forked from enviPath/enviPy
264 lines
10 KiB
HTML
264 lines
10 KiB
HTML
{% extends "framework.html" %}
|
|
{% load static %}
|
|
|
|
{% block content %}
|
|
|
|
{% block action_modals %}
|
|
{% endblock action_modals %}
|
|
|
|
<!-- Include required libs -->
|
|
<script src="https://d3js.org/d3.v5.min.js"></script>
|
|
<script src="https://cdn.jsdelivr.net/npm/c3@0.7.20/c3.min.js"></script>
|
|
<link href="https://cdn.jsdelivr.net/npm/c3@0.7.20/c3.min.css" rel="stylesheet">
|
|
|
|
<div class="panel-group" id="model-detail">
|
|
<div class="panel panel-default">
|
|
<div class="panel-heading" id="headingPanel" style="font-size:2rem;height: 46px">
|
|
{{ model.name }}
|
|
<div id="actionsButton"
|
|
style="float: right;font-weight: normal;font-size: medium;position: relative; top: 50%; transform: translateY(-50%);z-index:100;"
|
|
class="dropdown"><a href="#" class="dropdown-toggle" data-toggle="dropdown" role="button"
|
|
aria-haspopup="true" aria-expanded="false"><span
|
|
class="glyphicon glyphicon-wrench"></span> Actions <span class="caret"></span><span
|
|
style="padding-right:1em"></span></a>
|
|
<ul id="actionsList" class="dropdown-menu">
|
|
{% block actions %}
|
|
{% endblock %}
|
|
</ul>
|
|
</div>
|
|
</div>
|
|
<div class="panel-body">
|
|
<p> {{ model.description }} </p>
|
|
</div>
|
|
<!-- Predict Panel -->
|
|
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
|
|
<h4 class="panel-title">
|
|
<a id="predict-smiles-link" data-toggle="collapse" data-parent="#model-detail"
|
|
href="#predict-smiles">Predict</a>
|
|
</h4>
|
|
</div>
|
|
<div id="predict-smiles" class="panel-collapse collapse in">
|
|
<div class="panel-body list-group-item">
|
|
<div class="input-group">
|
|
<input id="smiles-to-predict" type="text" class="form-control" placeholder="CCN(CC)C(=O)C1=CC(=CC=C1)C">
|
|
<span class="input-group-btn">
|
|
<button class="btn btn-default" type="submit" id="predict-button">Predict!</button>
|
|
</span>
|
|
</div>
|
|
<div id="loading"></div>
|
|
<div id="predictResultTable"></div>
|
|
</div>
|
|
</div>
|
|
<!-- End Predict Panel -->
|
|
{% if model.model_status == 'FINISHED' %}
|
|
<!-- Single Gen Curve Panel -->
|
|
<div class="panel panel-default panel-heading list-group-item" style="background-color:silver">
|
|
<h4 class="panel-title">
|
|
<a id="sg-curve-link" data-toggle="collapse" data-parent="#model-detail"
|
|
href="#sg-curve">Predict</a>
|
|
</h4>
|
|
</div>
|
|
<div id="sg-curve" class="panel-collapse collapse in">
|
|
<div class="panel-body list-group-item">
|
|
<!-- Center container contents -->
|
|
<div class="container" style="display: flex;justify-content: center;">
|
|
<div id="sg-curve-plotdiv" class="chart">
|
|
<div id="sg-chart"></div>
|
|
</div>
|
|
</div>
|
|
|
|
</div>
|
|
</div>
|
|
<script>
|
|
$(function() {
|
|
if(!($('#sg-chart').length > 0)) {
|
|
return;
|
|
}
|
|
console.log($('#sg-chart').length)
|
|
//$('#sg-curve-plotdiv').empty();
|
|
|
|
var x = ['Recall'];
|
|
var y = ['Precision'];
|
|
var thres = ['threshold'];
|
|
|
|
// Compare function for the given array
|
|
function compare(a, b) {
|
|
if (a.threshold < b.threshold)
|
|
return -1;
|
|
else if (a.threshold > b.threshold)
|
|
return 1;
|
|
else
|
|
return 0;
|
|
}
|
|
|
|
function getIndexForValue(data, val, val_name) {
|
|
for(var idx in data) {
|
|
if(data[idx][val_name] == val) {
|
|
return idx;
|
|
}
|
|
}
|
|
return -1;
|
|
}
|
|
|
|
var data = {{ model.pr_curve|safe }}
|
|
var dataLength = Object.keys(data).length;
|
|
data.sort(compare);
|
|
|
|
for (var idx in data) {
|
|
var d = data[idx];
|
|
x.push(d.recall);
|
|
y.push(d.precision);
|
|
thres.push(d.threshold);
|
|
}
|
|
var chart = c3.generate({
|
|
bindto: '#sg-chart',
|
|
data: {
|
|
onclick: function (d, e) {
|
|
var idx = d.index;
|
|
var thresh = data[dataLength-idx-1].threshold;
|
|
|
|
//onclick(thresh)
|
|
|
|
},
|
|
x: 'Recall',
|
|
y: 'Precision',
|
|
columns: [
|
|
x,
|
|
y,
|
|
//thres
|
|
]
|
|
},
|
|
size: {
|
|
height: 400, // TODO: Make variable to current modal width
|
|
width: 480
|
|
},
|
|
axis: {
|
|
x: {
|
|
max: 1,
|
|
min: 0,
|
|
label: 'Recall',
|
|
padding: 0,
|
|
tick: {
|
|
fit: true,
|
|
values: [0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0]
|
|
}
|
|
},
|
|
y: {
|
|
max: 1,
|
|
min: 0,
|
|
label: 'Precision',
|
|
padding: 0,
|
|
tick: {
|
|
fit: true,
|
|
values: [0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1.0]
|
|
}
|
|
}
|
|
},
|
|
point: {
|
|
r: 4
|
|
},
|
|
tooltip: {
|
|
format: {
|
|
title: function (recall) {
|
|
idx = getIndexForValue(data, recall, "recall");
|
|
if(idx != -1) {
|
|
return "Threshold: " + data[idx].threshold;
|
|
}
|
|
return "";
|
|
},
|
|
value: function (precision, ratio, id) {
|
|
return undefined;
|
|
}
|
|
}
|
|
},
|
|
zoom: {
|
|
enabled: true
|
|
}
|
|
});
|
|
});
|
|
</script>
|
|
<!-- End Single Gen Curve Panel -->
|
|
{% endif %}
|
|
</div>
|
|
</div>
|
|
|
|
<script>
|
|
|
|
function handleResponse(data) {
|
|
res = "<table class='table table-striped'>"
|
|
res += "<thead>"
|
|
res += "<th scope='col'>#</th>"
|
|
|
|
columns = ['products', 'image', 'probability', 'btrule']
|
|
|
|
for(col in columns) {
|
|
res += "<th scope='col'>" + columns[col] + "</th>"
|
|
}
|
|
|
|
res += "</thead>"
|
|
res += "<tbody>"
|
|
var cnt = 1;
|
|
for(transformation in data) {
|
|
res += "<tr>"
|
|
res += "<th scope='row'>" + cnt + "</th>"
|
|
res += "<th scope='row'>" + data[transformation]['products'][0].join(', ') + "</th>"
|
|
res += "<th scope='row'>" + "<img width='400' src='{% url 'depict' %}?smiles=" + encodeURIComponent(data[transformation]['products'][0].join('.')) + "'></th>"
|
|
res += "<th scope='row'>" + data[transformation]['probability'].toFixed(3) + "</th>"
|
|
if (data[transformation]['btrule'] != null) {
|
|
res += "<th scope='row'>" + "<a href='" + data[transformation]['btrule']['url'] + "'>" + data[transformation]['btrule']['name'] + "</a>" + "</th>"
|
|
} else {
|
|
res += "<th scope='row'>N/A</th>"
|
|
}
|
|
res += "</tr>"
|
|
cnt += 1;
|
|
}
|
|
|
|
res += "</tbody>"
|
|
res += "</table>"
|
|
$("#predictResultTable").append(res);
|
|
}
|
|
|
|
function clear() {
|
|
$("#predictResultTable").removeClass("alert alert-danger");
|
|
$("#predictResultTable").empty();
|
|
}
|
|
|
|
if($('#predict-button').length > 0) {
|
|
$("#predict-button").on("click", function(e) {
|
|
e.preventDefault();
|
|
|
|
data = {
|
|
"smiles": $("#smiles-to-predict").val(),
|
|
"classify": "ILikeCats!"
|
|
}
|
|
|
|
clear();
|
|
|
|
makeLoadingGif("#loading", "{% static '/images/wait.gif' %}");
|
|
$.ajax({
|
|
type : 'get',
|
|
data : data,
|
|
url : '',
|
|
success: function(data, textStatus) {
|
|
try {
|
|
$("#loading").empty();
|
|
handleResponse(data);
|
|
} catch (error) {
|
|
console.log("Error");
|
|
$("#loading").empty();
|
|
$("#predictResultTable").addClass("alert alert-danger");
|
|
$("#predictResultTable").append("Error while processing request :/");
|
|
}
|
|
},
|
|
error : function(jqXHR, textStatus, errorThrown) {
|
|
$("#loading").empty();
|
|
$("#predictResultTable").addClass("alert alert-danger");
|
|
$("#predictResultTable").append("Error while processing request :/");
|
|
}
|
|
});
|
|
});
|
|
}
|
|
</script>
|
|
|
|
{% endblock content %}
|