «
+                </button>
+                <template x-for="item in pageNumbers" :key="item.key">
+                  <button
+                    class="join-item btn btn-sm"
+                    :class="{ 'btn-active': item.page === currentPage }"
+                    :disabled="item.isEllipsis"
+                    @click="!item.isEllipsis && goToPage(item.page)"
+                    x-text="item.page"
+                  ></button>
+                </template>
+                <button
+                  class="join-item btn btn-sm"
+                  :disabled="currentPage === totalPages"
+                  @click="nextPage()"
+                >
+                  »
+                </button>
+              </div>
+            </div>
+          </div>
+        </div>
       {% endif %}
     </div>
-    <style>
-        .spinner-widget {
-            position: fixed; /* stays in place on scroll */
-            bottom: 20px; /* distance from bottom */
-            right: 20px; /* distance from right */
-            z-index: 9999; /* above most elements */
-            width: 60px; /* adjust to gif size */
-            height: 60px;
-        }
-
-        .spinner-widget img {
-            width: 100%;
-            height: auto;
-        }
-    </style>
-
-    <div id="load-all-loading" class="spinner-widget" style="display: none">
-        <img id="loading-gif" src="{% static '/images/wait.gif' %}" alt="Loading...">
   </div>
 
-</div>
   <script>
-        $(function () {
+    document.addEventListener("DOMContentLoaded", function () {
-
+      // Show actions button if there are actions
-            $('#object-search').show();
+      const actionsButton = document.getElementById("actionsButton");
-
+      const actionsList = actionsButton?.querySelector("ul");
-            {% if object_type != 'package' and object_type != 'user' and object_type != 'group' %}
+      if (actionsList && actionsList.children.length > 0) {
-                {% if reviewed_objects|length > 50 or unreviewed_objects|length > 50 %}
+        actionsButton?.classList.remove("hidden");
-                    $('#load-all-loading').show()
-
-                    setTimeout(function () {
-                        $('#load-all-error').hide();
-
-                        $.getJSON('?all=true', function (resp) {
-                            $('#ReviewedContent').empty();
-                            $('#UnreviewedContent').empty();
-
-                            for (o in resp.objects) {
-                                obj = resp.objects[o];
-                                if (obj.reviewed) {
-                                    $('#ReviewedContent').append('<a class="list-group-item" href="' + obj.url + '">' + obj.name + ' <span class="glyphicon glyphicon-star" aria-hidden="true" style="float:right" data-toggle="tooltip" data-placement="top" title="" data-original-title="Reviewed"></span></a>');
-                                } else {
-                                    $('#UnreviewedContent').append('<a class="list-group-item" href="' + obj.url + '">' + obj.name + '</a>');
-                                }
       }
 
-                            $('#load-all-loading').hide();
+      // Show search input and connect to Alpine pagination
-                            $('#load-remaining').hide();
+      const objectSearch = document.getElementById("object-search");
-                        }).fail(function (resp) {
+      if (objectSearch) {
-                            $('#load-all-loading').hide();
+        objectSearch.classList.remove("hidden");
-                            $('#load-all-error').show();
+        objectSearch.addEventListener("input", function () {
+          const query = this.value;
+          // Dispatch search to all paginatedList components
+          document
+            .querySelectorAll('[x-data*="paginatedList"]')
+            .forEach((el) => {
+              if (el._x_dataStack && el._x_dataStack[0]) {
+                el._x_dataStack[0].search(query);
+              }
             });
+        });
+      }
 
-                    }, 2500);
+      // Delete form submit handler
-                {% endif %}
+      const deleteSubmit = document.getElementById("modal-form-delete-submit");
-            {% endif %}
+      const deleteForm = document.getElementById("modal-form-delete");
-        
+      if (deleteSubmit && deleteForm) {
-            $('#modal-form-delete-submit').on('click', function (e) {
+        deleteSubmit.addEventListener("click", function (e) {
           e.preventDefault();
-                $('#modal-form-delete').submit();
+          deleteForm.submit();
         });
-
+      }
-            $('#object-search').on('keyup', function () {
-                let query = $(this).val().toLowerCase();
-                $('a.list-group-item').each(function () {
-                    let text = $(this).text().toLowerCase();
-                    $(this).toggle(text.indexOf(query) !== -1);
-                });
-            });
-
     });
   </script>
 {% endblock content %}

templates/collections/packages_paginated.html

@@ -0,0 +1,95 @@
+{% extends "collections/paginated_base.html" %}
+
+{% block page_title %}Packages{% endblock %}
+
+{% block action_button %}
+  {% if meta.can_edit %}
+    <div class="flex items-center gap-2">
+      <button
+        type="button"
+        class="btn btn-primary btn-sm"
+        id="new-package-button"
+        onclick="document.getElementById('new_package_modal').showModal(); return false;"
+      >
+        <svg
+          xmlns="http://www.w3.org/2000/svg"
+          width="24"
+          height="24"
+          viewBox="0 0 24 24"
+          fill="none"
+          stroke="currentColor"
+          stroke-width="2"
+          stroke-linecap="round"
+          stroke-linejoin="round"
+          class="lucide lucide-folder-plus-icon lucide-folder-plus"
+        >
+          <path d="M12 10v6" />
+          <path d="M9 13h6" />
+          <path
+            d="M20 20a2 2 0 0 0 2-2V8a2 2 0 0 0-2-2h-7.9a2 2 0 0 1-1.69-.9L9.6 3.9A2 2 0 0 0 7.93 3H4a2 2 0 0 0-2 2v13a2 2 0 0 0 2 2Z"
+          />
+        </svg>
+      </button>
+      <div class="dropdown dropdown-end">
+        <div tabindex="0" role="button" class="btn btn-sm">
+          Import
+          <svg
+            xmlns="http://www.w3.org/2000/svg"
+            width="16"
+            height="16"
+            viewBox="0 0 24 24"
+            fill="none"
+            stroke="currentColor"
+            stroke-width="2"
+            stroke-linecap="round"
+            stroke-linejoin="round"
+            class="lucide lucide-chevron-down ml-1"
+          >
+            <path d="m6 9 6 6 6-6" />
+          </svg>
+        </div>
+        <ul
+          tabindex="-1"
+          class="dropdown-content menu bg-base-100 rounded-box z-50 w-56 p-2"
+        >
+          <li>
+            <a
+              role="button"
+              onclick="document.getElementById('import_package_modal').showModal(); return false;"
+            >
+              Import Package from JSON
+            </a>
+          </li>
+          <li>
+            <a
+              role="button"
+              onclick="document.getElementById('import_legacy_package_modal').showModal(); return false;"
+            >
+              Import Package from legacy JSON
+            </a>
+          </li>
+        </ul>
+      </div>
+    </div>
+  {% endif %}
+{% endblock action_button %}
+
+{% block action_modals %}
+  {% include "modals/collections/new_package_modal.html" %}
+  {% include "modals/collections/import_package_modal.html" %}
+  {% include "modals/collections/import_legacy_package_modal.html" %}
+{% endblock action_modals %}
+
+{% block description %}
+  <p>
+    A package contains pathways, rules, etc. and can reflect specific
+    experimental conditions.
+  </p>
+  <a
+    target="_blank"
+    href="https://wiki.envipath.org/index.php/packages"
+    class="link link-primary"
+  >
+    Learn more &gt;&gt;
+  </a>
+{% endblock description %}

templates/collections/paginated_base.html

@@ -0,0 +1,128 @@
+{% extends "framework_modern.html" %}
+{% load static %}
+
+{# List title for empty text - defaults to "items", should be overridden by child templates #}
+{% block list_title %}items{% endblock %}
+
+{% block content %}
+  {% block action_modals %}
+  {% endblock action_modals %}
+
+  <div class="px-8 py-4">
+    <!-- Header Section -->
+    <div class="card bg-base-100">
+      <div class="card-body px-0 py-4">
+        <div class="flex items-center justify-between">
+          <h2 class="card-title text-2xl">
+            {% block page_title %}{{ page_title|default:"Items" }}{% endblock %}
+          </h2>
+          {% block action_button %}
+            {# Can be overridden by including action buttons for entity type #}
+          {% endblock %}
+        </div>
+        <div class="mt-2">
+          {% block description %}
+          {% endblock %}
+        </div>
+      </div>
+    </div>
+
+    {% if list_mode == "combined" %}
+      {# ===== COMBINED MODE: Single list without tabs ===== #}
+      <div
+        class="mt-6 w-full"
+        x-data="remotePaginatedList({
+            endpoint: '{{ api_endpoint }}',
+            instanceId: '{{ entity_type }}_combined',
+            perPage: {{ per_page|default:50 }}
+          })"
+      >
+        {% include "collections/_paginated_list_partial.html" with empty_text=list_title|default:"items" show_review_badge=True %}
+      </div>
+    {% else %}
+      {# ===== TABBED MODE: Reviewed/Unreviewed tabs (default) ===== #}
+      <div
+        class="mt-6 w-full"
+        x-data="{
+          activeTab: 'reviewed',
+          reviewedCount: null,
+          unreviewedCount: null,
+          get bothLoaded() { return this.reviewedCount !== null && this.unreviewedCount !== null },
+          get isEmpty() { return this.bothLoaded && this.reviewedCount === 0 && this.unreviewedCount === 0 },
+          updateTabSelection() {
+            if (this.bothLoaded && this.reviewedCount === 0 && this.unreviewedCount > 0) {
+              this.activeTab = 'unreviewed';
+            }
+          }
+        }"
+      >
+        {# No items found message - only show after both tabs have loaded #}
+        <div x-show="isEmpty" class="text-base-content/70 py-8 text-center">
+          <p>No items found.</p>
+        </div>
+
+        {# Tabs Navigation #}
+        <div role="tablist" class="tabs tabs-border" x-show="!isEmpty">
+          <button
+            role="tab"
+            class="tab"
+            :class="{ 'tab-active': activeTab === 'reviewed' }"
+            @click="activeTab = 'reviewed'"
+            x-show="reviewedCount === null || reviewedCount > 0"
+          >
+            Reviewed
+            <span
+              class="badge badge-xs badge-dash badge-info mb-2 ml-2"
+              :class="{ 'animate-pulse': reviewedCount === null }"
+              x-text="reviewedCount ?? '…'"
+            ></span>
+          </button>
+          <button
+            role="tab"
+            class="tab"
+            :class="{ 'tab-active': activeTab === 'unreviewed' }"
+            @click="activeTab = 'unreviewed'"
+            x-show="unreviewedCount === null || unreviewedCount > 0"
+          >
+            Unreviewed
+            <span
+              class="badge badge-xs badge-dash badge-info mb-2 ml-2"
+              :class="{ 'animate-pulse': unreviewedCount === null }"
+              x-text="unreviewedCount ?? '…'"
+            ></span>
+          </button>
+        </div>
+
+        {# Reviewed Tab Content #}
+        <div
+          class="mt-6"
+          x-show="activeTab === 'reviewed' && !isEmpty"
+          x-data="remotePaginatedList({
+              endpoint: '{{ api_endpoint }}?review_status=true',
+              instanceId: '{{ entity_type }}_reviewed',
+              isReviewed: true,
+              perPage: {{ per_page|default:50 }}
+            })"
+          @items-loaded="reviewedCount = totalItems; updateTabSelection()"
+        >
+          {% include "collections/_paginated_list_partial.html" with empty_text="reviewed "|add:list_title|default:"items" show_review_badge=True always_show_badge=True %}
+        </div>
+
+        {# Unreviewed Tab Content #}
+        <div
+          class="mt-6"
+          x-show="activeTab === 'unreviewed' && !isEmpty"
+          x-data="remotePaginatedList({
+              endpoint: '{{ api_endpoint }}?review_status=false',
+              instanceId: '{{ entity_type }}_unreviewed',
+              isReviewed: false,
+              perPage: {{ per_page|default:50 }}
+            })"
+          @items-loaded="unreviewedCount = totalItems; updateTabSelection()"
+        >
+          {% include "collections/_paginated_list_partial.html" with empty_text="unreviewed "|add:list_title|default:"items" %}
+        </div>
+      </div>
+    {% endif %}
+  </div>
+{% endblock content %}

templates/collections/pathways_paginated.html

@@ -0,0 +1,29 @@
+{% extends "collections/paginated_base.html" %}
+
+{% block page_title %}Pathways{% endblock %}
+
+{% block action_button %}
+  {% if meta.can_edit %}
+    <div class="flex items-center gap-2">
+      <a
+        class="btn btn-primary btn-sm"
+        href="{% if meta.current_package %}{{ meta.current_package.url }}/predict{% else %}/predict{% endif %}"
+      >
+        New Pathway
+      </a>
+    </div>
+  {% endif %}
+{% endblock action_button %}
+
+{% block description %}
+  <p>
+    A pathway displays the (predicted) biodegradation of a compound as graph.
+  </p>
+  <a
+    target="_blank"
+    href="https://wiki.envipath.org/index.php/pathways"
+    class="link link-primary"
+  >
+    Learn more &gt;&gt;
+  </a>
+{% endblock description %}

templates/collections/reactions_paginated.html

@@ -0,0 +1,33 @@
+{% extends "collections/paginated_base.html" %}
+
+{% block page_title %}Reactions{% endblock %}
+
+{% block action_button %}
+  {% if meta.can_edit %}
+    <button
+      type="button"
+      class="btn btn-primary btn-sm"
+      onclick="document.getElementById('new_reaction_modal').showModal(); return false;"
+    >
+      New Reaction
+    </button>
+  {% endif %}
+{% endblock action_button %}
+
+{% block action_modals %}
+  {% include "modals/collections/new_reaction_modal.html" %}
+{% endblock action_modals %}
+
+{% block description %}
+  <p>
+    A reaction is a specific biotransformation from educt compounds to product
+    compounds.
+  </p>
+  <a
+    target="_blank"
+    href="https://wiki.envipath.org/index.php/reactions"
+    class="link link-primary"
+  >
+    Learn more &gt;&gt;
+  </a>
+{% endblock description %}

templates/collections/rules_paginated.html

@@ -0,0 +1,33 @@
+{% extends "collections/paginated_base.html" %}
+
+{% block page_title %}Rules{% endblock %}
+
+{% block action_button %}
+  {% if meta.can_edit %}
+    <button
+      type="button"
+      class="btn btn-primary btn-sm"
+      onclick="document.getElementById('new_rule_modal').showModal(); return false;"
+    >
+      New Rule
+    </button>
+  {% endif %}
+{% endblock action_button %}
+
+{% block action_modals %}
+  {% include "modals/collections/new_rule_modal.html" %}
+{% endblock action_modals %}
+
+{% block description %}
+  <p>
+    A rule describes a biotransformation reaction template that is defined as
+    SMIRKS.
+  </p>
+  <a
+    target="_blank"
+    href="https://wiki.envipath.org/index.php/Rules"
+    class="link link-primary"
+  >
+    Learn more &gt;&gt;
+  </a>
+{% endblock description %}

templates/collections/scenarios_paginated.html

@@ -0,0 +1,33 @@
+{% extends "collections/paginated_base.html" %}
+
+{% block page_title %}Scenarios{% endblock %}
+
+{% block action_button %}
+  {% if meta.can_edit %}
+    <button
+      type="button"
+      class="btn btn-primary btn-sm"
+      onclick="document.getElementById('new_scenario_modal').showModal(); return false;"
+    >
+      New Scenario
+    </button>
+  {% endif %}
+{% endblock action_button %}
+
+{% block action_modals %}
+  {% include "modals/collections/new_scenario_modal.html" %}
+{% endblock action_modals %}
+
+{% block description %}
+  <p>
+    A scenario contains meta-information that can be attached to other data
+    (compounds, rules, ..).
+  </p>
+  <a
+    target="_blank"
+    href="https://wiki.envipath.org/index.php/scenarios"
+    class="link link-primary"
+  >
+    Learn more &gt;&gt;
+  </a>
+{% endblock description %}

templates/collections/structures_paginated.html

@@ -0,0 +1,30 @@
+{% extends "collections/paginated_base.html" %}
+
+{% block page_title %}{{ page_title|default:"Structures" }}{% endblock %}
+
+{% block action_button %}
+  {% if meta.can_edit %}
+    <button
+      type="button"
+      class="btn btn-primary btn-sm"
+      onclick="document.getElementById('new_compound_structure_modal').showModal(); return false;"
+    >
+      New Structure
+    </button>
+  {% endif %}
+{% endblock action_button %}
+
+{% block action_modals %}
+  {# FIXME: New Compound Structure Modal #}
+{% endblock action_modals %}
+
+{% block description %}
+  <p>The structures stored in this compound.</p>
+  <a
+    target="_blank"
+    href="https://wiki.envipath.org/index.php/compounds"
+    class="link link-primary"
+  >
+    Learn more &gt;&gt;
+  </a>
+{% endblock description %}